Cetirizine
(PGLIUCLTXOYQMV-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)COCCN1CCN(CC1)C(c1ccc(cc1)Cl)c1ccccc1.Cl.Cl
- Molecular Formula:
- C21H27Cl3N2O3
- Molecular Weight:
- 461.810
- Log P:
- 4.6280
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 53.01
- CAS Number(s):
- 83881-52-1
Synonym(s)
1.
Cetirizine
2.
(2-(4-((4-Chlorophenyl)phenylmethyl)-1-piperazinyl)ethoxy)acetic Acid
3.
Alerlisin
4.
Cetalerg
5.
Ceterifug
6.
Ceti TAD
7.
Ceti-Puren
8.
CetiLich
9.
Cetiderm
10.
Cetidura
11.
Cetil von ct
12.
Cetirigamma
13.
Cetirizin AL
14.
Cetirizin AZU
15.
Cetirizin Basics
16.
Cetirizine Dihydrochloride
17.
Cetirlan
18.
P-071
19.
Reactine
20.
Virlix
21.
Voltric
22.
Zetir
23.
Zirtek
24.
Zyrtec
25.
Dihydrochloride, Cetirizine
26.
P 071
27.
P071
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 1561 Canada Vigilance: 70 | Canada Vigilance US FAERS | |
| 2 | Somnolence | FAERS: 866 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 3 | Product use issue | FAERS: 767 | US FAERS | |
| 4 | Therapeutic response unexpected | FAERS: 677 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Pruritus | FAERS: 628 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 6 | Product use in unapproved indication | FAERS: 548 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Product quality issue | FAERS: 391 | US FAERS | |
| 8 | Overdose | FAERS: 383 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Incorrect dose administered | FAERS: 335 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Fatigue | FAERS: 330 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 11 | Expired product administered | FAERS: 318 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Urticaria | FAERS: 310 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 13 | Drug ineffective for unapproved indication | FAERS: 250 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Feeling abnormal | FAERS: 245 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Dizziness | FAERS: 226 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 16 | Extra dose administered | FAERS: 215 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Accidental overdose | FAERS: 202 | US FAERS | |
| 18 | Drug effect incomplete | FAERS: 182 | US FAERS | |
| 19 | Wrong technique in product usage process | FAERS: 180 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Headache | FAERS: 179 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 21 | Wrong patient received medication | FAERS: 157 | US FAERS | |
| 22 | Hypersensitivity | FAERS: 149 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 23 | Drug withdrawal syndrome | FAERS: 141 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Malaise | FAERS: 135 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 25 | Drug administration error | FAERS: 131 | US FAERS | |
| 26 | Nausea | FAERS: 126 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 27 | Drug administered to patient of inappropriate age | FAERS: 116 | US FAERS | |
| 28 | Wrong drug administered | FAERS: 105 | US FAERS | |
| 29 | Vomiting | FAERS: 97 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 30 | Inappropriate schedule of drug administration | FAERS: 94 | US FAERS | |
| 31 | Product packaging issue | FAERS: 84 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Drug Dependence | FAERS: 82 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 33 | Drug exposure during pregnancy | FAERS: 82 | US FAERS | |
| 34 | Accidental exposure to product | FAERS: 80 | US FAERS | |
| 35 | Product label issue | FAERS: 75 | US FAERS | |
| 36 | Pain | FAERS: 74 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Palpitations | FAERS: 74 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 38 | Adverse event | FAERS: 73 | US FAERS | |
| 39 | Anxiety | FAERS: 62 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 40 | Dysgeusia | FAERS: 59 | US FAERS | |
| 41 | Hypersomnia | FAERS: 56 | US FAERS | |
| 42 | Asthenia | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Epistaxis | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Anger | FAERS: 48 | US FAERS | |
| 45 | Product physical issue | FAERS: 47 | US FAERS | |
| 46 | Drug prescribing error | FAERS: 40 | US FAERS | |
| 47 | No adverse event | FAERS: 40 | US FAERS | |
| 48 | Burning sensation | FAERS: 39 | US FAERS | |
| 49 | Intentional product misuse | FAERS: 39 | US FAERS | |
| 50 | Mood swings | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 51 | Tremor | FAERS: 38 | US FAERS | |
| 52 | Sneezing | FAERS: 37 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 53 | Agitation | FAERS: 36 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 54 | Lethargy | FAERS: 36 | US FAERS | |
| 55 | Abdominal discomfort | FAERS: 35 | US FAERS | |
| 56 | Abdominal Pain | FAERS: 34 | US FAERS | |
| 57 | Crying | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Oropharyngeal pain | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Erythema | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 60 | Medication Error | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Throat irritation | FAERS: 31 | US FAERS | |
