ponatinib
(PHXJVRSECIGDHY-UHFFFAOYSA-N)
Structure
- SMILES
- CN1CCN(CC1)Cc1ccc(cc1C(F)(F)F)NC(=O)c1ccc(c(c1)C#Cc1cnc2n1nccc2)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE24
- Molecular Formula:
- C29H27F3N6O
- Molecular Weight:
- 532.559
- Log P:
- 4.4048
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 65.77
- CAS Number(s):
- 943319-70-8
Synonym(s)
1.
ponatinib
2.
3-(2-(imidazo(1,2-b)pyridazin-3-yl)ethynyl)-4-methyl-N-(4-((4-methylpiperazin-y-1-yl)methyl)-3-(trifluoromethyl)phenyl)benzamide
3.
AP 24534
4.
AP-24534
5.
AP24534
6.
Iclusig
7.
ponatinib hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 256 | SIDER US FAERS | |
| 2 | Headache | FAERS: 217 | SIDER US FAERS | |
| 3 | Nausea | FAERS: 165 | SIDER US FAERS | |
| 4 | Chest Pain | FAERS: 151 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Constipation | FAERS: 150 | SIDER US FAERS | |
| 6 | Dry skin | FAERS: 144 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Arthralgia | FAERS: 143 | SIDER US FAERS | |
| 8 | Pain | FAERS: 136 | SIDER US FAERS | |
| 9 | Asthenia | FAERS: 106 | SIDER US FAERS | |
| 10 | Thrombocytopenia | FAERS: 104 | SIDER US FAERS | |
| 11 | Pneumonia | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Abdominal Pain | FAERS: 96 | SIDER US FAERS | |
| 13 | Vomiting | FAERS: 90 | SIDER US FAERS | |
| 14 | Malaise | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Back Pain | FAERS: 86 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Blood count abnormal | FAERS: 78 | US FAERS | |
| 17 | White blood cell count decreased | FAERS: 78 | SIDER US FAERS | |
| 18 | Cerebrovascular accident | FAERS: 72 | SIDER US FAERS | |
| 19 | Dizziness | FAERS: 70 | SIDER US FAERS | |
| 20 | Chemotherapy | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Infection | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Myalgia | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 23 | Stem cell transplant | FAERS: 61 | US FAERS | |
| 24 | Anxiety | FAERS: 60 | US FAERS | |
| 25 | Bone pain | FAERS: 58 | SIDER US FAERS | |
| 26 | Pancytopenia | FAERS: 57 | SIDER US FAERS | |
| 27 | Pancreatitis | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 28 | Sepsis | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Alopecia | FAERS: 48 | SIDER US FAERS | |
| 30 | Chest discomfort | FAERS: 48 | US FAERS | |
| 31 | Neutropenia | FAERS: 48 | SIDER US FAERS | |
| 32 | Weight decreased | FAERS: 48 | SIDER US FAERS | |
| 33 | Drug ineffective | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 34 | Myocardial Infarction | FAERS: 44 | 25304212 | CTD SIDER US FAERS |
| 35 | Blood glucose increased | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Transplant | FAERS: 39 | US FAERS | |
| 37 | Febrile Neutropenia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Peripheral swelling | FAERS: 38 | US FAERS | |
| 39 | Dehydration | FAERS: 37 | SIDER US FAERS | |
| 40 | Pruritus | FAERS: 34 | SIDER US FAERS | |
| 41 | Lipase increased | FAERS: 32 | SIDER US FAERS | |
| 42 | Musculoskeletal Pain | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Disease Progression | FAERS: 31 | US FAERS | |
| 44 | Full blood count decreased | FAERS: 31 | US FAERS | |
| 45 | Night sweats | FAERS: 31 | SIDER US FAERS | |
| 46 | Urinary tract infection | FAERS: 31 | SIDER US FAERS | |
| 47 | Thrombosis | FAERS: 29 | US FAERS | |
| 48 | Epistaxis | FAERS: 28 | SIDER US FAERS | |
| 49 | Erythema | FAERS: 28 | SIDER US FAERS | |
| 50 | Visual Impairment | FAERS: 28 | SIDER US FAERS | |
| 51 | Acute kidney injury | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Pericardial effusion | FAERS: 26 | SIDER US FAERS | |
| 53 | Product use issue | FAERS: 26 | US FAERS | |
| 54 | Pulmonary Embolism | FAERS: 26 | SIDER US FAERS | |
| 55 | Joint swelling | FAERS: 24 | US FAERS | |
| 56 | Chills | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 57 | Drug dose omission | FAERS: 23 | US FAERS | |
| 58 | Influenza | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Nasopharyngitis | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Abdominal discomfort | FAERS: 22 | SIDER US FAERS | |
| 61 | Alanine Aminotransferase Increased | FAERS: 22 | SIDER US FAERS | |
| 62 | Blood alkaline phosphatase increased | FAERS: 22 | SIDER US FAERS | |
| 63 | Dyspepsia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 64 | Memory impairment | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Pallor | FAERS: 22 | US FAERS | |
| 66 | Atrial Fibrillation | FAERS: 21 | SIDER US FAERS | |
| 67 | Neck Pain | FAERS: 21 | SIDER US FAERS | |
| 68 | Rash erythematous | FAERS: 21 | US FAERS | |
| 69 | Cellulitis | FAERS: 20 | SIDER US FAERS | |
| 70 | Peripheral arterial occlusive disease | FAERS: 20 | SIDER US FAERS | |
| 71 | Splenomegaly | FAERS: 20 | US FAERS | |
| 72 | Tachycardia | FAERS: 20 | US FAERS | |
| 73 | Unevaluable event | FAERS: 20 | US FAERS | |
| 74 | Angina Pectoris | FAERS: 19 | SIDER US FAERS | |
| 75 | Bronchitis | FAERS: 19 | US FAERS | |
| 76 | Deep Vein Thrombosis | FAERS: 19 | SIDER US FAERS | |
| 77 | Erectile dysfunction | FAERS: 19 | SIDER US FAERS | |
| 78 | Hypothyroidism | FAERS: 19 | US FAERS | |
| 79 | Product dose omission | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 80 | Somnolence | FAERS: 19 | US FAERS | |
| 81 | Clostridium difficile infection | FAERS: 18 | US FAERS | |
| 82 | Cytopenia | FAERS: 18 | US FAERS | |
| 83 | Dysphonia | FAERS: 18 | SIDER US FAERS | |
| 84 | No adverse event | FAERS: 18 | US FAERS | |
| 85 | Palpitations | FAERS: 18 | US FAERS | |
| 86 | Aspartate Aminotransferase Increased | FAERS: 17 | SIDER US FAERS | |
| 87 | Platelet count abnormal | FAERS: 17 | US FAERS | |
| 88 | Respiratory Failure | FAERS: 17 | US FAERS | |
| 89 | Graft versus host disease in skin | FAERS: 16 | US FAERS | |
