17 alpha-Hydroxyprogesterone Caproate
(DOMWKUIIPQCAJU-LJHIYBGHSA-N)
Structure
- SMILES
- CCCCCC(=O)O[C@@]1(CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C)C(=O)C
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C27H40O4
- Molecular Weight:
- 428.604
- Log P:
- 5.9696
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 60.44
- CAS Number(s):
- 630-56-8
Synonym(s)
1.
17 alpha-Hydroxyprogesterone Caproate
2.
17 alpha-Oxyprogesterone Capronate
3.
17-Hydroxyprogesterone Capronate
4.
17-alpha-Hydroxy-Progesterone Caproate
5.
Delalutin
6.
Hydroxyprogesterone Caproate
7.
Hydroxyprogesterone Hexanoate
8.
Makena
9.
Neolutin
10.
Oxyprogesterone Caproate
11.
Prolutin Depot
12.
Proluton Depot
13.
17 Hydroxyprogesterone Capronate
14.
17 alpha Hydroxy Progesterone Caproate
15.
17 alpha Hydroxyprogesterone Caproate
16.
17 alpha Oxyprogesterone Capronate
17.
Caproate, 17-alpha-Hydroxy-Progesterone
External Link(s)
| MeSH | D000077713 |
| PubChem Compound | 169870 |
| BindingDB | 70293 |
| ChEBI | 5812 |
| CHEMBL | CHEMBL1200848 |
| DrugBank | DB06789 |
| DrugCentral | 4189 |
| KEGG | cpd:C08148 dr:D00949 |
| Therapeutic Target Database | D00AEQ |
| ZINC | 4083606 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Injection site pain | FAERS: 1090 | US FAERS | |
| 2 | Injection site pruritus | FAERS: 846 | US FAERS | |
| 3 | Uterine contractions during pregnancy | FAERS: 411 | US FAERS | |
| 4 | Injection site mass | FAERS: 349 | US FAERS | |
| 5 | Stillbirth | FAERS: 334 | US FAERS | |
| 6 | Inappropriate schedule of product administration | FAERS: 277 | US FAERS | |
| 7 | Injection site erythema | FAERS: 277 | US FAERS | |
| 8 | Headache | FAERS: 261 | US FAERS | |
| 9 | Pruritus | FAERS: 260 | US FAERS | |
| 10 | Nausea | FAERS: 257 | US FAERS | |
| 11 | Product dose omission | FAERS: 187 | US FAERS | |
| 12 | Dizziness | FAERS: 178 | US FAERS | |
| 13 | Pain | FAERS: 156 | US FAERS | |
| 14 | Fatigue | FAERS: 139 | US FAERS | |
| 15 | Back Pain | FAERS: 135 | US FAERS | |
| 16 | Injection site bruising | FAERS: 128 | US FAERS | |
| 17 | Injection site nodule | FAERS: 126 | US FAERS | |
| 18 | Vomiting | FAERS: 125 | US FAERS | |
| 19 | Injection site warmth | FAERS: 112 | US FAERS | |
| 20 | Peripheral swelling | FAERS: 109 | US FAERS | |
| 21 | Medication Error | FAERS: 108 | US FAERS | |
| 22 | Injection Site Reaction | FAERS: 96 | US FAERS | |
| 23 | Hypersensitivity | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Urticaria | FAERS: 91 | US FAERS | |
| 25 | Product administration error | FAERS: 86 | US FAERS | |
| 26 | Abdominal Pain | FAERS: 76 | US FAERS | |
| 27 | Shortened cervix | FAERS: 72 | US FAERS | |
| 28 | Anxiety | FAERS: 71 | US FAERS | |
| 29 | Pre-Eclampsia | FAERS: 70 | US FAERS | |
| 30 | Product administered at inappropriate site | FAERS: 66 | US FAERS | |
| 31 | Injection site urticaria | FAERS: 65 | US FAERS | |
| 32 | Maternal exposure during pregnancy | FAERS: 63 | US FAERS | |
| 33 | Erythema | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Malaise | FAERS: 60 | US FAERS | |
| 35 | Arthralgia | FAERS: 57 | US FAERS | |
| 36 | Burning sensation | FAERS: 57 | US FAERS | |
| 37 | Swelling | FAERS: 56 | US FAERS | |
| 38 | Inappropriate schedule of drug administration | FAERS: 55 | US FAERS | |
| 39 | Urinary tract infection | FAERS: 52 | US FAERS | |
| 40 | Abdominal discomfort | FAERS: 51 | US FAERS | |
| 41 | Gestational Diabetes | FAERS: 44 | US FAERS | |
| 42 | Vaginal Discharge | FAERS: 42 | US FAERS | |
| 43 | Breech Presentation | FAERS: 39 | US FAERS | |
