Solifenacin Succinate
(RXZMMZZRUPYENV-VROPFNGYSA-N)
Structure
- SMILES
- O=C(N1CCc2c([C@@H]1c1ccccc1)cccc2)O[C@H]1CN2CCC1CC2.OC(=O)CCC(=O)O
- Molecular Formula:
- C27H32N2O6
- Molecular Weight:
- 480.553
- Log P:
- 3.6765
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 107.38
- CAS Number(s):
- 242478-38-2
Synonym(s)
1.
Solifenacin Succinate
2.
2(1H)-Isoquinolinecarboxylic acid, 3,4-dihydro-1-phenyl-,1- azabicyclo(2.2.2)oct-3-yl ester, (R-(R*,S*))-
3.
Quinuclidin-3'-yl-1-phenyl-1,2,3,4-tetrahydroisoquinoline-2-carboxylate monosuccinate
4.
Solifenacin
5.
Vesicare
6.
YM 905
7.
YM905
8.
905, YM
9.
Succinate, Solifenacin
External Link(s)
| MeSH | D000069464 |
| PubChem Compound | 216457 |
| ChEBI | 32151 |
| CHEMBL | CHEMBL1200803 |
| KEGG | dr:D01269 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 1770 Canada Vigilance: 26 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Constipation | FAERS: 687 Canada Vigilance: 4 | 11488427 | CTD Canada Vigilance US FAERS |
| 3 | Inappropriate schedule of drug administration | FAERS: 204 | US FAERS | |
| 4 | Dizziness | FAERS: 201 Canada Vigilance: 2 | 19837435 | CTD OFFSIDES Canada Vigilance US FAERS |
| 5 | Nocturia | FAERS: 177 Canada Vigilance: 1 | 17131169 17574730 | CTD OFFSIDES Canada Vigilance US FAERS |
| 6 | Urinary Retention | FAERS: 154 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Drug effect incomplete | FAERS: 149 | US FAERS | |
| 8 | Fatigue | FAERS: 141 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 9 | Headache | FAERS: 140 | US FAERS | |
| 10 | Urinary Incontinence | FAERS: 140 | 17574730 | CTD US FAERS |
| 11 | Dyspepsia | FAERS: 105 | OFFSIDES US FAERS | |
| 12 | Pruritus | FAERS: 100 | US FAERS | |
| 13 | Malaise | FAERS: 99 | US FAERS | |
| 14 | Wrong technique in product usage process | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Urinary tract infection | FAERS: 93 | US FAERS | |
| 16 | Wrong technique in drug usage process | FAERS: 93 | US FAERS | |
| 17 | Somnolence | FAERS: 91 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Nausea | FAERS: 90 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 19 | Dysuria | FAERS: 75 | OFFSIDES US FAERS | |
| 20 | Overdose | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Abdominal Pain | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Pain | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Drug prescribing error | FAERS: 59 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Abdominal discomfort | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Vomiting | FAERS: 47 | US FAERS | |
| 27 | Visual Impairment | FAERS: 46 | US FAERS | |
| 28 | Back Pain | FAERS: 44 | US FAERS | |
| 29 | Drug ineffective for unapproved indication | FAERS: 44 | US FAERS | |
| 30 | Hypersensitivity | FAERS: 43 | US FAERS | |
| 31 | Drug dose omission | FAERS: 42 | US FAERS | |
| 32 | Product use in unapproved indication | FAERS: 42 | US FAERS | |
| 33 | Cerebrovascular accident | FAERS: 40 | US FAERS | |
| 34 | Chest Pain | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Urticaria | FAERS: 40 | US FAERS | |
| 36 | No adverse event | FAERS: 39 | US FAERS | |
| 37 | Asthenia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Product use issue | FAERS: 38 | US FAERS | |
| 39 | Dysphonia | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Dementia | FAERS: 36 | US FAERS | |
| 41 | Memory impairment | FAERS: 36 | US FAERS | |
| 42 | Peripheral swelling | FAERS: 34 | US FAERS | |
| 43 | Alopecia | FAERS: 32 | US FAERS | |
| 44 | Dry skin | FAERS: 32 | US FAERS | |
| 45 | Dysgeusia | FAERS: 32 | OFFSIDES US FAERS | |
| 46 | Amnesia | FAERS: 31 | US FAERS | |
| 47 | Circumstance or information capable of leading to medication error | FAERS: 31 | OFFSIDES US FAERS | |
| 48 | Nasopharyngitis | FAERS: 30 | US FAERS | |
| 49 | Palpitations | FAERS: 30 | US FAERS | |
| 50 | Dehydration | FAERS: 29 | OFFSIDES US FAERS | |
| 51 | Cystitis | FAERS: 28 | US FAERS | |
| 52 | Medication Error | FAERS: 28 | US FAERS | |
| 53 | Adverse event | FAERS: 25 | US FAERS | |
| 54 | Product packaging quantity issue | FAERS: 25 | US FAERS | |
| 55 | Blood urine present | FAERS: 24 | OFFSIDES US FAERS | |
