Tamsulosin
(ZZIZZTHXZRDOFM-XFULWGLBSA-N)
Structure
- SMILES
- CCOc1ccccc1OCCN[C@@H](Cc1ccc(c(c1)S(=O)(=O)N)OC)C.Cl
- Molecular Formula:
- C20H29ClN2O5S
- Molecular Weight:
- 444.973
- Log P:
- 5.3149
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 108.26
- CAS Number(s):
- 106463-17-6
Synonym(s)
1.
Tamsulosin
2.
5-(2-((2-(2-Ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide
3.
Flomax
4.
LY 253352
5.
LY-253352
6.
Tamsulosin Hydrochloride
7.
YM 617
8.
YM-617
External Link(s)
| MeSH | D000077409 |
| PubChem Compound | 5362376 25137847 |
| ChEBI | 9399 |
| CHEMBL | CHEMBL1200914 |
| KEGG | dr:D01024 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 584 Canada Vigilance: 31 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 373 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 3 | Nocturia | FAERS: 157 | US FAERS | |
| 4 | Procedural complication | FAERS: 132 | US FAERS | |
| 5 | Syncope | FAERS: 103 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 6 | Dysuria | FAERS: 90 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Hypotension | FAERS: 90 | US FAERS | |
| 8 | Headache | FAERS: 87 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Cataract | FAERS: 86 | US FAERS | |
| 10 | Fatigue | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Semen volume decreased | FAERS: 74 | US FAERS | |
| 12 | Product substitution issue | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Cataract operation complication | FAERS: 69 | US FAERS | |
| 14 | Floppy iris syndrome | FAERS: 64 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 15 | Urinary Retention | FAERS: 61 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Erectile dysfunction | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Nausea | FAERS: 59 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 18 | Back Pain | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Pruritus | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Asthenia | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Pain | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Retrograde ejaculation | FAERS: 48 | US FAERS | |
| 23 | Urinary Incontinence | FAERS: 47 | US FAERS | |
| 24 | Iridocele | FAERS: 45 | US FAERS | |
| 25 | Somnolence | FAERS: 43 | US FAERS | |
| 26 | Feeling abnormal | FAERS: 38 | US FAERS | |
| 27 | Middle insomnia | FAERS: 37 | US FAERS | |
| 28 | Urine flow decreased | FAERS: 36 | US FAERS | |
| 29 | Urticaria | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Vertigo | FAERS: 33 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Constipation | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Abdominal Pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Palpitations | FAERS: 27 | US FAERS | |
| 35 | Malaise | FAERS: 26 | US FAERS | |
| 36 | Sexual Dysfunction | FAERS: 24 | US FAERS | |
| 37 | Hypersensitivity | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Tremor | FAERS: 23 | US FAERS | |
| 39 | Cataract operation | FAERS: 22 | US FAERS | |
| 40 | Cerebrovascular accident | FAERS: 22 | US FAERS | |
| 41 | Chest Pain | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 42 | Presyncope | FAERS: 21 | US FAERS | |
| 43 | Tachycardia | FAERS: 21 | US FAERS | |
| 44 | Unevaluable event | FAERS: 21 | US FAERS | |
| 45 | Medication Error | FAERS: 20 | US FAERS | |
| 46 | Priapism | FAERS: 20 | US FAERS | |
| 47 | Urinary hesitation | FAERS: 20 | US FAERS | |
| 48 | Blindness | FAERS: 19 | US FAERS | |
| 49 | Anxiety | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Arthralgia | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Residual urine | FAERS: 18 | US FAERS | |
| 52 | Eye operation complication | FAERS: 17 | US FAERS | |
| 53 | Tinnitus | FAERS: 16 | US FAERS | |
| 54 | Vomiting | FAERS: 16 | US FAERS | |
| 55 | Pneumonia | FAERS: 15 | US FAERS | |
| 56 | Weight decreased | FAERS: 15 | US FAERS | |
| 57 | Adverse event | FAERS: 14 | US FAERS | |
| 58 | Benign Prostatic Hyperplasia | FAERS: 14 | US FAERS | |
| 59 | Chest discomfort | FAERS: 14 | US FAERS | |
| 60 | Epistaxis | FAERS: 14 | US FAERS | |
| 61 | Product quality issue | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Erythema | FAERS: 13 | US FAERS | |
| 63 | Inappropriate schedule of drug administration | FAERS: 13 | US FAERS | |
| 64 | Myalgia | FAERS: 12 | US FAERS | |
| 65 | Oropharyngeal pain | FAERS: 12 | US FAERS | |
| 66 | Visual disturbance | FAERS: 12 | US FAERS | |