| 44 | Somnolence | FAERS: 39 | US FAERS | |
| 45 | Drug dose omission | FAERS: 38 | US FAERS | |
| 46 | Asthenia | FAERS: 35 | US FAERS | |
| 47 | Chest discomfort | FAERS: 35 | US FAERS | |
| 48 | Palpitations | FAERS: 35 | US FAERS | |
| 49 | Limb discomfort | FAERS: 34 | US FAERS | |
| 50 | Emotional disorder | FAERS: 32 | US FAERS | |
| 51 | Mood swings | FAERS: 32 | US FAERS | |
| 52 | Feeling abnormal | FAERS: 29 | US FAERS | |
| 53 | Adverse event | FAERS: 28 | US FAERS | |
| 54 | Drug administered at inappropriate site | FAERS: 28 | US FAERS | |
| 55 | Injection site irritation | FAERS: 28 | US FAERS | |
| 56 | Syncope | FAERS: 28 | US FAERS | |
| 57 | Chest Pain | FAERS: 26 | US FAERS | |
| 58 | Pelvic Pain | FAERS: 25 | US FAERS | |
| 59 | Blood glucose increased | FAERS: 24 | US FAERS | |
| 60 | Dehydration | FAERS: 24 | US FAERS | |
| 61 | Constipation | FAERS: 23 | US FAERS | |
| 62 | Throat irritation | FAERS: 23 | US FAERS | |
| 63 | Nasopharyngitis | FAERS: 22 | US FAERS | |
| 64 | Depressed mood | FAERS: 21 | US FAERS | |
| 65 | Injection site discomfort | FAERS: 21 | US FAERS | |
| 66 | Myalgia | FAERS: 21 | US FAERS | |
| 67 | Dyspepsia | FAERS: 20 | US FAERS | |
| 68 | Maternal exposure timing unspecified | FAERS: 19 | US FAERS | |
| 69 | Crying | FAERS: 18 | US FAERS | |
| 70 | Discomfort | FAERS: 18 | US FAERS | |
| 71 | Dysgeusia | FAERS: 18 | US FAERS | |
| 72 | Vulvovaginal discomfort | FAERS: 18 | US FAERS | |
| 73 | Asthma | FAERS: 17 | US FAERS | |
| 74 | Epistaxis | FAERS: 17 | US FAERS | |
| 75 | Injection site extravasation | FAERS: 17 | US FAERS | |
| 76 | Oligohydramnios | FAERS: 17 | US FAERS | |
| 77 | Presyncope | FAERS: 17 | US FAERS | |
| 78 | Infection | FAERS: 16 | US FAERS | |
| 79 | Injection site hypersensitivity | FAERS: 16 | US FAERS | |
| 80 | Injection site inflammation | FAERS: 16 | US FAERS | |
| 81 | Sciatica | FAERS: 15 | US FAERS | |
| 82 | Cellulitis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Chills | FAERS: 14 | US FAERS | |
| 84 | Nodule | FAERS: 13 | US FAERS | |
| 85 | Overdose | FAERS: 13 | US FAERS | |
| 86 | Pelvic discomfort | FAERS: 13 | US FAERS | |
| 87 | Anger | FAERS: 12 | US FAERS | |
| 88 | Cholestasis of pregnancy | FAERS: 12 | US FAERS | |
| 89 | Injection site infection | FAERS: 12 | US FAERS | |
| 90 | Blood glucose decreased | FAERS: 11 | US FAERS | |
| 91 | Muscle tightness | FAERS: 11 | US FAERS | |
| 92 | Musculoskeletal stiffness | FAERS: 11 | US FAERS | |
| 93 | Nephrolithiasis | FAERS: 11 | US FAERS | |
| 94 | Accidental overdose | FAERS: 10 | US FAERS | |
| 95 | Alopecia | FAERS: 10 | US FAERS | |
| 96 | Injection site movement impairment | FAERS: 10 | US FAERS | |
| 97 | Neonatal respiratory distress | FAERS: 10 | US FAERS | |
| 98 | Vulvovaginal pain | FAERS: 10 | US FAERS | |
| 99 | Bacterial Vaginosis | FAERS: 9 | US FAERS | |
| 100 | Incorrect route of product administration | FAERS: 9 | US FAERS | |
| 101 | Influenza | FAERS: 9 | US FAERS | |
| 102 | Joint swelling | FAERS: 9 | US FAERS | |
| 103 | Lethargy | FAERS: 9 | US FAERS | |
| 104 | Lip swelling | FAERS: 9 | US FAERS | |
| 105 | Musculoskeletal Pain | FAERS: 9 | US FAERS | |
| 106 | Tremor | FAERS: 9 | US FAERS | |
| 107 | Drug administration error | FAERS: 8 | US FAERS | |
| 108 | Hypotension | FAERS: 8 | US FAERS | |
| 109 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 110 | Injection site scab | FAERS: 8 | US FAERS | |
| 111 | Trisomy 21 | FAERS: 8 | US FAERS | |
| 112 | Acne | FAERS: 7 | US FAERS | |
| 113 | Blood glucose abnormal | FAERS: 7 | US FAERS | |
