eltrombopag
(SVOQIEJWJCQGDQ-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)c1cccc(c1)c1cccc(c1O)N=Nc1c(C)[nH]n(c1=O)c1ccc(c(c1)C)C
- Type(s)
- Approved
- ATC code(s)
- B02BX05
- Molecular Formula:
- C25H22N4O4
- Molecular Weight:
- 442.467
- Log P:
- 5.5770
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 120.04
- CAS Number(s):
- 376591-99-0; 496775-61-2; 1807882-48-9
Synonym(s)
1.
eltrombopag
2.
Promacta
3.
Revolade
4.
SB-497 115
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 448 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Fatigue | FAERS: 198 | SIDER US FAERS | |
| 3 | Headache | FAERS: 192 | SIDER US FAERS | |
| 4 | Nausea | FAERS: 145 | SIDER US FAERS | |
| 5 | Malaise | FAERS: 140 | US FAERS | |
| 6 | Drug dose omission | FAERS: 92 | US FAERS | |
| 7 | Alopecia | FAERS: 90 | SIDER US FAERS | |
| 8 | Pneumonia | FAERS: 89 | US FAERS | |
| 9 | Arthralgia | FAERS: 84 | SIDER US FAERS | |
| 10 | Dizziness | FAERS: 82 | SIDER US FAERS | |
| 11 | Thrombosis | FAERS: 82 | SIDER US FAERS | |
| 12 | Myalgia | FAERS: 78 | SIDER US FAERS | |
| 13 | Asthenia | FAERS: 74 | SIDER US FAERS | |
| 14 | Pruritus | FAERS: 73 | SIDER US FAERS | |
| 15 | Pain | FAERS: 72 | US FAERS | |
| 16 | No adverse event | FAERS: 68 | US FAERS | |
| 17 | Thrombocytopenia | FAERS: 65 | US FAERS | |
| 18 | Cerebrovascular accident | FAERS: 59 | US FAERS | |
| 19 | Disease Progression | FAERS: 59 | US FAERS | |
| 20 | MYELODYSPLASTIC SYNDROME | FAERS: 55 | US FAERS | |
| 21 | Product use in unapproved indication | FAERS: 51 | US FAERS | |
| 22 | Epistaxis | FAERS: 50 | US FAERS | |
| 23 | Myocardial Infarction | FAERS: 49 | US FAERS | |
| 24 | Vomiting | FAERS: 49 | SIDER US FAERS | |
| 25 | Nasopharyngitis | FAERS: 48 | SIDER US FAERS | |
| 26 | Maternal exposure during pregnancy | FAERS: 45 | US FAERS | |
| 27 | Pulmonary Embolism | FAERS: 45 | SIDER US FAERS | |
| 28 | Peripheral swelling | FAERS: 43 | US FAERS | |
| 29 | Back Pain | FAERS: 42 | SIDER US FAERS | |
| 30 | Deep Vein Thrombosis | FAERS: 41 | SIDER US FAERS | |
| 31 | Chest Pain | FAERS: 38 | US FAERS | |
| 32 | Therapy non-responder | FAERS: 38 | US FAERS | |
| 33 | Abdominal discomfort | FAERS: 35 | US FAERS | |
| 34 | Feeling abnormal | FAERS: 35 | US FAERS | |
| 35 | Weight decreased | FAERS: 35 | US FAERS | |
| 36 | Hypersensitivity | FAERS: 33 | US FAERS | |
| 37 | Urinary tract infection | FAERS: 32 | SIDER US FAERS | |
| 38 | Myelofibrosis | FAERS: 31 | US FAERS | |
| 39 | Platelet count abnormal | FAERS: 30 | US FAERS | |
| 40 | Sepsis | FAERS: 30 | US FAERS | |
| 41 | Bone pain | FAERS: 29 | US FAERS | |
| 42 | Dementia | FAERS: 29 | US FAERS | |
| 43 | Visual Impairment | FAERS: 28 | US FAERS | |
| 44 | Abdominal Pain | FAERS: 27 | SIDER US FAERS | |
| 45 | Bone marrow reticulin fibrosis | FAERS: 27 | US FAERS | |
| 46 | Constipation | FAERS: 27 | US FAERS | |
| 47 | Memory impairment | FAERS: 25 | US FAERS | |
| 48 | Adverse event | FAERS: 24 | US FAERS | |
| 49 | Product use issue | FAERS: 24 | US FAERS | |
| 50 | Amnesia | FAERS: 23 | US FAERS | |
| 51 | Infection | FAERS: 23 | SIDER US FAERS | |
| 52 | Respiratory Failure | FAERS: 22 | US FAERS | |
| 53 | Therapy cessation | FAERS: 22 | US FAERS | |
| 54 | Influenza | FAERS: 21 | SIDER US FAERS | |
| 55 | Urticaria | FAERS: 21 | US FAERS | |
| 56 | Portal Vein Thrombosis | FAERS: 20 | US FAERS | |
| 57 | Splenomegaly | FAERS: 20 | US FAERS | |
| 58 | Joint swelling | FAERS: 19 | US FAERS | |
| 59 | White blood cell count decreased | FAERS: 19 | US FAERS | |
| 60 | Dry skin | FAERS: 18 | US FAERS | |
| 61 | Hospice Care | FAERS: 18 | US FAERS | |
| 62 | Pancytopenia | FAERS: 18 | US FAERS | |
| 63 | Chills | FAERS: 17 | SIDER US FAERS | |
| 64 | Drug administration error | FAERS: 17 | US FAERS | |
| 65 | Immune thrombocytopenic purpura | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Acute myocardial infarction | FAERS: 16 | SIDER US FAERS | |
| 67 | Tremor | FAERS: 16 | US FAERS | |
| 68 | Blood creatinine increased | FAERS: 15 | US FAERS | |