| 90 | Hypoxia | FAERS: 16 | US FAERS | |
| 91 | Hypotension | FAERS: 15 | US FAERS | |
| 92 | Lymphadenopathy | FAERS: 15 | US FAERS | |
| 93 | Blood creatinine increased | FAERS: 14 | SIDER US FAERS | |
| 94 | Cataract | FAERS: 14 | US FAERS | |
| 95 | Coronary Artery Disease | FAERS: 14 | SIDER US FAERS | |
| 96 | Diplopia | FAERS: 14 | US FAERS | |
| 97 | Hypersensitivity | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Nephrolithiasis | FAERS: 14 | US FAERS | |
| 99 | Neuralgia | FAERS: 14 | US FAERS | |
| 100 | Photophobia | FAERS: 14 | US FAERS | |
| 101 | Septic Shock | FAERS: 14 | US FAERS | |
| 102 | Toxicity to various agents | FAERS: 14 | US FAERS | |
| 103 | Urticaria | FAERS: 14 | US FAERS | |
| 104 | Wheezing | FAERS: 14 | US FAERS | |
| 105 | Atelectasis | FAERS: 13 | US FAERS | |
| 106 | Blood potassium decreased | FAERS: 13 | SIDER US FAERS | |
| 107 | Burning sensation | FAERS: 13 | US FAERS | |
| 108 | Diabetes Mellitus | FAERS: 13 | US FAERS | |
| 109 | Neutrophil count decreased | FAERS: 13 | SIDER US FAERS | |
| 110 | Skin Wrinkling | FAERS: 13 | US FAERS | |
| 111 | Therapy non-responder | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Transaminases increased | FAERS: 13 | US FAERS | |
| 113 | Abdominal tenderness | FAERS: 12 | US FAERS | |
| 114 | Aphasia | FAERS: 12 | US FAERS | |
| 115 | Arthritis | FAERS: 12 | US FAERS | |
| 116 | General physical health deterioration | FAERS: 12 | US FAERS | |
| 117 | Intestinal Obstruction | FAERS: 12 | US FAERS | |
| 118 | Oropharyngeal pain | FAERS: 12 | US FAERS | |
| 119 | Skin lesion | FAERS: 12 | US FAERS | |
| 120 | Device related infection | FAERS: 11 | US FAERS | |
| 121 | Facial paralysis | FAERS: 11 | US FAERS | |
| 122 | Leukocytosis | FAERS: 11 | US FAERS | |
| 123 | Monocyte count increased | FAERS: 11 | US FAERS | |
| 124 | Oral candidiasis | FAERS: 11 | US FAERS | |
| 125 | Stomatitis | FAERS: 11 | SIDER US FAERS | |
| 126 | Abasia | FAERS: 10 | US FAERS | |
| 127 | Acne | FAERS: 10 | US FAERS | |
| 128 | Adverse event | FAERS: 10 | US FAERS | |
| 129 | Cerebral Infarction | FAERS: 10 | SIDER US FAERS | |
| 130 | Clostridium difficile colitis | FAERS: 10 | US FAERS | |
| 131 | Deafness | FAERS: 10 | US FAERS | |
| 132 | Feeling abnormal | FAERS: 10 | US FAERS | |
| 133 | Graft versus host disease in gastrointestinal tract | FAERS: 10 | US FAERS | |
| 134 | Joint stiffness | FAERS: 10 | US FAERS | |
| 135 | Pulmonary Hypertension | FAERS: 10 | US FAERS | |
| 136 | Skin Ulcer | FAERS: 10 | US FAERS | |
| 137 | Tremor | FAERS: 10 | US FAERS | |
| 138 | Acute myocardial infarction | FAERS: 9 | US FAERS | |
| 139 | Amylase increased | FAERS: 9 | SIDER US FAERS | |
| 140 | Blood albumin decreased | FAERS: 9 | SIDER US FAERS | |
| 141 | Blood chloride increased | FAERS: 9 | US FAERS | |
| 142 | Blood urea increased | FAERS: 9 | US FAERS | |
| 143 | Blood urine present | FAERS: 9 | US FAERS | |
| 144 | Cardiac Arrest | FAERS: 9 | US FAERS | |
| 145 | Cholelithiasis | FAERS: 9 | US FAERS | |
| 146 | Drug resistance | FAERS: 9 | US FAERS | |
| 147 | Dysuria | FAERS: 9 | US FAERS | |
| 148 | Eye pain | FAERS: 9 | US FAERS | |
| 149 | Gout | FAERS: 9 | US FAERS | |
| 150 | Hepatomegaly | FAERS: 9 | US FAERS | |
| 151 | Iron deficiency | FAERS: 9 | US FAERS | |
| 152 | Pneumonitis | FAERS: 9 | US FAERS | |
| 153 | White blood cell count abnormal | FAERS: 9 | US FAERS | |
| 154 | Ascites | FAERS: 8 | US FAERS | |
| 155 | Blood lactate dehydrogenase increased | FAERS: 8 | US FAERS | |
| 156 | Gait inability | FAERS: 8 | US FAERS | |
| 157 | Graft versus host disease in eye | FAERS: 8 | US FAERS | |
| 158 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 159 | Peripheral artery stenosis | FAERS: 8 | SIDER US FAERS | |
| 160 | Sunburn | FAERS: 8 | US FAERS | |
| 161 | Urinary Incontinence | FAERS: 8 | US FAERS | |
| 162 | Urinary Retention | FAERS: 8 | US FAERS | |
| 163 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 164 | Arteriosclerosis | FAERS: 7 | US FAERS | |
| 165 | Blindness | FAERS: 7 | US FAERS | |
| 166 | Bradycardia | FAERS: 7 | US FAERS | |
| 167 | Bronchopulmonary Aspergillosis | FAERS: 7 | US FAERS | |
| 168 | Cardiomegaly | FAERS: 7 | US FAERS | |
| 169 | Colitis | FAERS: 7 | US FAERS | |
| 170 | Depressed mood | FAERS: 7 | US FAERS | |
| 171 | Embolism | FAERS: 7 | US FAERS | |
| 172 | Exfoliative rash | FAERS: 7 | SIDER US FAERS | |
| 173 | Hepatotoxicity | FAERS: 7 | SIDER US FAERS | |
| 174 | Immunosuppression | FAERS: 7 | US FAERS | |
| 175 | Lethargy | FAERS: 7 | SIDER US FAERS | |
| 176 | Leukopenia | FAERS: 7 | SIDER US FAERS | |
| 177 | Limb discomfort | FAERS: 7 | US FAERS | |
| 178 | Musculoskeletal discomfort | FAERS: 7 | SIDER US FAERS | |
| 179 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 180 | Pericarditis | FAERS: 7 | US FAERS | |
| 181 | Platelet Transfusion | FAERS: 7 | US FAERS | |
| 182 | Swelling | FAERS: 7 | US FAERS | |
| 183 | Throat irritation | FAERS: 7 | US FAERS | |
| 184 | Thrombocytosis | FAERS: 7 | US FAERS | |
| 185 | Vascular occlusion | FAERS: 7 | SIDER US FAERS | |
| 186 | Venoocclusive disease | FAERS: 7 | US FAERS | |
| 187 | Abscess | FAERS: 6 | US FAERS | |
| 188 | Acute respiratory failure | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Amnesia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Anorectal discomfort | FAERS: 6 | US FAERS | |
| 191 | Blood magnesium decreased | FAERS: 6 | US FAERS | |
| 192 | Blood pressure fluctuation | FAERS: 6 | US FAERS | |
| 193 | Carbon dioxide decreased | FAERS: 6 | US FAERS | |
| 194 | Cardiac Flutter | FAERS: 6 | US FAERS | |
| 195 | Cystitis | FAERS: 6 | US FAERS | |
| 196 | Decreased immune responsiveness | FAERS: 6 | US FAERS | |
| 197 | Dental caries | FAERS: 6 | US FAERS | |
| 198 | Dyschromatopsia | FAERS: 6 | US FAERS | |