| 114 | Fibronectin increased | FAERS: 7 | US FAERS | |
| 115 | Flushing | FAERS: 7 | US FAERS | |
| 116 | Incorrect route of drug administration | FAERS: 7 | US FAERS | |
| 117 | Injection site vesicles | FAERS: 7 | US FAERS | |
| 118 | Musculoskeletal discomfort | FAERS: 7 | US FAERS | |
| 119 | Product prescribing issue | FAERS: 7 | US FAERS | |
| 120 | Therapy cessation | FAERS: 7 | US FAERS | |
| 121 | Unevaluable event | FAERS: 7 | US FAERS | |
| 122 | Uterine Rupture | FAERS: 7 | US FAERS | |
| 123 | Uterine spasm | FAERS: 7 | US FAERS | |
| 124 | Amniotic fluid volume decreased | FAERS: 6 | US FAERS | |
| 125 | Blood iron decreased | FAERS: 6 | US FAERS | |
| 126 | Cervix enlargement | FAERS: 6 | US FAERS | |
| 127 | Cold sweat | FAERS: 6 | US FAERS | |
| 128 | Hunger | FAERS: 6 | US FAERS | |
| 129 | Pneumonia | FAERS: 6 | US FAERS | |
| 130 | Poor feeding infant | FAERS: 6 | US FAERS | |
| 131 | Chromaturia | FAERS: 5 | US FAERS | |
| 132 | Cystitis | FAERS: 5 | US FAERS | |
| 133 | Flatulence | FAERS: 5 | US FAERS | |
| 134 | Incorrect dose administered by device | FAERS: 5 | US FAERS | |
| 135 | Injection site abscess | FAERS: 5 | US FAERS | |
| 136 | Injection site scar | FAERS: 5 | US FAERS | |
| 137 | Placenta Accreta | FAERS: 5 | US FAERS | |
| 138 | Sepsis | FAERS: 5 | US FAERS | |
| 139 | Umbilical cord vascular disorder | FAERS: 5 | US FAERS | |
| 140 | Vertigo | FAERS: 5 | US FAERS | |
| 141 | Visual Impairment | FAERS: 5 | US FAERS | |
| 142 | ABO incompatibility | FAERS: 4 | US FAERS | |
| 143 | Abasia | FAERS: 4 | US FAERS | |
| 144 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 145 | Bipolar Disorder | FAERS: 4 | US FAERS | |
| 146 | Carpal Tunnel Syndrome | FAERS: 4 | US FAERS | |
| 147 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 148 | Diplopia | FAERS: 4 | US FAERS | |
| 149 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 150 | Dry skin | FAERS: 4 | US FAERS | |
| 151 | Dysuria | FAERS: 4 | US FAERS | |
| 152 | Low birth weight baby | FAERS: 4 | US FAERS | |
| 153 | Microcephaly | FAERS: 4 | US FAERS | |
| 154 | Neck Pain | FAERS: 4 | US FAERS | |
| 155 | Nervousness | FAERS: 4 | US FAERS | |
| 156 | Pallor | FAERS: 4 | US FAERS | |
| 157 | Pericardial effusion | FAERS: 4 | US FAERS | |
| 158 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 159 | Rash erythematous | FAERS: 4 | US FAERS | |
| 160 | Selective eating disorder | FAERS: 4 | US FAERS | |
| 161 | Single umbilical artery | FAERS: 4 | US FAERS | |
| 162 | Tachycardia | FAERS: 4 | US FAERS | |
| 163 | Thrombosis | FAERS: 4 | 17139407 | CTD US FAERS |
| 164 | Tinnitus | FAERS: 4 | US FAERS | |
| 165 | Weight decreased | FAERS: 4 | US FAERS | |
| 166 | Bone pain | FAERS: 3 | US FAERS | |
| 167 | Bronchiolitis | FAERS: 3 | US FAERS | |
| 168 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 169 | Cleft Palate | FAERS: 3 | US FAERS | |
| 170 | Congenital heart valve disorder | FAERS: 3 | US FAERS | |
| 171 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 172 | Drug ineffective | FAERS: 3 | US FAERS | |
| 173 | Emotional distress | FAERS: 3 | US FAERS | |
| 174 | Eye pain | FAERS: 3 | US FAERS | |
| 175 | Feeling Cold | FAERS: 3 | US FAERS | |
| 176 | HELLP Syndrome | FAERS: 3 | US FAERS | |
| 177 | Immature respiratory system | FAERS: 3 | US FAERS | |
| 178 | Incorrect drug administration rate | FAERS: 3 | US FAERS | |
| 179 | Induration | FAERS: 3 | US FAERS | |
| 180 | Injection site cellulitis | FAERS: 3 | US FAERS | |
| 181 | Joint stiffness | FAERS: 3 | US FAERS | |