| 56 | Incorrect dose administered | FAERS: 24 | US FAERS | |
| 57 | Lip swelling | FAERS: 24 | US FAERS | |
| 58 | Arthralgia | FAERS: 23 | US FAERS | |
| 59 | Urine flow decreased | FAERS: 23 | US FAERS | |
| 60 | Blood glucose increased | FAERS: 22 | US FAERS | |
| 61 | Diplopia | FAERS: 22 | OFFSIDES US FAERS | |
| 62 | Drug dispensing error | FAERS: 22 | US FAERS | |
| 63 | Joint swelling | FAERS: 22 | US FAERS | |
| 64 | Bladder spasm | FAERS: 21 | OFFSIDES US FAERS | |
| 65 | Flatulence | FAERS: 21 | US FAERS | |
| 66 | Oropharyngeal pain | FAERS: 21 | US FAERS | |
| 67 | Tremor | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Anxiety | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Myocardial Infarction | FAERS: 20 | US FAERS | |
| 70 | Syncope | FAERS: 20 | US FAERS | |
| 71 | Chromaturia | FAERS: 19 | OFFSIDES US FAERS | |
| 72 | Incorrect product storage | FAERS: 19 | US FAERS | |
| 73 | Vertigo | FAERS: 19 | US FAERS | |
| 74 | Disorientation | FAERS: 18 | US FAERS | |
| 75 | Thirst | FAERS: 18 | US FAERS | |
| 76 | Unevaluable event | FAERS: 18 | OFFSIDES US FAERS | |
| 77 | Glaucoma | FAERS: 17 | OFFSIDES US FAERS | |
| 78 | Intentional product misuse | FAERS: 17 | US FAERS | |
| 79 | Pneumonia | FAERS: 17 | US FAERS | |
| 80 | Prescribed overdose | FAERS: 17 | US FAERS | |
| 81 | Tachycardia | FAERS: 16 | US FAERS | |
| 82 | Expired product administered | FAERS: 15 | US FAERS | |
| 83 | Incontinence | FAERS: 15 | OFFSIDES US FAERS | |
| 84 | Influenza | FAERS: 15 | US FAERS | |
| 85 | Joint injury | FAERS: 14 | US FAERS | |
| 86 | Therapeutic product effect incomplete | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Accidental overdose | FAERS: 13 | US FAERS | |
| 88 | Agitation | FAERS: 13 | US FAERS | |
| 89 | Chills | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Diabetes Mellitus | FAERS: 13 | US FAERS | |
| 91 | Epistaxis | FAERS: 13 | OFFSIDES US FAERS | |
| 92 | Throat irritation | FAERS: 13 | US FAERS | |
| 93 | Angioedema | FAERS: 12 | US FAERS | |
| 94 | Bladder pain | FAERS: 12 | US FAERS | |
| 95 | Erythema | FAERS: 12 | US FAERS | |
| 96 | Eye pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Swelling | FAERS: 12 | US FAERS | |
| 98 | Tinnitus | FAERS: 12 | US FAERS | |
| 99 | Burning sensation | FAERS: 11 | US FAERS | |
| 100 | Erectile dysfunction | FAERS: 11 | US FAERS | |
| 101 | Pyelonephritis | FAERS: 11 | OFFSIDES US FAERS | |
| 102 | Weight decreased | FAERS: 11 | US FAERS | |
| 103 | Activities of daily living impaired | FAERS: 10 | OFFSIDES US FAERS | |
| 104 | Chest discomfort | FAERS: 10 | US FAERS | |
| 105 | Discomfort | FAERS: 10 | US FAERS | |
| 106 | Flushing | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Inappropriate schedule of product administration | FAERS: 10 | US FAERS | |
| 108 | Lethargy | FAERS: 10 | US FAERS | |
| 109 | Myalgia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Ageusia | FAERS: 9 | US FAERS | |
| 111 | Aphonia | FAERS: 9 | US FAERS | |
| 112 | Bradycardia | FAERS: 9 | OFFSIDES US FAERS | |
| 113 | Cataract | FAERS: 9 | OFFSIDES US FAERS | |
| 114 | Depressed Level of Consciousness | FAERS: 9 | US FAERS | |
| 115 | Hypotension | FAERS: 9 | US FAERS | |
| 116 | Multiple Sclerosis | FAERS: 9 | OFFSIDES US FAERS | |
| 117 | Nephrolithiasis | FAERS: 9 | US FAERS | |
| 118 | Sepsis | FAERS: 9 | US FAERS | |
| 119 | Therapeutic response unexpected | FAERS: 9 | US FAERS | |
| 120 | Thrombosis | FAERS: 9 | US FAERS | |
| 121 | Urine output increased | FAERS: 9 | US FAERS | |
| 122 | nervous system disorder | FAERS: 9 | US FAERS | |
| 123 | Abasia | FAERS: 8 | OFFSIDES US FAERS | |
| 124 | Aspartate Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 125 | Atrial Fibrillation | FAERS: 8 | US FAERS | |
| 126 | Bronchitis | FAERS: 8 | US FAERS | |
| 127 | Enuresis | FAERS: 8 | OFFSIDES US FAERS | |
| 128 | Eye irritation | FAERS: 8 | US FAERS | |
| 129 | Intestinal Obstruction | FAERS: 8 | US FAERS | |
| 130 | Musculoskeletal stiffness | FAERS: 8 | US FAERS | |
| 131 | Product dose omission | FAERS: 8 | US FAERS | |