| 67 | Angioedema | FAERS: 11 | US FAERS | |
| 68 | Blood urine present | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Myocardial Infarction | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Overdose | FAERS: 11 | US FAERS | |
| 71 | Post procedural complication | FAERS: 11 | US FAERS | |
| 72 | Visual Impairment | FAERS: 11 | US FAERS | |
| 73 | Blood glucose increased | FAERS: 10 | US FAERS | |
| 74 | Disorientation | FAERS: 10 | US FAERS | |
| 75 | Incontinence | FAERS: 10 | US FAERS | |
| 76 | Lethargy | FAERS: 10 | US FAERS | |
| 77 | Throat cancer | FAERS: 10 | US FAERS | |
| 78 | Urinary tract infection | FAERS: 10 | US FAERS | |
| 79 | Wrong technique in product usage process | FAERS: 10 | US FAERS | |
| 80 | Amnesia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 82 | Erection increased | FAERS: 9 | US FAERS | |
| 83 | Lip swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Nephrolithiasis | FAERS: 9 | US FAERS | |
| 85 | Rhinitis | FAERS: 9 | US FAERS | |
| 86 | Shock | FAERS: 9 | US FAERS | |
| 87 | Bradycardia | FAERS: 8 | US FAERS | |
| 88 | Chills | FAERS: 8 | US FAERS | |
| 89 | Dementia | FAERS: 8 | US FAERS | |
| 90 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 91 | Monoplegia | FAERS: 8 | US FAERS | |
| 92 | Product use issue | FAERS: 8 | US FAERS | |
| 93 | Skin laceration | FAERS: 8 | US FAERS | |
| 94 | Toothache | FAERS: 8 | US FAERS | |
| 95 | Alopecia | FAERS: 7 | US FAERS | |
| 96 | Anaphylactic shock | FAERS: 7 | US FAERS | |
| 97 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 98 | Anorexia | FAERS: 7 | US FAERS | |
| 99 | Anorgasmia | FAERS: 7 | US FAERS | |
| 100 | Asthma | FAERS: 7 | US FAERS | |
| 101 | Burning sensation | FAERS: 7 | US FAERS | |
| 102 | Cold sweat | FAERS: 7 | US FAERS | |
| 103 | Cystitis | FAERS: 7 | US FAERS | |
| 104 | Dysarthria | FAERS: 7 | US FAERS | |
| 105 | Dyspepsia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Eye pain | FAERS: 7 | US FAERS | |
| 107 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 108 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 109 | Macular degeneration | FAERS: 7 | US FAERS | |
| 110 | Nasal discomfort | FAERS: 7 | US FAERS | |
| 111 | Retinal Detachment | FAERS: 7 | US FAERS | |
| 112 | Accidental overdose | FAERS: 6 | US FAERS | |
| 113 | Bladder spasm | FAERS: 6 | US FAERS | |
| 114 | Discomfort | FAERS: 6 | US FAERS | |
| 115 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 116 | Dysgeusia | FAERS: 6 | US FAERS | |
| 117 | Intervertebral disc injury | FAERS: 6 | US FAERS | |
| 118 | Memory impairment | FAERS: 6 | US FAERS | |
| 119 | Musculoskeletal discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Myasthenia Gravis | FAERS: 6 | US FAERS | |
| 121 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 122 | Wheezing | FAERS: 6 | US FAERS | |
| 123 | jaundice | FAERS: 6 | US FAERS | |
| 124 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 125 | Anuria | FAERS: 5 | US FAERS | |
| 126 | Aphasia | FAERS: 5 | US FAERS | |
| 127 | Arthritis | FAERS: 5 | US FAERS | |
| 128 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 129 | Bedridden | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Breast tenderness | FAERS: 5 | US FAERS | |
| 131 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 132 | Chromaturia | FAERS: 5 | US FAERS | |
| 133 | Corneal degeneration | FAERS: 5 | US FAERS | |
| 134 | Dehydration | FAERS: 5 | US FAERS | |
| 135 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 136 | Dysphonia | FAERS: 5 | US FAERS | |
| 137 | Enuresis | FAERS: 5 | US FAERS | |
| 138 | Flatulence | FAERS: 5 | US FAERS | |
| 139 | Head discomfort | FAERS: 5 | US FAERS | |
| 140 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 141 | Megakaryocytes increased | FAERS: 5 | US FAERS | |
| 142 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 143 | Pallor | FAERS: 5 | US FAERS | |
| 144 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 145 | Sepsis | FAERS: 5 | US FAERS | |
| 146 | Sinusitis | FAERS: 5 | US FAERS | |
| 147 | Swelling | FAERS: 5 | US FAERS | |
| 148 | Thirst | FAERS: 5 | US FAERS | |
| 149 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 150 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 151 | Amaurosis Fugax | FAERS: 4 | US FAERS | |
| 152 | Bladder Neoplasm | FAERS: 4 | US FAERS | |
| 153 | Bladder pain | FAERS: 4 | US FAERS | |
| 154 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 155 | Bone pain | FAERS: 4 | US FAERS | |