| 182 | Lack of injection site rotation | FAERS: 3 | US FAERS | |
| 183 | Laryngomalacia | FAERS: 3 | US FAERS | |
| 184 | Ligament pain | FAERS: 3 | US FAERS | |
| 185 | Meconium Aspiration Syndrome | FAERS: 3 | US FAERS | |
| 186 | Muscle strain | FAERS: 3 | US FAERS | |
| 187 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 188 | Neonatal aspiration | FAERS: 3 | US FAERS | |
| 189 | Obstetric procedure complication | FAERS: 3 | US FAERS | |
| 190 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 191 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 192 | Patent ductus arteriosus | FAERS: 3 | US FAERS | |
| 193 | Polyhydramnios | FAERS: 3 | US FAERS | |
| 194 | Product prescribing error | FAERS: 3 | US FAERS | |
| 195 | Progesterone increased | FAERS: 3 | US FAERS | |
| 196 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 197 | Restlessness | FAERS: 3 | US FAERS | |
| 198 | Skin Papilloma | FAERS: 3 | US FAERS | |
| 199 | Skin reaction | FAERS: 3 | US FAERS | |
| 200 | Stress | FAERS: 3 | US FAERS | |
| 201 | Talipes | FAERS: 3 | US FAERS | |
| 202 | Vulvovaginal pruritus | FAERS: 3 | US FAERS | |
| 203 | Weight decrease neonatal | FAERS: 3 | US FAERS | |
| 204 | Wheezing | FAERS: 3 | US FAERS | |
| 205 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 206 | jaundice | FAERS: 3 | US FAERS | |
| 207 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 208 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 209 | Amniotic fluid volume increased | FAERS: 2 | US FAERS | |
| 210 | Bed rest | FAERS: 2 | US FAERS | |
| 211 | Bedridden | FAERS: 2 | US FAERS | |
| 212 | Bladder pain | FAERS: 2 | US FAERS | |
| 213 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 214 | Blood urine present | FAERS: 2 | US FAERS | |
| 215 | Body temperature fluctuation | FAERS: 2 | US FAERS | |
| 216 | Breast tenderness | FAERS: 2 | US FAERS | |
| 217 | Bronchitis | FAERS: 2 | US FAERS | |
| 218 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 219 | Carditis | FAERS: 2 | US FAERS | |
| 220 | Cholestasis | FAERS: 2 | US FAERS | |
| 221 | Chorioamnionitis | FAERS: 2 | US FAERS | |
| 222 | Congenital hearing disorder | FAERS: 2 | US FAERS | |
| 223 | Dermatitis | FAERS: 2 | US FAERS | |
| 224 | Device use issue | FAERS: 2 | US FAERS | |
| 225 | Dextrocardia | FAERS: 2 | US FAERS | |
| 226 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 227 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 228 | Eczema | FAERS: 2 | US FAERS | |
| 229 | Epilepsy | FAERS: 2 | US FAERS | |
| 230 | Eye irritation | FAERS: 2 | US FAERS | |
| 231 | Facial Pain | FAERS: 2 | US FAERS | |
| 232 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 233 | Formication | FAERS: 2 | US FAERS | |
| 234 | Gait inability | FAERS: 2 | US FAERS | |
| 235 | Gastritis | FAERS: 2 | US FAERS | |
| 236 | Genital pain | FAERS: 2 | US FAERS | |
| 237 | Head deformity | FAERS: 2 | US FAERS | |
| 238 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 239 | Hyperemesis Gravidarum | FAERS: 2 | US FAERS | |
| 240 | Hypersomnia | FAERS: 2 | US FAERS | |
| 241 | Hypokinesia | FAERS: 2 | US FAERS | |
| 242 | Hypophagia | FAERS: 2 | US FAERS | |
| 243 | Impaired work ability | FAERS: 2 | US FAERS | |
| 244 | Impatience | FAERS: 2 | US FAERS | |
| 245 | Injection site discharge | FAERS: 2 | US FAERS | |
| 246 | Injection site dryness | FAERS: 2 | US FAERS | |
| 247 | Injury associated with device | FAERS: 2 | US FAERS | |
| 248 | Invasive Ductal Breast Carcinoma | FAERS: 2 | US FAERS | |
| 249 | Joint Instability | FAERS: 2 | US FAERS | |
