Minocycline
(WTJXVDPDEQKTCV-VQAITOIOSA-N)
Structure
- SMILES
- CN([C@@H]1C(=O)C(=C([C@@]2([C@H]1C[C@@H]1Cc3c(C(=C1C2=O)O)c(O)ccc3N(C)C)O)O)C(=O)N)C.Cl
- Molecular Formula:
- C23H28ClN3O7
- Molecular Weight:
- 493.937
- Log P:
- 1.5323
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 6
- TPSA:
- 164.63
- CAS Number(s):
- 13614-98-7
Synonym(s)
1.
Minocycline
2.
Akamin
3.
Akne-Puren
4.
Aknemin
5.
Aknin-Mino
6.
Aknosan
7.
Apo-Minocycline
8.
Arestin
9.
Blemix
10.
Cyclomin
11.
Cyclops
12.
Dentomycin
13.
Dynacin
14.
Icht-Oral
15.
Klinomycin
16.
Lederderm
17.
Mestacine
18.
Minakne
19.
Mino-Wolff
20.
Minocin
21.
Minocin MR
22.
Minoclir
23.
Minocycline Hydrochloride
24.
Minocycline Monohydrochloride
25.
Minocycline, (4R-(4 alpha,4a beta,5a beta,12a beta))-Isomer
26.
Minolis
27.
Minomycin
28.
Minoplus
29.
Minotab
30.
Minox 50
31.
Mynocine
32.
Akne Puren
33.
Aknin Mino
34.
Apo Minocycline
35.
Hydrochloride, Minocycline
36.
Icht Oral
37.
Mino Wolff
38.
Monohydrochloride, Minocycline
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 99 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 2 | Arthralgia | FAERS: 98 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 3 | Urticaria | FAERS: 79 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 52 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 5 | Dizziness | FAERS: 49 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 6 | Pain | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Fatigue | FAERS: 48 | US FAERS | |
| 8 | Lupus-like syndrome | FAERS: 43 | US FAERS | |
| 9 | Polyarteritis Nodosa | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Pruritus | FAERS: 35 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 11 | Vasculitis | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Drug ineffective | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Lymphadenopathy | FAERS: 34 | US FAERS | |
| 14 | Vomiting | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 15 | Autoimmune hepatitis | FAERS: 32 | US FAERS | |
| 16 | Hepatitis | FAERS: 32 | US FAERS | |
| 17 | Malaise | FAERS: 32 | US FAERS | |
| 18 | Hypersensitivity | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Joint swelling | FAERS: 25 | US FAERS | |
| 20 | No adverse event | FAERS: 24 | US FAERS | |
| 21 | Transaminases increased | FAERS: 23 | US FAERS | |
| 22 | Myalgia | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Swelling | FAERS: 22 | US FAERS | |
| 24 | Eosinophilia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Arthritis | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Asthenia | FAERS: 20 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 27 | Weight decreased | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Diplopia | FAERS: 19 | US FAERS | |
| 29 | Feeling abnormal | FAERS: 19 | US FAERS | |
| 30 | Tinnitus | FAERS: 19 | US FAERS | |
| 31 | Alanine Aminotransferase Increased | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Aspartate Aminotransferase Increased | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Lip swelling | FAERS: 18 | US FAERS | |
| 34 | Acne | FAERS: 17 | US FAERS | |
| 35 | Chills | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Erythema | FAERS: 17 | US FAERS | |
| 37 | Product quality issue | FAERS: 17 | US FAERS | |
| 38 | Tachycardia | FAERS: 16 | US FAERS | |
| 39 | Anxiety | FAERS: 14 | US FAERS | |
| 40 | Mononeuropathy Multiplex | FAERS: 14 | US FAERS | |
| 41 | Oropharyngeal pain | FAERS: 14 | US FAERS | |
| 42 | Serum Sickness | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 43 | Abdominal Pain | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | Dysgeusia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Eosinophilic myocarditis | FAERS: 12 | US FAERS | |
| 46 | Scleral pigmentation | FAERS: 12 | US FAERS | |
| 47 | Vertigo | FAERS: 12 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 48 | Blindness | FAERS: 11 | US FAERS | |
| 49 | Chest Pain | FAERS: 11 | US FAERS | |
| 50 | Musculoskeletal stiffness | FAERS: 11 | US FAERS | |
| 51 | Neck Pain | FAERS: 11 | US FAERS | |
| 52 | Shock | FAERS: 11 | US FAERS | |
| 53 | Splenomegaly | FAERS: 11 | US FAERS | |
| 54 | Exposure during breast feeding | FAERS: 10 | US FAERS | |