| 62 | Accidental exposure to product by child | FAERS: 30 | US FAERS | |
| 63 | Incorrect drug administration duration | FAERS: 30 | US FAERS | |
| 64 | Activities of daily living impaired | FAERS: 29 | US FAERS | |
| 65 | Personality Change | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Product substitution issue | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Syncope | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Asthma | FAERS: 28 | US FAERS | |
| 69 | Arthralgia | FAERS: 27 | US FAERS | |
| 70 | Depressed mood | FAERS: 26 | US FAERS | |
| 71 | Angioedema | FAERS: 25 | US FAERS | |
| 72 | Chest Pain | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 73 | Intentional product use issue | FAERS: 25 | US FAERS | |
| 74 | Constipation | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Hepatitis | FAERS: 24 | US FAERS | |
| 76 | Product administered to patient of inappropriate age | FAERS: 24 | US FAERS | |
| 77 | Amnesia | FAERS: 23 | US FAERS | |
| 78 | Discomfort | FAERS: 23 | US FAERS | |
| 79 | Dyspepsia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Prescribed overdose | FAERS: 23 | US FAERS | |
| 81 | Swelling | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Dehydration | FAERS: 22 | US FAERS | |
| 83 | Hepatotoxicity | FAERS: 22 | US FAERS | |
| 84 | Vertigo | FAERS: 22 | US FAERS | |
| 85 | Alopecia | FAERS: 21 | US FAERS | |
| 86 | Dysuria | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Lip swelling | FAERS: 21 | US FAERS | |
| 88 | Product package associated injury | FAERS: 21 | US FAERS | |
| 89 | Chest discomfort | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 90 | Dysphonia | FAERS: 20 | US FAERS | |
| 91 | Euphoric mood | FAERS: 20 | US FAERS | |
| 92 | Feeling jittery | FAERS: 20 | US FAERS | |
| 93 | Dependence | FAERS: 19 | US FAERS | |
| 94 | Pharmaceutical product complaint | FAERS: 19 | US FAERS | |
| 95 | Product closure removal difficult | FAERS: 19 | US FAERS | |
| 96 | Therapeutic product effect incomplete | FAERS: 19 | US FAERS | |
| 97 | Anaphylactic shock | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 98 | Disorientation | FAERS: 18 | US FAERS | |
| 99 | Dystonia | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Product container issue | FAERS: 18 | US FAERS | |
| 101 | Product taste abnormal | FAERS: 18 | US FAERS | |
| 102 | Thirst | FAERS: 18 | US FAERS | |
| 103 | Drug dose omission | FAERS: 17 | US FAERS | |
| 104 | Myalgia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Nervousness | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Blood glucose increased | FAERS: 16 | US FAERS | |
| 107 | Dry skin | FAERS: 16 | US FAERS | |
| 108 | Loss of personal independence in daily activities | FAERS: 16 | US FAERS | |
| 109 | Retching | FAERS: 16 | US FAERS | |
| 110 | Tinnitus | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 111 | Unevaluable event | FAERS: 16 | US FAERS | |
| 112 | Eye pain | FAERS: 15 | US FAERS | |
| 113 | Formication | FAERS: 15 | US FAERS | |
| 114 | Weight decreased | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Myasthenia Gravis | FAERS: 14 | US FAERS | |
| 116 | Screaming | FAERS: 14 | US FAERS | |
| 117 | Alanine Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 118 | Cholestasis | FAERS: 13 | US FAERS | |
| 119 | Chromaturia | FAERS: 13 | US FAERS | |
| 120 | Eye irritation | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 121 | Product lot number issue | FAERS: 13 | US FAERS | |
| 122 | Restlessness | FAERS: 13 | US FAERS | |
| 123 | Therapeutic response delayed | FAERS: 13 | US FAERS | |
| 124 | Ageusia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Anosmia | FAERS: 12 | US FAERS | |
| 126 | Atrial Fibrillation | FAERS: 12 | US FAERS | |
| 127 | Back Pain | FAERS: 12 | US FAERS | |
| 128 | Emotional disorder | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Musculoskeletal stiffness | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Peripheral swelling | FAERS: 12 | US FAERS | |
| 131 | Product contamination | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Product expiration date issue | FAERS: 12 | US FAERS | |
| 133 | Sluggishness | FAERS: 12 | US FAERS | |
| 134 | Urinary Retention | FAERS: 12 | US FAERS | |
| 135 | Visual Impairment | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Aspartate Aminotransferase Increased | FAERS: 11 | US FAERS | |
| 137 | Drug dispensing error | FAERS: 11 | US FAERS | |
| 138 | Impaired work ability | FAERS: 11 | US FAERS | |
| 139 | Pallor | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Product formulation issue | FAERS: 11 | US FAERS | |
| 141 | Tachycardia | FAERS: 11 | US FAERS | |
| 142 | Wheezing | FAERS: 11 | US FAERS | |
| 143 | Deafness | FAERS: 10 | US FAERS | |
| 144 | Drug effect delayed | FAERS: 10 | US FAERS | |
| 145 | Drug effective for unapproved indication | FAERS: 10 | US FAERS | |