| 156 | Choroidal Detachment | FAERS: 4 | US FAERS | |
| 157 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 158 | Diplopia | FAERS: 4 | US FAERS | |
| 159 | Disease recurrence | FAERS: 4 | US FAERS | |
| 160 | Drug administration error | FAERS: 4 | US FAERS | |
| 161 | Ear discomfort | FAERS: 4 | US FAERS | |
| 162 | Feeling jittery | FAERS: 4 | US FAERS | |
| 163 | Glaucoma | FAERS: 4 | US FAERS | |
| 164 | Hypersomnia | FAERS: 4 | US FAERS | |
| 165 | Impaired work ability | FAERS: 4 | US FAERS | |
| 166 | Male Orgasmic Disorder | FAERS: 4 | US FAERS | |
| 167 | Medication residue | FAERS: 4 | US FAERS | |
| 168 | Neck Pain | FAERS: 4 | US FAERS | |
| 169 | Night sweats | FAERS: 4 | US FAERS | |
| 170 | Nipple pain | FAERS: 4 | US FAERS | |
| 171 | Pelvic Pain | FAERS: 4 | US FAERS | |
| 172 | Polyuria | FAERS: 4 | US FAERS | |
| 173 | Product physical issue | FAERS: 4 | US FAERS | |
| 174 | Product size issue | FAERS: 4 | US FAERS | |
| 175 | Product use complaint | FAERS: 4 | US FAERS | |
| 176 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 177 | Productive Cough | FAERS: 4 | US FAERS | |
| 178 | Pupillary light reflex tests abnormal | FAERS: 4 | US FAERS | |
| 179 | Skin irritation | FAERS: 4 | US FAERS | |
| 180 | Sperm count decreased | FAERS: 4 | US FAERS | |
| 181 | Spontaneous penile erection | FAERS: 4 | US FAERS | |
| 182 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 183 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 184 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 185 | Vitreous loss | FAERS: 4 | US FAERS | |
| 186 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 187 | Abasia | FAERS: 3 | US FAERS | |
| 188 | Anger | FAERS: 3 | US FAERS | |
| 189 | Aortic Aneurysm | FAERS: 3 | US FAERS | |
| 190 | Apathy | FAERS: 3 | US FAERS | |
| 191 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 192 | Blood creatinine increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Cardiac Tamponade | FAERS: 3 | US FAERS | |
| 194 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 195 | Choking | FAERS: 3 | US FAERS | |
| 196 | Deafness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Delirium | FAERS: 3 | US FAERS | |
| 198 | Drug Dependence | FAERS: 3 | US FAERS | |
| 199 | Drug dose omission | FAERS: 3 | US FAERS | |
| 200 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 201 | Drug toxicity | FAERS: 3 | US FAERS | |
| 202 | Flushing | FAERS: 3 | US FAERS | |
| 203 | Fracture | FAERS: 3 | US FAERS | |
| 204 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 205 | Gastrointestinal candidiasis | FAERS: 3 | US FAERS | |
| 206 | Gastrostomy | FAERS: 3 | US FAERS | |
| 207 | Genital rash | FAERS: 3 | US FAERS | |
| 208 | Gluten sensitivity | FAERS: 3 | US FAERS | |
| 209 | Hepatitis | FAERS: 3 | US FAERS | |
| 210 | Hernia | FAERS: 3 | US FAERS | |
| 211 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 212 | Hypokinesia | FAERS: 3 | US FAERS | |
| 213 | Hypophagia | FAERS: 3 | US FAERS | |
| 214 | Incision site infection | FAERS: 3 | US FAERS | |
| 215 | Inflammation | FAERS: 3 | US FAERS | |
| 216 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 217 | Joint stiffness | FAERS: 3 | US FAERS | |
| 218 | Joint swelling | FAERS: 3 | US FAERS | |
| 219 | Limb discomfort | FAERS: 3 | US FAERS | |
| 220 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 221 | Malabsorption | FAERS: 3 | US FAERS | |
| 222 | Muscle tightness | FAERS: 3 | US FAERS | |
| 223 | Nervousness | FAERS: 3 | US FAERS | |
| 224 | Osteoporosis | FAERS: 3 | US FAERS | |
| 225 | Pancytopenia | FAERS: 3 | US FAERS | |
| 226 | Paranoia | FAERS: 3 | US FAERS | |
| 227 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 228 | Pneumothorax | FAERS: 3 | US FAERS | |
| 229 | Prostatic specific antigen decreased | FAERS: 3 | US FAERS | |
| 230 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 231 | Rash erythematous | FAERS: 3 | US FAERS | |
| 232 | Semen analysis abnormal | FAERS: 3 | US FAERS | |
| 233 | Sinus headache | FAERS: 3 | US FAERS | |
| 234 | Squamous cell carcinoma of skin | FAERS: 3 | US FAERS | |
| 235 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 236 | Stomatitis | FAERS: 3 | US FAERS | |
| 237 | Stress | FAERS: 3 | US FAERS | |
| 238 | Surgical failure | FAERS: 3 | US FAERS | |
| 239 | Throat irritation | FAERS: 3 | US FAERS | |