| 55 | Hypotension | FAERS: 10 | US FAERS | |
| 56 | Hypoxia | FAERS: 10 | US FAERS | |
| 57 | Tremor | FAERS: 10 | US FAERS | |
| 58 | Alopecia | FAERS: 9 | US FAERS | |
| 59 | Burning sensation | FAERS: 9 | US FAERS | |
| 60 | Dermatomyositis | FAERS: 9 | US FAERS | |
| 61 | Palpitations | FAERS: 9 | US FAERS | |
| 62 | Crying | FAERS: 8 | US FAERS | |
| 63 | Erythema Nodosum | FAERS: 8 | US FAERS | |
| 64 | Livedo Reticularis | FAERS: 8 | US FAERS | |
| 65 | Oral infection | FAERS: 8 | US FAERS | |
| 66 | Pericarditis | FAERS: 8 | US FAERS | |
| 67 | Abdominal discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Drug dose omission | FAERS: 7 | US FAERS | |
| 69 | Inflammation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 71 | Pneumonia | FAERS: 7 | US FAERS | |
| 72 | Stomatitis | FAERS: 7 | US FAERS | |
| 73 | Visual Impairment | FAERS: 7 | US FAERS | |
| 74 | Activities of daily living impaired | FAERS: 6 | US FAERS | |
| 75 | Application site pain | FAERS: 6 | US FAERS | |
| 76 | Autoimmune thyroiditis | FAERS: 6 | US FAERS | |
| 77 | Back Pain | FAERS: 6 | US FAERS | |
| 78 | Bone hyperpigmentation | FAERS: 6 | US FAERS | |
| 79 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 80 | Chest discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Chromaturia | FAERS: 6 | US FAERS | |
| 82 | Constipation | FAERS: 6 | US FAERS | |
| 83 | Cytolytic hepatitis | FAERS: 6 | US FAERS | |
| 84 | Hepatic necrosis | FAERS: 6 | US FAERS | |
| 85 | Idiosyncratic drug reaction | FAERS: 6 | US FAERS | |
| 86 | Joint stiffness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Lethargy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Leukopenia | FAERS: 6 | US FAERS | |
| 89 | Myocarditis | FAERS: 6 | US FAERS | |
| 90 | Night sweats | FAERS: 6 | US FAERS | |
| 91 | Photophobia | FAERS: 6 | US FAERS | |
| 92 | Serum sickness-like reaction | FAERS: 6 | US FAERS | |
| 93 | Sinusitis | FAERS: 6 | US FAERS | |
| 94 | Somnolence | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 96 | Unresponsive to stimuli | FAERS: 6 | US FAERS | |
| 97 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 98 | Angioedema | FAERS: 5 | US FAERS | |
| 99 | Anti-thyroid antibody positive | FAERS: 5 | US FAERS | |
| 100 | Aortic Aneurysm | FAERS: 5 | US FAERS | |
| 101 | Blood alkaline phosphatase increased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 102 | Blood creatinine increased | FAERS: 5 | US FAERS | |
| 103 | Breast Feeding | FAERS: 5 | US FAERS | |
| 104 | Conjunctival pigmentation | FAERS: 5 | US FAERS | |
| 105 | Deafness | FAERS: 5 | US FAERS | |
| 106 | Discomfort | FAERS: 5 | US FAERS | |
| 107 | Gingival erythema | FAERS: 5 | US FAERS | |
| 108 | Hepatomegaly | FAERS: 5 | US FAERS | |
| 109 | Hyperthyroidism | FAERS: 5 | US FAERS | |
| 110 | Influenza | FAERS: 5 | US FAERS | |
| 111 | Leukocytosis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Meningitis | FAERS: 5 | US FAERS | |
| 113 | Mood swings | FAERS: 5 | US FAERS | |
| 114 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 115 | Oral pain | FAERS: 5 | US FAERS | |
| 116 | Pneumonitis | FAERS: 5 | US FAERS | |
| 117 | Polyarthritis | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 118 | Product substitution issue | FAERS: 5 | US FAERS | |
| 119 | Stevens-Johnson Syndrome | FAERS: 5 | US FAERS | |
| 120 | Sunburn | FAERS: 5 | US FAERS | |
| 121 | Syncope | FAERS: 5 | US FAERS | |
| 122 | Thrombocytopenia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 123 | Agitation | FAERS: 4 | US FAERS | |
| 124 | Anorexia | FAERS: 4 | US FAERS | |
| 125 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 126 | Completed Suicide | FAERS: 4 | US FAERS | |
| 127 | Dehydration | FAERS: 4 | US FAERS | |
| 128 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 129 | Eosinophilic Pneumonia | FAERS: 4 | US FAERS | |
| 130 | Expired product administered | FAERS: 4 | US FAERS | |
| 131 | Eye pain | FAERS: 4 | US FAERS | |
| 132 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 133 | Hypersomnia | FAERS: 4 | US FAERS | |
| 134 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 135 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 136 | Impaired work ability | FAERS: 4 | US FAERS | |