| 146 | Dysarthria | FAERS: 10 | US FAERS | |
| 147 | Exposure during breast feeding | FAERS: 10 | US FAERS | |
| 148 | Incorrect route of drug administration | FAERS: 10 | US FAERS | |
| 149 | Oral pruritus | FAERS: 10 | US FAERS | |
| 150 | Suspected counterfeit product | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Accidental exposure | FAERS: 9 | US FAERS | |
| 152 | Chills | FAERS: 9 | US FAERS | |
| 153 | Eczema | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Epilepsy | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 155 | Flushing | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 156 | Gamma-Glutamyltransferase Increased | FAERS: 9 | US FAERS | |
| 157 | Impaired driving ability | FAERS: 9 | US FAERS | |
| 158 | Laceration | FAERS: 9 | US FAERS | |
| 159 | Memory impairment | FAERS: 9 | US FAERS | |
| 160 | Nasopharyngitis | FAERS: 9 | US FAERS | |
| 161 | Poor quality drug administered | FAERS: 9 | US FAERS | |
| 162 | Product use complaint | FAERS: 9 | US FAERS | |
| 163 | Rebound effect | FAERS: 9 | US FAERS | |
| 164 | Sopor | FAERS: 9 | US FAERS | |
| 165 | jaundice | FAERS: 9 | US FAERS | |
| 166 | Blood alkaline phosphatase increased | FAERS: 8 | US FAERS | |
| 167 | Bronchitis | FAERS: 8 | US FAERS | |
| 168 | Cerebrovascular accident | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Flatulence | FAERS: 8 | US FAERS | |
| 170 | Product blister packaging issue | FAERS: 8 | US FAERS | |
| 171 | Tooth Erosion | FAERS: 8 | US FAERS | |
| 172 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 173 | Acne | FAERS: 7 | US FAERS | |
| 174 | Aphasia | FAERS: 7 | US FAERS | |
| 175 | Choking | FAERS: 7 | US FAERS | |
| 176 | Diplopia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Drug Tolerance | FAERS: 7 | US FAERS | |
| 178 | Hunger | FAERS: 7 | US FAERS | |
| 179 | Infection | FAERS: 7 | US FAERS | |
| 180 | Maternal exposure during pregnancy | FAERS: 7 | US FAERS | |
| 181 | Musculoskeletal Pain | FAERS: 7 | US FAERS | |
| 182 | Paranoia | FAERS: 7 | US FAERS | |
| 183 | Poor quality sleep | FAERS: 7 | US FAERS | |
| 184 | Pregnancy | FAERS: 7 | US FAERS | |
| 185 | Product administration error | FAERS: 7 | US FAERS | |
| 186 | Product packaging quantity issue | FAERS: 7 | US FAERS | |
| 187 | Rash erythematous | FAERS: 7 | US FAERS | |
| 188 | Reaction to excipient | FAERS: 7 | US FAERS | |
| 189 | Sinusitis | FAERS: 7 | US FAERS | |
| 190 | Unintentional use for unapproved indication | FAERS: 7 | US FAERS | |
| 191 | Unresponsive to stimuli | FAERS: 7 | US FAERS | |
| 192 | Ventricular Fibrillation | FAERS: 7 | US FAERS | |
| 193 | nervous system disorder | FAERS: 7 | US FAERS | |
| 194 | Drug effect variable | FAERS: 6 | US FAERS | |
| 195 | Expired drug administered | FAERS: 6 | US FAERS | |
| 196 | Facial Paresis | FAERS: 6 | US FAERS | |
| 197 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 6 | US FAERS | |
| 198 | Hepatic necrosis | FAERS: 6 | US FAERS | |
| 199 | Hyperventilation | FAERS: 6 | US FAERS | |
| 200 | Middle insomnia | FAERS: 6 | US FAERS | |
| 201 | Multiple allergies | FAERS: 6 | US FAERS | |
| 202 | Skin irritation | FAERS: 6 | US FAERS | |
| 203 | Sunburn | FAERS: 6 | US FAERS | |
| 204 | Therapy cessation | FAERS: 6 | US FAERS | |
| 205 | Thrombocytopenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | White blood cell count decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 207 | Abasia | FAERS: 5 | US FAERS | |
| 208 | Allergic reaction to excipient | FAERS: 5 | US FAERS | |
| 209 | Aphonia | FAERS: 5 | US FAERS | |
| 210 | Blindness | FAERS: 5 | US FAERS | |
| 211 | Bone pain | FAERS: 5 | US FAERS | |
| 212 | Drug screen positive | FAERS: 5 | US FAERS | |
| 213 | Growth retardation | FAERS: 5 | US FAERS | |
| 214 | Hallucinations, mixed | FAERS: 5 | US FAERS | |
| 215 | Hepatomegaly | FAERS: 5 | US FAERS | |
| 216 | Hypokinesia | FAERS: 5 | US FAERS | |
| 217 | Hypotension | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 218 | Laryngitis | FAERS: 5 | US FAERS | |
| 219 | Nasal discomfort | FAERS: 5 | US FAERS | |
| 220 | Performance status decreased | FAERS: 5 | US FAERS | |
| 221 | Product outer packaging issue | FAERS: 5 | US FAERS | |
| 222 | Productive Cough | FAERS: 5 | US FAERS | |
| 223 | Reaction to drug excipients | FAERS: 5 | US FAERS | |
| 224 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 225 | Skin laceration | FAERS: 5 | US FAERS | |
| 226 | Sudden infant death syndrome | FAERS: 5 | US FAERS | |
| 227 | Suicide attempt | FAERS: 5 | US FAERS | |
| 228 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 229 | Visual disturbance | FAERS: 5 | US FAERS | |
| 230 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 231 | Asthenopia | FAERS: 4 | US FAERS | |
| 232 | Blood urine present | FAERS: 4 | US FAERS | |
| 233 | Bradycardia | FAERS: 4 | US FAERS | |
| 234 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 235 | Completed Suicide | FAERS: 4 | US FAERS | |