| 199 | Dysgeusia | FAERS: 6 | US FAERS | |
| 200 | Ecchymosis | FAERS: 6 | SIDER US FAERS | |
| 201 | Flatulence | FAERS: 6 | US FAERS | |
| 202 | Fluid overload | FAERS: 6 | US FAERS | |
| 203 | Gastroenteritis | FAERS: 6 | US FAERS | |
| 204 | Gastrointestinal infection | FAERS: 6 | US FAERS | |
| 205 | Haematotoxicity | FAERS: 6 | US FAERS | |
| 206 | Hospice Care | FAERS: 6 | US FAERS | |
| 207 | Hydronephrosis | FAERS: 6 | US FAERS | |
| 208 | Malignant neoplasm progression | FAERS: 6 | US FAERS | |
| 209 | Malnutrition | FAERS: 6 | SIDER US FAERS | |
| 210 | Nervousness | FAERS: 6 | US FAERS | |
| 211 | Neutrophil count abnormal | FAERS: 6 | US FAERS | |
| 212 | Obesity | FAERS: 6 | US FAERS | |
| 213 | Papule | FAERS: 6 | US FAERS | |
| 214 | Peripheral artery occlusion | FAERS: 6 | US FAERS | |
| 215 | Protein total decreased | FAERS: 6 | US FAERS | |
| 216 | Respiratory distress | FAERS: 6 | US FAERS | |
| 217 | Sciatica | FAERS: 6 | US FAERS | |
| 218 | Sinusitis | FAERS: 6 | US FAERS | |
| 219 | Skin Papilloma | FAERS: 6 | US FAERS | |
| 220 | Tinnitus | FAERS: 6 | US FAERS | |
| 221 | Vertigo | FAERS: 6 | US FAERS | |
| 222 | Vitamin D Deficiency | FAERS: 6 | US FAERS | |
| 223 | Vitreous floaters | FAERS: 6 | US FAERS | |
| 224 | treatment failure | FAERS: 6 | US FAERS | |
| 225 | Blood glucose abnormal | FAERS: 5 | US FAERS | |
| 226 | Blood potassium increased | FAERS: 5 | SIDER US FAERS | |
| 227 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 228 | Chromaturia | FAERS: 5 | US FAERS | |
| 229 | Dermatitis | FAERS: 5 | SIDER US FAERS | |
| 230 | Device related thrombosis | FAERS: 5 | US FAERS | |
| 231 | Dysarthria | FAERS: 5 | US FAERS | |
| 232 | Ejection Fraction Decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 233 | Eye Infection | FAERS: 5 | US FAERS | |
| 234 | Eye irritation | FAERS: 5 | US FAERS | |
| 235 | Hypophagia | FAERS: 5 | US FAERS | |
| 236 | Initial insomnia | FAERS: 5 | US FAERS | |
| 237 | Macular degeneration | FAERS: 5 | US FAERS | |
| 238 | Menorrhagia | FAERS: 5 | US FAERS | |
| 239 | Muscle tightness | FAERS: 5 | US FAERS | |
| 240 | Musculoskeletal chest pain | FAERS: 5 | SIDER US FAERS | |
| 241 | Pleuritic pain | FAERS: 5 | US FAERS | |
| 242 | Proteinuria | FAERS: 5 | US FAERS | |
| 243 | Renal Artery Stenosis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Retinal Drusen | FAERS: 5 | US FAERS | |
| 245 | Splenic Rupture | FAERS: 5 | US FAERS | |
| 246 | Stress | FAERS: 5 | US FAERS | |
| 247 | Thrombosis in device | FAERS: 5 | US FAERS | |
| 248 | VIIth nerve paralysis | FAERS: 5 | US FAERS | |
| 249 | Venous Thrombosis | FAERS: 5 | SIDER US FAERS | |
| 250 | Ventricular hypokinesia | FAERS: 5 | US FAERS | |
| 251 | Agranulocytosis | FAERS: 4 | US FAERS | |
| 252 | Allodynia | FAERS: 4 | US FAERS | |
| 253 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 254 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 255 | Blood glucose decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 256 | Brain Death | FAERS: 4 | US FAERS | |
| 257 | Carpal Tunnel Syndrome | FAERS: 4 | US FAERS | |
| 258 | Complication associated with device | FAERS: 4 | US FAERS | |
| 259 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 260 | Dementia | FAERS: 4 | US FAERS | |
| 261 | Demyelination | FAERS: 4 | US FAERS | |
| 262 | Discomfort | FAERS: 4 | US FAERS | |
| 263 | Diverticulum | FAERS: 4 | US FAERS | |
| 264 | Erythema Nodosum | FAERS: 4 | US FAERS | |
| 265 | Escherichia infection | FAERS: 4 | US FAERS | |
| 266 | Flushing | FAERS: 4 | SIDER US FAERS | |
| 267 | Full blood count increased | FAERS: 4 | US FAERS | |
| 268 | Glaucoma | FAERS: 4 | US FAERS | |
| 269 | Hemiparesis | FAERS: 4 | US FAERS | |
| 270 | Hepatosplenomegaly | FAERS: 4 | US FAERS | |
| 271 | Hip surgery | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 272 | Homans' sign positive | FAERS: 4 | US FAERS | |
| 273 | Hypersomnia | FAERS: 4 | US FAERS | |
| 274 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 275 | Ileus | FAERS: 4 | US FAERS | |
| 276 | Infusion site erythema | FAERS: 4 | US FAERS | |
| 277 | Intermittent Claudication | FAERS: 4 | SIDER US FAERS | |
| 278 | Lichenification | FAERS: 4 | US FAERS | |
| 279 | Limb injury | FAERS: 4 | US FAERS | |
| 280 | Lymphocyte count decreased | FAERS: 4 | US FAERS | |
| 281 | Lymphocyte count increased | FAERS: 4 | US FAERS | |
| 282 | Mood swings | FAERS: 4 | US FAERS | |
| 283 | Neutropenic sepsis | FAERS: 4 | US FAERS | |
| 284 | Nodule | FAERS: 4 | US FAERS | |
| 285 | Non-cardiac chest pain | FAERS: 4 | SIDER US FAERS | |
| 286 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 287 | Oncologic complication | FAERS: 4 | US FAERS | |
| 288 | Optic Neuritis | FAERS: 4 | US FAERS | |
| 289 | Overdose | FAERS: 4 | US FAERS | |
| 290 | Pancreatic enzymes increased | FAERS: 4 | US FAERS | |
| 291 | Peritonitis | FAERS: 4 | US FAERS | |
| 292 | Philadelphia chromosome positive | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 293 | Pleurisy | FAERS: 4 | US FAERS | |
| 294 | Poor peripheral circulation | FAERS: 4 | SIDER US FAERS | |
| 295 | Pulmonary arterial hypertension | FAERS: 4 | US FAERS | |
| 296 | Restlessness | FAERS: 4 | US FAERS | |
| 297 | Retinal Artery Occlusion | FAERS: 4 | US FAERS | |
| 298 | Retinal Vascular Disorder | FAERS: 4 | US FAERS | |
| 299 | Rhinovirus infection | FAERS: 4 | US FAERS | |
| 300 | Skin toxicity | FAERS: 4 | US FAERS | |
| 301 | Squamous cell carcinoma | FAERS: 4 | US FAERS | |
| 302 | Sudden death | FAERS: 4 | US FAERS | |
| 303 | Therapy partial responder | FAERS: 4 | US FAERS | |
| 304 | Toothache | FAERS: 4 | US FAERS | |
| 305 | Wheelchair user | FAERS: 4 | US FAERS | |
| 306 | furuncle | FAERS: 4 | US FAERS | |
| 307 | nervous system disorder | FAERS: 4 | SIDER US FAERS | |