| 69 | Diabetes Mellitus | FAERS: 15 | US FAERS | |
| 70 | Thrombocytosis | FAERS: 15 | US FAERS | |
| 71 | Toxicity to various agents | FAERS: 15 | US FAERS | |
| 72 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 73 | Full blood count decreased | FAERS: 14 | US FAERS | |
| 74 | Oropharyngeal pain | FAERS: 14 | SIDER US FAERS | |
| 75 | Atrial Fibrillation | FAERS: 13 | US FAERS | |
| 76 | Blindness | FAERS: 13 | US FAERS | |
| 77 | Somnolence | FAERS: 13 | US FAERS | |
| 78 | Burning sensation | FAERS: 12 | US FAERS | |
| 79 | Cardiac Arrest | FAERS: 12 | US FAERS | |
| 80 | Febrile Neutropenia | FAERS: 12 | SIDER US FAERS | |
| 81 | Incorrect dose administered | FAERS: 12 | US FAERS | |
| 82 | Neutropenia | FAERS: 12 | US FAERS | |
| 83 | Swelling | FAERS: 12 | US FAERS | |
| 84 | Blood count abnormal | FAERS: 11 | US FAERS | |
| 85 | Cataract | FAERS: 11 | SIDER US FAERS | |
| 86 | Drug dispensing error | FAERS: 11 | US FAERS | |
| 87 | Embolism | FAERS: 11 | SIDER US FAERS | |
| 88 | Erythema | FAERS: 11 | US FAERS | |
| 89 | Hypotension | FAERS: 11 | US FAERS | |
| 90 | Musculoskeletal stiffness | FAERS: 11 | US FAERS | |
| 91 | Nephrolithiasis | FAERS: 11 | US FAERS | |
| 92 | Petechiae | FAERS: 11 | US FAERS | |
| 93 | Splenectomy | FAERS: 11 | US FAERS | |
| 94 | Blood glucose increased | FAERS: 10 | US FAERS | |
| 95 | Deafness | FAERS: 10 | US FAERS | |
| 96 | Dyspepsia | FAERS: 10 | US FAERS | |
| 97 | Lymphoma | FAERS: 10 | US FAERS | |
| 98 | Retinal Artery Occlusion | FAERS: 10 | US FAERS | |
| 99 | Alanine Aminotransferase Increased | FAERS: 9 | SIDER US FAERS | |
| 100 | Anxiety | FAERS: 9 | US FAERS | |
| 101 | Aspartate Aminotransferase Increased | FAERS: 9 | SIDER US FAERS | |
| 102 | Cerebral Infarction | FAERS: 9 | SIDER US FAERS | |
| 103 | Dehydration | FAERS: 9 | US FAERS | |
| 104 | Malignant neoplasm progression | FAERS: 9 | US FAERS | |
| 105 | Nervousness | FAERS: 9 | US FAERS | |
| 106 | Night sweats | FAERS: 9 | US FAERS | |
| 107 | Pancreatitis | FAERS: 9 | US FAERS | |
| 108 | Acute kidney injury | FAERS: 8 | US FAERS | |
| 109 | Ascites | FAERS: 8 | US FAERS | |
| 110 | Back disorder | FAERS: 8 | US FAERS | |
| 111 | Chest discomfort | FAERS: 8 | US FAERS | |
| 112 | Dysphonia | FAERS: 8 | US FAERS | |
| 113 | Flatulence | FAERS: 8 | US FAERS | |
| 114 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 115 | Head discomfort | FAERS: 8 | US FAERS | |
| 116 | Hepatomegaly | FAERS: 8 | US FAERS | |
| 117 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 118 | jaundice | FAERS: 8 | US FAERS | |
| 119 | Agitation | FAERS: 7 | US FAERS | |
| 120 | Arthritis | FAERS: 7 | US FAERS | |
| 121 | Leukocytosis | FAERS: 7 | US FAERS | |
| 122 | Lymphadenopathy | FAERS: 7 | US FAERS | |
| 123 | Musculoskeletal Pain | FAERS: 7 | SIDER US FAERS | |
| 124 | Neck Pain | FAERS: 7 | US FAERS | |
| 125 | Overdose | FAERS: 7 | US FAERS | |
| 126 | Rehabilitation therapy | FAERS: 7 | US FAERS | |
| 127 | Stress | FAERS: 7 | US FAERS | |
| 128 | Therapy change | FAERS: 7 | US FAERS | |
| 129 | Transaminases increased | FAERS: 7 | SIDER US FAERS | |
| 130 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 131 | Cellulitis | FAERS: 6 | US FAERS | |
| 132 | Clostridium difficile infection | FAERS: 6 | US FAERS | |
| 133 | Concomitant disease aggravated | FAERS: 6 | US FAERS | |
| 134 | Diplopia | FAERS: 6 | US FAERS | |
| 135 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 136 | Fluid overload | FAERS: 6 | US FAERS | |
| 137 | Hepatotoxicity | FAERS: 6 | SIDER US FAERS | |
| 138 | Mental status changes | FAERS: 6 | US FAERS | |
| 139 | Neutrophil count decreased | FAERS: 6 | US FAERS | |
| 140 | Osteoporosis | FAERS: 6 | US FAERS | |
| 141 | Peritonitis | FAERS: 6 | US FAERS | |
| 142 | Ammonia increased | FAERS: 5 | US FAERS | |
| 143 | Cataract operation | FAERS: 5 | US FAERS | |
| 144 | Discomfort | FAERS: 5 | US FAERS | |
| 145 | Disease complication | FAERS: 5 | US FAERS | |
| 146 | Dysuria | FAERS: 5 | US FAERS | |