| 236 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 237 | Documented hypersensitivity to administered drug | FAERS: 4 | US FAERS | |
| 238 | Drug toxicity | FAERS: 4 | US FAERS | |
| 239 | Dysphemia | FAERS: 4 | US FAERS | |
| 240 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 241 | Erythema Multiforme | FAERS: 4 | US FAERS | |
| 242 | False positive investigation result | FAERS: 4 | US FAERS | |
| 243 | Gastritis | FAERS: 4 | US FAERS | |
| 244 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 245 | Glaucoma | FAERS: 4 | US FAERS | |
| 246 | Head discomfort | FAERS: 4 | US FAERS | |
| 247 | Hypospadias | FAERS: 4 | US FAERS | |
| 248 | Incontinence | FAERS: 4 | US FAERS | |
| 249 | Lack of spontaneous speech | FAERS: 4 | US FAERS | |
| 250 | Limb discomfort | FAERS: 4 | US FAERS | |
| 251 | Medical diet | FAERS: 4 | US FAERS | |
| 252 | Metrorrhagia | FAERS: 4 | US FAERS | |
| 253 | Micropenis | FAERS: 4 | US FAERS | |
| 254 | Neck Pain | FAERS: 4 | US FAERS | |
| 255 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 256 | Onychoclasis | FAERS: 4 | US FAERS | |
| 257 | Pain of skin | FAERS: 4 | US FAERS | |
| 258 | Product measured potency issue | FAERS: 4 | US FAERS | |
| 259 | Product tampering | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Product used for unknown indication | FAERS: 4 | US FAERS | |
| 261 | Sinus headache | FAERS: 4 | US FAERS | |
| 262 | Skin reaction | FAERS: 4 | US FAERS | |
| 263 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 264 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 265 | Underweight | FAERS: 4 | US FAERS | |
| 266 | Upper-airway cough syndrome | FAERS: 4 | US FAERS | |
| 267 | Violence-related symptom | FAERS: 4 | US FAERS | |
| 268 | Alcohol interaction | FAERS: 3 | US FAERS | |
| 269 | Alopecia totalis | FAERS: 3 | US FAERS | |
| 270 | Anorexia | FAERS: 3 | US FAERS | |
| 271 | Apathy | FAERS: 3 | US FAERS | |
| 272 | Arthritis | FAERS: 3 | US FAERS | |
| 273 | Ataxia | FAERS: 3 | US FAERS | |
| 274 | Bilirubin conjugated increased | FAERS: 3 | US FAERS | |
| 275 | Blepharitis | FAERS: 3 | US FAERS | |
| 276 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 277 | Blood urea increased | FAERS: 3 | US FAERS | |
| 278 | Bronchospasm | FAERS: 3 | US FAERS | |
| 279 | Cold sweat | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Dermatitis | FAERS: 3 | US FAERS | |
| 281 | Drug exposure via breast milk | FAERS: 3 | US FAERS | |
| 282 | Drug resistance | FAERS: 3 | US FAERS | |
| 283 | Ear discomfort | FAERS: 3 | US FAERS | |
| 284 | Emotional distress | FAERS: 3 | US FAERS | |
| 285 | Eye Infection | FAERS: 3 | US FAERS | |
| 286 | Eye inflammation | FAERS: 3 | US FAERS | |
| 287 | Facial Pain | FAERS: 3 | US FAERS | |
| 288 | Feelings of worthlessness | FAERS: 3 | US FAERS | |
| 289 | Food Allergy | FAERS: 3 | US FAERS | |
| 290 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 291 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 292 | Inappropriate schedule of product administration | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 293 | Incoherent | FAERS: 3 | US FAERS | |
| 294 | Increased upper airway secretion | FAERS: 3 | US FAERS | |
| 295 | Inflammation | FAERS: 3 | US FAERS | |
| 296 | Initial insomnia | FAERS: 3 | US FAERS | |
| 297 | Joint stiffness | FAERS: 3 | US FAERS | |
| 298 | Joint swelling | FAERS: 3 | US FAERS | |
| 299 | Leukopenia | FAERS: 3 | US FAERS | |
| 300 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 301 | Mechanical urticaria | FAERS: 3 | US FAERS | |
| 302 | Menorrhagia | FAERS: 3 | US FAERS | |
| 303 | Miliaria | FAERS: 3 | US FAERS | |
| 304 | Mouth swelling | FAERS: 3 | US FAERS | |
| 305 | Nephrolithiasis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 306 | Obsessive-Compulsive Disorder | FAERS: 3 | US FAERS | |
| 307 | Ocular icterus | FAERS: 3 | US FAERS | |
| 308 | Oculogyric crisis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Oppositional Defiant Disorder | FAERS: 3 | US FAERS | |
| 310 | Oral pain | FAERS: 3 | US FAERS | |
| 311 | Papule | FAERS: 3 | US FAERS | |
| 312 | Pharyngitis | FAERS: 3 | US FAERS | |
| 313 | Physical product label issue | FAERS: 3 | US FAERS | |
| 314 | Pneumonia | FAERS: 3 | US FAERS | |
| 315 | Product contamination physical | FAERS: 3 | US FAERS | |
| 316 | Psoriasis | FAERS: 3 | US FAERS | |
| 317 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 318 | Rhinalgia | FAERS: 3 | US FAERS | |
| 319 | Rhinitis | FAERS: 3 | US FAERS | |
| 320 | Shock | FAERS: 3 | US FAERS | |
| 321 | Somnambulism | FAERS: 3 | US FAERS | |
| 322 | Stomatitis | FAERS: 3 | US FAERS | |
| 323 | Tension Headache | FAERS: 3 | US FAERS | |
| 324 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 325 | Toothache | FAERS: 3 | US FAERS | |
| 326 | Torticollis | FAERS: 3 | US FAERS | |
| 327 | Abnormal sleep-related event | FAERS: 2 | US FAERS | |
| 328 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 329 | Amphetamines positive | FAERS: 2 | US FAERS | |
