Hydroxyzine
(ZQDWXGKKHFNSQK-UHFFFAOYSA-N)
Structure
- SMILES
- OCCOCCN1CCN(CC1)C(c1ccc(cc1)Cl)c1ccccc1
- Type(s)
- Approved
- ATC code(s)
- N05BB01; N05BB51
- Molecular Formula:
- C21H27ClN2O2
- Molecular Weight:
- 374.904
- Log P:
- 2.9317
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 35.94
- CAS Number(s):
- 68-88-2
Synonym(s)
1.
Hydroxyzine
2.
2-(2-(4-((4-Chlorophenyl)phenylmethyl)-1-piperazinyl)ethoxy)ethanol
3.
Atarax
4.
Durrax
5.
Hydroxyzine Dihydrochloride
6.
Hydroxyzine Hydrochloride
7.
Hydroxyzine Pamoate
8.
Orgatrax
9.
Vistaril
10.
Pamoate, Hydroxyzine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Suicide attempt | FAERS: 30 | US FAERS | |
| 2 | Drug ineffective | FAERS: 26 | OFFSIDES US FAERS | |
| 3 | Drug exposure during pregnancy | FAERS: 19 | US FAERS | |
| 4 | Overdose | FAERS: 19 | OFFSIDES US FAERS | |
| 5 | Anxiety | FAERS: 17 | OFFSIDES US FAERS | |
| 6 | Pruritus | FAERS: 15 Canada Vigilance: 3 | 11034010 | CTD Canada Vigilance US FAERS |
| 7 | Injection site necrosis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Headache | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 9 | Somnolence | FAERS: 13 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 10 | Fatigue | FAERS: 12 | OFFSIDES US FAERS | |
| 11 | Feeling abnormal | FAERS: 10 | OFFSIDES US FAERS | |
| 12 | Medication Error | FAERS: 10 | US FAERS | |
| 13 | Agitation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Incorrect route of drug administration | FAERS: 8 | US FAERS | |
| 15 | Injection site pain | FAERS: 8 | US FAERS | |
| 16 | Nausea | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Tremor | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Urticaria | FAERS: 8 Canada Vigilance: 4 | 1683191 2569996 17632232 | CTD SIDER Canada Vigilance US FAERS |
| 19 | Dizziness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Hypersomnia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Vomiting | FAERS: 7 | US FAERS | |
| 22 | Amnesia | FAERS: 6 | OFFSIDES US FAERS | |
| 23 | Completed Suicide | FAERS: 6 | US FAERS | |
| 24 | Hypersensitivity | FAERS: 6 Canada Vigilance: 1 | 2570798 | CTD SIDER Canada Vigilance US FAERS |
| 25 | Product substitution issue | FAERS: 6 | US FAERS | |
| 26 | Sepsis | FAERS: 6 | US FAERS | |
| 27 | Skin necrosis | FAERS: 6 | US FAERS | |
| 28 | Abdominal Pain | FAERS: 5 | OFFSIDES US FAERS | |
| 29 | Angioedema | FAERS: 5 | US FAERS | |
| 30 | Depressed Level of Consciousness | FAERS: 5 | SIDER US FAERS | |
| 31 | Drug ineffective for unapproved indication | FAERS: 5 | US FAERS | |
| 32 | Malaise | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Malnutrition | FAERS: 5 | US FAERS | |
| 34 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 35 | Swelling | FAERS: 5 | US FAERS | |
| 36 | Urinary Retention | FAERS: 5 | US FAERS | |
| 37 | Bipolar Disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 38 | Drug screen positive | FAERS: 4 | US FAERS | |
| 39 | Limb discomfort | FAERS: 4 | US FAERS | |
| 40 | Lip swelling | FAERS: 4 | US FAERS | |
| 41 | Mental status changes | FAERS: 4 | US FAERS | |
| 42 | Parotitis | FAERS: 4 | US FAERS | |
| 43 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 44 | Psoriasis | FAERS: 4 | OFFSIDES US FAERS | |
| 45 | Syncope | FAERS: 4 Canada Vigilance: 1 | 19057127 | CTD Canada Vigilance US FAERS |
| 46 | Tachycardia | FAERS: 4 | 5690527 | CTD US FAERS |
| 47 | Abdominal Infection | FAERS: 3 | US FAERS | |