| 250 | Laziness | FAERS: 2 | US FAERS | |
| 251 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 252 | Mastitis | FAERS: 2 | US FAERS | |
| 253 | Maternal exposure during delivery | FAERS: 2 | US FAERS | |
| 254 | Meconium plug syndrome | FAERS: 2 | US FAERS | |
| 255 | Medical device pain | FAERS: 2 | US FAERS | |
| 256 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 257 | Monoplegia | FAERS: 2 | US FAERS | |
| 258 | Mouth swelling | FAERS: 2 | US FAERS | |
| 259 | Neonatal infection | FAERS: 2 | US FAERS | |
| 260 | Neonatal respiratory failure | FAERS: 2 | US FAERS | |
| 261 | Neuralgia | FAERS: 2 | US FAERS | |
| 262 | Oxygen supplementation | FAERS: 2 | US FAERS | |
| 263 | Petechiae | FAERS: 2 | US FAERS | |
| 264 | Pharyngeal swelling | FAERS: 2 | US FAERS | |
| 265 | Placental Insufficiency | FAERS: 2 | US FAERS | |
| 266 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 267 | Pregnancy | FAERS: 2 | US FAERS | |
| 268 | Product quality issue | FAERS: 2 | US FAERS | |
| 269 | Product storage error | FAERS: 2 | US FAERS | |
| 270 | Pulmonary interstitial emphysema syndrome | FAERS: 2 | US FAERS | |
| 271 | Pyelocaliectasis | FAERS: 2 | US FAERS | |
| 272 | Renal pain | FAERS: 2 | US FAERS | |
| 273 | Retching | FAERS: 2 | US FAERS | |
| 274 | Scab | FAERS: 2 | US FAERS | |
| 275 | Shoulder Dystocia | FAERS: 2 | US FAERS | |
| 276 | Sinusitis | FAERS: 2 | US FAERS | |
| 277 | Skin Induration | FAERS: 2 | US FAERS | |
| 278 | Skin irritation | FAERS: 2 | US FAERS | |
| 279 | Skin lesion | FAERS: 2 | US FAERS | |
| 280 | Sluggishness | FAERS: 2 | US FAERS | |
| 281 | Spina Bifida | FAERS: 2 | US FAERS | |
| 282 | Stridor | FAERS: 2 | US FAERS | |
| 283 | Therapy change | FAERS: 2 | US FAERS | |
| 284 | Thirst | FAERS: 2 | US FAERS | |
| 285 | Varicose veins vaginal | FAERS: 2 | US FAERS | |
| 286 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 287 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 288 | Vulvovaginal swelling | FAERS: 2 | US FAERS | |
| 289 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 290 | treatment failure | FAERS: 2 | US FAERS | |
| 291 | Abdominal mass | FAERS: 1 | US FAERS | |
| 292 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 293 | Administration site indentation | FAERS: 1 | US FAERS | |
| 294 | Administration site movement impairment | FAERS: 1 | US FAERS | |
| 295 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 296 | Adrenal insufficiency neonatal | FAERS: 1 | US FAERS | |
| 297 | Agitation | FAERS: 1 | US FAERS | |
| 298 | Amino acid level increased | FAERS: 1 | US FAERS | |
| 299 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 300 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 301 | Arthropathy | FAERS: 1 | US FAERS | |
| 302 | Arthropod bite | FAERS: 1 | US FAERS | |
| 303 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 304 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 305 | Aura | FAERS: 1 | US FAERS | |
| 306 | Autoimmune progesterone dermatitis | FAERS: 1 | US FAERS | |
| 307 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 308 | Biliary Colic | FAERS: 1 | US FAERS | |
| 309 | Blood HIV RNA increased | FAERS: 1 | US FAERS | |
| 310 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 311 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 312 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 313 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 314 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 315 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 316 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 317 | Bradycardia | FAERS: 1 | US FAERS | |