| 147 | Gastrointestinal infection | FAERS: 5 | US FAERS | |
| 148 | Glioblastoma | FAERS: 5 | US FAERS | |
| 149 | Gout | FAERS: 5 | US FAERS | |
| 150 | Hypokinesia | FAERS: 5 | US FAERS | |
| 151 | Impaired work ability | FAERS: 5 | US FAERS | |
| 152 | Joint injury | FAERS: 5 | US FAERS | |
| 153 | Lethargy | FAERS: 5 | US FAERS | |
| 154 | Limb injury | FAERS: 5 | US FAERS | |
| 155 | Mood swings | FAERS: 5 | US FAERS | |
| 156 | Myelodysplastic syndrome transformation | FAERS: 5 | US FAERS | |
| 157 | Purpura | FAERS: 5 | US FAERS | |
| 158 | Sinusitis | FAERS: 5 | US FAERS | |
| 159 | Skin lesion | FAERS: 5 | US FAERS | |
| 160 | Sneezing | FAERS: 5 | US FAERS | |
| 161 | Stomatitis | FAERS: 5 | US FAERS | |
| 162 | Syncope | FAERS: 5 | US FAERS | |
| 163 | Terminal state | FAERS: 5 | US FAERS | |
| 164 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 165 | Toothache | FAERS: 5 | US FAERS | |
| 166 | Vertigo | FAERS: 5 | US FAERS | |
| 167 | Vitreous floaters | FAERS: 5 | US FAERS | |
| 168 | treatment failure | FAERS: 5 | US FAERS | |
| 169 | Anger | FAERS: 4 | US FAERS | |
| 170 | Antiphospholipid Syndrome | FAERS: 4 | US FAERS | |
| 171 | Aortic Aneurysm | FAERS: 4 | US FAERS | |
| 172 | Apparent death | FAERS: 4 | US FAERS | |
| 173 | Autoimmune thrombocytopenia | FAERS: 4 | US FAERS | |
| 174 | Blood alkaline phosphatase increased | FAERS: 4 | SIDER US FAERS | |
| 175 | Bronchitis | FAERS: 4 | US FAERS | |
| 176 | Cerebral Thrombosis | FAERS: 4 | US FAERS | |
| 177 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 178 | Cystitis | FAERS: 4 | US FAERS | |
| 179 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 180 | Disorientation | FAERS: 4 | US FAERS | |
| 181 | Dysgeusia | FAERS: 4 | US FAERS | |
| 182 | Feeling Cold | FAERS: 4 | US FAERS | |
| 183 | Gastrointestinal hypomotility | FAERS: 4 | US FAERS | |
| 184 | Hepatitis | FAERS: 4 | US FAERS | |
| 185 | Hepatosplenomegaly | FAERS: 4 | US FAERS | |
| 186 | Hernia | FAERS: 4 | US FAERS | |
| 187 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 188 | Intestinal Perforation | FAERS: 4 | US FAERS | |
| 189 | Joint stiffness | FAERS: 4 | US FAERS | |
| 190 | Limb discomfort | FAERS: 4 | US FAERS | |
| 191 | Muscle strain | FAERS: 4 | US FAERS | |
| 192 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 193 | Product dose omission | FAERS: 4 | US FAERS | |
| 194 | Productive Cough | FAERS: 4 | US FAERS | |
| 195 | Pulmonary thrombosis | FAERS: 4 | US FAERS | |
| 196 | Venous Thrombosis | FAERS: 4 | US FAERS | |
| 197 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 198 | Abasia | FAERS: 3 | US FAERS | |
| 199 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 200 | Accidental overdose | FAERS: 3 | US FAERS | |
| 201 | Ageusia | FAERS: 3 | US FAERS | |
| 202 | Blast cell count increased | FAERS: 3 | US FAERS | |
| 203 | Blood bilirubin unconjugated increased | FAERS: 3 | US FAERS | |
| 204 | Blood blister | FAERS: 3 | US FAERS | |
| 205 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 206 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 207 | Blood smear test abnormal | FAERS: 3 | US FAERS | |
| 208 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 209 | Cardiac Death | FAERS: 3 | US FAERS | |
| 210 | Chromaturia | FAERS: 3 | US FAERS | |
| 211 | Colitis | FAERS: 3 | US FAERS | |
| 212 | Crying | FAERS: 3 | US FAERS | |
| 213 | Disease recurrence | FAERS: 3 | US FAERS | |
| 214 | Dysarthria | FAERS: 3 | US FAERS | |
| 215 | Extra dose administered | FAERS: 3 | US FAERS | |
| 216 | Eye pain | FAERS: 3 | US FAERS | |
| 217 | Fibrosis | FAERS: 3 | US FAERS | |
| 218 | Hepatitis C | FAERS: 3 | US FAERS | |
| 219 | Hypoxia | FAERS: 3 | US FAERS | |
| 220 | Ileus | FAERS: 3 | US FAERS | |
| 221 | Increased tendency to bruise | FAERS: 3 | US FAERS | |
| 222 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 223 | Iron Overload | FAERS: 3 | US FAERS | |
| 224 | Iron deficiency | FAERS: 3 | US FAERS | |
| 225 | Laceration | FAERS: 3 | US FAERS | |
| 226 | Laryngitis | FAERS: 3 | US FAERS | |