| 48 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 49 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 50 | Anger | FAERS: 3 | OFFSIDES US FAERS | |
| 51 | Cellulitis | FAERS: 3 | OFFSIDES US FAERS | |
| 52 | Delirium | FAERS: 3 | US FAERS | |
| 53 | Drug administration error | FAERS: 3 | US FAERS | |
| 54 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 55 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 56 | Erythema | FAERS: 3 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 57 | Fibromyalgia | FAERS: 3 | OFFSIDES US FAERS | |
| 58 | Flatulence | FAERS: 3 | US FAERS | |
| 59 | General physical health deterioration | FAERS: 3 | OFFSIDES US FAERS | |
| 60 | Hepatorenal Syndrome | FAERS: 3 | US FAERS | |
| 61 | Inflammation | FAERS: 3 | US FAERS | |
| 62 | Lethargy | FAERS: 3 | US FAERS | |
| 63 | Middle insomnia | FAERS: 3 | OFFSIDES US FAERS | |
| 64 | Necrosis | FAERS: 3 | US FAERS | |
| 65 | Neonatal disorder | FAERS: 3 | US FAERS | |
| 66 | Oropharyngeal pain | FAERS: 3 | OFFSIDES US FAERS | |
| 67 | Pain | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 68 | Pallor | FAERS: 3 | OFFSIDES US FAERS | |
| 69 | Palpitations | FAERS: 3 | US FAERS | |
| 70 | Poisoning | FAERS: 3 | US FAERS | |
| 71 | Product use issue | FAERS: 3 | US FAERS | |
| 72 | Screaming | FAERS: 3 | US FAERS | |
| 73 | Shock | FAERS: 3 | US FAERS | |
| 74 | Status Epilepticus | FAERS: 3 | US FAERS | |
| 75 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 76 | Alopecia | FAERS: 2 | OFFSIDES US FAERS | |
| 77 | Anaphylactoid Reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Arthralgia | FAERS: 2 | US FAERS | |
| 79 | Asthenia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 80 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 81 | Back Pain | FAERS: 2 | US FAERS | |
| 82 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 83 | Bronchospasm | FAERS: 2 | US FAERS | |
| 84 | Cerebral vasoconstriction | FAERS: 2 | US FAERS | |
| 85 | Chemical submission | FAERS: 2 | US FAERS | |
| 86 | Chest Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 87 | Chest discomfort | FAERS: 2 | US FAERS | |
| 88 | Chromaturia | FAERS: 2 | US FAERS | |
| 89 | Constipation | FAERS: 2 | US FAERS | |
| 90 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 91 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 92 | Dementia | FAERS: 2 | US FAERS | |
| 93 | Disseminated Intravascular Coagulation | FAERS: 2 | OFFSIDES US FAERS | |
| 94 | Drug Dependence | FAERS: 2 | US FAERS | |
| 95 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 96 | Drug exposure via breast milk | FAERS: 2 | US FAERS | |
| 97 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 98 | Drug toxicity | FAERS: 2 | OFFSIDES US FAERS | |
| 99 | Dysphonia | FAERS: 2 | US FAERS | |
| 100 | Eosinophilia | FAERS: 2 | US FAERS | |
| 101 | Fat necrosis | FAERS: 2 | US FAERS | |
| 102 | Formication | FAERS: 2 | OFFSIDES US FAERS | |
| 103 | Gastric Fistula | FAERS: 2 | US FAERS | |
| 104 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 105 | Hormone level abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 106 | Hyperparathyroidism | FAERS: 2 | US FAERS | |
| 107 | Injection Site Reaction | FAERS: 2 | US FAERS | |
| 108 | Injection site ulcer | FAERS: 2 | US FAERS | |
| 109 | Meconium plug syndrome | FAERS: 2 | US FAERS | |
| 110 | Medication residue | FAERS: 2 | US FAERS | |
| 111 | Memory impairment | FAERS: 2 | US FAERS | |