| 318 | Breast engorgement | FAERS: 1 | US FAERS | |
| 319 | Bursitis | FAERS: 1 | US FAERS | |
| 320 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 321 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 322 | Cardiomyopathy neonatal | FAERS: 1 | US FAERS | |
| 323 | Cataract | FAERS: 1 | US FAERS | |
| 324 | Chronic villitis of unknown etiology | FAERS: 1 | US FAERS | |
| 325 | Coagulation factor X level abnormal | FAERS: 1 | US FAERS | |
| 326 | Colitis | FAERS: 1 | US FAERS | |
| 327 | Complication of delivery | FAERS: 1 | US FAERS | |
| 328 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 329 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 330 | Congenital cytomegalovirus infection | FAERS: 1 | US FAERS | |
| 331 | Congenital heart valve incompetence | FAERS: 1 | US FAERS | |
| 332 | Cyanosis | FAERS: 1 | US FAERS | |
| 333 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 334 | Device breakage | FAERS: 1 | US FAERS | |
| 335 | Device malfunction | FAERS: 1 | US FAERS | |
| 336 | Device related infection | FAERS: 1 | US FAERS | |
| 337 | Diabetes mellitus management | FAERS: 1 | US FAERS | |
| 338 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 339 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 340 | Disease complication | FAERS: 1 | US FAERS | |
| 341 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 342 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 343 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 344 | Dysarthria | FAERS: 1 | US FAERS | |
| 345 | Dysphonia | FAERS: 1 | US FAERS | |
| 346 | Ear discomfort | FAERS: 1 | US FAERS | |
| 347 | Eclampsia | FAERS: 1 | US FAERS | |
| 348 | Economic problem | FAERS: 1 | US FAERS | |
| 349 | Enuresis | FAERS: 1 | US FAERS | |
| 350 | Eructation | FAERS: 1 | US FAERS | |
| 351 | Expired product administered | FAERS: 1 | US FAERS | |
| 352 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 353 | Face presentation | FAERS: 1 | US FAERS | |
| 354 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 355 | Feeding tube user | FAERS: 1 | US FAERS | |
| 356 | Feeling jittery | FAERS: 1 | US FAERS | |
| 357 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 358 | Flat affect | FAERS: 1 | US FAERS | |
| 359 | Food Poisoning | FAERS: 1 | US FAERS | |
| 360 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 361 | Full blood count increased | FAERS: 1 | US FAERS | |
| 362 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 363 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 364 | Gastroschisis | FAERS: 1 | US FAERS | |
| 365 | Glossitis | FAERS: 1 | US FAERS | |
| 366 | Granuloma | FAERS: 1 | US FAERS | |
| 367 | Head discomfort | FAERS: 1 | US FAERS | |
| 368 | Hernia | FAERS: 1 | US FAERS | |
| 369 | Hidradenitis | FAERS: 1 | US FAERS | |
| 370 | Hordeolum | FAERS: 1 | US FAERS | |
| 371 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 372 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 373 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 374 | Hyperventilation | FAERS: 1 | US FAERS | |
| 375 | Hypospadias | FAERS: 1 | US FAERS | |
| 376 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 377 | Hysterectomy | FAERS: 1 | US FAERS | |
| 378 | Imminent abortion | FAERS: 1 | US FAERS | |
| 379 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 380 | Incoherent | FAERS: 1 | US FAERS | |
| 381 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 382 | Infantile vomiting | FAERS: 1 | US FAERS | |