| 137 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 138 | Myopathy | FAERS: 4 | US FAERS | |
| 139 | Nail pigmentation | FAERS: 4 | US FAERS | |
| 140 | Pancreatitis | FAERS: 4 | US FAERS | |
| 141 | Pericardial effusion | FAERS: 4 | US FAERS | |
| 142 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 143 | Post inflammatory pigmentation change | FAERS: 4 | US FAERS | |
| 144 | Product use complaint | FAERS: 4 | US FAERS | |
| 145 | Rash erythematous | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Renal pain | FAERS: 4 | US FAERS | |
| 147 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 148 | Retinal pigmentation | FAERS: 4 | US FAERS | |
| 149 | Toothache | FAERS: 4 | US FAERS | |
| 150 | Trismus | FAERS: 4 | US FAERS | |
| 151 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 152 | Abasia | FAERS: 3 | US FAERS | |
| 153 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 154 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 155 | Antinuclear antibody increased | FAERS: 3 | US FAERS | |
| 156 | Antiphospholipid antibodies positive | FAERS: 3 | US FAERS | |
| 157 | Apoptosis | FAERS: 3 | US FAERS | |
| 158 | Ascites | FAERS: 3 | US FAERS | |
| 159 | Blood iron decreased | FAERS: 3 | US FAERS | |
| 160 | Bradycardia | FAERS: 3 | US FAERS | |
| 161 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 162 | Cervical myelopathy | FAERS: 3 | US FAERS | |
| 163 | Cholecystitis | FAERS: 3 | US FAERS | |
| 164 | Conjunctival deposit | FAERS: 3 | US FAERS | |
| 165 | Drug administration error | FAERS: 3 | US FAERS | |
| 166 | Dry skin | FAERS: 3 | US FAERS | |
| 167 | Educational problem | FAERS: 3 | US FAERS | |
| 168 | Emotional disorder | FAERS: 3 | US FAERS | |
| 169 | Erythema Multiforme | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 170 | Exophthalmos | FAERS: 3 | US FAERS | |
| 171 | Incoherent | FAERS: 3 | US FAERS | |
| 172 | Lymphocytosis | FAERS: 3 | US FAERS | |
| 173 | Medication Error | FAERS: 3 | US FAERS | |
| 174 | Mouth swelling | FAERS: 3 | US FAERS | |
| 175 | Myopericarditis | FAERS: 3 | US FAERS | |
| 176 | Nervousness | FAERS: 3 | US FAERS | |
| 177 | Noninfective gingivitis | FAERS: 3 | US FAERS | |
| 178 | Oral pruritus | FAERS: 3 | US FAERS | |
| 179 | Osteoma cutis | FAERS: 3 | US FAERS | |
| 180 | Pharyngitis | FAERS: 3 | US FAERS | |
| 181 | Renal aneurysm | FAERS: 3 | US FAERS | |
| 182 | Renal tubular atrophy | FAERS: 3 | US FAERS | |
| 183 | Septic Shock | FAERS: 3 | US FAERS | |
| 184 | Throat irritation | FAERS: 3 | US FAERS | |
| 185 | Thrombosis | FAERS: 3 | US FAERS | |
| 186 | Tongue biting | FAERS: 3 | US FAERS | |
| 187 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 188 | Unevaluable event | FAERS: 3 | US FAERS | |
| 189 | Vulvovaginal pruritus | FAERS: 3 | US FAERS | |
| 190 | jaundice | FAERS: 3 | US FAERS | |
| 191 | nervous system disorder | FAERS: 3 | US FAERS | |
| 192 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 193 | Adverse event | FAERS: 2 | US FAERS | |
| 194 | Alveolitis | FAERS: 2 | US FAERS | |
| 195 | Amnesia | FAERS: 2 | US FAERS | |
| 196 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 197 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 2 | US FAERS | |
| 198 | Application site inflammation | FAERS: 2 | US FAERS | |
| 199 | Arteritis | FAERS: 2 | US FAERS | |
| 200 | Arthropathy | FAERS: 2 | US FAERS | |
| 201 | Ataxia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 202 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 203 | Biopsy skin abnormal | FAERS: 2 | US FAERS | |
| 204 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 205 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 206 | Blood immunoglobulin G increased | FAERS: 2 | US FAERS | |
| 207 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 208 | Bone pain | FAERS: 2 | US FAERS | |
| 209 | Breast tenderness | FAERS: 2 | US FAERS | |
| 210 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 211 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 212 | Colitis | FAERS: 2 | US FAERS | |
| 213 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 214 | Cyanosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Dental caries | FAERS: 2 | US FAERS | |