| 112 | Mental impairment | FAERS: 2 | OFFSIDES US FAERS | |
| 113 | Muscle necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 114 | Myositis | FAERS: 2 | US FAERS | |
| 115 | No adverse event | FAERS: 2 | US FAERS | |
| 116 | Oliguria | FAERS: 2 | US FAERS | |
| 117 | Paranoia | FAERS: 2 | US FAERS | |
| 118 | Pneumonia | FAERS: 2 | US FAERS | |
| 119 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 120 | Product quality issue | FAERS: 2 | US FAERS | |
| 121 | Radial nerve palsy | FAERS: 2 | US FAERS | |
| 122 | Respiratory distress | FAERS: 2 | US FAERS | |
| 123 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 124 | Restlessness | FAERS: 2 | US FAERS | |
| 125 | Self-induced vomiting | FAERS: 2 | US FAERS | |
| 126 | Septic Shock | FAERS: 2 | US FAERS | |
| 127 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 128 | Sopor | FAERS: 2 | US FAERS | |
| 129 | Stress | FAERS: 2 | OFFSIDES US FAERS | |
| 130 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 131 | Transaminases increased | FAERS: 2 | OFFSIDES US FAERS | |
| 132 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 133 | Vein pain | FAERS: 2 | US FAERS | |
| 134 | Visual Impairment | FAERS: 2 | US FAERS | |
| 135 | Weight decreased | FAERS: 2 | US FAERS | |
| 136 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 137 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 138 | Accidental overdose | FAERS: 1 | US FAERS | |
| 139 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 140 | Ammonia increased | FAERS: 1 | US FAERS | |
| 141 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 142 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 143 | Apathy | FAERS: 1 | OFFSIDES US FAERS | |
| 144 | Aphasia | FAERS: 1 | US FAERS | |
| 145 | Application site necrosis | FAERS: 1 | US FAERS | |
| 146 | Arteriosclerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 147 | Arthritis | FAERS: 1 | OFFSIDES US FAERS | |
| 148 | Arthropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 149 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 150 | Asthma | FAERS: 1 | US FAERS | |
| 151 | Bedridden | FAERS: 1 | OFFSIDES US FAERS | |
| 152 | Bicytopenia | FAERS: 1 | US FAERS | |
| 153 | Blepharospasm | FAERS: 1 | US FAERS | |
| 154 | Blood Pressure | FAERS: 1 | US FAERS | |
| 155 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 156 | Blood glucose decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 157 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 158 | Bronchial Obstruction | FAERS: 1 | OFFSIDES US FAERS | |
| 159 | Burning sensation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Cataract | FAERS: 1 | OFFSIDES US FAERS | |
| 161 | Catatonia | FAERS: 1 | 15782600 | CTD US FAERS |
| 162 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 163 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 164 | Chills | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 166 | Choking | FAERS: 1 | OFFSIDES US FAERS | |
| 167 | Circumstance or information capable of leading to medication error | FAERS: 1 | OFFSIDES US FAERS | |
| 168 | Clonus | FAERS: 1 | US FAERS | |
| 169 | Clumsiness | FAERS: 1 | US FAERS | |
| 170 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 171 | Congenital heart valve disorder | FAERS: 1 | US FAERS | |
| 172 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 173 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 174 | Crying | FAERS: 1 | US FAERS | |
| 175 | Cyanosis | FAERS: 1 | US FAERS | |
