Methylprednisolone Hemisuccinate
(FQISKWAFAHGMGT-SGJOWKDISA-M)
Structure
- SMILES
- [O-]C(=O)CCC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)C.[Na+]
- Molecular Formula:
- C26H33NaO8
- Molecular Weight:
- 496.525
- Log P:
- 0.8846
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 141.03
- CAS Number(s):
- 2375-03-3
Synonym(s)
1.
Methylprednisolone Hemisuccinate
2.
Methylprednisolone Succinate
3.
6 alpha-Methylprednisolone Sodium Hemisuccinate
4.
A-MethaPred
5.
Methylprednisolone Hemisuccinate Monosodium Salt
6.
Methylprednisolone Sodium Hemisuccinate
7.
Methylprednisolone Sodium Succinate
8.
Solu-Medrol
9.
Solumedrol
10.
Urbason-Soluble
11.
Hemisuccinate, Methylprednisolone
12.
Sodium Hemisuccinate, Methylprednisolone
13.
Sodium Succinate, Methylprednisolone
14.
Succinate, Methylprednisolone
15.
UrbasonSoluble
External Link(s)
| MeSH | D008776 |
| PubChem Compound | 23680530 |
| ChEBI | 6890 |
| CHEMBL | CHEMBL1201081 |
| KEGG | dr:D00751 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 87 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 2 | Urticaria | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Flushing | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Hypersensitivity | FAERS: 32 | US FAERS | |
| 5 | Nausea | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Injection site pain | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Dizziness | FAERS: 29 | US FAERS | |
| 8 | Pruritus | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 9 | Hypotension | FAERS: 27 | US FAERS | |
| 10 | Anaphylactic shock | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Delirium | FAERS: 24 | US FAERS | |
| 12 | Headache | FAERS: 23 | US FAERS | |
| 13 | Pain | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Product quality issue | FAERS: 23 | US FAERS | |
| 15 | Blood glucose increased | FAERS: 21 | US FAERS | |
| 16 | Chills | FAERS: 21 | US FAERS | |
| 17 | Diabetes Mellitus | FAERS: 20 | US FAERS | |
| 18 | Anxiety | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Erythema | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 20 | Vomiting | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Hepatitis | FAERS: 18 | OFFSIDES US FAERS | |
| 22 | Asthenia | FAERS: 16 | OFFSIDES US FAERS | |
| 23 | Malaise | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Bronchospasm | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Fatigue | FAERS: 15 | US FAERS | |
| 26 | Palpitations | FAERS: 15 | US FAERS | |
| 27 | Product use in unapproved indication | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Posterior reversible encephalopathy syndrome | FAERS: 14 | US FAERS | |
| 29 | Sepsis | FAERS: 14 | US FAERS | |
| 30 | Agitation | FAERS: 13 | US FAERS | |
| 31 | Bradycardia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 32 | Drug effect incomplete | FAERS: 11 | US FAERS | |
| 33 | Abdominal Pain | FAERS: 10 | OFFSIDES US FAERS | |
| 34 | Arthralgia | FAERS: 10 | US FAERS | |
| 35 | Chest Pain | FAERS: 10 | US FAERS | |
| 36 | Chest discomfort | FAERS: 10 | US FAERS | |
| 37 | Cyanosis | FAERS: 9 | OFFSIDES US FAERS | |
| 38 | Pallor | FAERS: 9 | OFFSIDES US FAERS | |
| 39 | Restlessness | FAERS: 9 | US FAERS | |
| 40 | Swelling | FAERS: 9 | US FAERS | |
| 41 | Syncope | FAERS: 9 | US FAERS | |
| 42 | Tachycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Angioedema | FAERS: 8 | OFFSIDES US FAERS | |
| 44 | Atrial Fibrillation | FAERS: 8 | US FAERS | |
| 45 | Blood glucose abnormal | FAERS: 8 | US FAERS | |
| 46 | Burning sensation | FAERS: 8 | OFFSIDES US FAERS | |
| 47 | Multiple Sclerosis | FAERS: 8 | OFFSIDES US FAERS | |
| 48 | Myalgia | FAERS: 7 | US FAERS | |
| 49 | Shock | FAERS: 7 | US FAERS | |
| 50 | Abdominal discomfort | FAERS: 6 | US FAERS | |