| 227 | Leukopenia | FAERS: 3 | US FAERS | |
| 228 | Medication Error | FAERS: 3 | US FAERS | |
| 229 | Metastatic Neoplasm | FAERS: 3 | US FAERS | |
| 230 | Monocyte count increased | FAERS: 3 | US FAERS | |
| 231 | Neuralgia | FAERS: 3 | US FAERS | |
| 232 | Palpitations | FAERS: 3 | US FAERS | |
| 233 | Performance status decreased | FAERS: 3 | US FAERS | |
| 234 | Peridiverticular abscess | FAERS: 3 | US FAERS | |
| 235 | Pharyngitis | FAERS: 3 | SIDER US FAERS | |
| 236 | Platelet aggregation | FAERS: 3 | US FAERS | |
| 237 | Pneumonitis | FAERS: 3 | US FAERS | |
| 238 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 239 | Post procedural infection | FAERS: 3 | US FAERS | |
| 240 | Product intolerance | FAERS: 3 | US FAERS | |
| 241 | Protein urine present | FAERS: 3 | US FAERS | |
| 242 | Psoriasis | FAERS: 3 | US FAERS | |
| 243 | Rash erythematous | FAERS: 3 | US FAERS | |
| 244 | Septic Shock | FAERS: 3 | US FAERS | |
| 245 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 246 | Skin irritation | FAERS: 3 | US FAERS | |
| 247 | Synovitis | FAERS: 3 | US FAERS | |
| 248 | Tachycardia | FAERS: 3 | US FAERS | |
| 249 | Tinnitus | FAERS: 3 | US FAERS | |
| 250 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 251 | furuncle | FAERS: 3 | US FAERS | |
| 252 | Abscess | FAERS: 2 | US FAERS | |
| 253 | Abulia | FAERS: 2 | US FAERS | |
| 254 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 255 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 256 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 257 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 258 | Apathy | FAERS: 2 | US FAERS | |
| 259 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 260 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 261 | Arthropathy | FAERS: 2 | US FAERS | |
| 262 | Asthma | FAERS: 2 | US FAERS | |
| 263 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 264 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 265 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 266 | Blood urine present | FAERS: 2 | US FAERS | |
| 267 | Chemotherapy | FAERS: 2 | US FAERS | |
| 268 | Choking | FAERS: 2 | US FAERS | |
| 269 | Clonal Evolution | FAERS: 2 | US FAERS | |
| 270 | Complication associated with device | FAERS: 2 | US FAERS | |
| 271 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 272 | Delirium | FAERS: 2 | US FAERS | |
| 273 | Depressed mood | FAERS: 2 | US FAERS | |
| 274 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 275 | Device related infection | FAERS: 2 | US FAERS | |
| 276 | Diffuse Large B-Cell Lymphoma | FAERS: 2 | US FAERS | |
| 277 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 278 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 279 | Ecchymosis | FAERS: 2 | SIDER US FAERS | |
| 280 | Emotional disorder | FAERS: 2 | US FAERS | |
| 281 | Exposure via partner | FAERS: 2 | US FAERS | |
| 282 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 283 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 284 | Gastritis | FAERS: 2 | US FAERS | |
| 285 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 286 | Hemiplegia | FAERS: 2 | US FAERS | |
| 287 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 288 | Hip surgery | FAERS: 2 | US FAERS | |
| 289 | Hunger | FAERS: 2 | US FAERS | |
| 290 | Hypersomnia | FAERS: 2 | US FAERS | |
| 291 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 292 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 293 | Inflammation | FAERS: 2 | US FAERS | |
| 294 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 295 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 296 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 297 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 298 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 299 | Macular degeneration | FAERS: 2 | US FAERS | |
| 300 | Mantle cell lymphoma | FAERS: 2 | US FAERS | |
| 301 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 302 | Medication residue present | FAERS: 2 | US FAERS | |