| 176 | Deafness | FAERS: 1 | US FAERS | |
| 177 | Dehydration | FAERS: 1 | OFFSIDES US FAERS | |
| 178 | Discomfort | FAERS: 1 | US FAERS | |
| 179 | Disease Progression | FAERS: 1 | US FAERS | |
| 180 | Disorientation | FAERS: 1 | US FAERS | |
| 181 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 182 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 183 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 184 | Drug level increased | FAERS: 1 | US FAERS | |
| 185 | Drug resistance | FAERS: 1 | US FAERS | |
| 186 | Dry skin | FAERS: 1 | OFFSIDES US FAERS | |
| 187 | Dysgeusia | FAERS: 1 | US FAERS | |
| 188 | Dysuria | FAERS: 1 | US FAERS | |
| 189 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 190 | Epilepsy | FAERS: 1 | US FAERS | |
| 191 | Eructation | FAERS: 1 | US FAERS | |
| 192 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 193 | Eschar | FAERS: 1 | US FAERS | |
| 194 | Excoriation | FAERS: 1 | OFFSIDES US FAERS | |
| 195 | Expired product administered | FAERS: 1 | US FAERS | |
| 196 | Extravasation | FAERS: 1 | US FAERS | |
| 197 | Eye irritation | FAERS: 1 | US FAERS | |
| 198 | False positive investigation result | FAERS: 1 | US FAERS | |
| 199 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 200 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 201 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 202 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 203 | Glaucoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 204 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 205 | Growth retardation | FAERS: 1 | US FAERS | |
| 206 | Homicide | FAERS: 1 | US FAERS | |
| 207 | Hunger | FAERS: 1 | US FAERS | |
| 208 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 209 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 210 | Injection site thrombosis | FAERS: 1 | US FAERS | |
| 211 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 212 | Intentional misuse | FAERS: 1 | US FAERS | |
| 213 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 214 | Intentional self-injury | FAERS: 1 | OFFSIDES US FAERS | |
| 215 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 216 | Joint injury | FAERS: 1 | US FAERS | |
| 217 | Joint swelling | FAERS: 1 | US FAERS | |
| 218 | Leukopenia | FAERS: 1 | US FAERS | |
| 219 | Mastication disorder | FAERS: 1 | US FAERS | |
| 220 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 221 | Myalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 222 | Mydriasis | FAERS: 1 | US FAERS | |
| 223 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 224 | Neck Pain | FAERS: 1 | US FAERS | |
| 225 | Neonatal oversedation | FAERS: 1 | US FAERS | |
| 226 | Nerve injury | FAERS: 1 | US FAERS | |
| 227 | Nervousness | FAERS: 1 | US FAERS | |
| 228 | Neutropenia | FAERS: 1 | US FAERS | |
| 229 | Neutrophilic dermatosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Nodule | FAERS: 1 | US FAERS | |
| 231 | Obesity surgery | FAERS: 1 | US FAERS | |
| 232 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 233 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 234 | Osteitis | FAERS: 1 | US FAERS | |
| 235 | Painful ejaculation | FAERS: 1 | US FAERS | |
| 236 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 237 | Panic Disorder | FAERS: 1 | US FAERS | |
| 238 | Papule | FAERS: 1 | US FAERS | |
| 239 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 240 | Personality Change | FAERS: 1 | US FAERS | |
