carfilzomib
(BLMPQMFVWMYDKT-NZTKNTHTSA-N)
Structure
- SMILES
- CC(C[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)[C@@]1(C)CO1)CC(C)C)Cc1ccccc1)NC(=O)[C@@H](NC(=O)CN1CCOCC1)CCc1ccccc1)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX45
- Molecular Formula:
- C40H57N5O7
- Molecular Weight:
- 719.910
- Log P:
- 4.0850
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 158.47
- CAS Number(s):
- 868540-17-4
Synonym(s)
1.
carfilzomib
2.
Kyprolis
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 357 Canada Vigilance: 37 | Canada Vigilance SIDER US FAERS | |
| 2 | Disease Progression | FAERS: 167 | SIDER US FAERS | |
| 3 | Nausea | FAERS: 158 Canada Vigilance: 22 | Canada Vigilance SIDER US FAERS | |
| 4 | Unevaluable event | FAERS: 158 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Asthenia | FAERS: 156 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 6 | Malaise | FAERS: 156 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 7 | Pneumonia | FAERS: 123 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 8 | Intercepted product preparation error | FAERS: 115 | US FAERS | |
| 9 | Pain | FAERS: 95 Canada Vigilance: 23 | Canada Vigilance SIDER US FAERS | |
| 10 | Back Pain | FAERS: 85 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 11 | Feeling abnormal | FAERS: 71 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Vomiting | FAERS: 71 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 13 | Product preparation error | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Headache | FAERS: 63 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 15 | Thrombocytopenia | FAERS: 62 Canada Vigilance: 20 | Canada Vigilance SIDER US FAERS | |
| 16 | Drug ineffective | FAERS: 61 | US FAERS | |
| 17 | Dehydration | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Somnolence | FAERS: 51 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 19 | Nasopharyngitis | FAERS: 50 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 20 | Constipation | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 21 | Chest Pain | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Inappropriate schedule of drug administration | FAERS: 48 | US FAERS | |
| 23 | Peripheral swelling | FAERS: 47 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 24 | Dizziness | FAERS: 41 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 25 | Influenza | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Chills | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 27 | White blood cell count decreased | FAERS: 38 | US FAERS | |
| 28 | Acute kidney injury | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Adverse event | FAERS: 37 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 30 | Arthralgia | FAERS: 37 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 31 | Urinary tract infection | FAERS: 36 | US FAERS | |
| 32 | Neutropenia | FAERS: 34 Canada Vigilance: 24 | Canada Vigilance SIDER US FAERS | |
| 33 | Hypotension | FAERS: 32 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 34 | Memory impairment | FAERS: 32 | US FAERS | |
| 35 | Sepsis | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 36 | Weight decreased | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 37 | Wrong technique in product usage process | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Infection | FAERS: 30 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 39 | Infusion Site Extravasation | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Atrial Fibrillation | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 41 | Drug dose omission | FAERS: 28 | US FAERS | |
| 42 | Infusion site pain | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 43 | Myocardial Infarction | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Thrombosis | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 45 | Tremor | FAERS: 27 | US FAERS | |
| 46 | Pulmonary Hypertension | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Bronchitis | FAERS: 23 | US FAERS | |
| 48 | Essential Hypertension | FAERS: 22 | US FAERS | |
| 49 | General physical health deterioration | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 50 | Epistaxis | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Respiratory Failure | FAERS: 21 | US FAERS | |
| 52 | Musculoskeletal Pain | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 53 | Blood creatinine increased | FAERS: 19 | SIDER US FAERS | |
| 54 | Hospice Care | FAERS: 19 | US FAERS | |
| 55 | Infusion site erythema | FAERS: 19 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 56 | Pancytopenia | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Abdominal Pain | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 58 | Cellulitis | FAERS: 18 | US FAERS | |
| 59 | Joint swelling | FAERS: 18 | US FAERS | |
| 60 | Extravasation | FAERS: 17 | US FAERS | |
| 61 | Infusion site swelling | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Intentional product misuse | FAERS: 17 | US FAERS | |