| 303 | Meningitis | FAERS: 2 | US FAERS | |
| 304 | Mental impairment | FAERS: 2 | US FAERS | |
| 305 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 306 | Metastatic Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 307 | Mucosal erosion | FAERS: 2 | US FAERS | |
| 308 | Multiple Myeloma | FAERS: 2 | US FAERS | |
| 309 | Musculoskeletal chest pain | FAERS: 2 | SIDER US FAERS | |
| 310 | Musculoskeletal discomfort | FAERS: 2 | SIDER US FAERS | |
| 311 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 312 | Nerve injury | FAERS: 2 | US FAERS | |
| 313 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 314 | Oral pain | FAERS: 2 | US FAERS | |
| 315 | Osteopenia | FAERS: 2 | US FAERS | |
| 316 | Pallor | FAERS: 2 | US FAERS | |
| 317 | Papule | FAERS: 2 | US FAERS | |
| 318 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 319 | Paraplegia | FAERS: 2 | US FAERS | |
| 320 | Pelvic mass | FAERS: 2 | US FAERS | |
| 321 | Platelet Transfusion | FAERS: 2 | US FAERS | |
| 322 | Polyuria | FAERS: 2 | US FAERS | |
| 323 | Post procedural complication | FAERS: 2 | US FAERS | |
| 324 | Procedural complication | FAERS: 2 | US FAERS | |
| 325 | Product dispensing error | FAERS: 2 | US FAERS | |
| 326 | Product use complaint | FAERS: 2 | US FAERS | |
| 327 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 328 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 329 | Red blood cell morphology abnormal | FAERS: 2 | US FAERS | |
| 330 | Regurgitation | FAERS: 2 | US FAERS | |
| 331 | Renal pain | FAERS: 2 | US FAERS | |
| 332 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 333 | Respiratory distress | FAERS: 2 | US FAERS | |
| 334 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 335 | Scab | FAERS: 2 | US FAERS | |
| 336 | Shock | FAERS: 2 | US FAERS | |
| 337 | Sluggishness | FAERS: 2 | US FAERS | |
| 338 | Tooth Loss | FAERS: 2 | US FAERS | |
| 339 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 340 | Troponin increased | FAERS: 2 | US FAERS | |
| 341 | Ulcer | FAERS: 2 | US FAERS | |
| 342 | Unevaluable event | FAERS: 2 | US FAERS | |
| 343 | Urinary Retention | FAERS: 2 | US FAERS | |
| 344 | Walking aid user | FAERS: 2 | US FAERS | |
| 345 | nervous system disorder | FAERS: 2 | US FAERS | |
| 346 | Abdominal mass | FAERS: 1 | US FAERS | |
| 347 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 348 | Acne | FAERS: 1 | US FAERS | |
| 349 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 350 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 351 | Amylase increased | FAERS: 1 | US FAERS | |
| 352 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 353 | Aneurysm | FAERS: 1 | US FAERS | |
| 354 | Animal scratch | FAERS: 1 | US FAERS | |
| 355 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 356 | Arthropod bite | FAERS: 1 | US FAERS | |
| 357 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 358 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 359 | Bed rest | FAERS: 1 | US FAERS | |
| 360 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 361 | Bilirubinuria | FAERS: 1 | US FAERS | |
| 362 | Bladder pain | FAERS: 1 | US FAERS | |
| 363 | Blast cell proliferation | FAERS: 1 | US FAERS | |
| 364 | Bleeding time shortened | FAERS: 1 | US FAERS | |
| 365 | Blister rupture | FAERS: 1 | US FAERS | |
| 366 | Blood 1,25-dihydroxycholecalciferol decreased | FAERS: 1 | US FAERS | |
| 367 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 368 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 369 | Blood creatine decreased | FAERS: 1 | US FAERS | |
| 370 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 371 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 372 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 373 | Blood urea increased | FAERS: 1 | US FAERS | |
| 374 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 375 | Bone marrow myelogram abnormal | FAERS: 1 | US FAERS | |
| 376 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 377 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 378 | Brain Death | FAERS: 1 | US FAERS | |