| 241 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 242 | Phlebitis | FAERS: 1 | 5690527 | CTD US FAERS |
| 243 | Poor sucking reflex | FAERS: 1 | US FAERS | |
| 244 | Priapism | FAERS: 1 | 7969858 | CTD US FAERS |
| 245 | Product barcode issue | FAERS: 1 | US FAERS | |
| 246 | Product physical issue | FAERS: 1 | US FAERS | |
| 247 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 248 | Pseudoparalysis | FAERS: 1 | US FAERS | |
| 249 | Purpura | FAERS: 1 | US FAERS | |
| 250 | Rash erythematous | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 251 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 252 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 253 | Reversible cerebral vasoconstriction syndrome | FAERS: 1 | US FAERS | |
| 254 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 255 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 256 | Skin Erosion | FAERS: 1 | US FAERS | |
| 257 | Skin Induration | FAERS: 1 | OFFSIDES US FAERS | |
| 258 | Skin laceration | FAERS: 1 | US FAERS | |
| 259 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 260 | Skin reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Skin test positive | FAERS: 1 | US FAERS | |
| 262 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 263 | Somnambulism | FAERS: 1 | US FAERS | |
| 264 | Stillbirth | FAERS: 1 | US FAERS | |
| 265 | Subcorneal pustular dermatosis | FAERS: 1 | US FAERS | |
| 266 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 267 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 268 | Tardive Dyskinesia | FAERS: 1 | OFFSIDES US FAERS | |
| 269 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 270 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 271 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 272 | Thrombosis | FAERS: 1 | US FAERS | |
| 273 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 274 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 275 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 276 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 277 | Urine output increased | FAERS: 1 | US FAERS | |
| 278 | Vasculitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 280 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 281 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 282 | Visual disturbance | FAERS: 1 | OFFSIDES US FAERS | |
| 283 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 284 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 285 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 286 | nervous system disorder | FAERS: 1 | US FAERS | |
| 287 | Abdominal symptom | OFFSIDES | ||
| 288 | Abnormal vision | OFFSIDES | ||
| 289 | Acid reflux | OFFSIDES | ||
| 290 | Actinomycosis | OFFSIDES | ||
| 291 | Activities of daily living impaired | OFFSIDES | ||
| 292 | Acute respiratory failure | OFFSIDES | ||
| 293 | Acute sinusitis | OFFSIDES | ||
| 294 | Adenoma | OFFSIDES | ||
| 295 | Adverse event | OFFSIDES | ||
| 296 | Agoraphobia | OFFSIDES | ||
| 297 | Agraphia | OFFSIDES | ||
| 298 | Albumin globulin ratio abnormal | OFFSIDES | ||
| 299 | Allergy to arthropod sting | OFFSIDES | ||
| 300 | Alveolitis | OFFSIDES | ||
| 301 | Anhedonia | OFFSIDES | ||
| 302 | Anorexia | OFFSIDES | ||
| 303 | Anosmia | OFFSIDES | ||
| 304 | Anti-erythropoietin antibody | OFFSIDES | ||
| 305 | Anxiety Disorders | 7781586 | CTD | |
| 306 | Application site erosion | OFFSIDES | ||
| 307 | Application site pain | OFFSIDES | ||