| 330 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 331 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 332 | Anticholinergic Syndrome | FAERS: 2 | US FAERS | |
| 333 | Ascites | FAERS: 2 | US FAERS | |
| 334 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 335 | Autoantibody positive | FAERS: 2 | US FAERS | |
| 336 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 337 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 338 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 339 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 340 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 341 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 342 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 343 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 344 | Cellulitis | FAERS: 2 | US FAERS | |
| 345 | Cerebral dysgenesis | FAERS: 2 | US FAERS | |
| 346 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 347 | Congenital inguinal hernia | FAERS: 2 | US FAERS | |
| 348 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 349 | Cyst | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 351 | Deja Vu | FAERS: 2 | US FAERS | |
| 352 | Delirium | FAERS: 2 | US FAERS | |
| 353 | Dental caries | FAERS: 2 | US FAERS | |
| 354 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 355 | Disability | FAERS: 2 | US FAERS | |
| 356 | Drooling | FAERS: 2 | US FAERS | |
| 357 | Drug abuse | FAERS: 2 | US FAERS | |
| 358 | Drug administered in wrong device | FAERS: 2 | US FAERS | |
| 359 | Ear congestion | FAERS: 2 | US FAERS | |
| 360 | Echolalia | FAERS: 2 | US FAERS | |
| 361 | Economic problem | FAERS: 2 | US FAERS | |
| 362 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 363 | Eosinophilia | FAERS: 2 | US FAERS | |
| 364 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 365 | Exposure to unspecified agent | FAERS: 2 | US FAERS | |
| 366 | Eyelid exfoliation | FAERS: 2 | US FAERS | |
| 367 | Feeling Cold | FAERS: 2 | US FAERS | |
| 368 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 369 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 370 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 371 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 372 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 373 | Homosexuality | FAERS: 2 | US FAERS | |
| 374 | Hyperacusis | FAERS: 2 | US FAERS | |
| 375 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 376 | Hypervigilance | FAERS: 2 | US FAERS | |
| 377 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 378 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 379 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 380 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 381 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 382 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 383 | Influenza | FAERS: 2 | US FAERS | |
| 384 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 385 | Intussusception | FAERS: 2 | US FAERS | |
| 386 | Joint injury | FAERS: 2 | US FAERS | |
| 387 | Lipase increased | FAERS: 2 | US FAERS | |
| 388 | Lung hyperinflation | FAERS: 2 | US FAERS | |
| 389 | Lymphocyte stimulation test positive | FAERS: 2 | US FAERS | |
| 390 | Macule | FAERS: 2 | US FAERS | |
| 391 | Markedly reduced dietary intake | FAERS: 2 | US FAERS | |
| 392 | Mental impairment | FAERS: 2 | US FAERS | |
| 393 | Milk Allergy | FAERS: 2 | US FAERS | |
| 394 | Multiple drug overdose intentional | FAERS: 2 | US FAERS | |
| 395 | Myocardial Infarction | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 396 | Nasal Flaring | FAERS: 2 | US FAERS | |
| 397 | Nasal Polyps | FAERS: 2 | US FAERS | |
| 398 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 399 | Nasal pruritus | FAERS: 2 | US FAERS | |
| 400 | Neuralgia | FAERS: 2 | US FAERS | |
| 401 | Night sweats | FAERS: 2 | US FAERS | |
| 402 | Nocturia | FAERS: 2 | US FAERS | |
| 403 | Osteoporosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 404 | Otitis Media | FAERS: 2 | US FAERS | |
| 405 | Packaging design issue | FAERS: 2 | US FAERS | |
| 406 | Pancreatitis | FAERS: 2 | US FAERS | |
| 407 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 408 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 409 | Presyncope | FAERS: 2 | US FAERS | |
| 410 | Product container seal issue | FAERS: 2 | US FAERS | |
| 411 | Product storage error | FAERS: 2 | US FAERS | |
| 412 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 413 | Renal pain | FAERS: 2 | US FAERS | |
| 414 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 415 | Respiratory distress | FAERS: 2 | US FAERS | |
| 416 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 417 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 418 | Schizophrenia | FAERS: 2 | US FAERS | |
| 419 | Sensitive skin | FAERS: 2 | US FAERS | |
| 420 | Serum Sickness | FAERS: 2 | US FAERS | |
| 421 | Sight disability | FAERS: 2 | US FAERS | |
| 422 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 423 | Skin lesion | FAERS: 2 | US FAERS | |