| 308 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 309 | Aphonia | FAERS: 3 | US FAERS | |
| 310 | Asthma | FAERS: 3 | US FAERS | |
| 311 | Ataxia | FAERS: 3 | US FAERS | |
| 312 | Axillary vein thrombosis | FAERS: 3 | US FAERS | |
| 313 | Back disorder | FAERS: 3 | US FAERS | |
| 314 | Bedridden | FAERS: 3 | US FAERS | |
| 315 | Bladder pain | FAERS: 3 | US FAERS | |
| 316 | Blast cell count increased | FAERS: 3 | US FAERS | |
| 317 | Blood immunoglobulin G decreased | FAERS: 3 | US FAERS | |
| 318 | Blood iron decreased | FAERS: 3 | US FAERS | |
| 319 | Blood phosphorus increased | FAERS: 3 | US FAERS | |
| 320 | Bone lesion | FAERS: 3 | US FAERS | |
| 321 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 322 | Bronchospasm | FAERS: 3 | US FAERS | |
| 323 | Cataract operation | FAERS: 3 | US FAERS | |
| 324 | Cholangitis | FAERS: 3 | US FAERS | |
| 325 | Delirium | FAERS: 3 | US FAERS | |
| 326 | Demodicidosis | FAERS: 3 | US FAERS | |
| 327 | Dermatitis acneiform | FAERS: 3 | US FAERS | |
| 328 | Disease susceptibility | FAERS: 3 | US FAERS | |
| 329 | Disorientation | FAERS: 3 | US FAERS | |
| 330 | Eczema | FAERS: 3 | US FAERS | |
| 331 | Emotional disorder | FAERS: 3 | US FAERS | |
| 332 | Essential Hypertension | FAERS: 3 | US FAERS | |
| 333 | Eyelid skin dryness | FAERS: 3 | US FAERS | |
| 334 | Facial wasting | FAERS: 3 | US FAERS | |
| 335 | Flank Pain | FAERS: 3 | US FAERS | |
| 336 | Gangrene | FAERS: 3 | US FAERS | |
| 337 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 338 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 339 | Gastrointestinal toxicity | FAERS: 3 | US FAERS | |
| 340 | Graft versus host disease in liver | FAERS: 3 | US FAERS | |
| 341 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 342 | Hunger | FAERS: 3 | US FAERS | |
| 343 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 344 | Inflammation | FAERS: 3 | US FAERS | |
| 345 | Joint Range of Motion Decreased | FAERS: 3 | US FAERS | |
| 346 | Limb operation | FAERS: 3 | US FAERS | |
| 347 | Lip neoplasm malignant stage unspecified | FAERS: 3 | US FAERS | |
| 348 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 349 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 350 | Medication Error | FAERS: 3 | US FAERS | |
| 351 | Meningitis | FAERS: 3 | US FAERS | |
| 352 | Mental status changes | FAERS: 3 | US FAERS | |
| 353 | Miscarriage of partner | FAERS: 3 | US FAERS | |
| 354 | Myositis | FAERS: 3 | US FAERS | |
| 355 | Nocturia | FAERS: 3 | US FAERS | |
| 356 | Oral mucosal exfoliation | FAERS: 3 | US FAERS | |
| 357 | Pain of skin | FAERS: 3 | SIDER US FAERS | |
| 358 | Pelvic Pain | FAERS: 3 | US FAERS | |
| 359 | Performance status decreased | FAERS: 3 | US FAERS | |
| 360 | Post lumbar puncture syndrome | FAERS: 3 | US FAERS | |
| 361 | Pregnancy of partner | FAERS: 3 | US FAERS | |
| 362 | Protein total increased | FAERS: 3 | US FAERS | |
| 363 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 364 | Rales | FAERS: 3 | US FAERS | |
| 365 | Renal cyst | FAERS: 3 | US FAERS | |
| 366 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 367 | Rhinitis | FAERS: 3 | US FAERS | |
| 368 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 369 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 370 | Skin reaction | FAERS: 3 | US FAERS | |
| 371 | Splenic Infarction | FAERS: 3 | SIDER US FAERS | |
| 372 | Ulcer | FAERS: 3 | US FAERS | |
| 373 | Uveitis | FAERS: 3 | US FAERS | |
| 374 | jaundice | FAERS: 3 | SIDER US FAERS | |
| 375 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 376 | Acquired gene mutation | FAERS: 2 | US FAERS | |
| 377 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 378 | Acute Coronary Syndrome | FAERS: 2 | SIDER US FAERS | |
| 379 | Ageusia | FAERS: 2 | US FAERS | |
| 380 | Agitation | FAERS: 2 | US FAERS | |
| 381 | Alanine aminotransferase decreased | FAERS: 2 | US FAERS | |
| 382 | Anal Fissure | FAERS: 2 | US FAERS | |
| 383 | Angioedema | FAERS: 2 | US FAERS | |
| 384 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 385 | Aortic valve sclerosis | FAERS: 2 | US FAERS | |
| 386 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 387 | Arteritis | FAERS: 2 | US FAERS | |
| 388 | Arthropathy | FAERS: 2 | US FAERS | |
| 389 | Arthropod bite | FAERS: 2 | US FAERS | |
| 390 | Asthenopia | FAERS: 2 | US FAERS | |
| 391 | Atrial pressure increased | FAERS: 2 | US FAERS | |
| 392 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 393 | Blast cells present | FAERS: 2 | US FAERS | |
| 394 | Blood 25-hydroxycholecalciferol | FAERS: 2 | US FAERS | |
| 395 | Blood albumin increased | FAERS: 2 | US FAERS | |
| 396 | Blood alkaline phosphatase abnormal | FAERS: 2 | US FAERS | |
| 397 | Blood bilirubin abnormal | FAERS: 2 | US FAERS | |
| 398 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 399 | Blood lactate dehydrogenase abnormal | FAERS: 2 | US FAERS | |
| 400 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 401 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 402 | Blood urea abnormal | FAERS: 2 | US FAERS | |
| 403 | Butterfly rash | FAERS: 2 | US FAERS | |
| 404 | Cachexia | FAERS: 2 | US FAERS | |
| 405 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 406 | Carotid Endarterectomy | FAERS: 2 | US FAERS | |
| 407 | Cell Death | FAERS: 2 | US FAERS | |
| 408 | Cerebral artery stenosis | FAERS: 2 | SIDER US FAERS | |
| 409 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 410 | Choking | FAERS: 2 | US FAERS | |
| 411 | Cholecystitis | FAERS: 2 | US FAERS | |
| 412 | Chronic disease | FAERS: 2 | US FAERS | |
| 413 | Chronic graft versus host disease in skin | FAERS: 2 | US FAERS | |
| 414 | Clubbing | FAERS: 2 | US FAERS | |
| 415 | Colectomy | FAERS: 2 | US FAERS | |
| 416 | Contrast media allergy | FAERS: 2 | US FAERS | |