| 308 | Application site rash | OFFSIDES | ||
| 309 | Application site vesicles | OFFSIDES | ||
| 310 | Asbestosis | OFFSIDES | ||
| 311 | Ascites | OFFSIDES | ||
| 312 | Aspiration Pneumonia | OFFSIDES | ||
| 313 | Ataxia | Canada Vigilance: 1 | Canada Vigilance | |
| 314 | Atelectasis | OFFSIDES | ||
| 315 | Atrial tachycardia | OFFSIDES | ||
| 316 | Aura | OFFSIDES | ||
| 317 | Bacterial test positive | OFFSIDES | ||
| 318 | Balanitis | OFFSIDES | ||
| 319 | Basal cell carcinoma | OFFSIDES | ||
| 320 | Bed rest | OFFSIDES | ||
| 321 | Bile Duct Stenosis | OFFSIDES | ||
| 322 | Biliary dilatation | OFFSIDES | ||
| 323 | Blood Glucose | OFFSIDES | ||
| 324 | Blood alkaline phosphatase increased | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 325 | Blood amylase increased | OFFSIDES | ||
| 326 | Blood chloride decreased | OFFSIDES | ||
| 327 | Blood cholesterol | OFFSIDES | ||
| 328 | Blood count abnormal | OFFSIDES | ||
| 329 | Blood creatine increased | OFFSIDES | ||
| 330 | Blood creatinine decreased | OFFSIDES | ||
| 331 | Blood creatinine increased | OFFSIDES | ||
| 332 | Blood fibrinogen | OFFSIDES | ||
| 333 | Blood homocysteine | OFFSIDES | ||
| 334 | Blood potassium decreased | OFFSIDES | ||
| 335 | Blood sodium increased | OFFSIDES | ||
| 336 | Blood sodium | OFFSIDES | ||
| 337 | Blood triglycerides increased | OFFSIDES | ||
| 338 | Blurred vision | OFFSIDES | ||
| 339 | Bone scan abnormal | OFFSIDES | ||
| 340 | Bradycardia | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 341 | Brain Death | OFFSIDES | ||
| 342 | Brain natriuretic peptide increased | OFFSIDES | ||
| 343 | Bronchitis | OFFSIDES | ||
| 344 | Bruxism | Canada Vigilance: 1 | Canada Vigilance | |
| 345 | Calciphylaxis | OFFSIDES | ||
| 346 | Cardiac Death | OFFSIDES | ||
| 347 | Cardiac function test abnormal | OFFSIDES | ||
| 348 | Carotid artery occlusion | OFFSIDES | ||
| 349 | Catheter site pain | OFFSIDES | ||
| 350 | Cerebral artery stenosis | OFFSIDES | ||
| 351 | Cholecystitis | OFFSIDES | ||
| 352 | Chorea | 20108362 | CTD | |
| 353 | Choroidal Detachment | OFFSIDES | ||
| 354 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 355 | Cirrhosis | OFFSIDES | ||
| 356 | Coagulation time shortened | OFFSIDES | ||
| 357 | Cold sweat | OFFSIDES | ||
| 358 | Compression fracture | OFFSIDES | ||
| 359 | Concomitant disease progression | OFFSIDES | ||
| 360 | Confabulation | OFFSIDES | ||
| 361 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 362 | Contact Dermatitis | OFFSIDES | ||
| 363 | Coronary angioplasty | OFFSIDES | ||
| 364 | Craniotomy | OFFSIDES | ||
| 365 | Cubital Tunnel Syndrome | OFFSIDES | ||
| 366 | Culture positive | OFFSIDES | ||
| 367 | Cutaneous Candidiasis | OFFSIDES | ||
| 368 | Cytolytic hepatitis | OFFSIDES | ||
| 369 | Debridement | OFFSIDES | ||
| 370 | Demyelination | OFFSIDES | ||
| 371 | Dental prosthesis placement | OFFSIDES | ||
| 372 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 373 | Device leakage | OFFSIDES | ||
| 374 | Diabetes | OFFSIDES | ||
| 375 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 376 | Diabetic Nephropathy | OFFSIDES | ||
| 377 | Diabetic Retinopathy | OFFSIDES | ||
| 378 | Diarrhea | OFFSIDES | ||
| 379 | Diastolic dysfunction | OFFSIDES | ||
| 380 | Diplopia | OFFSIDES | ||
| 381 | Disorders of Excessive Somnolence | 2148177 | CTD | |
| 382 | Diverticulitis | OFFSIDES | ||
| 383 | Drowsiness | OFFSIDES SIDER | ||
| 384 | Drug abuser | OFFSIDES | ||