| 424 | Spermatozoa progressive motility decreased | FAERS: 2 | US FAERS | |
| 425 | Splenomegaly | FAERS: 2 | US FAERS | |
| 426 | Stasis dermatitis | FAERS: 2 | US FAERS | |
| 427 | Stress | FAERS: 2 | US FAERS | |
| 428 | Sudden onset of sleep | FAERS: 2 | US FAERS | |
| 429 | Suspected product tampering | FAERS: 2 | US FAERS | |
| 430 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 431 | Transaminases increased | FAERS: 2 | US FAERS | |
| 432 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 433 | Vasculitis | FAERS: 2 | US FAERS | |
| 434 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 435 | Viral upper respiratory tract infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 436 | Wrong product administered | FAERS: 2 | US FAERS | |
| 437 | treatment failure | FAERS: 2 | US FAERS | |
| 438 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 439 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 440 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 441 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 442 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 443 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 444 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 445 | Alopecia universalis | FAERS: 1 | US FAERS | |
| 446 | Amniocentesis | FAERS: 1 | US FAERS | |
| 447 | Anencephaly | FAERS: 1 | US FAERS | |
| 448 | Anhedonia | FAERS: 1 | US FAERS | |
| 449 | Anhidrosis | FAERS: 1 | US FAERS | |
| 450 | Antiacetylcholine receptor antibody positive | FAERS: 1 | US FAERS | |
| 451 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 452 | Anuria | FAERS: 1 | US FAERS | |
| 453 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 454 | Apparent death | FAERS: 1 | US FAERS | |
| 455 | Application site rash | FAERS: 1 | US FAERS | |
| 456 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 457 | Asphyxia | FAERS: 1 | US FAERS | |
| 458 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 459 | Aura | FAERS: 1 | US FAERS | |
| 460 | Back disorder | FAERS: 1 | US FAERS | |
| 461 | Bile output abnormal | FAERS: 1 | US FAERS | |
| 462 | Biopsy kidney abnormal | FAERS: 1 | US FAERS | |
| 463 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 464 | Bladder pain | FAERS: 1 | US FAERS | |
| 465 | Blepharospasm | FAERS: 1 | US FAERS | |
| 466 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 467 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 468 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 469 | Blood chromogranin A increased | FAERS: 1 | US FAERS | |
| 470 | Blood creatine decreased | FAERS: 1 | US FAERS | |
| 471 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 472 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 473 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 474 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 475 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 476 | Boredom | FAERS: 1 | US FAERS | |
| 477 | Botulism | FAERS: 1 | US FAERS | |
| 478 | Breast engorgement | FAERS: 1 | US FAERS | |
| 479 | Breast tenderness | FAERS: 1 | US FAERS | |
| 480 | Bruxism | FAERS: 1 | US FAERS | |
| 481 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 482 | Cataract | FAERS: 1 | US FAERS | |
| 483 | Catatonia | FAERS: 1 | US FAERS | |
| 484 | Cheilitis | FAERS: 1 | US FAERS | |
| 485 | Childhood psychosis | FAERS: 1 | US FAERS | |
| 486 | Cleft Palate | FAERS: 1 | US FAERS | |
| 487 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 488 | Coating in mouth | FAERS: 1 | US FAERS | |
| 489 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 490 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 491 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 492 | Conversion disorder | FAERS: 1 | US FAERS | |
| 493 | Convulsion in childhood | FAERS: 1 | US FAERS | |
| 494 | Croup infectious | FAERS: 1 | US FAERS | |
| 495 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 496 | Deficiency of bile secretion | FAERS: 1 | US FAERS | |
| 497 | Depression suicidal | FAERS: 1 | US FAERS | |
| 498 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 499 | Diet refusal | FAERS: 1 | US FAERS | |
| 500 | Drug name confusion | FAERS: 1 | US FAERS | |
| 501 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 502 | Dwarfism | FAERS: 1 | US FAERS | |
| 503 | Dyschezia | FAERS: 1 | US FAERS | |
| 504 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 505 | Educational problem | FAERS: 1 | US FAERS | |
| 506 | Electrocardiogram U-wave abnormality | FAERS: 1 | US FAERS | |
| 507 | Encephalitis | FAERS: 1 | US FAERS | |
| 508 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 509 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 510 | Epidermolysis | FAERS: 1 | US FAERS | |
| 511 | Epididymitis | FAERS: 1 | US FAERS | |
| 512 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 513 | Erection increased | FAERS: 1 | US FAERS | |
| 514 | Eructation | FAERS: 1 | US FAERS | |