| 240 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 241 | muscle injury | FAERS: 3 | US FAERS | |
| 242 | treatment failure | FAERS: 3 | US FAERS | |
| 243 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 244 | Acne | FAERS: 2 | US FAERS | |
| 245 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 246 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 247 | Ageusia | FAERS: 2 | US FAERS | |
| 248 | Amblyopia | FAERS: 2 | US FAERS | |
| 249 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 250 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 251 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 252 | Anosmia | FAERS: 2 | US FAERS | |
| 253 | Blood Pressure | FAERS: 2 | US FAERS | |
| 254 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 255 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 256 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 257 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 258 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 259 | Crying | FAERS: 2 | US FAERS | |
| 260 | Dacryocystitis | FAERS: 2 | US FAERS | |
| 261 | Dacryostenosis acquired | FAERS: 2 | US FAERS | |
| 262 | Depressed mood | FAERS: 2 | US FAERS | |
| 263 | Dermatitis | FAERS: 2 | US FAERS | |
| 264 | Device occlusion | FAERS: 2 | US FAERS | |
| 265 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 266 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 267 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 268 | Dry skin | FAERS: 2 | US FAERS | |
| 269 | Ecchymosis | FAERS: 2 | US FAERS | |
| 270 | Eczema | FAERS: 2 | US FAERS | |
| 271 | Emotional disorder | FAERS: 2 | US FAERS | |
| 272 | Eructation | FAERS: 2 | US FAERS | |
| 273 | Eye inflammation | FAERS: 2 | US FAERS | |
| 274 | Eye irritation | FAERS: 2 | US FAERS | |
| 275 | Feeling Cold | FAERS: 2 | US FAERS | |
| 276 | Foreign body trauma | FAERS: 2 | US FAERS | |
| 277 | Hemiparesis | FAERS: 2 | US FAERS | |
| 278 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 279 | Hypotonic urinary bladder | FAERS: 2 | US FAERS | |
| 280 | Ileus | FAERS: 2 | US FAERS | |
| 281 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 282 | Incoherent | FAERS: 2 | US FAERS | |
| 283 | Infection | FAERS: 2 | US FAERS | |
| 284 | Influenza | FAERS: 2 | US FAERS | |
| 285 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 286 | Iris injury | FAERS: 2 | US FAERS | |
| 287 | Joint Instability | FAERS: 2 | US FAERS | |
| 288 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 289 | Laceration | FAERS: 2 | US FAERS | |
| 290 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 291 | Leukocytosis | FAERS: 2 | US FAERS | |
| 292 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 293 | Loss of bladder sensation | FAERS: 2 | US FAERS | |
| 294 | Malabsorption from administration site | FAERS: 2 | US FAERS | |
| 295 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 296 | Medication residue present | FAERS: 2 | US FAERS | |
| 297 | Mental status changes | FAERS: 2 | US FAERS | |
| 298 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 299 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 300 | Mydriasis | FAERS: 2 | US FAERS | |
| 301 | Myoglobinuria | FAERS: 2 | US FAERS | |
| 302 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 303 | Oral pain | FAERS: 2 | US FAERS | |
| 304 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 305 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 306 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 307 | Posterior capsule rupture | FAERS: 2 | US FAERS | |
| 308 | Pre-existing condition improved | FAERS: 2 | US FAERS | |
| 309 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 310 | Prostate cancer recurrent | FAERS: 2 | US FAERS | |
| 311 | Prostate examination abnormal | FAERS: 2 | US FAERS | |
| 312 | Pseudoexfoliation of lens capsule | FAERS: 2 | US FAERS | |
| 313 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 314 | Pupillary deformity | FAERS: 2 | US FAERS | |
| 315 | Renal pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Respiratory distress | FAERS: 2 | US FAERS | |
| 317 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 318 | Sensation of blood flow | FAERS: 2 | US FAERS | |
| 319 | Septic Shock | FAERS: 2 | US FAERS | |
| 320 | Skin reaction | FAERS: 2 | US FAERS | |
| 321 | Skin tightness | FAERS: 2 | US FAERS | |
| 322 | Sleep disorder due to general medical condition, insomnia type | FAERS: 2 | US FAERS | |