| 385 | Drug withdrawal headache | OFFSIDES | ||
| 386 | Ductus arteriosus premature closure | OFFSIDES | ||
| 387 | Dysthymic Disorder | OFFSIDES | ||
| 388 | Dystonia | OFFSIDES | ||
| 389 | Ectropion | OFFSIDES | ||
| 390 | Eczema | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 391 | Ejection Fraction Decreased | OFFSIDES | ||
| 392 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 393 | Embolism | OFFSIDES | ||
| 394 | Emotional disorder | OFFSIDES | ||
| 395 | Emotional distress | OFFSIDES | ||
| 396 | Endodontic procedure | OFFSIDES | ||
| 397 | Enterocolitis bacterial | OFFSIDES | ||
| 398 | Enuresis | OFFSIDES | ||
| 399 | Escherichia infection | OFFSIDES | ||
| 400 | Escherichia urinary tract infection | OFFSIDES | ||
| 401 | Esophageal Stenosis | OFFSIDES | ||
| 402 | Euphoric mood | OFFSIDES | ||
| 403 | Exfoliative rash | OFFSIDES | ||
| 404 | Fatty Liver | OFFSIDES | ||
| 405 | Feeling Cold | OFFSIDES | ||
| 406 | Fixed drug eruption | SIDER | ||
| 407 | Frustration | OFFSIDES | ||
| 408 | Gallop rhythm present | OFFSIDES | ||
| 409 | Gastric pH decreased | OFFSIDES | ||
| 410 | Gastrinoma | OFFSIDES | ||
| 411 | Gastroenteritis | OFFSIDES | ||
| 412 | Gastrointestinal hypomotility | OFFSIDES | ||
| 413 | Granulocytosis | OFFSIDES | ||
| 414 | Grip strength | OFFSIDES | ||
| 415 | Haemoconcentration | OFFSIDES | ||
| 416 | Hepatic vein occlusion | OFFSIDES | ||
| 417 | Hepatomegaly | 28108177 | CTD | |
| 418 | Hyperkeratosis | OFFSIDES | ||
| 419 | Hyperpigmentation | OFFSIDES | ||
| 420 | Hyperreflexia | OFFSIDES | ||
| 421 | Hyperventilation | OFFSIDES | ||
| 422 | Hypoparathyroidism | OFFSIDES | ||
| 423 | Hypotension | Canada Vigilance: 2 | 5690527 | CTD SIDER Canada Vigilance |
| 424 | Hypoxia | OFFSIDES | ||
| 425 | Immunosuppressant drug level | OFFSIDES | ||
| 426 | Incontinence | OFFSIDES | ||
| 427 | Increased upper airway secretion | OFFSIDES | ||
| 428 | Infection | OFFSIDES | ||
| 429 | Injection site inflammation | Canada Vigilance: 1 | Canada Vigilance | |
| 430 | Insulin-requiring type 2 diabetes mellitus | OFFSIDES | ||
| 431 | Intertrigo | OFFSIDES | ||
| 432 | Intervertebral disc disorder | OFFSIDES | ||
| 433 | Jugular vein distension | OFFSIDES | ||
| 434 | Keratitis sicca | OFFSIDES | ||
| 435 | Kidney Failure | OFFSIDES | ||
| 436 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 437 | Leukoencephalopathy | OFFSIDES | ||
| 438 | Leukopenia neonatal | OFFSIDES | ||
| 439 | Long QT Syndrome | 19057127 | CTD | |
| 440 | Malignant neoplasm progression | OFFSIDES | ||
| 441 | Metrorrhagia | Canada Vigilance: 1 | Canada Vigilance | |
| 442 | Mitral Valve Stenosis | OFFSIDES | ||
| 443 | Muscle Weakness | OFFSIDES | ||
| 444 | Muscle strain | OFFSIDES | ||
| 445 | Muscle tightness | OFFSIDES | ||
| 446 | Musculoskeletal chest pain | OFFSIDES | ||
| 447 | Myelocytosis | OFFSIDES | ||
| 448 | Myelodysplasia | OFFSIDES | ||
| 449 | Myoglobinaemia | OFFSIDES | ||
| 450 | Myopia | OFFSIDES | ||
| 451 | Nasopharyngitis | OFFSIDES | ||
| 452 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 453 | Nephrolithiasis | OFFSIDES | ||
| 454 | Nervous tension | OFFSIDES | ||
| 455 | Neuroblastoma recurrent | OFFSIDES | ||
| 456 | Neurodermatitis | OFFSIDES | ||
| 457 | Neuroleptic Malignant Syndrome | OFFSIDES | ||
| 458 | Neutropenic colitis | OFFSIDES | ||
| 459 | Neutrophil count decreased | OFFSIDES | ||
| 460 | Nocturia | OFFSIDES | ||