| 63 | Anxiety | FAERS: 16 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 64 | Bone pain | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 65 | Ejection Fraction Decreased | FAERS: 16 | US FAERS | |
| 66 | Polyneuropathy | FAERS: 16 | US FAERS | |
| 67 | Mental status changes | FAERS: 15 | US FAERS | |
| 68 | Plasma cell myeloma recurrent | FAERS: 15 | US FAERS | |
| 69 | Protein total increased | FAERS: 15 | US FAERS | |
| 70 | Chest discomfort | FAERS: 14 | US FAERS | |
| 71 | Discomfort | FAERS: 14 | US FAERS | |
| 72 | Drug effect incomplete | FAERS: 14 | US FAERS | |
| 73 | Therapy non-responder | FAERS: 14 | US FAERS | |
| 74 | Agranulocytosis | FAERS: 13 | US FAERS | |
| 75 | Cardiotoxicity | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Cerebrovascular accident | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Fluid overload | FAERS: 13 | US FAERS | |
| 78 | Full blood count decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Light chain analysis increased | FAERS: 13 | US FAERS | |
| 80 | Bradycardia | FAERS: 12 | US FAERS | |
| 81 | Cardiac dysfunction | FAERS: 12 | US FAERS | |
| 82 | Cataract | FAERS: 12 | US FAERS | |
| 83 | Clostridium difficile infection | FAERS: 12 | US FAERS | |
| 84 | Dysuria | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Erythema | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Intercepted medication error | FAERS: 12 | US FAERS | |
| 87 | Myalgia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Pulmonary Embolism | FAERS: 12 | US FAERS | |
| 89 | Septic Shock | FAERS: 12 | US FAERS | |
| 90 | Blood count abnormal | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Diabetes Mellitus | FAERS: 11 | US FAERS | |
| 92 | Hypersomnia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Hypoxia | FAERS: 11 | US FAERS | |
| 94 | Oropharyngeal pain | FAERS: 11 | US FAERS | |
| 95 | Palpitations | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 96 | Toxicity to various agents | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Bone lesion | FAERS: 10 | US FAERS | |
| 98 | Burning sensation | FAERS: 10 | US FAERS | |
| 99 | Cancer Pain | FAERS: 10 | US FAERS | |
| 100 | Cardiac Arrest | FAERS: 10 | SIDER US FAERS | |
| 101 | Cystitis | FAERS: 10 | US FAERS | |
| 102 | Cytopenia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Musculoskeletal chest pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 104 | Neck Pain | FAERS: 10 | US FAERS | |
| 105 | Respiratory distress | FAERS: 10 | US FAERS | |
| 106 | Tachycardia | FAERS: 10 | US FAERS | |
| 107 | Visual Impairment | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Abdominal discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Activities of daily living impaired | FAERS: 9 | US FAERS | |
| 110 | Angina Pectoris | FAERS: 9 | US FAERS | |
| 111 | Dyspepsia | FAERS: 9 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 112 | Pancreatitis | FAERS: 9 | US FAERS | |
| 113 | Phlebitis | FAERS: 9 | US FAERS | |
| 114 | Pruritus | FAERS: 9 | US FAERS | |
| 115 | Wheezing | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Abasia | FAERS: 8 | US FAERS | |
| 117 | Arthropathy | FAERS: 8 | US FAERS | |
| 118 | Asthma | FAERS: 8 | US FAERS | |
| 119 | Brain natriuretic peptide increased | FAERS: 8 | US FAERS | |
| 120 | Cardiomegaly | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Depressed mood | FAERS: 8 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 122 | Disease complication | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Flushing | FAERS: 8 | US FAERS | |
| 124 | Posterior reversible encephalopathy syndrome | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Sinusitis | FAERS: 8 | US FAERS | |
| 126 | Stress | FAERS: 8 | US FAERS | |
| 127 | Swelling | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Walking aid user | FAERS: 8 | US FAERS | |
| 129 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 130 | Blood glucose increased | FAERS: 7 | US FAERS | |
| 131 | Decreased immune responsiveness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Dysgeusia | FAERS: 7 | US FAERS | |
| 133 | Infarction | FAERS: 7 | US FAERS | |
| 134 | MYELODYSPLASTIC SYNDROME | FAERS: 7 | US FAERS | |
| 135 | Palliative Care | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 136 | Platelet count abnormal | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Pneumonitis | FAERS: 7 | US FAERS | |
| 138 | Therapeutic response unexpected | FAERS: 7 | US FAERS | |
| 139 | Throat irritation | FAERS: 7 | US FAERS | |
| 140 | Vitamin D Deficiency | FAERS: 7 | US FAERS | |
| 141 | nervous system disorder | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | treatment failure | FAERS: 7 | US FAERS | |
| 143 | Acidosis | FAERS: 6 | US FAERS | |
| 144 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 145 | Amnesia | FAERS: 6 | US FAERS | |
| 146 | Back disorder | FAERS: 6 | US FAERS | |
| 147 | Bedridden | FAERS: 6 | US FAERS | |
| 148 | Blood potassium decreased | FAERS: 6 | US FAERS | |