| 323 | Sneezing | FAERS: 2 | US FAERS | |
| 324 | Spermatozoa abnormal | FAERS: 2 | US FAERS | |
| 325 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 326 | Stridor | FAERS: 2 | US FAERS | |
| 327 | Stupor | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 328 | Suicide attempt | FAERS: 2 | US FAERS | |
| 329 | Tension Headache | FAERS: 2 | US FAERS | |
| 330 | Terminal dribbling | FAERS: 2 | US FAERS | |
| 331 | Thrombosis | FAERS: 2 | US FAERS | |
| 332 | Urinary tract obstruction | FAERS: 2 | US FAERS | |
| 333 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 334 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 335 | X-ray abnormal | FAERS: 2 | US FAERS | |
| 336 | insulinoma | FAERS: 2 | US FAERS | |
| 337 | Aase syndrome | FAERS: 1 | US FAERS | |
| 338 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 339 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 340 | Accidental exposure | FAERS: 1 | US FAERS | |
| 341 | Agitation | FAERS: 1 | US FAERS | |
| 342 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 343 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 344 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 345 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 346 | Aphagia | FAERS: 1 | US FAERS | |
| 347 | Aphonia | FAERS: 1 | US FAERS | |
| 348 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 349 | Arthropathy | FAERS: 1 | US FAERS | |
| 350 | Aspermia | FAERS: 1 | US FAERS | |
| 351 | Astigmatism | FAERS: 1 | US FAERS | |
| 352 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 353 | Azoospermia | FAERS: 1 | US FAERS | |
| 354 | Bacterial test | FAERS: 1 | US FAERS | |
| 355 | Bladder stenosis | FAERS: 1 | US FAERS | |
| 356 | Bladder transitional cell carcinoma metastatic | FAERS: 1 | US FAERS | |
| 357 | Blepharitis | FAERS: 1 | US FAERS | |
| 358 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 359 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 360 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 361 | Blood testosterone free decreased | FAERS: 1 | US FAERS | |
| 362 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 363 | Bronchitis | FAERS: 1 | US FAERS | |
| 364 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 365 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 366 | Carcinoma | FAERS: 1 | US FAERS | |
| 367 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 368 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 369 | Catheter management | FAERS: 1 | US FAERS | |
| 370 | Cerebral circulatory failure | FAERS: 1 | US FAERS | |
| 371 | Choking sensation | FAERS: 1 | US FAERS | |
| 372 | Cholangitis | FAERS: 1 | US FAERS | |
| 373 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 374 | Complication associated with device | FAERS: 1 | US FAERS | |
| 375 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 376 | Cyanosis | FAERS: 1 | US FAERS | |
| 377 | Cystitis escherichia | FAERS: 1 | US FAERS | |
| 378 | Cyst | FAERS: 1 | US FAERS | |
| 379 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 380 | Deformity | FAERS: 1 | US FAERS | |
| 381 | Dependence | FAERS: 1 | US FAERS | |
| 382 | Diverticulitis | FAERS: 1 | US FAERS | |
| 383 | Drooling | FAERS: 1 | US FAERS | |
| 384 | Drowning | FAERS: 1 | US FAERS | |
| 385 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 386 | Drug delivery system malfunction | FAERS: 1 | US FAERS | |
| 387 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 388 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 389 | Drug effect variable | FAERS: 1 | US FAERS | |
| 390 | Drug screen positive | FAERS: 1 | US FAERS | |
| 391 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 392 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 393 | Ear operation complication | FAERS: 1 | US FAERS | |
| 394 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 395 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 396 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 397 | Escherichia infection | FAERS: 1 | US FAERS | |
| 398 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 399 | Exophthalmos | FAERS: 1 | US FAERS | |
| 400 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 401 | Expulsion of medication | FAERS: 1 | US FAERS | |
| 402 | Eye complication associated with device | FAERS: 1 | US FAERS | |
| 403 | Facial Pain | FAERS: 1 | US FAERS | |
| 404 | False positive investigation result | FAERS: 1 | US FAERS | |