| 132 | Vulvovaginal dryness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Angle Closure Glaucoma | FAERS: 7 | OFFSIDES US FAERS | |
| 134 | Anorexia | FAERS: 7 | US FAERS | |
| 135 | Anuria | FAERS: 7 | US FAERS | |
| 136 | Arthritis | FAERS: 7 | US FAERS | |
| 137 | Blindness | FAERS: 7 | US FAERS | |
| 138 | Dental caries | FAERS: 7 | US FAERS | |
| 139 | Inability to afford medication | FAERS: 7 | US FAERS | |
| 140 | Infection | FAERS: 7 | US FAERS | |
| 141 | Limb injury | FAERS: 7 | US FAERS | |
| 142 | Macular degeneration | FAERS: 7 | US FAERS | |
| 143 | Middle insomnia | FAERS: 7 | US FAERS | |
| 144 | Nervousness | FAERS: 7 | US FAERS | |
| 145 | Visual disturbance | FAERS: 7 | OFFSIDES US FAERS | |
| 146 | Alanine Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 147 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 148 | Bladder neck suspension | FAERS: 6 | US FAERS | |
| 149 | Choking | FAERS: 6 | US FAERS | |
| 150 | Fracture | FAERS: 6 | US FAERS | |
| 151 | Impaired driving ability | FAERS: 6 | US FAERS | |
| 152 | Irritable Bowel Syndrome | FAERS: 6 | US FAERS | |
| 153 | Neck Pain | FAERS: 6 | US FAERS | |
| 154 | Product storage error | FAERS: 6 | US FAERS | |
| 155 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 156 | Renal pain | FAERS: 6 | US FAERS | |
| 157 | Urinary hesitation | FAERS: 6 | US FAERS | |
| 158 | Vitreous floaters | FAERS: 6 | US FAERS | |
| 159 | Vulvovaginal burning sensation | FAERS: 6 | US FAERS | |
| 160 | Asthenopia | FAERS: 5 | OFFSIDES US FAERS | |
| 161 | Cataract operation | FAERS: 5 | OFFSIDES US FAERS | |
| 162 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 163 | Dysarthria | FAERS: 5 | US FAERS | |
| 164 | Emotional distress | FAERS: 5 | OFFSIDES US FAERS | |
| 165 | Eructation | FAERS: 5 | US FAERS | |
| 166 | Feeling Cold | FAERS: 5 | US FAERS | |
| 167 | Gastrointestinal obstruction | FAERS: 5 | OFFSIDES US FAERS | |
| 168 | Heat Stroke | FAERS: 5 | OFFSIDES US FAERS | |
| 169 | Ileus | FAERS: 5 | US FAERS | |
| 170 | Increased upper airway secretion | FAERS: 5 | US FAERS | |
| 171 | Intentional drug misuse | FAERS: 5 | US FAERS | |
| 172 | Mental impairment | FAERS: 5 | US FAERS | |
| 173 | Ocular Hypertension | FAERS: 5 | US FAERS | |
| 174 | Product physical issue | FAERS: 5 | US FAERS | |
| 175 | Rash erythematous | FAERS: 5 | US FAERS | |
| 176 | Sluggishness | FAERS: 5 | US FAERS | |
| 177 | Stomatitis | FAERS: 5 | US FAERS | |
| 178 | Stress | FAERS: 5 | OFFSIDES US FAERS | |
| 179 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 180 | Acne | FAERS: 4 | US FAERS | |
| 181 | Aphagia | FAERS: 4 | OFFSIDES US FAERS | |
| 182 | Aphasia | FAERS: 4 | US FAERS | |
| 183 | Arthropathy | FAERS: 4 | US FAERS | |
| 184 | Blood creatinine increased | FAERS: 4 | US FAERS | |
| 185 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 186 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 187 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 188 | Clostridium difficile infection | FAERS: 4 | US FAERS | |
| 189 | Cyst | FAERS: 4 | US FAERS | |
| 190 | Deafness | FAERS: 4 | US FAERS | |
| 191 | Delirium | FAERS: 4 | US FAERS | |
| 192 | Depressed mood | FAERS: 4 | US FAERS | |
| 193 | Diverticulitis | FAERS: 4 | US FAERS | |
| 194 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 195 | Expired drug administered | FAERS: 4 | US FAERS | |
| 196 | Head discomfort | FAERS: 4 | US FAERS | |
| 197 | Hypophagia | FAERS: 4 | US FAERS | |
| 198 | Inflammation | FAERS: 4 | US FAERS | |
| 199 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 200 | Laryngitis | FAERS: 4 | US FAERS | |
| 201 | Micturition frequency decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 202 | Mouth swelling | FAERS: 4 | US FAERS | |
| 203 | Mydriasis | FAERS: 4 | US FAERS | |
| 204 | Oral pain | FAERS: 4 | US FAERS | |
| 205 | Photophobia | FAERS: 4 | US FAERS | |
| 206 | Presyncope | FAERS: 4 | US FAERS | |
| 207 | Product packaging issue | FAERS: 4 | US FAERS | |
| 208 | Product prescribing error | FAERS: 4 | US FAERS | |
| 209 | Retching | FAERS: 4 | US FAERS | |
| 210 | Tooth Loss | FAERS: 4 | OFFSIDES US FAERS | |
| 211 | Viral upper respiratory tract infection | FAERS: 4 | US FAERS | |