| 51 | Back Pain | FAERS: 6 | US FAERS | |
| 52 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 53 | Infection | FAERS: 6 | US FAERS | |
| 54 | Meningitis | FAERS: 6 | US FAERS | |
| 55 | Pneumatosis intestinalis | FAERS: 6 | US FAERS | |
| 56 | Pneumonia | FAERS: 6 | US FAERS | |
| 57 | Wheezing | FAERS: 6 | US FAERS | |
| 58 | Dysgeusia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 59 | Epilepsy | FAERS: 5 | US FAERS | |
| 60 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 61 | Hypertensive crisis | FAERS: 5 | US FAERS | |
| 62 | Hypoxia | FAERS: 5 | OFFSIDES US FAERS | |
| 63 | Injection Site Reaction | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Laceration | FAERS: 5 | US FAERS | |
| 65 | Medication Error | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Mucormycosis | FAERS: 5 | US FAERS | |
| 67 | Multiple sclerosis relapse | FAERS: 5 | OFFSIDES US FAERS | |
| 68 | Pneumothorax | FAERS: 5 | OFFSIDES US FAERS | |
| 69 | Reaction to drug excipients | FAERS: 5 | US FAERS | |
| 70 | Respiratory Failure | FAERS: 5 | OFFSIDES US FAERS | |
| 71 | Respiratory distress | FAERS: 5 | US FAERS | |
| 72 | Autoimmune hepatitis | FAERS: 4 | OFFSIDES US FAERS | |
| 73 | Cataract | FAERS: 4 | US FAERS | |
| 74 | Discomfort | FAERS: 4 | US FAERS | |
| 75 | Disease Progression | FAERS: 4 | US FAERS | |
| 76 | Dysphonia | FAERS: 4 | OFFSIDES US FAERS | |
| 77 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 78 | Paraparesis | FAERS: 4 | US FAERS | |
| 79 | Product container issue | FAERS: 4 | US FAERS | |
| 80 | Product use issue | FAERS: 4 | US FAERS | |
| 81 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 82 | Vertigo | FAERS: 4 | US FAERS | |
| 83 | Visual Impairment | FAERS: 4 | US FAERS | |
| 84 | jaundice | FAERS: 4 | US FAERS | |
| 85 | Acne | FAERS: 3 | US FAERS | |
| 86 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 87 | Alopecia | FAERS: 3 | OFFSIDES US FAERS | |
| 88 | Anger | FAERS: 3 | US FAERS | |
| 89 | Arteriovenous fistula | FAERS: 3 | US FAERS | |
| 90 | Asthma | FAERS: 3 | OFFSIDES US FAERS | |
| 91 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 92 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 93 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 94 | Disease recurrence | FAERS: 3 | US FAERS | |
| 95 | Disorientation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Dural Arteriovenous Fistula | FAERS: 3 | US FAERS | |
| 97 | Exophthalmos | FAERS: 3 | US FAERS | |
| 98 | Eye pain | FAERS: 3 | US FAERS | |
| 99 | Hyperpyrexia | FAERS: 3 | US FAERS | |
| 100 | Hyperventilation | FAERS: 3 | OFFSIDES US FAERS | |
| 101 | Immunosuppression | FAERS: 3 | US FAERS | |
| 102 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 103 | Incorrect drug administration rate | FAERS: 3 | US FAERS | |
| 104 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 105 | Leukocytosis | FAERS: 3 | US FAERS | |
| 106 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 107 | Mood swings | FAERS: 3 | US FAERS | |
| 108 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 109 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 110 | Occupational exposure to product | FAERS: 3 | US FAERS | |
| 111 | Paraplegia | FAERS: 3 | US FAERS | |
| 112 | Peripheral swelling | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Peritonitis | FAERS: 3 | OFFSIDES US FAERS | |
| 114 | Petechiae | FAERS: 3 | US FAERS | |
| 115 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 116 | Presyncope | FAERS: 3 | US FAERS | |
| 117 | Product contamination | FAERS: 3 | US FAERS | |
| 118 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 119 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 120 | Tinnitus | FAERS: 3 | US FAERS | |