| 149 | Dysphonia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Incorrect dose administered | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Infusion site reaction | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Limb discomfort | FAERS: 6 | US FAERS | |
| 153 | Muscle tightness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Oral candidiasis | FAERS: 6 | US FAERS | |
| 155 | Skin lesion | FAERS: 6 | US FAERS | |
| 156 | Toothache | FAERS: 6 | US FAERS | |
| 157 | Acute Coronary Syndrome | FAERS: 5 | SIDER US FAERS | |
| 158 | Acute respiratory failure | FAERS: 5 | US FAERS | |
| 159 | Agitation | FAERS: 5 | US FAERS | |
| 160 | Alopecia | FAERS: 5 | US FAERS | |
| 161 | Arthritis | FAERS: 5 | US FAERS | |
| 162 | Blood glucose abnormal | FAERS: 5 | US FAERS | |
| 163 | Blood lactate dehydrogenase increased | FAERS: 5 | US FAERS | |
| 164 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 165 | Colitis | FAERS: 5 | US FAERS | |
| 166 | Diplopia | FAERS: 5 | US FAERS | |
| 167 | Disorientation | FAERS: 5 | US FAERS | |
| 168 | Febrile Neutropenia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 169 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 170 | Inflammation | FAERS: 5 | US FAERS | |
| 171 | Injection site pain | FAERS: 5 | US FAERS | |
| 172 | Laceration | FAERS: 5 | US FAERS | |
| 173 | Lower respiratory tract infection | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 174 | Monoclonal immunoglobulin present | FAERS: 5 | US FAERS | |
| 175 | Musculoskeletal discomfort | FAERS: 5 | SIDER US FAERS | |
| 176 | Night sweats | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 177 | Osteoporosis | FAERS: 5 | US FAERS | |
| 178 | Product quality issue | FAERS: 5 | US FAERS | |
| 179 | Productive Cough | FAERS: 5 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 180 | Rash erythematous | FAERS: 5 | US FAERS | |
| 181 | Respiratory tract congestion | FAERS: 5 | US FAERS | |
| 182 | Retching | FAERS: 5 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 183 | Skin Ulcer | FAERS: 5 | US FAERS | |
| 184 | Supraventricular tachycardia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Syncope | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 186 | Transplant | FAERS: 5 | US FAERS | |
| 187 | Troponin increased | FAERS: 5 | US FAERS | |
| 188 | Ageusia | FAERS: 4 | US FAERS | |
| 189 | Amyloidosis | FAERS: 4 | US FAERS | |
| 190 | Blood immunoglobulin G increased | FAERS: 4 | US FAERS | |
| 191 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 192 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 193 | Cold sweat | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Dementia | FAERS: 4 | US FAERS | |
| 195 | Device related infection | FAERS: 4 | US FAERS | |
| 196 | Diastolic dysfunction | FAERS: 4 | US FAERS | |
| 197 | Disease recurrence | FAERS: 4 | US FAERS | |
| 198 | Drug resistance | FAERS: 4 | US FAERS | |
| 199 | Eye pain | FAERS: 4 | US FAERS | |
| 200 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 201 | Head discomfort | FAERS: 4 | US FAERS | |
| 202 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 203 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 204 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 205 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 206 | Infusion site bruising | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 207 | Infusion site coldness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 208 | Injection site extravasation | FAERS: 4 | US FAERS | |
| 209 | Intentional dose omission | FAERS: 4 | US FAERS | |
| 210 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 211 | Leukopenia | FAERS: 4 | SIDER US FAERS | |
| 212 | Living in residential institution | FAERS: 4 | US FAERS | |
| 213 | Malabsorption | FAERS: 4 | US FAERS | |
| 214 | Medication Error | FAERS: 4 | US FAERS | |
| 215 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 216 | Nervousness | FAERS: 4 | US FAERS | |
| 217 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 218 | No adverse event | FAERS: 4 | US FAERS | |
| 219 | Obesity | FAERS: 4 | US FAERS | |
| 220 | Occupational exposure to product | FAERS: 4 | US FAERS | |
| 221 | Pallor | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 222 | Pathological fracture | FAERS: 4 | US FAERS | |
| 223 | Pericardial effusion | FAERS: 4 | US FAERS | |
| 224 | Plasmacytoma | FAERS: 4 | US FAERS | |
| 225 | Product preparation issue | FAERS: 4 | US FAERS | |
| 226 | Proteinuria | FAERS: 4 | US FAERS | |
| 227 | Pulmonary thrombosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 228 | Rehabilitation therapy | FAERS: 4 | US FAERS | |
| 229 | Stomatitis | FAERS: 4 | US FAERS | |
| 230 | Urinary Retention | FAERS: 4 | US FAERS | |
| 231 | Urticaria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Aphonia | FAERS: 3 | US FAERS | |
| 233 | Ascites | FAERS: 3 | US FAERS | |
| 234 | Aspartate Aminotransferase Increased | FAERS: 3 | SIDER US FAERS | |
| 235 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 236 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 237 | Dermatitis | FAERS: 3 | US FAERS | |
| 238 | Drug administration error | FAERS: 3 | US FAERS | |