| 405 | Fear of falling | FAERS: 1 | US FAERS | |
| 406 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 407 | Folliculitis | FAERS: 1 | US FAERS | |
| 408 | Formication | FAERS: 1 | US FAERS | |
| 409 | Free prostate-specific antigen decreased | FAERS: 1 | US FAERS | |
| 410 | Gait inability | FAERS: 1 | US FAERS | |
| 411 | Gastrectomy | FAERS: 1 | US FAERS | |
| 412 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 413 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 414 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 415 | Genital discharge | FAERS: 1 | US FAERS | |
| 416 | Genital pain | FAERS: 1 | US FAERS | |
| 417 | Genital swelling | FAERS: 1 | US FAERS | |
| 418 | Gout | FAERS: 1 | US FAERS | |
| 419 | Guttate psoriasis | FAERS: 1 | US FAERS | |
| 420 | Head Banging | FAERS: 1 | US FAERS | |
| 421 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 422 | Hepatitis C | FAERS: 1 | US FAERS | |
| 423 | Hypogeusia | FAERS: 1 | US FAERS | |
| 424 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 425 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 426 | Immobile | FAERS: 1 | US FAERS | |
| 427 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 428 | Impatience | FAERS: 1 | US FAERS | |
| 429 | Inappropriate release of product for distribution | FAERS: 1 | US FAERS | |
| 430 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 431 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 432 | Intermittent Explosive Disorder | FAERS: 1 | US FAERS | |
| 433 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 434 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 435 | Intestinal stoma complication | FAERS: 1 | US FAERS | |
| 436 | Intraocular lens dislocation | FAERS: 1 | US FAERS | |
| 437 | Iritis | FAERS: 1 | US FAERS | |
| 438 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 439 | Joint injury | FAERS: 1 | US FAERS | |
| 440 | Laser Therapy | FAERS: 1 | US FAERS | |
| 441 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 442 | Limb injury | FAERS: 1 | US FAERS | |
| 443 | Loose tooth | FAERS: 1 | US FAERS | |
| 444 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 445 | Lymphomatoid Papulosis | FAERS: 1 | US FAERS | |
| 446 | Lymphoma | FAERS: 1 | US FAERS | |
| 447 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 448 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 449 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 450 | Medical device complication | FAERS: 1 | US FAERS | |
| 451 | Menorrhagia | FAERS: 1 | US FAERS | |
| 452 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 453 | Monoparesis | FAERS: 1 | US FAERS | |
| 454 | Mood swings | FAERS: 1 | US FAERS | |
| 455 | Multiple Pregnancy | FAERS: 1 | US FAERS | |
| 456 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 457 | Nephrectomy | FAERS: 1 | US FAERS | |
| 458 | Nerve injury | FAERS: 1 | US FAERS | |
| 459 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 460 | No adverse event | FAERS: 1 | US FAERS | |
| 461 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 462 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 463 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 464 | Oliguria | FAERS: 1 | US FAERS | |
| 465 | Onychomycosis | FAERS: 1 | US FAERS | |
| 466 | Opiates positive | FAERS: 1 | US FAERS | |
| 467 | Osteopenia | FAERS: 1 | US FAERS | |
| 468 | Painful ejaculation | FAERS: 1 | US FAERS | |
| 469 | Pancreatitis | FAERS: 1 | US FAERS | |
| 470 | Panic Disorder | FAERS: 1 | US FAERS | |
| 471 | Pemphigus | FAERS: 1 | US FAERS | |
| 472 | Pericarditis | FAERS: 1 | US FAERS | |
| 473 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 474 | Pharyngeal Stenosis | FAERS: 1 | US FAERS | |
| 475 | Pharyngeal erosion | FAERS: 1 | US FAERS | |
| 476 | Photophobia | FAERS: 1 | US FAERS | |
| 477 | Pleurisy | FAERS: 1 | US FAERS | |
| 478 | Polyarteritis Nodosa | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 479 | Polyarthritis | FAERS: 1 | US FAERS | |
| 480 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 481 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 482 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 483 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 484 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 485 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 486 | Presbyopia | FAERS: 1 | US FAERS | |