| 379 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 380 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 381 | Catheter site infection | FAERS: 1 | US FAERS | |
| 382 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 383 | Cold sweat | FAERS: 1 | US FAERS | |
| 384 | Colectomy | FAERS: 1 | US FAERS | |
| 385 | Completed Suicide | FAERS: 1 | US FAERS | |
| 386 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 387 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 388 | Cytopenia | FAERS: 1 | US FAERS | |
| 389 | Dental caries | FAERS: 1 | US FAERS | |
| 390 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 391 | Device malfunction | FAERS: 1 | US FAERS | |
| 392 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 393 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 394 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 395 | Diverticulum | FAERS: 1 | US FAERS | |
| 396 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 397 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 398 | Drug resistance | FAERS: 1 | US FAERS | |
| 399 | Dysplasia | FAERS: 1 | US FAERS | |
| 400 | Dystonia | FAERS: 1 | US FAERS | |
| 401 | Eczema | FAERS: 1 | US FAERS | |
| 402 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 403 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 404 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 405 | Embolic stroke | FAERS: 1 | US FAERS | |
| 406 | Emergency care examination | FAERS: 1 | US FAERS | |
| 407 | Endocarditis | FAERS: 1 | US FAERS | |
| 408 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 409 | Eosinophilic Fasciitis | FAERS: 1 | US FAERS | |
| 410 | Epilepsy | FAERS: 1 | US FAERS | |
| 411 | Eructation | FAERS: 1 | US FAERS | |
| 412 | Erythroblast count increased | FAERS: 1 | US FAERS | |
| 413 | Erythroblastosis | FAERS: 1 | US FAERS | |
| 414 | Erythromelalgia | FAERS: 1 | US FAERS | |
| 415 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 416 | Evans syndrome | FAERS: 1 | US FAERS | |
| 417 | Expired drug administered | FAERS: 1 | US FAERS | |
| 418 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 419 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 420 | Fistula discharge | FAERS: 1 | US FAERS | |
| 421 | Food aversion | FAERS: 1 | US FAERS | |
| 422 | Full blood count increased | FAERS: 1 | US FAERS | |
| 423 | Gait inability | FAERS: 1 | US FAERS | |
| 424 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 425 | Gangrene | FAERS: 1 | US FAERS | |
| 426 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 427 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 428 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 429 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 430 | Gene Mutation | FAERS: 1 | US FAERS | |
| 431 | Genital abscess | FAERS: 1 | US FAERS | |
| 432 | Germ Cell Cancer | FAERS: 1 | US FAERS | |
| 433 | Granulocyte count increased | FAERS: 1 | US FAERS | |
| 434 | Granuloma | FAERS: 1 | US FAERS | |
| 435 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 436 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 437 | Hearing disability | FAERS: 1 | US FAERS | |
| 438 | Hemiparesis | FAERS: 1 | US FAERS | |
| 439 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 440 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 441 | Hepatitis B | FAERS: 1 | US FAERS | |
| 442 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 443 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 444 | Hypogonadism | FAERS: 1 | US FAERS | |
| 445 | Hypophagia | FAERS: 1 | US FAERS | |
| 446 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 447 | Immunoglobulin Therapy | FAERS: 1 | US FAERS | |
| 448 | Immunosuppression | FAERS: 1 | US FAERS | |
| 449 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 450 | Incoherent | FAERS: 1 | US FAERS | |
| 451 | Incontinence | FAERS: 1 | US FAERS | |
| 452 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 453 | Infarction | FAERS: 1 | US FAERS | |