| 515 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 516 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 517 | Exophthalmos | FAERS: 1 | US FAERS | |
| 518 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 519 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 520 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 521 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 522 | Fight in school | FAERS: 1 | US FAERS | |
| 523 | Fine motor delay | FAERS: 1 | US FAERS | |
| 524 | Fixed eruption | FAERS: 1 | US FAERS | |
| 525 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 526 | Food aversion | FAERS: 1 | US FAERS | |
| 527 | Food craving | FAERS: 1 | US FAERS | |
| 528 | Frustration | FAERS: 1 | US FAERS | |
| 529 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 530 | Gastric hypertonia | FAERS: 1 | US FAERS | |
| 531 | Gastric hypomotility | FAERS: 1 | US FAERS | |
| 532 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 533 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 534 | Genital rash | FAERS: 1 | US FAERS | |
| 535 | Global Amnesia | FAERS: 1 | US FAERS | |
| 536 | Head titubation | FAERS: 1 | US FAERS | |
| 537 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 538 | Hemiplegia | FAERS: 1 | US FAERS | |
| 539 | Hepatitis B surface antibody positive | FAERS: 1 | US FAERS | |
| 540 | Hip surgery | FAERS: 1 | US FAERS | |
| 541 | Histamine level increased | FAERS: 1 | US FAERS | |
| 542 | Hostility | FAERS: 1 | US FAERS | |
| 543 | Hypercholia | FAERS: 1 | US FAERS | |
| 544 | Hyperphagia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 545 | Hypophagia | FAERS: 1 | US FAERS | |
| 546 | Ileus | FAERS: 1 | US FAERS | |
| 547 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 548 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 549 | Impaired reasoning | FAERS: 1 | US FAERS | |
| 550 | Impatience | FAERS: 1 | US FAERS | |
| 551 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 552 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 553 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 554 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 555 | Infantile spitting up | FAERS: 1 | US FAERS | |
| 556 | Infertility | FAERS: 1 | US FAERS | |
| 557 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 558 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 559 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 560 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 561 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 562 | Laziness | FAERS: 1 | US FAERS | |
| 563 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 564 | Limb injury | FAERS: 1 | US FAERS | |
| 565 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 566 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 567 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 568 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 569 | Macular degeneration | FAERS: 1 | US FAERS | |
| 570 | Malabsorption | FAERS: 1 | US FAERS | |
| 571 | Medication residue present | FAERS: 1 | US FAERS | |
| 572 | Mental status changes | FAERS: 1 | US FAERS | |
| 573 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 574 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 575 | Moaning | FAERS: 1 | US FAERS | |
| 576 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 577 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 578 | Muscle strain | FAERS: 1 | US FAERS | |
| 579 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 580 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 581 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 582 | Mydriasis | FAERS: 1 | US FAERS | |
| 583 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 584 | Myoclonus | FAERS: 1 | US FAERS | |
| 585 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 586 | Nasal turbinate abnormality | FAERS: 1 | US FAERS | |
| 587 | Nephritis allergic | FAERS: 1 | US FAERS | |
| 588 | Neuritis | FAERS: 1 | US FAERS | |
| 589 | Neutropenia | FAERS: 1 | US FAERS | |
| 590 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 591 | No adverse effect | FAERS: 1 | US FAERS | |
| 592 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 593 | Obesity | FAERS: 1 | US FAERS | |
| 594 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 595 | Opisthotonus | FAERS: 1 | US FAERS | |
| 596 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 597 | Oral infection | FAERS: 1 | US FAERS | |
| 598 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 599 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 600 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 601 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 602 | Ototoxicity | FAERS: 1 | US FAERS | |
| 603 | Palpable purpura | FAERS: 1 | US FAERS | |
| 604 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 605 | Penile size reduced | FAERS: 1 | US FAERS | |
| 606 | Penile swelling | FAERS: 1 | US FAERS | |
| 607 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 608 | Petechiae | FAERS: 1 | US FAERS | |