| 239 | Flatulence | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 240 | Gastric hypermotility | FAERS: 3 | US FAERS | |
| 241 | Gastritis | FAERS: 3 | US FAERS | |
| 242 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 243 | Gout | FAERS: 3 | US FAERS | |
| 244 | Hypokinesia | FAERS: 3 | US FAERS | |
| 245 | Ileus | FAERS: 3 | US FAERS | |
| 246 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 247 | Infusion site cellulitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Infusion site infection | FAERS: 3 | US FAERS | |
| 249 | Infusion site warmth | FAERS: 3 | US FAERS | |
| 250 | Injection site erythema | FAERS: 3 | US FAERS | |
| 251 | Intervertebral disc disorder | FAERS: 3 | US FAERS | |
| 252 | Laryngitis | FAERS: 3 | US FAERS | |
| 253 | Lethargy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Malnutrition | FAERS: 3 | US FAERS | |
| 255 | Mental impairment | FAERS: 3 | US FAERS | |
| 256 | Muscle strain | FAERS: 3 | US FAERS | |
| 257 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 258 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 259 | Nicotine Dependence | FAERS: 3 | US FAERS | |
| 260 | Oral pain | FAERS: 3 | US FAERS | |
| 261 | Osteomyelitis | FAERS: 3 | US FAERS | |
| 262 | Overdose | FAERS: 3 | US FAERS | |
| 263 | Pericarditis | FAERS: 3 | US FAERS | |
| 264 | Peritonitis | FAERS: 3 | US FAERS | |
| 265 | Pharyngitis | FAERS: 3 | US FAERS | |
| 266 | Product storage error | FAERS: 3 | US FAERS | |
| 267 | Protein total decreased | FAERS: 3 | US FAERS | |
| 268 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 269 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 270 | Right ventricular failure | FAERS: 3 | US FAERS | |
| 271 | Secretion discharge | FAERS: 3 | US FAERS | |
| 272 | Skin Papilloma | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 273 | Sluggishness | FAERS: 3 | US FAERS | |
| 274 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 275 | Sudden Cardiac Death | FAERS: 3 | US FAERS | |
| 276 | Sudden death | FAERS: 3 | US FAERS | |
| 277 | Therapy cessation | FAERS: 3 | US FAERS | |
| 278 | Tinnitus | FAERS: 3 | US FAERS | |
| 279 | Vertigo | FAERS: 3 | US FAERS | |
| 280 | White blood cell count abnormal | FAERS: 3 | US FAERS | |
| 281 | Acute sinusitis | FAERS: 2 | US FAERS | |
| 282 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 283 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 284 | Angioedema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 286 | Aphasia | FAERS: 2 | US FAERS | |
| 287 | Application site extravasation | FAERS: 2 | US FAERS | |
| 288 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 289 | Atelectasis | FAERS: 2 | US FAERS | |
| 290 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 291 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 292 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 293 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 294 | Blood bilirubin abnormal | FAERS: 2 | US FAERS | |
| 295 | Blood glucose decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Blood immunoglobulin A increased | FAERS: 2 | US FAERS | |
| 297 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 298 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 299 | Blood urea increased | FAERS: 2 | US FAERS | |
| 300 | Bone density abnormal | FAERS: 2 | US FAERS | |
| 301 | Borderline glaucoma | FAERS: 2 | US FAERS | |
| 302 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 303 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 304 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 305 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 306 | Choking | FAERS: 2 | US FAERS | |
| 307 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 308 | Chronic sinusitis | FAERS: 2 | US FAERS | |
| 309 | Complication associated with device | FAERS: 2 | US FAERS | |
| 310 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 311 | Cyanosis | FAERS: 2 | US FAERS | |
| 312 | Delirium | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 313 | Dental caries | FAERS: 2 | US FAERS | |
| 314 | Diaphragmatic abnormal relaxation | FAERS: 2 | US FAERS | |
| 315 | Disseminated Intravascular Coagulation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Diverticulitis | FAERS: 2 | US FAERS | |
| 317 | Drug abuse | FAERS: 2 | US FAERS | |
| 318 | Dysarthria | FAERS: 2 | US FAERS | |
| 319 | Echocardiogram abnormal | FAERS: 2 | US FAERS | |
| 320 | Electrocardiogram | FAERS: 2 | US FAERS | |
| 321 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 322 | Embolism | FAERS: 2 | US FAERS | |
| 323 | Encephalitis | FAERS: 2 | US FAERS | |
| 324 | Enzyme level abnormal | FAERS: 2 | US FAERS | |
| 325 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 326 | Extra dose administered | FAERS: 2 | US FAERS | |
| 327 | Eye Infection | FAERS: 2 | US FAERS | |
| 328 | Facial paralysis | FAERS: 2 | US FAERS | |
| 329 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 330 | Feeling jittery | FAERS: 2 | US FAERS | |
| 331 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 332 | Genital injury | FAERS: 2 | US FAERS | |