| 121 | Tremor | FAERS: 3 | US FAERS | |
| 122 | Weight decreased | FAERS: 3 | US FAERS | |
| 123 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 124 | nervous system disorder | FAERS: 3 | US FAERS | |
| 125 | Abasia | FAERS: 2 | US FAERS | |
| 126 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 127 | Acute respiratory failure | FAERS: 2 | OFFSIDES US FAERS | |
| 128 | Adverse event | FAERS: 2 | US FAERS | |
| 129 | Alanine Aminotransferase Increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 130 | Aspartate Aminotransferase Increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Blindness | FAERS: 2 | US FAERS | |
| 132 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 133 | Blood potassium decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 134 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 135 | Cell Death | FAERS: 2 | OFFSIDES US FAERS | |
| 136 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 137 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 138 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 139 | Cold sweat | FAERS: 2 | OFFSIDES US FAERS | |
| 140 | Colitis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 141 | Constipation | FAERS: 2 | US FAERS | |
| 142 | Crying | FAERS: 2 | US FAERS | |
| 143 | Depressed mood | FAERS: 2 | OFFSIDES US FAERS | |
| 144 | Diplegia | FAERS: 2 | US FAERS | |
| 145 | Disseminated Intravascular Coagulation | FAERS: 2 | OFFSIDES US FAERS | |
| 146 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 147 | Dyspepsia | FAERS: 2 | US FAERS | |
| 148 | Emotional disorder | FAERS: 2 | US FAERS | |
| 149 | Empyema | FAERS: 2 | US FAERS | |
| 150 | Epistaxis | FAERS: 2 | US FAERS | |
| 151 | Erythema Infectiosum | FAERS: 2 | US FAERS | |
| 152 | Euphoric mood | FAERS: 2 | US FAERS | |
| 153 | Extravasation | FAERS: 2 | US FAERS | |
| 154 | General physical health deterioration | FAERS: 2 | OFFSIDES US FAERS | |
| 155 | Glaucoma | FAERS: 2 | US FAERS | |
| 156 | Hemiparesis | FAERS: 2 | US FAERS | |
| 157 | Hepatitis B | FAERS: 2 | US FAERS | |
| 158 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 159 | Histiocytosis haematophagic | FAERS: 2 | OFFSIDES US FAERS | |
| 160 | Inflammation | FAERS: 2 | US FAERS | |
| 161 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 162 | Joint swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Limb injury | FAERS: 2 | US FAERS | |
| 164 | Lip swelling | FAERS: 2 | US FAERS | |
| 165 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 166 | Mental status changes | FAERS: 2 | US FAERS | |
| 167 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 168 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 169 | Nerve injury | FAERS: 2 | US FAERS | |
| 170 | Nervousness | FAERS: 2 | US FAERS | |
| 171 | Neuralgia | FAERS: 2 | OFFSIDES US FAERS | |
| 172 | Occult blood positive | FAERS: 2 | US FAERS | |
| 173 | Oral infection | FAERS: 2 | US FAERS | |
| 174 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 175 | Osteoporosis | FAERS: 2 | US FAERS | |
| 176 | PCO2 increased | FAERS: 2 | US FAERS | |
| 177 | Palmar erythema | FAERS: 2 | US FAERS | |
| 178 | Pleural infection bacterial | FAERS: 2 | US FAERS | |
| 179 | Product label issue | FAERS: 2 | US FAERS | |
| 180 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 181 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 182 | Rhinitis | FAERS: 2 | US FAERS | |
| 183 | Shock symptom | FAERS: 2 | US FAERS | |
| 184 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 185 | Skin test positive | FAERS: 2 | US FAERS | |
| 186 | Stenotrophomonas infection | FAERS: 2 | US FAERS | |
| 187 | Stupor | FAERS: 2 | US FAERS | |
| 188 | Suicide attempt | FAERS: 2 | US FAERS | |