| 454 | Insurance issue | FAERS: 1 | US FAERS | |
| 455 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 456 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 457 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 458 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 459 | Intussusception | FAERS: 1 | US FAERS | |
| 460 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 461 | Lip swelling | FAERS: 1 | US FAERS | |
| 462 | Lipase increased | FAERS: 1 | US FAERS | |
| 463 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 464 | Lung cyst | FAERS: 1 | US FAERS | |
| 465 | Lupus endocarditis | FAERS: 1 | US FAERS | |
| 466 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 467 | Lyme Disease | FAERS: 1 | US FAERS | |
| 468 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 469 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 470 | Lymphopenia | FAERS: 1 | US FAERS | |
| 471 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 472 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 473 | Medication residue | FAERS: 1 | US FAERS | |
| 474 | Megakaryocytes increased | FAERS: 1 | US FAERS | |
| 475 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 476 | Menorrhagia | FAERS: 1 | US FAERS | |
| 477 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 478 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 479 | Metastasis | FAERS: 1 | US FAERS | |
| 480 | Monoplegia | FAERS: 1 | US FAERS | |
| 481 | Multimorbidity | FAERS: 1 | US FAERS | |
| 482 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 483 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 484 | Mydriasis | FAERS: 1 | US FAERS | |
| 485 | Myelitis | FAERS: 1 | US FAERS | |
| 486 | Myeloblast count increased | FAERS: 1 | US FAERS | |
| 487 | Myeloblast percentage decreased | FAERS: 1 | US FAERS | |
| 488 | Myositis | FAERS: 1 | US FAERS | |
| 489 | Nail cuticle fissure | FAERS: 1 | US FAERS | |
| 490 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 491 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 492 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 493 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 494 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 495 | Obesity | FAERS: 1 | US FAERS | |
| 496 | Occult blood positive | FAERS: 1 | US FAERS | |
| 497 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 498 | Ocular icterus | FAERS: 1 | US FAERS | |
| 499 | Oliguria | FAERS: 1 | US FAERS | |
| 500 | Onychoclasis | FAERS: 1 | US FAERS | |
| 501 | Onychomycosis | FAERS: 1 | US FAERS | |
| 502 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 503 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 504 | Overweight | FAERS: 1 | US FAERS | |
| 505 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 506 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 507 | Pain of skin | FAERS: 1 | US FAERS | |
| 508 | Paracentesis | FAERS: 1 | US FAERS | |
| 509 | Paternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 510 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 511 | Penetrating abdominal trauma | FAERS: 1 | US FAERS | |
| 512 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 513 | Pericarditis | FAERS: 1 | US FAERS | |
| 514 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 515 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 516 | Phlebitis | FAERS: 1 | US FAERS | |
| 517 | Photophobia | FAERS: 1 | US FAERS | |
| 518 | Platelet adhesiveness increased | FAERS: 1 | US FAERS | |
| 519 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 520 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 521 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 522 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 523 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 524 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 525 | Presyncope | FAERS: 1 | US FAERS | |
| 526 | Product administration error | FAERS: 1 | US FAERS | |
| 527 | Product container seal issue | FAERS: 1 | US FAERS | |