| 333 | Graft versus host disease in gastrointestinal tract | FAERS: 2 | US FAERS | |
| 334 | Graft versus host disease in skin | FAERS: 2 | US FAERS | |
| 335 | Hepatitis | FAERS: 2 | US FAERS | |
| 336 | Hypophagia | FAERS: 2 | US FAERS | |
| 337 | Immunology test abnormal | FAERS: 2 | US FAERS | |
| 338 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 339 | Infusion site injury | FAERS: 2 | US FAERS | |
| 340 | Infusion site irritation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 341 | Injection site irritation | FAERS: 2 | US FAERS | |
| 342 | Intercepted product storage error | FAERS: 2 | US FAERS | |
| 343 | Intracranial mass | FAERS: 2 | US FAERS | |
| 344 | Investigation abnormal | FAERS: 2 | US FAERS | |
| 345 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 346 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 347 | Limb injury | FAERS: 2 | US FAERS | |
| 348 | Lower Urinary Tract Symptoms | FAERS: 2 | US FAERS | |
| 349 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 350 | Lymphopenia | FAERS: 2 | SIDER US FAERS | |
| 351 | Macular degeneration | FAERS: 2 | US FAERS | |
| 352 | Malignant Hypertension | FAERS: 2 | US FAERS | |
| 353 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 354 | Metastasis | FAERS: 2 | US FAERS | |
| 355 | Multimorbidity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 356 | Nerve injury | FAERS: 2 | US FAERS | |
| 357 | Neutrophil count abnormal | FAERS: 2 | US FAERS | |
| 358 | Osteonecrosis of Jaw | FAERS: 2 | US FAERS | |
| 359 | Otitis Media | FAERS: 2 | US FAERS | |
| 360 | Paraparesis | FAERS: 2 | US FAERS | |
| 361 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 362 | Pertussis | FAERS: 2 | US FAERS | |
| 363 | Pneumococcal sepsis | FAERS: 2 | US FAERS | |
| 364 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 365 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 366 | Post procedural contusion | FAERS: 2 | US FAERS | |
| 367 | Protein urine present | FAERS: 2 | US FAERS | |
| 368 | Pulmonary Infarction | FAERS: 2 | US FAERS | |
| 369 | Pulmonary arterial pressure abnormal | FAERS: 2 | US FAERS | |
| 370 | Pulmonary toxicity | FAERS: 2 | US FAERS | |
| 371 | Radiculopathy | FAERS: 2 | US FAERS | |
| 372 | Renal pain | FAERS: 2 | US FAERS | |
| 373 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 374 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 375 | Schistocytosis | FAERS: 2 | US FAERS | |
| 376 | Shock | FAERS: 2 | US FAERS | |
| 377 | Sinus headache | FAERS: 2 | US FAERS | |
| 378 | Sleep disorder due to general medical condition, insomnia type | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 380 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 381 | Systolic dysfunction | FAERS: 2 | US FAERS | |
| 382 | Tension Headache | FAERS: 2 | US FAERS | |
| 383 | Thoracic vertebral fracture | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 384 | Transaminases increased | FAERS: 2 | US FAERS | |
| 385 | Transplant evaluation | FAERS: 2 | US FAERS | |
| 386 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 387 | Vascular fragility | FAERS: 2 | US FAERS | |
| 388 | Vascular pain | FAERS: 2 | US FAERS | |
| 389 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 390 | Wheelchair user | FAERS: 2 | US FAERS | |
| 391 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 392 | furuncle | FAERS: 2 | US FAERS | |
| 393 | jaundice | FAERS: 2 | US FAERS | |
| 394 | ATRIAL ENLARGEMENT | FAERS: 1 | US FAERS | |
| 395 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 396 | Abscess | FAERS: 1 | US FAERS | |
| 397 | Acne | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 398 | Acute cardiac event | FAERS: 1 | US FAERS | |
| 399 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 1 | US FAERS | |
| 400 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 401 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 402 | Allergic cough | FAERS: 1 | US FAERS | |
| 403 | Ammonia increased | FAERS: 1 | US FAERS | |
| 404 | Amylase increased | FAERS: 1 | US FAERS | |
| 405 | Anger | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 406 | Antibiotic therapy | FAERS: 1 | US FAERS | |
| 407 | Anuria | FAERS: 1 | US FAERS | |
| 408 | Application site pain | FAERS: 1 | US FAERS | |
| 409 | Arteriovenous fistula site complication | FAERS: 1 | US FAERS | |
| 410 | Arthrodesis | FAERS: 1 | US FAERS | |
| 411 | Arthropod bite | FAERS: 1 | US FAERS | |
| 412 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 413 | Asthenopia | FAERS: 1 | US FAERS | |
| 414 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 415 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 416 | B-cell lymphoma stage I | FAERS: 1 | US FAERS | |
| 417 | Benign neoplasm of skin | FAERS: 1 | US FAERS | |
| 418 | Bicytopenia | FAERS: 1 | US FAERS | |
| 419 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 420 | Bladder spasm | FAERS: 1 | US FAERS | |
| 421 | Blepharitis | FAERS: 1 | US FAERS | |