| 189 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 190 | Tetany | FAERS: 2 | US FAERS | |
| 191 | Therapeutic product effect incomplete | FAERS: 2 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 192 | Throat irritation | FAERS: 2 | US FAERS | |
| 193 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 194 | Thyrotoxic periodic paralysis | FAERS: 2 | US FAERS | |
| 195 | Toothache | FAERS: 2 | US FAERS | |
| 196 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 197 | Transaminases increased | FAERS: 2 | OFFSIDES US FAERS | |
| 198 | Tuberculosis | FAERS: 2 | US FAERS | |
| 199 | Vasculitis | FAERS: 2 | US FAERS | |
| 200 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 201 | treatment failure | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 202 | Acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 203 | Acinetobacter test positive | FAERS: 1 | US FAERS | |
| 204 | Activated partial thromboplastin time shortened | FAERS: 1 | US FAERS | |
| 205 | Ageusia | FAERS: 1 | US FAERS | |
| 206 | Albuminuria | FAERS: 1 | US FAERS | |
| 207 | Aldolase increased | FAERS: 1 | US FAERS | |
| 208 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 209 | Altered state of consciousness | FAERS: 1 | OFFSIDES US FAERS | |
| 210 | Amnesia | FAERS: 1 | US FAERS | |
| 211 | Anal abscess | FAERS: 1 | US FAERS | |
| 212 | Anaphylactoid Reaction | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 213 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 214 | Aphasia | FAERS: 1 | US FAERS | |
| 215 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 216 | Arterial Injury | FAERS: 1 | US FAERS | |
| 217 | Arthritis | FAERS: 1 | OFFSIDES US FAERS | |
| 218 | Arthropod bite | FAERS: 1 | US FAERS | |
| 219 | Autoimmune Lymphoproliferative Syndrome | FAERS: 1 | US FAERS | |
| 220 | Bacillus infection | FAERS: 1 | US FAERS | |
| 221 | Bicytopenia | FAERS: 1 | US FAERS | |
| 222 | Blood 1,25-dihydroxycholecalciferol increased | FAERS: 1 | US FAERS | |
| 223 | Blood Corticotrophin Decreased | FAERS: 1 | US FAERS | |
| 224 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 225 | Blood creatinine increased | FAERS: 1 | OFFSIDES US FAERS | |
| 226 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 227 | Blood pressure fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 228 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 229 | Brain Abscess | FAERS: 1 | US FAERS | |
| 230 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 231 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 232 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 233 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 234 | Cellulitis | FAERS: 1 | US FAERS | |
| 235 | Cerebral ataxia | FAERS: 1 | US FAERS | |
| 236 | Cholestasis | FAERS: 1 | US FAERS | |
| 237 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 238 | Clumsiness | FAERS: 1 | US FAERS | |
| 239 | Colectomy | FAERS: 1 | US FAERS | |
| 240 | Cytomegalovirus chorioretinitis | FAERS: 1 | US FAERS | |
| 241 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 242 | Dehydration | FAERS: 1 | US FAERS | |
| 243 | Dementia | FAERS: 1 | US FAERS | |
| 244 | Demyelination | FAERS: 1 | US FAERS | |
| 245 | Device breakage | FAERS: 1 | US FAERS | |
| 246 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 247 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 248 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 249 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 250 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 251 | Drug administration error | FAERS: 1 | US FAERS | |
| 252 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 253 | Drug exposure during pregnancy | FAERS: 1 | OFFSIDES US FAERS | |
| 254 | Drug resistance | FAERS: 1 | US FAERS | |