| 216 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 217 | Disease recurrence | FAERS: 2 | US FAERS | |
| 218 | Disorientation | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 219 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 220 | Drug level increased | FAERS: 2 | US FAERS | |
| 221 | Drug toxicity | FAERS: 2 | US FAERS | |
| 222 | Dyspepsia | FAERS: 2 | US FAERS | |
| 223 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 224 | Encephalitis | FAERS: 2 | US FAERS | |
| 225 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 226 | Epistaxis | FAERS: 2 | US FAERS | |
| 227 | Erythrodermic psoriasis | FAERS: 2 | US FAERS | |
| 228 | Exfoliative rash | FAERS: 2 | US FAERS | |
| 229 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 230 | Gastrointestinal mucosal disorder | FAERS: 2 | US FAERS | |
| 231 | Gingival Recession | FAERS: 2 | US FAERS | |
| 232 | Gingival discomfort | FAERS: 2 | US FAERS | |
| 233 | Granuloma | FAERS: 2 | US FAERS | |
| 234 | Hepatitis E | FAERS: 2 | US FAERS | |
| 235 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 236 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 237 | Infection | FAERS: 2 | US FAERS | |
| 238 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 239 | Insulin Resistance | FAERS: 2 | US FAERS | |
| 240 | Juvenile arthritis | FAERS: 2 | US FAERS | |
| 241 | Liver transplant rejection | FAERS: 2 | US FAERS | |
| 242 | Mechanical urticaria | FAERS: 2 | US FAERS | |
| 243 | Memory impairment | FAERS: 2 | US FAERS | |
| 244 | Meningeal disorder | FAERS: 2 | US FAERS | |
| 245 | Mental status changes | FAERS: 2 | US FAERS | |
| 246 | Monocytosis | FAERS: 2 | US FAERS | |
| 247 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 248 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 249 | Neutropenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 250 | Ocular icterus | FAERS: 2 | US FAERS | |
| 251 | Optic Atrophy | FAERS: 2 | US FAERS | |
| 252 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 253 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 254 | Ototoxicity | FAERS: 2 | US FAERS | |
| 255 | Pallor | FAERS: 2 | US FAERS | |
| 256 | Panniculitis | FAERS: 2 | US FAERS | |
| 257 | Parotitis | FAERS: 2 | US FAERS | |
| 258 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 259 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 260 | Product physical issue | FAERS: 2 | US FAERS | |
| 261 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 262 | Purulent discharge | FAERS: 2 | US FAERS | |
| 263 | Respiratory distress | FAERS: 2 | US FAERS | |
| 264 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 265 | Rosacea | FAERS: 2 | US FAERS | |
| 266 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 267 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 268 | Strabismus | FAERS: 2 | US FAERS | |
| 269 | Stress | FAERS: 2 | US FAERS | |
| 270 | Superinfection bacterial | FAERS: 2 | US FAERS | |
| 271 | Superinfection fungal | FAERS: 2 | US FAERS | |
| 272 | Synovitis | FAERS: 2 | US FAERS | |
| 273 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 274 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 275 | Tooth Erosion | FAERS: 2 | US FAERS | |
| 276 | Type III immune complex mediated reaction | FAERS: 2 | US FAERS | |
| 277 | Ulcer | FAERS: 2 | US FAERS | |
| 278 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 279 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 280 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 281 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 282 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 283 | Accidental overdose | FAERS: 1 | US FAERS | |
| 284 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 285 | Administration site irritation | FAERS: 1 | US FAERS | |
| 286 | Ageusia | FAERS: 1 | US FAERS | |
| 287 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 288 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 289 | Anti-SS-A antibody positive | FAERS: 1 | US FAERS | |
| 290 | Antibody test abnormal | FAERS: 1 | US FAERS | |
| 291 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 292 | Antisocial Personality Disorder | FAERS: 1 | US FAERS | |
| 293 | Aortic valve sclerosis | FAERS: 1 | US FAERS | |