| 383 | Infertility | FAERS: 1 | US FAERS | |
| 384 | Inflammation | FAERS: 1 | US FAERS | |
| 385 | Injected limb mobility decreased | FAERS: 1 | US FAERS | |
| 386 | Injection site dermatitis | FAERS: 1 | US FAERS | |
| 387 | Injection site indentation | FAERS: 1 | US FAERS | |
| 388 | Injection site injury | FAERS: 1 | US FAERS | |
| 389 | Injection site nerve damage | FAERS: 1 | US FAERS | |
| 390 | Injection site papule | FAERS: 1 | US FAERS | |
| 391 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 392 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 393 | Invasive Lobular Breast Carcinoma | FAERS: 1 | US FAERS | |
| 394 | Joint injury | FAERS: 1 | US FAERS | |
| 395 | Kell blood group positive | FAERS: 1 | US FAERS | |
| 396 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 397 | Ligament rupture | FAERS: 1 | US FAERS | |
| 398 | Limb mass | FAERS: 1 | US FAERS | |
| 399 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 400 | Listeriosis | FAERS: 1 | US FAERS | |
| 401 | Local reaction | FAERS: 1 | US FAERS | |
| 402 | Lung cyst | FAERS: 1 | US FAERS | |
| 403 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 404 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 405 | Lymphangitis | FAERS: 1 | US FAERS | |
| 406 | Macrocephaly | FAERS: 1 | US FAERS | |
| 407 | Macule | FAERS: 1 | US FAERS | |
| 408 | Malnutrition | FAERS: 1 | US FAERS | |
| 409 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 410 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 411 | Meningitis | FAERS: 1 | US FAERS | |
| 412 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 413 | Miliaria | FAERS: 1 | US FAERS | |
| 414 | Milk Allergy | FAERS: 1 | US FAERS | |
| 415 | Morning Sickness | FAERS: 1 | US FAERS | |
| 416 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 417 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 418 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 419 | Needle issue | FAERS: 1 | US FAERS | |
| 420 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 421 | Neonatal gastrointestinal disorder | FAERS: 1 | US FAERS | |
| 422 | Neonatal hypotension | FAERS: 1 | US FAERS | |
| 423 | Neonatal pneumonia | FAERS: 1 | US FAERS | |
| 424 | Night sweats | FAERS: 1 | US FAERS | |
| 425 | Nipple pain | FAERS: 1 | US FAERS | |
| 426 | No adverse event | FAERS: 1 | US FAERS | |
| 427 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 428 | Obstetric infection | FAERS: 1 | US FAERS | |
| 429 | Oliguria | FAERS: 1 | US FAERS | |
| 430 | Oral pruritus | FAERS: 1 | US FAERS | |
| 431 | Orgasmic sensation decreased | FAERS: 1 | US FAERS | |
| 432 | Osteopenia | FAERS: 1 | US FAERS | |
| 433 | Otitis Media | FAERS: 1 | US FAERS | |
| 434 | Panic Disorder | FAERS: 1 | US FAERS | |
| 435 | Perineal injury | FAERS: 1 | US FAERS | |
| 436 | Pharyngitis | FAERS: 1 | US FAERS | |
| 437 | Photophobia | FAERS: 1 | US FAERS | |
| 438 | Plagiocephaly | FAERS: 1 | US FAERS | |
| 439 | Pneumothorax | FAERS: 1 | US FAERS | |
| 440 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 441 | Post procedural complication | FAERS: 1 | US FAERS | |
| 442 | Post procedural fever | FAERS: 1 | US FAERS | |
| 443 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 444 | Premature baby death | FAERS: 1 | US FAERS | |
| 445 | Product deposit | FAERS: 1 | US FAERS | |
| 446 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 447 | Product distribution issue | FAERS: 1 | US FAERS | |
| 448 | Product formulation issue | FAERS: 1 | US FAERS | |