| 487 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 488 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 489 | Product counterfeit | FAERS: 1 | US FAERS | |
| 490 | Product dose omission | FAERS: 1 | US FAERS | |
| 491 | Product formulation issue | FAERS: 1 | US FAERS | |
| 492 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 493 | Product residue present | FAERS: 1 | US FAERS | |
| 494 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 495 | Prostatectomy | FAERS: 1 | US FAERS | |
| 496 | Prostatic pain | FAERS: 1 | US FAERS | |
| 497 | Psoriasis | FAERS: 1 | US FAERS | |
| 498 | Purpura | FAERS: 1 | US FAERS | |
| 499 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 500 | Radiation injury | FAERS: 1 | US FAERS | |
| 501 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 502 | Regurgitation | FAERS: 1 | US FAERS | |
| 503 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 504 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 505 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 506 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 507 | Restlessness | FAERS: 1 | US FAERS | |
| 508 | Retching | FAERS: 1 | US FAERS | |
| 509 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 510 | Rhinalgia | FAERS: 1 | US FAERS | |
| 511 | Rhonchi | FAERS: 1 | US FAERS | |
| 512 | Rosacea | FAERS: 1 | US FAERS | |
| 513 | Salmonella test positive | FAERS: 1 | US FAERS | |
| 514 | Semen volume abnormal | FAERS: 1 | US FAERS | |
| 515 | Semen volume increased | FAERS: 1 | US FAERS | |
| 516 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 517 | Skeletal injury | FAERS: 1 | US FAERS | |
| 518 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 519 | Skin lesion | FAERS: 1 | US FAERS | |
| 520 | Skin necrosis | FAERS: 1 | US FAERS | |
| 521 | Sluggishness | FAERS: 1 | US FAERS | |
| 522 | Snoring | FAERS: 1 | US FAERS | |
| 523 | Somnambulism | FAERS: 1 | US FAERS | |
| 524 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 525 | Sperm count abnormal | FAERS: 1 | US FAERS | |
| 526 | Spermatozoa morphology abnormal | FAERS: 1 | US FAERS | |
| 527 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 528 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 529 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 530 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 531 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 532 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 533 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 534 | Tension | FAERS: 1 | US FAERS | |
| 535 | Testis discomfort | FAERS: 1 | US FAERS | |
| 536 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 537 | Therapeutic reaction time decreased | FAERS: 1 | US FAERS | |
| 538 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 539 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 540 | Therapy cessation | FAERS: 1 | US FAERS | |
| 541 | Thermal burn | FAERS: 1 | US FAERS | |
| 542 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 543 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 544 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 545 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 546 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 547 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 548 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 549 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 550 | Urine cannabinoids increased | FAERS: 1 | US FAERS | |
| 551 | Urine ketone body | FAERS: 1 | US FAERS | |
| 552 | Urine output increased | FAERS: 1 | US FAERS | |
| 553 | Vasculitis | FAERS: 1 | US FAERS | |
| 554 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 555 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 556 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 557 | Vitrectomy | FAERS: 1 | US FAERS | |
| 558 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 559 | Vitreous prolapse | FAERS: 1 | US FAERS | |
| 560 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 561 | cancer surgery | FAERS: 1 | US FAERS | |
| 562 | prostatitis | FAERS: 1 | US FAERS | |
| 563 | Pharyngeal swelling | Canada Vigilance: 2 | Canada Vigilance | |
| 564 | Product quality control issue | Canada Vigilance: 1 | Canada Vigilance | |
| 565 | Prostatism | Canada Vigilance: 1 | Canada Vigilance | |
| 566 | Soft tissue inflammation | Canada Vigilance: 1 | Canada Vigilance | |
| 567 | Therapeutic product cross-reactivity | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.