| 255 | Duodenal Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 256 | Dural abscess | FAERS: 1 | US FAERS | |
| 257 | Dysuria | FAERS: 1 | US FAERS | |
| 258 | Ear discomfort | FAERS: 1 | US FAERS | |
| 259 | Elevated mood | FAERS: 1 | US FAERS | |
| 260 | Encephalitis | FAERS: 1 | US FAERS | |
| 261 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 262 | Eosinophilia | FAERS: 1 | US FAERS | |
| 263 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 264 | Epinephrine increased | FAERS: 1 | US FAERS | |
| 265 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 266 | Eructation | FAERS: 1 | US FAERS | |
| 267 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 268 | Excessive sexual fantasies | FAERS: 1 | US FAERS | |
| 269 | Expired product administered | FAERS: 1 | US FAERS | |
| 270 | Exserohilum infection | FAERS: 1 | US FAERS | |
| 271 | Facial paralysis | FAERS: 1 | US FAERS | |
| 272 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 273 | Flank Pain | FAERS: 1 | US FAERS | |
| 274 | Flatulence | FAERS: 1 | US FAERS | |
| 275 | Fracture | FAERS: 1 | US FAERS | |
| 276 | Fulminant type 1 diabetes mellitus | FAERS: 1 | US FAERS | |
| 277 | Gamma-Glutamyltransferase Increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 278 | Gastrointestinal infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 280 | Hepatitis B DNA increased | FAERS: 1 | US FAERS | |
| 281 | Herpes simplex hepatitis | FAERS: 1 | US FAERS | |
| 282 | Hyperaldosteronism | FAERS: 1 | US FAERS | |
| 283 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 284 | Hypocomplementaemia | FAERS: 1 | US FAERS | |
| 285 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 286 | Hypoventilation | FAERS: 1 | US FAERS | |
| 287 | Ideas of reference | FAERS: 1 | US FAERS | |
| 288 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 289 | Ileal ulcer | FAERS: 1 | US FAERS | |
| 290 | Immediate post-injection reaction | FAERS: 1 | US FAERS | |
| 291 | Immune complex level increased | FAERS: 1 | US FAERS | |
| 292 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 293 | Incoherent | FAERS: 1 | US FAERS | |
| 294 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 295 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 296 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 297 | Infusion site pruritus | FAERS: 1 | US FAERS | |
| 298 | Infusion site rash | FAERS: 1 | US FAERS | |
| 299 | Initial insomnia | FAERS: 1 | US FAERS | |
| 300 | Injection site bruising | FAERS: 1 | US FAERS | |
| 301 | Injection site erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 302 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 303 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 304 | Injection site injury | FAERS: 1 | US FAERS | |
| 305 | Intensive care unit acquired weakness | FAERS: 1 | US FAERS | |
| 306 | Intestinal Perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 307 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 308 | Joint Tuberculosis | FAERS: 1 | US FAERS | |
| 309 | Joint stiffness | FAERS: 1 | US FAERS | |
| 310 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 311 | Limb discomfort | FAERS: 1 | US FAERS | |
| 312 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 313 | Loose associations | FAERS: 1 | US FAERS | |
| 314 | Lower respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 315 | Lung cyst | FAERS: 1 | US FAERS | |
| 316 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 317 | Lymphocyte count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 318 | Lymphoma | FAERS: 1 | US FAERS | |
| 319 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 320 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 321 | Memory impairment | FAERS: 1 | US FAERS | |