| 449 | Product intolerance | FAERS: 1 | US FAERS | |
| 450 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 451 | Product substitution issue | FAERS: 1 | US FAERS | |
| 452 | Product use issue | FAERS: 1 | US FAERS | |
| 453 | Productive Cough | FAERS: 1 | US FAERS | |
| 454 | Progesterone decreased | FAERS: 1 | US FAERS | |
| 455 | Protein urine present | FAERS: 1 | US FAERS | |
| 456 | Psoriasis | FAERS: 1 | US FAERS | |
| 457 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 458 | Pubic pain | FAERS: 1 | US FAERS | |
| 459 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 460 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 461 | Renal Colic | FAERS: 1 | US FAERS | |
| 462 | Renal impairment neonatal | FAERS: 1 | US FAERS | |
| 463 | Respiratory distress | FAERS: 1 | US FAERS | |
| 464 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 465 | Retained products of conception | FAERS: 1 | US FAERS | |
| 466 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 467 | Rhabdomyoma | FAERS: 1 | US FAERS | |
| 468 | Rhinitis | FAERS: 1 | US FAERS | |
| 469 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 470 | Secretion discharge | FAERS: 1 | US FAERS | |
| 471 | Sinus headache | FAERS: 1 | US FAERS | |
| 472 | Skin indentation | FAERS: 1 | US FAERS | |
| 473 | Small size placenta | FAERS: 1 | US FAERS | |
| 474 | Sneezing | FAERS: 1 | US FAERS | |
| 475 | Somnambulism | FAERS: 1 | US FAERS | |
| 476 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 477 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 478 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 479 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 480 | Tension Headache | FAERS: 1 | US FAERS | |
| 481 | Thermal burn | FAERS: 1 | US FAERS | |
| 482 | Throat clearing | FAERS: 1 | US FAERS | |
| 483 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 484 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 485 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 486 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 487 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 488 | Uterine cervical pain | FAERS: 1 | US FAERS | |
| 489 | Vaginal relaxation | FAERS: 1 | US FAERS | |
| 490 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 491 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 492 | Wrong device used | FAERS: 1 | US FAERS | |
| 493 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 494 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 495 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 496 | inhibin B | FAERS: 1 | US FAERS | |
| 497 | Carcinoma | 9208491 | CTD | |
| 498 | Endometrial Hyperplasia | 11695813 | CTD | |
| 499 | Endometrial Neoplasms | CTD | ||
| 500 | Fetal Resorption | 3816235 | CTD | |
| 501 | Liver Cirrhosis, Experimental | 1465320 | CTD | |
| 502 | Neoplasms, Experimental | 8068195 | CTD | |
| 503 | Neoplasms, Hormone-Dependent | 8500499 | CTD | |
| 504 | Obstetric Labor Complications | 16946206 | CTD | |
| 505 | Osteoporosis, Postmenopausal | 16373245 | CTD | |
| 506 | Ovarian Hyperstimulation Syndrome | 11719720 12960445 | CTD | |
| 507 | Precancerous Conditions | 8082440 | CTD | |
| 508 | Pregnancy Complications | 19546757 | CTD | |
| 509 | Premature Birth |
2138496
12802023 15684150 16135587 16946206 17000233 17346529 17437227 17826411 18456237 18712170 18839818 18928983 19492920 20170407 20350641 20550052 | CTD | |
| 510 | Uterine Cervical Incompetence | 19492920 | CTD | |
| 511 | Uterine hemorrhage | 17139407 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.