| 422 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 423 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 424 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 425 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 426 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 427 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 428 | Blood osmolarity increased | FAERS: 1 | US FAERS | |
| 429 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 430 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 431 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 432 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 433 | Blood stem cell harvest failure | FAERS: 1 | US FAERS | |
| 434 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 435 | Blood uric acid decreased | FAERS: 1 | US FAERS | |
| 436 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 437 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 438 | Brain natriuretic peptide abnormal | FAERS: 1 | US FAERS | |
| 439 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 440 | C-reactive protein abnormal | FAERS: 1 | US FAERS | |
| 441 | Cachexia | FAERS: 1 | US FAERS | |
| 442 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 443 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 444 | Cardiac Death | FAERS: 1 | US FAERS | |
| 445 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 446 | Cardiac imaging procedure abnormal | FAERS: 1 | US FAERS | |
| 447 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 448 | Cataract operation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 449 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 450 | Cholangitis | FAERS: 1 | US FAERS | |
| 451 | Cholecystitis | FAERS: 1 | US FAERS | |
| 452 | Chorioretinal scar | FAERS: 1 | US FAERS | |
| 453 | Chronic disease | FAERS: 1 | US FAERS | |
| 454 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 455 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 456 | Cluster Headache | FAERS: 1 | US FAERS | |
| 457 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 458 | Compression fracture | FAERS: 1 | US FAERS | |
| 459 | Convalescent | FAERS: 1 | US FAERS | |
| 460 | Conversion disorder | FAERS: 1 | US FAERS | |
| 461 | Coombs test positive | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 462 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 463 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 464 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 465 | Cyst | FAERS: 1 | US FAERS | |
| 466 | Cytokine Release Syndrome | FAERS: 1 | US FAERS | |
| 467 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 468 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 469 | Device Failure | FAERS: 1 | US FAERS | |
| 470 | Device occlusion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 471 | Device related thrombosis | FAERS: 1 | US FAERS | |
| 472 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 473 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 474 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 475 | Dyschezia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 476 | Dysphemia | FAERS: 1 | US FAERS | |
| 477 | Ear discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 478 | Ecchymosis | FAERS: 1 | US FAERS | |
| 479 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 480 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 481 | Emotional disorder | FAERS: 1 | US FAERS | |
| 482 | Emotional distress | FAERS: 1 | US FAERS | |
| 483 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 484 | Enterocolitis bacterial | FAERS: 1 | US FAERS | |
| 485 | Enterocolitis | FAERS: 1 | US FAERS | |
| 486 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 487 | Eosinophilia | FAERS: 1 | US FAERS | |
| 488 | Epididymitis | FAERS: 1 | US FAERS | |
| 489 | Epilepsy | FAERS: 1 | US FAERS | |
| 490 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 491 | Escherichia infection | FAERS: 1 | US FAERS | |
| 492 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 493 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 494 | Euphoric mood | FAERS: 1 | US FAERS | |
| 495 | Exposed bone in jaw | FAERS: 1 | US FAERS | |
| 496 | Eye complication associated with device | FAERS: 1 | US FAERS | |
| 497 | Eye irritation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 498 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 499 | Facial Pain | FAERS: 1 | US FAERS | |
| 500 | Fear of falling | FAERS: 1 | US FAERS | |
| 501 | Fine motor delay | FAERS: 1 | US FAERS | |
| 502 | Flank Pain | FAERS: 1 | US FAERS | |
| 503 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 504 | Fluid replacement | FAERS: 1 | US FAERS | |
| 505 | Fracture | FAERS: 1 | US FAERS | |
| 506 | Gangrene | FAERS: 1 | US FAERS | |
| 507 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 508 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 509 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 510 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 511 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 512 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 513 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 514 | Gastrointestinal wall thickening | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 515 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 516 | Gingivitis | FAERS: 1 | US FAERS | |