| 417 | Counterfeit product administered | FAERS: 2 | US FAERS | |
| 418 | Device occlusion | FAERS: 2 | US FAERS | |
| 419 | Device related sepsis | FAERS: 2 | US FAERS | |
| 420 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 421 | Disease complication | FAERS: 2 | US FAERS | |
| 422 | Diverticulitis | FAERS: 2 | US FAERS | |
| 423 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 424 | Ear discomfort | FAERS: 2 | US FAERS | |
| 425 | Echocardiogram abnormal | FAERS: 2 | US FAERS | |
| 426 | Enterobacter sepsis | FAERS: 2 | US FAERS | |
| 427 | Epilepsy | FAERS: 2 | US FAERS | |
| 428 | Eructation | FAERS: 2 | US FAERS | |
| 429 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 430 | Escherichia test positive | FAERS: 2 | US FAERS | |
| 431 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 432 | Eye excision | FAERS: 2 | US FAERS | |
| 433 | Eyelid pain | FAERS: 2 | US FAERS | |
| 434 | Folliculitis | FAERS: 2 | SIDER US FAERS | |
| 435 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 436 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 437 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 438 | Fungal test positive | FAERS: 2 | US FAERS | |
| 439 | Gastric pH decreased | FAERS: 2 | US FAERS | |
| 440 | Gastritis | FAERS: 2 | US FAERS | |
| 441 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 442 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 443 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 444 | Gene Mutation | FAERS: 2 | US FAERS | |
| 445 | Gingivitis | FAERS: 2 | US FAERS | |
| 446 | Head discomfort | FAERS: 2 | US FAERS | |
| 447 | Hemiplegia | FAERS: 2 | US FAERS | |
| 448 | Hepatic congestion | FAERS: 2 | US FAERS | |
| 449 | Hepatitis C | FAERS: 2 | US FAERS | |
| 450 | Hepatitis | FAERS: 2 | US FAERS | |
| 451 | Hordeolum | FAERS: 2 | US FAERS | |
| 452 | Human anaplasmosis | FAERS: 2 | US FAERS | |
| 453 | Hyperleukocytosis | FAERS: 2 | US FAERS | |
| 454 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 455 | Impaired self-care | FAERS: 2 | US FAERS | |
| 456 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 457 | Insurance issue | FAERS: 2 | US FAERS | |
| 458 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 459 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 460 | Intra-abdominal fluid collection | FAERS: 2 | US FAERS | |
| 461 | Intracranial mass | FAERS: 2 | US FAERS | |
| 462 | Iron Overload | FAERS: 2 | US FAERS | |
| 463 | Keratosis pilaris | FAERS: 2 | US FAERS | |
| 464 | Labile hypertension | FAERS: 2 | US FAERS | |
| 465 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 466 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 467 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 468 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 469 | Lower respiratory tract congestion | FAERS: 2 | US FAERS | |
| 470 | Lymph node palpable | FAERS: 2 | US FAERS | |
| 471 | Lymphocyte count abnormal | FAERS: 2 | US FAERS | |
| 472 | Lymphoma | FAERS: 2 | US FAERS | |
| 473 | Macule | FAERS: 2 | US FAERS | |
| 474 | Mental impairment | FAERS: 2 | US FAERS | |
| 475 | Mesenteric arterial occlusion | FAERS: 2 | US FAERS | |
| 476 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 477 | Myeloblast count decreased | FAERS: 2 | US FAERS | |
| 478 | Myopathy | FAERS: 2 | US FAERS | |
| 479 | Nasogastric output high | FAERS: 2 | US FAERS | |
| 480 | Nephrosclerosis | FAERS: 2 | US FAERS | |
| 481 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 482 | Ocular icterus | FAERS: 2 | US FAERS | |
| 483 | Oral infection | FAERS: 2 | US FAERS | |
| 484 | Oral pain | FAERS: 2 | US FAERS | |
| 485 | Osteopenia | FAERS: 2 | US FAERS | |
| 486 | Osteoporosis | FAERS: 2 | US FAERS | |
| 487 | Otitis Externa | FAERS: 2 | US FAERS | |
| 488 | Ovarian adenoma | FAERS: 2 | US FAERS | |
| 489 | Overweight | FAERS: 2 | US FAERS | |
| 490 | PO2 decreased | FAERS: 2 | US FAERS | |
| 491 | Pancreatic enlargement | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 492 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 493 | Paraplegia | FAERS: 2 | US FAERS | |
| 494 | Parotitis | FAERS: 2 | US FAERS | |
| 495 | Pathological fracture | FAERS: 2 | US FAERS | |
| 496 | Peripheral artery bypass | FAERS: 2 | US FAERS | |
| 497 | Peripheral artery thrombosis | FAERS: 2 | US FAERS | |
| 498 | Petechiae | FAERS: 2 | SIDER US FAERS | |
| 499 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 500 | Post procedural complication | FAERS: 2 | US FAERS | |
| 501 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 502 | Pregnancy | FAERS: 2 | US FAERS | |
| 503 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 504 | Pulmonary granuloma | FAERS: 2 | US FAERS | |
| 505 | Pulmonary pain | FAERS: 2 | US FAERS | |
| 506 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 507 | Rash follicular | FAERS: 2 | US FAERS | |
| 508 | Red cell distribution width abnormal | FAERS: 2 | US FAERS | |
| 509 | Red cell distribution width decreased | FAERS: 2 | US FAERS | |
| 510 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 511 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 512 | Respiratory fume inhalation disorder | FAERS: 2 | US FAERS | |
| 513 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 514 | Retinal Vein Occlusion | FAERS: 2 | SIDER US FAERS | |
| 515 | Rhonchi | FAERS: 2 | US FAERS | |
| 516 | Sapovirus test positive | FAERS: 2 | US FAERS | |
| 517 | Secretion discharge | FAERS: 2 | US FAERS | |
| 518 | Serositis | FAERS: 2 | US FAERS | |
| 519 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 520 | Sinus headache | FAERS: 2 | US FAERS | |
| 521 | Skin irritation | FAERS: 2 | US FAERS | |
| 522 | Slow speech | FAERS: 2 | US FAERS | |
| 523 | Sluggishness | FAERS: 2 | US FAERS | |
| 524 | Suprapubic pain | FAERS: 2 | US FAERS | |
| 525 | Terminal state | FAERS: 2 | US FAERS | |