| 212 | Vulvovaginal pain | FAERS: 4 | US FAERS | |
| 213 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 214 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 215 | treatment failure | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 216 | Altered state of consciousness | FAERS: 3 | OFFSIDES US FAERS | |
| 217 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 218 | Bladder discomfort | FAERS: 3 | US FAERS | |
| 219 | Bladder prolapse | FAERS: 3 | US FAERS | |
| 220 | Breast tenderness | FAERS: 3 | US FAERS | |
| 221 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 222 | Choking sensation | FAERS: 3 | US FAERS | |
| 223 | Cholangitis | FAERS: 3 | US FAERS | |
| 224 | Crying | FAERS: 3 | US FAERS | |
| 225 | Disease Progression | FAERS: 3 | US FAERS | |
| 226 | Drug administration error | FAERS: 3 | US FAERS | |
| 227 | Epilepsy | FAERS: 3 | US FAERS | |
| 228 | Extra dose administered | FAERS: 3 | US FAERS | |
| 229 | Hernia | FAERS: 3 | US FAERS | |
| 230 | Hip surgery | FAERS: 3 | US FAERS | |
| 231 | Hydronephrosis | FAERS: 3 | OFFSIDES US FAERS | |
| 232 | Hysterectomy | FAERS: 3 | OFFSIDES US FAERS | |
| 233 | Impaired gastric emptying | FAERS: 3 | OFFSIDES US FAERS | |
| 234 | Musculoskeletal chest pain | FAERS: 3 | OFFSIDES US FAERS | |
| 235 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 236 | Pelvic Pain | FAERS: 3 | US FAERS | |
| 237 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 238 | Polyuria | FAERS: 3 | US FAERS | |
| 239 | Product container seal issue | FAERS: 3 | US FAERS | |
| 240 | Product label issue | FAERS: 3 | US FAERS | |
| 241 | Product quality issue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Product substitution issue | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 243 | Productive Cough | FAERS: 3 | US FAERS | |
| 244 | Psoriasis | FAERS: 3 | US FAERS | |
| 245 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 246 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 247 | Restlessness | FAERS: 3 | US FAERS | |
| 248 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 249 | Saliva altered | FAERS: 3 | OFFSIDES US FAERS | |
| 250 | Septic Shock | FAERS: 3 | US FAERS | |
| 251 | Sinusitis | FAERS: 3 | US FAERS | |
| 252 | Skin lesion | FAERS: 3 | OFFSIDES US FAERS | |
| 253 | Spinal column stenosis | FAERS: 3 | OFFSIDES US FAERS | |
| 254 | Suicide attempt | FAERS: 3 | US FAERS | |
| 255 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 256 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 257 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 258 | Urge Incontinence | FAERS: 3 | OFFSIDES US FAERS | |
| 259 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 260 | Vulvovaginal pruritus | FAERS: 3 | US FAERS | |
| 261 | prostatitis | FAERS: 3 | OFFSIDES US FAERS | |
| 262 | Anosmia | FAERS: 2 | US FAERS | |
| 263 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 264 | Apparent death | FAERS: 2 | US FAERS | |
| 265 | Arthropod bite | FAERS: 2 | US FAERS | |
| 266 | Asthma | FAERS: 2 | US FAERS | |
| 267 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 268 | Bedridden | FAERS: 2 | US FAERS | |
| 269 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 270 | Bladder neck obstruction | FAERS: 2 | US FAERS | |
| 271 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 272 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 273 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 274 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 275 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 276 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 277 | Cheilitis | FAERS: 2 | US FAERS | |
| 278 | Completed Suicide | FAERS: 2 | US FAERS | |
| 279 | Cystopexy | FAERS: 2 | US FAERS | |
| 280 | Disability | FAERS: 2 | US FAERS | |
| 281 | Drug effect variable | FAERS: 2 | US FAERS | |
| 282 | Ear congestion | FAERS: 2 | US FAERS | |
| 283 | Ear discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 284 | Eczema | FAERS: 2 | US FAERS | |
| 285 | Elbow operation | FAERS: 2 | US FAERS | |