| 322 | Mental impairment | FAERS: 1 | US FAERS | |
| 323 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 324 | Milk Allergy | FAERS: 1 | US FAERS | |
| 325 | Mouth swelling | FAERS: 1 | US FAERS | |
| 326 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 327 | Muscle tightness | FAERS: 1 | US FAERS | |
| 328 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 329 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 330 | Mydriasis | FAERS: 1 | US FAERS | |
| 331 | Myopathy | FAERS: 1 | US FAERS | |
| 332 | Necrosis | FAERS: 1 | US FAERS | |
| 333 | Neologism | FAERS: 1 | US FAERS | |
| 334 | Neuroborreliosis | FAERS: 1 | US FAERS | |
| 335 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 336 | Night sweats | FAERS: 1 | US FAERS | |
| 337 | Oliguria | FAERS: 1 | OFFSIDES US FAERS | |
| 338 | Open globe injury | FAERS: 1 | US FAERS | |
| 339 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 340 | Oral discharge | FAERS: 1 | US FAERS | |
| 341 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 342 | Oral mucosal erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 343 | Oral pruritus | FAERS: 1 | US FAERS | |
| 344 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 345 | Overdose | FAERS: 1 | US FAERS | |
| 346 | PO2 decreased | FAERS: 1 | US FAERS | |
| 347 | Pancreatitis | FAERS: 1 | US FAERS | |
| 348 | Pancytopenia | FAERS: 1 | US FAERS | |
| 349 | Panniculitis | FAERS: 1 | US FAERS | |
| 350 | Papule | FAERS: 1 | US FAERS | |
| 351 | Paranoia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 353 | Periodontitis | FAERS: 1 | US FAERS | |
| 354 | Pharyngotonsillitis | FAERS: 1 | US FAERS | |
| 355 | Phlebitis | FAERS: 1 | US FAERS | |
| 356 | Physical assault | FAERS: 1 | US FAERS | |
| 357 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 358 | Post procedural complication | FAERS: 1 | US FAERS | |
| 359 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 360 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 361 | Prehypertension | FAERS: 1 | US FAERS | |
| 362 | Pressure of speech | FAERS: 1 | US FAERS | |
| 363 | Product administration error | FAERS: 1 | US FAERS | |
| 364 | Product dispensing error | FAERS: 1 | US FAERS | |
| 365 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 366 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 367 | Product physical issue | FAERS: 1 | US FAERS | |
| 368 | Product preparation issue | FAERS: 1 | US FAERS | |
| 369 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 370 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 371 | Protein Deficiency | FAERS: 1 | US FAERS | |
| 372 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 373 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 374 | Rash erythematous | FAERS: 1 | US FAERS | |
| 375 | Red cell distribution width decreased | FAERS: 1 | US FAERS | |
| 376 | Regurgitation | FAERS: 1 | US FAERS | |
| 377 | Relapsing Fever | FAERS: 1 | US FAERS | |
| 378 | Renin decreased | FAERS: 1 | US FAERS | |
| 379 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 380 | Retching | FAERS: 1 | US FAERS | |
| 381 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 382 | Schizophrenia | FAERS: 1 | US FAERS | |
| 383 | Scleroderma renal crisis | FAERS: 1 | US FAERS | |
| 384 | Scleroderma | FAERS: 1 | US FAERS | |
| 385 | Septic Shock | FAERS: 1 | OFFSIDES US FAERS | |
| 386 | Septic embolus | FAERS: 1 | US FAERS | |
| 387 | Serum amyloid A protein increased | FAERS: 1 | US FAERS | |
| 388 | Skin laceration | FAERS: 1 | OFFSIDES US FAERS | |
| 389 | Skin lesion | FAERS: 1 | US FAERS | |
| 390 | Sluggishness | FAERS: 1 | US FAERS | |
| 391 | Sodium retention | FAERS: 1 | US FAERS | |
| 392 | Sopor | FAERS: 1 | US FAERS | |
| 393 | Splenomegaly | FAERS: 1 | US FAERS | |