| 294 | Aphagia | FAERS: 1 | US FAERS | |
| 295 | Aphasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 297 | Apparent death | FAERS: 1 | US FAERS | |
| 298 | Application site discomfort | FAERS: 1 | US FAERS | |
| 299 | Application site erythema | FAERS: 1 | US FAERS | |
| 300 | Application site infection | FAERS: 1 | US FAERS | |
| 301 | Application site pruritus | FAERS: 1 | US FAERS | |
| 302 | Application site reaction | FAERS: 1 | US FAERS | |
| 303 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 304 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 305 | Asthma | FAERS: 1 | US FAERS | |
| 306 | Astigmatism | FAERS: 1 | US FAERS | |
| 307 | Atopy | FAERS: 1 | US FAERS | |
| 308 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 309 | Auricular swelling | FAERS: 1 | US FAERS | |
| 310 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 311 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 312 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 313 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 314 | Biopsy lung abnormal | FAERS: 1 | US FAERS | |
| 315 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 316 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 317 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 318 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 319 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 320 | Blood urea increased | FAERS: 1 | US FAERS | |
| 321 | Blood zinc decreased | FAERS: 1 | US FAERS | |
| 322 | Bone lesion | FAERS: 1 | US FAERS | |
| 323 | Bone swelling | FAERS: 1 | US FAERS | |
| 324 | Brain Death | FAERS: 1 | US FAERS | |
| 325 | Calcinosis | FAERS: 1 | US FAERS | |
| 326 | Candidiasis | FAERS: 1 | US FAERS | |
| 327 | Capillary nail refill test abnormal | FAERS: 1 | US FAERS | |
| 328 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 329 | Cardiomyopathy acute | FAERS: 1 | US FAERS | |
| 330 | Catabolic state | FAERS: 1 | US FAERS | |
| 331 | Catheter site pain | FAERS: 1 | US FAERS | |
| 332 | Cellulitis | FAERS: 1 | US FAERS | |
| 333 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 334 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 335 | Cerebrospinal fluid retention | FAERS: 1 | US FAERS | |
| 336 | Cholangitis | FAERS: 1 | US FAERS | |
| 337 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 338 | Chylothorax | FAERS: 1 | US FAERS | |
| 339 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 340 | Cold sweat | FAERS: 1 | US FAERS | |
| 341 | Cystitis | FAERS: 1 | US FAERS | |
| 342 | Dental Fistula | FAERS: 1 | US FAERS | |
| 343 | Dental discomfort | FAERS: 1 | US FAERS | |
| 344 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 345 | Detachment of retinal pigment epithelium | FAERS: 1 | US FAERS | |
| 346 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 347 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 348 | Dissociation | FAERS: 1 | US FAERS | |
| 349 | Drug abuser | FAERS: 1 | US FAERS | |
| 350 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 351 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 352 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 353 | Dysarthria | FAERS: 1 | US FAERS | |
| 354 | Dysphonia | FAERS: 1 | US FAERS | |
| 355 | Dysuria | FAERS: 1 | US FAERS | |
| 356 | Economic problem | FAERS: 1 | US FAERS | |
| 357 | Encephalomyelitis | FAERS: 1 | US FAERS | |
| 358 | Endocarditis | FAERS: 1 | US FAERS | |
| 359 | Endometriosis | FAERS: 1 | US FAERS | |
| 360 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 361 | Epididymitis | FAERS: 1 | US FAERS | |
| 362 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 363 | Eschar | FAERS: 1 | US FAERS | |
| 364 | Expired drug administered | FAERS: 1 | US FAERS | |
| 365 | Exposure via father | FAERS: 1 | US FAERS | |
| 366 | Expulsion of medication | FAERS: 1 | US FAERS | |
| 367 | Facial Pain | FAERS: 1 | US FAERS | |
| 368 | False positive investigation result | FAERS: 1 | US FAERS | |
| 369 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 370 | Fibrosis | FAERS: 1 | US FAERS | |
| 371 | Fixed drug eruption | FAERS: 1 | US FAERS | |