| 286 | Emotional disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 287 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 288 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 289 | Euphoric mood | FAERS: 2 | US FAERS | |
| 290 | Flank Pain | FAERS: 2 | US FAERS | |
| 291 | Food Allergy | FAERS: 2 | US FAERS | |
| 292 | Food Poisoning | FAERS: 2 | US FAERS | |
| 293 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 294 | Gastric hypomotility | FAERS: 2 | US FAERS | |
| 295 | Gastritis | FAERS: 2 | US FAERS | |
| 296 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 297 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 298 | General symptom | FAERS: 2 | US FAERS | |
| 299 | Genital burning sensation | FAERS: 2 | US FAERS | |
| 300 | Hilar lymphadenopathy | FAERS: 2 | US FAERS | |
| 301 | Hospice Care | FAERS: 2 | US FAERS | |
| 302 | Hypersomnia | FAERS: 2 | US FAERS | |
| 303 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 304 | Hyperventilation | FAERS: 2 | US FAERS | |
| 305 | Hypohidrosis | FAERS: 2 | US FAERS | |
| 306 | Hypotrichosis | FAERS: 2 | US FAERS | |
| 307 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 308 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 309 | Intercepted product prescribing error | FAERS: 2 | US FAERS | |
| 310 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 311 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 312 | Laceration | FAERS: 2 | US FAERS | |
| 313 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 314 | Limb crushing injury | FAERS: 2 | US FAERS | |
| 315 | Limb operation | FAERS: 2 | US FAERS | |
| 316 | Lip exfoliation | FAERS: 2 | OFFSIDES US FAERS | |
| 317 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 318 | Mastication disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 319 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 320 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 321 | Mood swings | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 323 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 324 | Nephrectomy | FAERS: 2 | US FAERS | |
| 325 | Neuralgia | FAERS: 2 | US FAERS | |
| 326 | Night sweats | FAERS: 2 | US FAERS | |
| 327 | Obesity | FAERS: 2 | US FAERS | |
| 328 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 329 | Oliguria | FAERS: 2 | OFFSIDES US FAERS | |
| 330 | Oral mucosal erythema | FAERS: 2 | OFFSIDES US FAERS | |
| 331 | Osteochondrosis | FAERS: 2 | US FAERS | |
| 332 | Osteopenia | FAERS: 2 | US FAERS | |
| 333 | Pallor | FAERS: 2 | US FAERS | |
| 334 | Paranoia | FAERS: 2 | US FAERS | |
| 335 | Parotitis | FAERS: 2 | OFFSIDES US FAERS | |
| 336 | Penile swelling | FAERS: 2 | US FAERS | |
| 337 | Personality Change | FAERS: 2 | US FAERS | |
| 338 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 339 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 340 | Product dispensing error | FAERS: 2 | US FAERS | |
| 341 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 342 | Prostatectomy | FAERS: 2 | US FAERS | |
| 343 | Quality of life decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 344 | Rectal fissure | FAERS: 2 | US FAERS | |
| 345 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 346 | Respiratory distress | FAERS: 2 | US FAERS | |
| 347 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 348 | Secretion discharge | FAERS: 2 | US FAERS | |
| 349 | Skin irritation | FAERS: 2 | US FAERS | |
| 350 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 351 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 352 | Tongue movement disturbance | FAERS: 2 | US FAERS | |
| 353 | Ulcer | FAERS: 2 | US FAERS | |
| 354 | Upper respiratory tract inflammation | FAERS: 2 | OFFSIDES US FAERS | |
| 355 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 356 | Urethral Obstruction | FAERS: 2 | OFFSIDES US FAERS | |
| 357 | Vaginal Prolapse | FAERS: 2 | US FAERS | |
| 358 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 359 | Wound Infection | FAERS: 2 | US FAERS | |
| 360 | jaundice | FAERS: 2 | US FAERS | |
| 361 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 362 | Abdominal sepsis | FAERS: 1 | US FAERS | |