| 394 | Strabismus | FAERS: 1 | US FAERS | |
| 395 | Stress | FAERS: 1 | US FAERS | |
| 396 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 397 | Supraventricular tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 398 | Tension Headache | FAERS: 1 | US FAERS | |
| 399 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 400 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 401 | Thirst | FAERS: 1 | US FAERS | |
| 402 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 403 | Thymoma | FAERS: 1 | US FAERS | |
| 404 | Tooth Loss | FAERS: 1 | US FAERS | |
| 405 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 406 | Transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 407 | Troponin increased | FAERS: 1 | US FAERS | |
| 408 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 409 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 410 | Urinary Retention | FAERS: 1 | US FAERS | |
| 411 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 412 | VIIth nerve paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 413 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 414 | Vascular purpura | FAERS: 1 | US FAERS | |
| 415 | Vascular rupture | FAERS: 1 | US FAERS | |
| 416 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 417 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 418 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 419 | Wrong dose | FAERS: 1 | US FAERS | |
| 420 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 421 | Abnormal vision | OFFSIDES | ||
| 422 | Acid reflux | OFFSIDES | ||
| 423 | Acute myocardial infarction | OFFSIDES | ||
| 424 | Adenocarcinoma | OFFSIDES | ||
| 425 | Adrenal cortex necrosis | OFFSIDES | ||
| 426 | Adrenal mass | OFFSIDES | ||
| 427 | Amaurosis Fugax | OFFSIDES | ||
| 428 | Amenorrhea | OFFSIDES | ||
| 429 | Ammonia increased | OFFSIDES | ||
| 430 | Angiodermatitis | OFFSIDES | ||
| 431 | Anhidrosis | OFFSIDES | ||
| 432 | Ascites | OFFSIDES | ||
| 433 | Atelectasis | OFFSIDES | ||
| 434 | Aura | OFFSIDES | ||
| 435 | Avascular necrosis | OFFSIDES | ||
| 436 | Basal cell carcinoma | OFFSIDES | ||
| 437 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 438 | Blast cells present | OFFSIDES | ||
| 439 | Blood albumin decreased | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 440 | Blood alkaline phosphatase increased | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 441 | Blood fibrinogen increased | OFFSIDES | ||
| 442 | Blood magnesium abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 443 | Blood sodium abnormal | OFFSIDES | ||
| 444 | Blood sodium | OFFSIDES | ||
| 445 | Blood urea increased | OFFSIDES | ||
| 446 | Body Temperature | OFFSIDES | ||
| 447 | Bone lesion | OFFSIDES | ||
| 448 | Bone marrow depression | OFFSIDES | ||
| 449 | Bone marrow necrosis | OFFSIDES | ||
| 450 | Brain Hypoxia | OFFSIDES | ||
| 451 | Breast Cyst | OFFSIDES | ||
| 452 | Breast tenderness | OFFSIDES | ||
| 453 | Bronchitis | OFFSIDES | ||
| 454 | Cardiac Flutter | OFFSIDES | ||
| 455 | Catheter related infection | OFFSIDES | ||
| 456 | Cervical spine flattening | OFFSIDES | ||
| 457 | Choking sensation | OFFSIDES | ||
| 458 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 459 | Chronic ulcerative colitis | OFFSIDES | ||
| 460 | Compression fracture | OFFSIDES | ||
| 461 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 462 | Cord blood transplant therapy | OFFSIDES | ||
| 463 | Creatinine renal clearance decreased | OFFSIDES | ||
| 464 | Cyst drainage | OFFSIDES | ||
| 465 | Cytolytic hepatitis | OFFSIDES | ||
| 466 | Cytomegalovirus test positive | OFFSIDES | ||
| 467 | Deafness | OFFSIDES | ||
| 468 | Debridement | OFFSIDES | ||
| 469 | Dental abscess | OFFSIDES | ||
| 470 | Denture wearer | OFFSIDES | ||