| 372 | Fixed eruption | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 373 | Flushing | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 374 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 375 | Food Allergy | FAERS: 1 | US FAERS | |
| 376 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 377 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 378 | Gingival hyperpigmentation | FAERS: 1 | US FAERS | |
| 379 | Gingival pruritus | FAERS: 1 | US FAERS | |
| 380 | Glossitis | FAERS: 1 | US FAERS | |
| 381 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 382 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 383 | Guttate psoriasis | FAERS: 1 | US FAERS | |
| 384 | Head discomfort | FAERS: 1 | US FAERS | |
| 385 | Hemiparesis | FAERS: 1 | US FAERS | |
| 386 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 387 | Heterophoria | FAERS: 1 | US FAERS | |
| 388 | Histone antibody positive | FAERS: 1 | US FAERS | |
| 389 | Hyperacusis | FAERS: 1 | US FAERS | |
| 390 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 391 | Hypervigilance | FAERS: 1 | US FAERS | |
| 392 | Hypophagia | FAERS: 1 | US FAERS | |
| 393 | Immunosuppression | FAERS: 1 | US FAERS | |
| 394 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 395 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 396 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 397 | Induration | FAERS: 1 | US FAERS | |
| 398 | Initial insomnia | FAERS: 1 | US FAERS | |
| 399 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 400 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 401 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 402 | Interleukin-2 receptor increased | FAERS: 1 | US FAERS | |
| 403 | Intestinal infarction | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 404 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 405 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 406 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 407 | Laryngomalacia | FAERS: 1 | US FAERS | |
| 408 | Lateral Medullary Syndrome | FAERS: 1 | US FAERS | |
| 409 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 410 | Limb discomfort | FAERS: 1 | US FAERS | |
| 411 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 412 | Lipoma | FAERS: 1 | US FAERS | |
| 413 | Lividity | FAERS: 1 | US FAERS | |
| 414 | Loose tooth | FAERS: 1 | US FAERS | |
| 415 | Lyme Disease | FAERS: 1 | US FAERS | |
| 416 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 417 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 418 | Lymphomatoid Papulosis | FAERS: 1 | US FAERS | |
| 419 | Lymphoma | FAERS: 1 | US FAERS | |
| 420 | Macular pigmentation | FAERS: 1 | US FAERS | |
| 421 | Macule | FAERS: 1 | US FAERS | |
| 422 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 423 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 424 | Melanosis | FAERS: 1 | US FAERS | |
| 425 | Meningism | FAERS: 1 | US FAERS | |
| 426 | Menorrhagia | FAERS: 1 | US FAERS | |
| 427 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 428 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 429 | Moaning | FAERS: 1 | US FAERS | |
| 430 | Mononucleosis heterophile test positive | FAERS: 1 | US FAERS | |
| 431 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 432 | Motion Sickness | FAERS: 1 | US FAERS | |
| 433 | Muscle strain | FAERS: 1 | US FAERS | |
| 434 | Muscle tightness | FAERS: 1 | US FAERS | |
| 435 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 436 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 437 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 438 | Nephritis | FAERS: 1 | US FAERS | |
| 439 | Neuropathy | FAERS: 1 | US FAERS | |
| 440 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 441 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 442 | Nodule on extremity | FAERS: 1 | US FAERS | |
| 443 | Nodule | FAERS: 1 | US FAERS | |
| 444 | Obesity surgery | FAERS: 1 | US FAERS | |
| 445 | Ochronosis | FAERS: 1 | US FAERS | |
| 446 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 447 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 448 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 449 | Osteoma | FAERS: 1 | US FAERS | |
| 450 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 451 | PO2 decreased | FAERS: 1 | US FAERS | |