| 517 | Glaucoma | FAERS: 1 | US FAERS | |
| 518 | Graft versus host disease in eye | FAERS: 1 | US FAERS | |
| 519 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 520 | Growth of eyelashes | FAERS: 1 | US FAERS | |
| 521 | Haemoconcentration | FAERS: 1 | US FAERS | |
| 522 | Hemiparesis | FAERS: 1 | US FAERS | |
| 523 | Hepatitis C | FAERS: 1 | US FAERS | |
| 524 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 525 | Herpes dermatitis | FAERS: 1 | US FAERS | |
| 526 | Hordeolum | FAERS: 1 | US FAERS | |
| 527 | Hunger | FAERS: 1 | US FAERS | |
| 528 | Hypercapnia | FAERS: 1 | US FAERS | |
| 529 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 530 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 531 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 532 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 533 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 534 | Hypertrophy of tongue papillae | FAERS: 1 | US FAERS | |
| 535 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 536 | Immunosuppression | FAERS: 1 | US FAERS | |
| 537 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 538 | Impaired work ability | FAERS: 1 | US FAERS | |
| 539 | Impatience | FAERS: 1 | US FAERS | |
| 540 | Implant site pain | FAERS: 1 | US FAERS | |
| 541 | Incisional hernia | FAERS: 1 | US FAERS | |
| 542 | Incoherent | FAERS: 1 | US FAERS | |
| 543 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 544 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 545 | Influenza A virus test positive | FAERS: 1 | US FAERS | |
| 546 | Infusion site discomfort | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 547 | Infusion site induration | FAERS: 1 | US FAERS | |
| 548 | Infusion site inflammation | FAERS: 1 | US FAERS | |
| 549 | Infusion site phlebitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 550 | Infusion site rash | FAERS: 1 | US FAERS | |
| 551 | Initial insomnia | FAERS: 1 | US FAERS | |
| 552 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 553 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 554 | Insomnia related to another mental condition | FAERS: 1 | US FAERS | |
| 555 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 556 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 557 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 558 | Invasive Lobular Breast Carcinoma | FAERS: 1 | US FAERS | |
| 559 | Iron deficiency | FAERS: 1 | US FAERS | |
| 560 | Joint injury | FAERS: 1 | US FAERS | |
| 561 | Joint stiffness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 562 | Klebsiella sepsis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 563 | Laryngospasm | FAERS: 1 | US FAERS | |
| 564 | Laziness | FAERS: 1 | US FAERS | |
| 565 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 566 | Leukocytosis | FAERS: 1 | US FAERS | |
| 567 | Light chain analysis decreased | FAERS: 1 | US FAERS | |
| 568 | Limb prosthesis user | FAERS: 1 | US FAERS | |
| 569 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 570 | Lip swelling | FAERS: 1 | US FAERS | |
| 571 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 572 | Loose tooth | FAERS: 1 | US FAERS | |
| 573 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 574 | Lower respiratory tract infection viral | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 575 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 576 | Lymphoma | FAERS: 1 | US FAERS | |
| 577 | Mastoiditis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 578 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 579 | Meningitis | FAERS: 1 | US FAERS | |
| 580 | Miliaria | FAERS: 1 | US FAERS | |
| 581 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 582 | Mononeuritis | FAERS: 1 | US FAERS | |
| 583 | Monoplegia | FAERS: 1 | US FAERS | |
| 584 | Myoclonus | FAERS: 1 | US FAERS | |
| 585 | Myopia | FAERS: 1 | US FAERS | |
| 586 | Necrosis | FAERS: 1 | US FAERS | |
| 587 | Nephritic syndrome | FAERS: 1 | US FAERS | |
| 588 | Neuralgia | FAERS: 1 | US FAERS | |
| 589 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 590 | Nocturia | FAERS: 1 | US FAERS | |
| 591 | Nodule | FAERS: 1 | US FAERS | |
| 592 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 593 | Osteomalacia | FAERS: 1 | US FAERS | |
| 594 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 595 | Oxygen saturation abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 596 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 597 | Panic Disorder | FAERS: 1 | US FAERS | |
| 598 | Paranasal sinus hyposecretion | FAERS: 1 | US FAERS | |
| 599 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 600 | Periarthritis | FAERS: 1 | US FAERS | |
| 601 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 602 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 603 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 604 | Perseveration | FAERS: 1 | US FAERS | |