| 471 | Device Failure | OFFSIDES | ||
| 472 | Diabetes | OFFSIDES | ||
| 473 | Diverticulosis | OFFSIDES | ||
| 474 | Drug withdrawal headache | OFFSIDES | ||
| 475 | Endocarditis | OFFSIDES | ||
| 476 | Endodontic procedure | OFFSIDES | ||
| 477 | Engraftment syndrome | OFFSIDES | ||
| 478 | Enterobacter pneumonia | OFFSIDES | ||
| 479 | Enterocolitis | OFFSIDES | ||
| 480 | Epiglottitis | OFFSIDES | ||
| 481 | Erosive gastritis | OFFSIDES | ||
| 482 | Escherichia sepsis | OFFSIDES | ||
| 483 | Fluid replacement | OFFSIDES | ||
| 484 | Gamma-glutamyltransferase abnormal | OFFSIDES | ||
| 485 | Gangrene | OFFSIDES | ||
| 486 | General symptom | OFFSIDES | ||
| 487 | Granulocytosis | OFFSIDES | ||
| 488 | Hemiplegia | OFFSIDES | ||
| 489 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 490 | Hepatitis C | OFFSIDES | ||
| 491 | Incontinence | OFFSIDES | ||
| 492 | Intention tremor | OFFSIDES | ||
| 493 | Keratitis sicca | OFFSIDES | ||
| 494 | Kidney Failure | OFFSIDES | ||
| 495 | Large intestine perforation | OFFSIDES | ||
| 496 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 497 | Leukopenia neonatal | OFFSIDES | ||
| 498 | Livedo Reticularis | OFFSIDES | ||
| 499 | Lung consolidation | OFFSIDES | ||
| 500 | Lung infection pseudomonal | OFFSIDES | ||
| 501 | Lymphedema | OFFSIDES | ||
| 502 | Metastases to nasal sinuses | OFFSIDES | ||
| 503 | Metastatic Neoplasm | OFFSIDES | ||
| 504 | Metatarsalgia | OFFSIDES | ||
| 505 | Micrographic skin surgery | OFFSIDES | ||
| 506 | Mononucleosis syndrome | OFFSIDES | ||
| 507 | Mucocutaneous rash | OFFSIDES | ||
| 508 | Muscle Weakness | OFFSIDES | ||
| 509 | Muscle necrosis | OFFSIDES | ||
| 510 | Myelitis | OFFSIDES | ||
| 511 | Nephrotic Syndrome | OFFSIDES | ||
| 512 | Nerve Block | OFFSIDES | ||
| 513 | Neuroblastoma recurrent | OFFSIDES | ||
| 514 | Oral candidiasis | Canada Vigilance: 1 | Canada Vigilance | |
| 515 | Osteolysis | OFFSIDES | ||
| 516 | Osteosclerosis | OFFSIDES | ||
| 517 | Pancreatic calcification | OFFSIDES | ||
| 518 | Pericardial effusion | OFFSIDES | ||
| 519 | Peritoneal Infection | OFFSIDES | ||
| 520 | Pleurodesis | OFFSIDES | ||
| 521 | Pneumoperitoneum | OFFSIDES | ||
| 522 | Post procedural discharge | OFFSIDES | ||
| 523 | Postoperative wound complication | OFFSIDES | ||
| 524 | Priapism | Canada Vigilance: 1 | Canada Vigilance | |
| 525 | Prostatitis Escherichia coli | OFFSIDES | ||
| 526 | Protein total increased | OFFSIDES | ||
| 527 | Pulmonary Hypertension | OFFSIDES | ||
| 528 | Pulmonary congestion | OFFSIDES | ||
| 529 | Pulmonary radiation injury | OFFSIDES | ||
| 530 | Purulent discharge | OFFSIDES | ||
| 531 | Pyoderma Gangrenosum | OFFSIDES | ||
| 532 | Radiotherapy to bone | OFFSIDES | ||
| 533 | Renal cyst | OFFSIDES | ||
| 534 | Respiratory tract congestion | OFFSIDES | ||
| 535 | Rhinorrhea | OFFSIDES | ||
| 536 | Risus sardonicus | OFFSIDES | ||
| 537 | Sequestrectomy | OFFSIDES | ||
| 538 | Serum Sickness | OFFSIDES | ||
| 539 | Sinus bradycardia | Canada Vigilance: 1 | Canada Vigilance | |
| 540 | Skin tightness | Canada Vigilance: 1 | Canada Vigilance | |
| 541 | Small intestine carcinoma | OFFSIDES | ||
| 542 | Soft Tissue Infection | OFFSIDES | ||
| 543 | Spinal column stenosis | OFFSIDES | ||
| 544 | Spondylolisthesis | OFFSIDES | ||
| 545 | Staphylococcal abscess | OFFSIDES | ||
| 546 | Stem cell transplant | OFFSIDES | ||
| 547 | Thoracic cavity drainage | OFFSIDES | ||
| 548 | Tonsillitis | OFFSIDES | ||
| 549 | Unresponsive to stimuli | OFFSIDES | ||
| 550 | Venous Insufficiency | OFFSIDES | ||
| 551 | Venous occlusion | OFFSIDES | ||
| 552 | Wound Debridement | OFFSIDES | ||
| 553 | Wound infection bacterial | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.