| 452 | Palpable purpura | FAERS: 1 | US FAERS | |
| 453 | Pancytopenia | FAERS: 1 | US FAERS | |
| 454 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 455 | Periodontal destruction | FAERS: 1 | US FAERS | |
| 456 | Petechiae | FAERS: 1 | US FAERS | |
| 457 | Pharyngeal erosion | FAERS: 1 | US FAERS | |
| 458 | Phonophobia | FAERS: 1 | US FAERS | |
| 459 | Pigmentation lip | FAERS: 1 | US FAERS | |
| 460 | Polydipsia | FAERS: 1 | US FAERS | |
| 461 | Polyserositis | FAERS: 1 | US FAERS | |
| 462 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 463 | Post procedural contusion | FAERS: 1 | US FAERS | |
| 464 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 465 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 466 | Pregnancy | FAERS: 1 | US FAERS | |
| 467 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 468 | Presyncope | FAERS: 1 | US FAERS | |
| 469 | Product contamination | FAERS: 1 | US FAERS | |
| 470 | Product contamination physical | FAERS: 1 | US FAERS | |
| 471 | Product preparation error | FAERS: 1 | US FAERS | |
| 472 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 473 | Product storage error | FAERS: 1 | US FAERS | |
| 474 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 475 | Product use issue | FAERS: 1 | US FAERS | |
| 476 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 477 | Productive Cough | FAERS: 1 | US FAERS | |
| 478 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 479 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 480 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 481 | Pulmonary vasculitis | FAERS: 1 | US FAERS | |
| 482 | Purpura | FAERS: 1 | US FAERS | |
| 483 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 484 | Pyuria | FAERS: 1 | US FAERS | |
| 485 | Radiculopathy | FAERS: 1 | US FAERS | |
| 486 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 487 | Retching | FAERS: 1 | US FAERS | |
| 488 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 489 | Retinal deposits | FAERS: 1 | US FAERS | |
| 490 | Retinal exudates | FAERS: 1 | US FAERS | |
| 491 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 492 | Schizophrenia | FAERS: 1 | US FAERS | |
| 493 | Scotoma | FAERS: 1 | US FAERS | |
| 494 | Secretion discharge | FAERS: 1 | US FAERS | |
| 495 | Sepsis | FAERS: 1 | US FAERS | |
| 496 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 497 | Skin lesion | FAERS: 1 | US FAERS | |
| 498 | Skin test positive | FAERS: 1 | US FAERS | |
| 499 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 500 | Sudden death | FAERS: 1 | US FAERS | |
| 501 | Suicide attempt | FAERS: 1 | US FAERS | |
| 502 | Symblepharon | FAERS: 1 | US FAERS | |
| 503 | Syringe issue | FAERS: 1 | US FAERS | |
| 504 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 505 | T-lymphocyte count increased | FAERS: 1 | US FAERS | |
| 506 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 507 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 508 | Tongue pigmentation | FAERS: 1 | US FAERS | |
| 509 | Tooth Infection | FAERS: 1 | US FAERS | |
| 510 | Tooth Loss | FAERS: 1 | US FAERS | |
| 511 | Tooth Resorption | FAERS: 1 | US FAERS | |
| 512 | Troponin I increased | FAERS: 1 | US FAERS | |
| 513 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 514 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 515 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 516 | Vascular fragility | FAERS: 1 | US FAERS | |
| 517 | Vasospasm | FAERS: 1 | US FAERS | |
| 518 | Venous stenosis | FAERS: 1 | US FAERS | |
| 519 | Visual disturbance | FAERS: 1 | US FAERS | |
| 520 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 521 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 522 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 523 | Xanthomatosis | FAERS: 1 | US FAERS | |
| 524 | Xanthoma | FAERS: 1 | US FAERS | |
| 525 | furuncle | FAERS: 1 | US FAERS | |
| 526 | treatment failure | FAERS: 1 | US FAERS | |
| 527 | Delirium | Canada Vigilance: 1 | Canada Vigilance | |
| 528 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance | |
| 529 | Euphoric mood | Canada Vigilance: 6 | Canada Vigilance | |
| 530 | Myositis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.