| 526 | Thermal burn | FAERS: 2 | US FAERS | |
| 527 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 528 | Tooth Infection | FAERS: 2 | US FAERS | |
| 529 | Transplantation complication | FAERS: 2 | US FAERS | |
| 530 | Tumour haemorrhage | FAERS: 2 | US FAERS | |
| 531 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 532 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 533 | Urinary tract obstruction | FAERS: 2 | US FAERS | |
| 534 | Uterine Prolapse | FAERS: 2 | US FAERS | |
| 535 | Vascular stent insertion | FAERS: 2 | US FAERS | |
| 536 | Ventricular drainage | FAERS: 2 | US FAERS | |
| 537 | Vertebral foraminal stenosis | FAERS: 2 | US FAERS | |
| 538 | Vocal Cord Dysfunction | FAERS: 2 | US FAERS | |
| 539 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 540 | skin abrasion | FAERS: 2 | US FAERS | |
| 541 | ABO incompatibility | FAERS: 1 | US FAERS | |
| 542 | Aborted pregnancy | FAERS: 1 | US FAERS | |
| 543 | Accidental overdose | FAERS: 1 | US FAERS | |
| 544 | Activated partial thromboplastin time shortened | FAERS: 1 | US FAERS | |
| 545 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 546 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 547 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 548 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 549 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 550 | Ammonia increased | FAERS: 1 | US FAERS | |
| 551 | Anal abscess | FAERS: 1 | US FAERS | |
| 552 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 553 | Anger | FAERS: 1 | US FAERS | |
| 554 | Anuria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 555 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 556 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 557 | Aortic wall hypertrophy | FAERS: 1 | US FAERS | |
| 558 | Apathy | FAERS: 1 | US FAERS | |
| 559 | Appendicitis | FAERS: 1 | US FAERS | |
| 560 | Arcus lipoides | FAERS: 1 | US FAERS | |
| 561 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 562 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 563 | Auricular swelling | FAERS: 1 | US FAERS | |
| 564 | BK virus infection | FAERS: 1 | US FAERS | |
| 565 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 566 | Basilar Artery Stenosis | FAERS: 1 | US FAERS | |
| 567 | Bicytopenia | FAERS: 1 | US FAERS | |
| 568 | Biliary Dyskinesia | FAERS: 1 | US FAERS | |
| 569 | Bladder wall calcification | FAERS: 1 | US FAERS | |
| 570 | Blepharitis | FAERS: 1 | US FAERS | |
| 571 | Blood chloride abnormal | FAERS: 1 | US FAERS | |
| 572 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 573 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 574 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 575 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 576 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 577 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 578 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 579 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 580 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 581 | Blood sodium increased | FAERS: 1 | SIDER US FAERS | |
| 582 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 583 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 584 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 585 | Blood triglycerides increased | FAERS: 1 | SIDER US FAERS | |
| 586 | Blood urea nitrogen/creatinine ratio decreased | FAERS: 1 | US FAERS | |
| 587 | Brain stem thrombosis | FAERS: 1 | US FAERS | |
| 588 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 589 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 590 | Calcinosis | FAERS: 1 | US FAERS | |
| 591 | Capnocytophaga infection | FAERS: 1 | US FAERS | |
| 592 | Carbon dioxide abnormal | FAERS: 1 | US FAERS | |
| 593 | Cardiac Death | FAERS: 1 | US FAERS | |
| 594 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 595 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 596 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 597 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 598 | Catheter site infection | FAERS: 1 | US FAERS | |
| 599 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 600 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 601 | Cerebral vascular occlusion | FAERS: 1 | US FAERS | |
| 602 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 603 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 604 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 605 | Chemical eye injury | FAERS: 1 | US FAERS | |
| 606 | Cholestasis | FAERS: 1 | US FAERS | |
| 607 | Chromatopsia | FAERS: 1 | US FAERS | |
| 608 | Cold sweat | FAERS: 1 | US FAERS | |
| 609 | Colon adenoma | FAERS: 1 | US FAERS | |
| 610 | Completed Suicide | FAERS: 1 | US FAERS | |
| 611 | Complications of bone marrow transplant | FAERS: 1 | US FAERS | |
| 612 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 613 | Conjunctival pallor | FAERS: 1 | US FAERS | |
| 614 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 615 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 616 | Coronavirus test positive | FAERS: 1 | US FAERS | |
| 617 | Crying | FAERS: 1 | US FAERS | |
| 618 | Cystitis viral | FAERS: 1 | US FAERS | |
| 619 | Cytokine Release Syndrome | FAERS: 1 | US FAERS | |
| 620 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 621 | Cytotoxic cardiomyopathy | FAERS: 1 | US FAERS | |
| 622 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 623 | Device use issue | FAERS: 1 | US FAERS | |
| 624 | Diabetic foot infection | FAERS: 1 | US FAERS | |
| 625 | Disability | FAERS: 1 | US FAERS | |
| 626 | Donor leukocyte infusion | FAERS: 1 | US FAERS | |
| 627 | Drug abuse | FAERS: 1 | US FAERS | |
| 628 | Drug administration error | FAERS: 1 | US FAERS | |