| 363 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 364 | Abnormal sleep-related event | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 366 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 367 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 368 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 369 | Allergic cystitis | FAERS: 1 | US FAERS | |
| 370 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 371 | Ammonia increased | FAERS: 1 | US FAERS | |
| 372 | Amylase increased | FAERS: 1 | US FAERS | |
| 373 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 374 | Anger | FAERS: 1 | US FAERS | |
| 375 | Anhidrosis | FAERS: 1 | US FAERS | |
| 376 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 377 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 378 | Antipsychotic drug level above therapeutic | FAERS: 1 | US FAERS | |
| 379 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 380 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 381 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 382 | Ascites | FAERS: 1 | US FAERS | |
| 383 | Autoimmune hepatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 384 | Back disorder | FAERS: 1 | US FAERS | |
| 385 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 386 | Benign Prostatic Hyperplasia | FAERS: 1 | OFFSIDES US FAERS | |
| 387 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 388 | Bladder sphincter atony | FAERS: 1 | US FAERS | |
| 389 | Blood Pressure | FAERS: 1 | US FAERS | |
| 390 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 391 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 392 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 393 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 394 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 395 | Bone density decreased | FAERS: 1 | US FAERS | |
| 396 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 397 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 398 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 399 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 400 | Bronchospasm | FAERS: 1 | US FAERS | |
| 401 | Bunion operation | FAERS: 1 | US FAERS | |
| 402 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 403 | Cardiac infection | FAERS: 1 | US FAERS | |
| 404 | Cardiac procedure complication | FAERS: 1 | OFFSIDES US FAERS | |
| 405 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 406 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 407 | Catheter placement | FAERS: 1 | US FAERS | |
| 408 | Catheter related complication | FAERS: 1 | US FAERS | |
| 409 | Catheter site extravasation | FAERS: 1 | US FAERS | |
| 410 | Cellulitis | FAERS: 1 | US FAERS | |
| 411 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 412 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 413 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 414 | Chemical burn of respiratory tract | FAERS: 1 | US FAERS | |
| 415 | Colitis | FAERS: 1 | US FAERS | |
| 416 | Compression fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 417 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 418 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 419 | Corneal defect | FAERS: 1 | US FAERS | |
| 420 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 421 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 422 | Culture urine positive | FAERS: 1 | US FAERS | |
| 423 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 424 | Delusion of replacement | FAERS: 1 | US FAERS | |
| 425 | Depression suicidal | FAERS: 1 | US FAERS | |
| 426 | Device interaction | FAERS: 1 | US FAERS | |
| 427 | Device leakage | FAERS: 1 | US FAERS | |
| 428 | Device material opacification | FAERS: 1 | US FAERS | |
| 429 | Device occlusion | FAERS: 1 | US FAERS | |
| 430 | Device related infection | FAERS: 1 | US FAERS | |
| 431 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 432 | Diplegia | FAERS: 1 | US FAERS | |
| 433 | Disease complication | FAERS: 1 | US FAERS | |
| 434 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 435 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 436 | Drug level decreased | FAERS: 1 | US FAERS | |
| 437 | Drug resistance | FAERS: 1 | US FAERS | |