| 461 | Non-cardiac chest pain | OFFSIDES | ||
| 462 | Ocular icterus | OFFSIDES | ||
| 463 | Oculomucocutaneous syndrome | OFFSIDES | ||
| 464 | Open reduction of fracture | OFFSIDES | ||
| 465 | Open wound | OFFSIDES | ||
| 466 | Oral discharge | OFFSIDES | ||
| 467 | Oral mucosal hypertrophy | OFFSIDES | ||
| 468 | Osteomyelitis | OFFSIDES | ||
| 469 | Osteopenia | OFFSIDES | ||
| 470 | Osteoporosis | OFFSIDES | ||
| 471 | PCO2 decreased | OFFSIDES | ||
| 472 | Pancreatic Duct Stenosis | OFFSIDES | ||
| 473 | Parent-child problem | OFFSIDES | ||
| 474 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 475 | Periarthritis | OFFSIDES | ||
| 476 | Pericardial effusion | OFFSIDES | ||
| 477 | Pertussis | OFFSIDES | ||
| 478 | Pharyngitis | Canada Vigilance: 1 | Canada Vigilance | |
| 479 | Phonophobia | OFFSIDES | ||
| 480 | Photodermatosis | OFFSIDES | ||
| 481 | Polyhydramnios | OFFSIDES | ||
| 482 | Polysubstance dependence | OFFSIDES | ||
| 483 | Polyuria | OFFSIDES | ||
| 484 | Poriomania | OFFSIDES | ||
| 485 | Prolapse repair | OFFSIDES | ||
| 486 | Protein total decreased | OFFSIDES | ||
| 487 | Pulmonary Hypertension | OFFSIDES | ||
| 488 | Pulmonary arterial hypertension | OFFSIDES | ||
| 489 | Pulmonary congestion | OFFSIDES | ||
| 490 | Pyoderma Gangrenosum | OFFSIDES | ||
| 491 | Radiation skin injury | OFFSIDES | ||
| 492 | Rectal Prolapse | OFFSIDES | ||
| 493 | Renal cyst | OFFSIDES | ||
| 494 | Renal tubular necrosis | OFFSIDES | ||
| 495 | Rhabdomyolysis | OFFSIDES | ||
| 496 | Rhinitis | 19672097 | CTD | |
| 497 | Rhinorrhea | OFFSIDES | ||
| 498 | Seizures | 16199350 | CTD | |
| 499 | Shunt malfunction | OFFSIDES | ||
| 500 | Sinusitis | OFFSIDES | ||
| 501 | Skin Wrinkling | OFFSIDES | ||
| 502 | Skin neoplasm excision | OFFSIDES | ||
| 503 | Skin tightness | OFFSIDES | ||
| 504 | Sleep Talking | OFFSIDES | ||
| 505 | Smoker | OFFSIDES | ||
| 506 | Sphincter of Oddi Dysfunction | OFFSIDES | ||
| 507 | Spinal claudication | OFFSIDES | ||
| 508 | Staphylococcal Scalded Skin Syndrome | OFFSIDES | ||
| 509 | Stasis dermatitis | OFFSIDES | ||
| 510 | Stupor | SIDER | ||
| 511 | Subileus | OFFSIDES | ||
| 512 | Substance Withdrawal Syndrome | 16199350 | CTD | |
| 513 | Superinfection lung | OFFSIDES | ||
| 514 | Tendinitis | OFFSIDES | ||
| 515 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 516 | Therapy cessation | OFFSIDES | ||
| 517 | Therapy regimen changed | OFFSIDES | ||
| 518 | Throat cancer | OFFSIDES | ||
| 519 | Tinea Pedis | OFFSIDES | ||
| 520 | Tinnitus | Canada Vigilance: 1 | Canada Vigilance | |
| 521 | Tobacco user | OFFSIDES | ||
| 522 | Tobacco withdrawal symptoms | OFFSIDES | ||
| 523 | Tongue movement disturbance | Canada Vigilance: 1 | Canada Vigilance | |
| 524 | Tooth Extraction | OFFSIDES | ||
| 525 | Toothache | Canada Vigilance: 1 | Canada Vigilance | |
| 526 | Torsades de Pointes | 19057127 | CTD | |
| 527 | Troponin T | OFFSIDES | ||
| 528 | Ulcer | OFFSIDES | ||
| 529 | Umbilical hernia | OFFSIDES | ||
| 530 | Urine amphetamine positive | OFFSIDES | ||
| 531 | Venous Insufficiency | OFFSIDES | ||
| 532 | Ventricular hypokinesia | OFFSIDES | ||
| 533 | Victim of homicide | OFFSIDES | ||
| 534 | Viral pharyngitis | OFFSIDES | ||
| 535 | Vitamin A Deficiency | OFFSIDES | ||
| 536 | Vitreous Detachment | OFFSIDES | ||
| 537 | Vulvovaginal burning sensation | OFFSIDES | ||
| 538 | Weight Gain | OFFSIDES | ||
| 539 | Xerosis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.