| 629 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 630 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 631 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 632 | Dyslexia | FAERS: 1 | US FAERS | |
| 633 | Ear congestion | FAERS: 1 | US FAERS | |
| 634 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 635 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 636 | Enteritis | FAERS: 1 | US FAERS | |
| 637 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 638 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 639 | Enterocolitis | FAERS: 1 | US FAERS | |
| 640 | Enuresis | FAERS: 1 | US FAERS | |
| 641 | Eosinophilia | FAERS: 1 | US FAERS | |
| 642 | Euphoric mood | FAERS: 1 | US FAERS | |
| 643 | Excessive skin | FAERS: 1 | US FAERS | |
| 644 | Excoriation | FAERS: 1 | US FAERS | |
| 645 | Expired product administered | FAERS: 1 | US FAERS | |
| 646 | Extra dose administered | FAERS: 1 | US FAERS | |
| 647 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 648 | Eye allergy | FAERS: 1 | US FAERS | |
| 649 | Facial Paresis | FAERS: 1 | US FAERS | |
| 650 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 651 | Feeling Cold | FAERS: 1 | US FAERS | |
| 652 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 653 | Fibrosis | FAERS: 1 | US FAERS | |
| 654 | Food Poisoning | FAERS: 1 | US FAERS | |
| 655 | Gamma-Glutamyltransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 656 | Gastric infection | FAERS: 1 | US FAERS | |
| 657 | Gastrostomy | FAERS: 1 | US FAERS | |
| 658 | General symptom | FAERS: 1 | US FAERS | |
| 659 | Graft versus host disease in intestine | FAERS: 1 | US FAERS | |
| 660 | Graft versus host disease in lung | FAERS: 1 | US FAERS | |
| 661 | Groin infection | FAERS: 1 | US FAERS | |
| 662 | Growth retardation | FAERS: 1 | US FAERS | |
| 663 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 664 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 665 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 666 | Hepatitis B | FAERS: 1 | US FAERS | |
| 667 | Hepatosplenic candidiasis | FAERS: 1 | US FAERS | |
| 668 | Hernia | FAERS: 1 | US FAERS | |
| 669 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 670 | Human rhinovirus test positive | FAERS: 1 | US FAERS | |
| 671 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 672 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 673 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 674 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 675 | Hypogonadism | FAERS: 1 | US FAERS | |
| 676 | Hypokinesia | FAERS: 1 | US FAERS | |
| 677 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 678 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 679 | Impatience | FAERS: 1 | US FAERS | |
| 680 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 681 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 682 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 683 | Incision site infection | FAERS: 1 | US FAERS | |
| 684 | Incontinence | FAERS: 1 | US FAERS | |
| 685 | Induration | FAERS: 1 | US FAERS | |
| 686 | Infection reactivation | FAERS: 1 | US FAERS | |
| 687 | Infusion site thrombosis | FAERS: 1 | US FAERS | |
| 688 | Injection site pain | FAERS: 1 | US FAERS | |
| 689 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 690 | Keratitis | FAERS: 1 | US FAERS | |
| 691 | Keratorhexis | FAERS: 1 | US FAERS | |
| 692 | Laryngitis | FAERS: 1 | US FAERS | |
| 693 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 694 | Limb girth decreased | FAERS: 1 | US FAERS | |
| 695 | Limb mass | FAERS: 1 | US FAERS | |
| 696 | Lip swelling | FAERS: 1 | US FAERS | |
| 697 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 698 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 699 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 700 | Lower respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 701 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 702 | Lymphocyte percentage increased | FAERS: 1 | US FAERS | |
| 703 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 704 | Malaria | FAERS: 1 | US FAERS | |
| 705 | Mastitis | FAERS: 1 | US FAERS | |
| 706 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 707 | Mesenteric artery stenosis | FAERS: 1 | US FAERS | |
| 708 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 709 | Metastasis | FAERS: 1 | US FAERS | |
| 710 | Middle insomnia | FAERS: 1 | US FAERS | |
| 711 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 712 | Mucormycosis | FAERS: 1 | US FAERS | |
| 713 | Multimorbidity | FAERS: 1 | US FAERS | |
| 714 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 715 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 716 | Myocarditis | FAERS: 1 | US FAERS | |
| 717 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 718 | Necrosis | FAERS: 1 | US FAERS | |
| 719 | Nephrectomy | FAERS: 1 | US FAERS | |
| 720 | Nerve injury | FAERS: 1 | US FAERS | |
| 721 | Neuroma | FAERS: 1 | US FAERS | |
| 722 | Non-high-density lipoprotein cholesterol increased | FAERS: 1 | US FAERS | |
| 723 | Occult blood positive | FAERS: 1 | US FAERS | |
| 724 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 725 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 726 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 727 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 728 | Panniculitis | FAERS: 1 | US FAERS | |
| 729 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 730 | Paternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 731 | Penile burning sensation | FAERS: 1 | US FAERS | |
| 732 | Peripheral artery angioplasty | FAERS: 1 | US FAERS | |
| 733 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 734 | Phlebitis | FAERS: 1 | US FAERS | |
| 735 | Pneumonia moraxella | FAERS: 1 | US FAERS | |
| 736 | Polydipsia | FAERS: 1 | US FAERS | |