| 528 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 529 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 530 | Product lot number issue | FAERS: 1 | US FAERS | |
| 531 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 532 | Product quality issue | FAERS: 1 | US FAERS | |
| 533 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 534 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 535 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 536 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 537 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 538 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 539 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 540 | Quadriparesis | FAERS: 1 | US FAERS | |
| 541 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 542 | Rales | FAERS: 1 | US FAERS | |
| 543 | Refractory cytopenia with unilineage dysplasia | FAERS: 1 | US FAERS | |
| 544 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 545 | Renal embolism | FAERS: 1 | US FAERS | |
| 546 | Restlessness | FAERS: 1 | US FAERS | |
| 547 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 548 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 549 | Retroperitoneal lymphadenopathy | FAERS: 1 | US FAERS | |
| 550 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 551 | Rhinalgia | FAERS: 1 | US FAERS | |
| 552 | Rhinitis | FAERS: 1 | US FAERS | |
| 553 | Sciatica | FAERS: 1 | US FAERS | |
| 554 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 555 | Single functional kidney | FAERS: 1 | US FAERS | |
| 556 | Sinus headache | FAERS: 1 | US FAERS | |
| 557 | Skeletal injury | FAERS: 1 | US FAERS | |
| 558 | Skin necrosis | FAERS: 1 | US FAERS | |
| 559 | Skin reaction | FAERS: 1 | US FAERS | |
| 560 | Skin toxicity | FAERS: 1 | US FAERS | |
| 561 | Sleep Talking | FAERS: 1 | US FAERS | |
| 562 | Somnambulism | FAERS: 1 | US FAERS | |
| 563 | Spinal column injury | FAERS: 1 | US FAERS | |
| 564 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 565 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 566 | Splenic embolism | FAERS: 1 | US FAERS | |
| 567 | Splenic neoplasm malignancy unspecified | FAERS: 1 | US FAERS | |
| 568 | Splenic thrombosis | FAERS: 1 | US FAERS | |
| 569 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 570 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 571 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 572 | Suture insertion | FAERS: 1 | US FAERS | |
| 573 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 574 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 575 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 576 | Tension Headache | FAERS: 1 | US FAERS | |
| 577 | Tension | FAERS: 1 | US FAERS | |
| 578 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 579 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 580 | Throat irritation | FAERS: 1 | US FAERS | |
| 581 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 582 | Tonsillitis | FAERS: 1 | US FAERS | |
| 583 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 584 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 585 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 586 | Vascular rupture | FAERS: 1 | US FAERS | |
| 587 | Vasculitis | FAERS: 1 | US FAERS | |
| 588 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 589 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 590 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 591 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 592 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 593 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 594 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 595 | cancer surgery | FAERS: 1 | US FAERS | |
| 596 | intensive care | FAERS: 1 | US FAERS | |
| 597 | skin abrasion | FAERS: 1 | US FAERS | |
| 598 | Blood Platelet Disorders | 28943563 | CTD | |
| 599 | Blood and lymphatic system disorders | SIDER | ||
| 600 | Infestation | SIDER | ||
| 601 | Pharyngolaryngeal Pain | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.