| 609 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 610 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 611 | Photophobia | FAERS: 1 | US FAERS | |
| 612 | Physical disability | FAERS: 1 | US FAERS | |
| 613 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 614 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 615 | Polyuria | FAERS: 1 | US FAERS | |
| 616 | Product commingling | FAERS: 1 | US FAERS | |
| 617 | Product complaint | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 618 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 619 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 620 | Product dispensing error | FAERS: 1 | US FAERS | |
| 621 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 622 | Product dose omission | FAERS: 1 | US FAERS | |
| 623 | Product leakage | FAERS: 1 | US FAERS | |
| 624 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 625 | Product shape issue | FAERS: 1 | US FAERS | |
| 626 | Product size issue | FAERS: 1 | US FAERS | |
| 627 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 628 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 629 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 630 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 631 | Purpura | FAERS: 1 | US FAERS | |
| 632 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 633 | Relaxation Therapy | FAERS: 1 | US FAERS | |
| 634 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 635 | Renal Colic | FAERS: 1 | US FAERS | |
| 636 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 637 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 638 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 639 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 640 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 641 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 642 | Rosacea | FAERS: 1 | US FAERS | |
| 643 | Saliva altered | FAERS: 1 | US FAERS | |
| 644 | Secretion discharge | FAERS: 1 | US FAERS | |
| 645 | Sedation complication | FAERS: 1 | US FAERS | |
| 646 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 647 | Sense of oppression | FAERS: 1 | US FAERS | |
| 648 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 649 | Sinonasal obstruction | FAERS: 1 | US FAERS | |
| 650 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 651 | Sinus perforation | FAERS: 1 | US FAERS | |
| 652 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 653 | Skin test negative | FAERS: 1 | US FAERS | |
| 654 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 655 | Skin tightness | FAERS: 1 | US FAERS | |
| 656 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 657 | Snoring | FAERS: 1 | US FAERS | |
| 658 | Spina Bifida | FAERS: 1 | US FAERS | |
| 659 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 660 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 661 | Stereotypic Movement Disorder | FAERS: 1 | US FAERS | |
| 662 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 663 | Stillbirth | FAERS: 1 | US FAERS | |
| 664 | Stupor | FAERS: 1 | US FAERS | |
| 665 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 666 | Talipes | FAERS: 1 | US FAERS | |
| 667 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 668 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 669 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 670 | Therapy change | FAERS: 1 | US FAERS | |
| 671 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 672 | Thought insertion | FAERS: 1 | US FAERS | |
| 673 | Throat cancer | FAERS: 1 | US FAERS | |
| 674 | Throat clearing | FAERS: 1 | US FAERS | |
| 675 | Thymus enlargement | FAERS: 1 | US FAERS | |
| 676 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 677 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 678 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 679 | Trismus | FAERS: 1 | US FAERS | |
| 680 | Ultrasound liver abnormal | FAERS: 1 | US FAERS | |
| 681 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 682 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 683 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 684 | Urine output increased | FAERS: 1 | US FAERS | |
| 685 | Urobilin urine present | FAERS: 1 | US FAERS | |
| 686 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 687 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 688 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 689 | Vitiligo | FAERS: 1 | US FAERS | |
| 690 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 691 | Water Intoxication | FAERS: 1 | US FAERS | |
| 692 | West Nile viral infection | FAERS: 1 | US FAERS | |
| 693 | Embolism | Canada Vigilance: 1 | Canada Vigilance | |
| 694 | Muscle Rigidity | Canada Vigilance: 1 | Canada Vigilance | |
| 695 | Pharyngeal swelling | Canada Vigilance: 2 | Canada Vigilance | |
| 696 | Skin discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 697 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 698 | Tooth Loss | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.