| 737 | Poor dental condition | FAERS: 1 | US FAERS | |
| 738 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 739 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 740 | Post procedural infection | FAERS: 1 | US FAERS | |
| 741 | Post stroke seizure | FAERS: 1 | US FAERS | |
| 742 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 743 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 744 | Procedural complication | FAERS: 1 | US FAERS | |
| 745 | Product packaging issue | FAERS: 1 | US FAERS | |
| 746 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 747 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 748 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 749 | Productive Cough | FAERS: 1 | US FAERS | |
| 750 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 751 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 752 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 753 | Pulmonary interstitial emphysema syndrome | FAERS: 1 | US FAERS | |
| 754 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 755 | Pyuria | FAERS: 1 | US FAERS | |
| 756 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 757 | Radiation injury | FAERS: 1 | US FAERS | |
| 758 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 759 | Radiculopathy | FAERS: 1 | US FAERS | |
| 760 | Rash maculovesicular | FAERS: 1 | US FAERS | |
| 761 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 762 | Renal mass | FAERS: 1 | US FAERS | |
| 763 | Renal pain | FAERS: 1 | US FAERS | |
| 764 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 765 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 766 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 767 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 768 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 769 | Right ventricular systolic pressure increased | FAERS: 1 | US FAERS | |
| 770 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 771 | Schistocytosis | FAERS: 1 | US FAERS | |
| 772 | Sensory level abnormal | FAERS: 1 | US FAERS | |
| 773 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 774 | Shock | FAERS: 1 | US FAERS | |
| 775 | Skin tightness | FAERS: 1 | US FAERS | |
| 776 | Snoring | FAERS: 1 | US FAERS | |
| 777 | Spleen palpable | FAERS: 1 | US FAERS | |
| 778 | Splenic abscess | FAERS: 1 | US FAERS | |
| 779 | Spondylitis | FAERS: 1 | US FAERS | |
| 780 | Stenosis | FAERS: 1 | US FAERS | |
| 781 | Suicide attempt | FAERS: 1 | US FAERS | |
| 782 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 783 | Syncope | FAERS: 1 | US FAERS | |
| 784 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 785 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 786 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 787 | Therapy cessation | FAERS: 1 | US FAERS | |
| 788 | Thirst | FAERS: 1 | US FAERS | |
| 789 | Thoracostomy | FAERS: 1 | US FAERS | |
| 790 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 791 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 792 | Thyroplasty | FAERS: 1 | US FAERS | |
| 793 | Tooth Loss | FAERS: 1 | US FAERS | |
| 794 | Tracheomalacia | FAERS: 1 | US FAERS | |
| 795 | Tracheostomy malfunction | FAERS: 1 | US FAERS | |
| 796 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 797 | Transplant evaluation | FAERS: 1 | US FAERS | |
| 798 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 799 | Trismus | FAERS: 1 | US FAERS | |
| 800 | Tuberculosis | FAERS: 1 | US FAERS | |
| 801 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 802 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 803 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 804 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 805 | Vascular resistance systemic increased | FAERS: 1 | US FAERS | |
| 806 | Vascular stent occlusion | FAERS: 1 | US FAERS | |
| 807 | Vascular stent restenosis | FAERS: 1 | US FAERS | |
| 808 | Vascular stent stenosis | FAERS: 1 | US FAERS | |
| 809 | Vasculitis | FAERS: 1 | US FAERS | |
| 810 | Venous stenosis | FAERS: 1 | US FAERS | |
| 811 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 812 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 813 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 814 | Vertebral Artery Stenosis | FAERS: 1 | US FAERS | |
| 815 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 816 | Vulvovaginal adhesion | FAERS: 1 | US FAERS | |
| 817 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 818 | White matter lesion | FAERS: 1 | US FAERS | |
| 819 | Wrong dose | FAERS: 1 | US FAERS | |
| 820 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 821 | Xerosis | FAERS: 1 | US FAERS | |
| 822 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 823 | kyphosis | FAERS: 1 | US FAERS | |
| 824 | prostatitis | FAERS: 1 | US FAERS | |
| 825 | Amylase decreased | SIDER | ||
| 826 | Atrial Flutter | SIDER | ||
| 827 | Blood amylase increased | SIDER | ||
| 828 | Blood and lymphatic system disorders | SIDER | ||
| 829 | Blood phosphorus decreased | SIDER | ||
| 830 | Ca++ increased | SIDER | ||
| 831 | Calcium low | SIDER | ||
| 832 | Cardiac discomfort | SIDER | ||
| 833 | Creatinine increased | SIDER | ||
| 834 | Glucose decreased | SIDER | ||
| 835 | Glucose increased | SIDER | ||
| 836 | Heart failure | 25304212 | CTD | |
| 837 | Infestation | SIDER | ||
| 838 | Lymphopenia | SIDER | ||
| 839 | Myelosuppression | SIDER | ||
| 840 | Neoplasms, Experimental | CTD | ||
| 841 | Neuropathy | SIDER | ||
| 842 | Ocular Toxicity | SIDER | ||
| 843 | Phosphorus low | SIDER | ||
| 844 | Potassium increased | SIDER | ||
| 845 | Potassium low | SIDER | ||
| 846 | Prurigo | SIDER | ||
| 847 | Sodium decreased | SIDER | ||
| 848 | Sodium high | SIDER | ||
| 849 | Venous Thromboembolism | SIDER | ||
| 850 | effusion | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.