| 605 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 606 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 607 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 608 | Polyarthritis | FAERS: 1 | US FAERS | |
| 609 | Polydipsia | FAERS: 1 | US FAERS | |
| 610 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 611 | Post procedural complication | FAERS: 1 | US FAERS | |
| 612 | Proctitis | FAERS: 1 | US FAERS | |
| 613 | Product closure issue | FAERS: 1 | US FAERS | |
| 614 | Product contamination physical | FAERS: 1 | US FAERS | |
| 615 | Product dose omission | FAERS: 1 | US FAERS | |
| 616 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 617 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 618 | Pseudodementia | FAERS: 1 | US FAERS | |
| 619 | Pterygium | FAERS: 1 | US FAERS | |
| 620 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 621 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 622 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 623 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 624 | Purpura | FAERS: 1 | US FAERS | |
| 625 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 626 | Rales | FAERS: 1 | US FAERS | |
| 627 | Rectosigmoid cancer | FAERS: 1 | US FAERS | |
| 628 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 629 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 630 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 631 | Restlessness | FAERS: 1 | US FAERS | |
| 632 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 633 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 634 | Rhinalgia | FAERS: 1 | US FAERS | |
| 635 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 636 | Sciatica | FAERS: 1 | US FAERS | |
| 637 | Scleral cyst | FAERS: 1 | US FAERS | |
| 638 | Scleritis | FAERS: 1 | US FAERS | |
| 639 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 640 | Shunt occlusion | FAERS: 1 | US FAERS | |
| 641 | Skin necrosis | FAERS: 1 | US FAERS | |
| 642 | Skin reaction | FAERS: 1 | US FAERS | |
| 643 | Skull X-ray abnormal | FAERS: 1 | US FAERS | |
| 644 | Sneezing | FAERS: 1 | US FAERS | |
| 645 | Snoring | FAERS: 1 | US FAERS | |
| 646 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 647 | Spinal column injury | FAERS: 1 | US FAERS | |
| 648 | Steatohepatitis | FAERS: 1 | US FAERS | |
| 649 | Stem cell transplant | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 650 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 651 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 652 | Terminal state | FAERS: 1 | US FAERS | |
| 653 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 654 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 655 | Thirst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 656 | Thoracostomy | FAERS: 1 | US FAERS | |
| 657 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 658 | Thrombosis in device | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Thyroiditis | FAERS: 1 | US FAERS | |
| 660 | Tinea cruris | FAERS: 1 | US FAERS | |
| 661 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 662 | Tooth Infection | FAERS: 1 | US FAERS | |
| 663 | Tooth Loss | FAERS: 1 | US FAERS | |
| 664 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 665 | Trigeminal Nerve Disorder | FAERS: 1 | US FAERS | |
| 666 | Tuberculosis | FAERS: 1 | US FAERS | |
| 667 | Ultrasound breast abnormal | FAERS: 1 | US FAERS | |
| 668 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 669 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 670 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 671 | Uveitis | FAERS: 1 | US FAERS | |
| 672 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 673 | Vascular Access Complication | FAERS: 1 | US FAERS | |
| 674 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 675 | Vein collapse | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 676 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 677 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 678 | Ventricular failure | FAERS: 1 | US FAERS | |
| 679 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 680 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 681 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 682 | Vitamin D abnormal | FAERS: 1 | US FAERS | |
| 683 | Vitreous degeneration | FAERS: 1 | US FAERS | |
| 684 | Wound Complication | FAERS: 1 | US FAERS | |
| 685 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 686 | Anorexia | SIDER | ||
| 687 | Chest wall pain | SIDER | ||
| 688 | Found dead | SIDER | ||
| 689 | Frustration tolerance decreased | Canada Vigilance: 2 | Canada Vigilance | |
| 690 | Liver Neoplasms, Experimental | 24632418 | CTD | |
| 691 | Multiple Myeloma | 24389365 | CTD | |
| 692 | Neuritis | SIDER | ||
| 693 | Peripheral motor neuropathy | SIDER | ||
| 694 | Skin laceration | Canada Vigilance: 1 | Canada Vigilance | |
| 695 | Sleep disorder due to a general medical condition | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.