| 438 | Dry lung syndrome | FAERS: 1 | US FAERS | |
| 439 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 440 | Dyschezia | FAERS: 1 | US FAERS | |
| 441 | Dysphasia | FAERS: 1 | US FAERS | |
| 442 | Elbow deformity | FAERS: 1 | US FAERS | |
| 443 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 444 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 445 | Enterovesical Fistula | FAERS: 1 | US FAERS | |
| 446 | Eosinophilia | FAERS: 1 | US FAERS | |
| 447 | Erection increased | FAERS: 1 | US FAERS | |
| 448 | Escherichia infection | FAERS: 1 | US FAERS | |
| 449 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 450 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 451 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 452 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 453 | Exposure via father | FAERS: 1 | US FAERS | |
| 454 | Exsanguination | FAERS: 1 | US FAERS | |
| 455 | Eye allergy | FAERS: 1 | US FAERS | |
| 456 | Eye inflammation | FAERS: 1 | US FAERS | |
| 457 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 458 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 459 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 460 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 461 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 462 | Frustration | FAERS: 1 | OFFSIDES US FAERS | |
| 463 | Gamma-Glutamyltransferase Increased | FAERS: 1 | OFFSIDES US FAERS | |
| 464 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 465 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 466 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 467 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 468 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 469 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 470 | Gastrostomy | FAERS: 1 | US FAERS | |
| 471 | Genital rash | FAERS: 1 | US FAERS | |
| 472 | Gingivitis | FAERS: 1 | US FAERS | |
| 473 | Growth retardation | FAERS: 1 | US FAERS | |
| 474 | Hair injury | FAERS: 1 | US FAERS | |
| 475 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 476 | Hemiplegia | FAERS: 1 | US FAERS | |
| 477 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 478 | Hernia obstructive | FAERS: 1 | US FAERS | |
| 479 | Hirsutism | FAERS: 1 | US FAERS | |
| 480 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 481 | Hostility | FAERS: 1 | US FAERS | |
| 482 | Hunger | FAERS: 1 | US FAERS | |
| 483 | Hydrocephalus | FAERS: 1 | OFFSIDES US FAERS | |
| 484 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 485 | Hypotonic urinary bladder | FAERS: 1 | US FAERS | |
| 486 | Impaired work ability | FAERS: 1 | US FAERS | |
| 487 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 488 | Incoherent | FAERS: 1 | US FAERS | |
| 489 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 490 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 491 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 492 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 493 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 494 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 495 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 496 | Iritis | FAERS: 1 | US FAERS | |
| 497 | Iron deficiency | FAERS: 1 | US FAERS | |
| 498 | Keratomileusis | FAERS: 1 | US FAERS | |
| 499 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 500 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 501 | Lichen Planus | FAERS: 1 | OFFSIDES US FAERS | |
| 502 | Ligament rupture | FAERS: 1 | OFFSIDES US FAERS | |
| 503 | Limb discomfort | FAERS: 1 | US FAERS | |
| 504 | Loose tooth | FAERS: 1 | OFFSIDES US FAERS | |
| 505 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 506 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 507 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 508 | Medication residue present | FAERS: 1 | US FAERS | |
| 509 | Menopause | FAERS: 1 | US FAERS | |
| 510 | Mental status changes | FAERS: 1 | OFFSIDES US FAERS | |
| 511 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 512 | Mole excision | FAERS: 1 | US FAERS | |
| 513 | Monoplegia | FAERS: 1 | US FAERS | |
| 514 | Motion Sickness | FAERS: 1 | OFFSIDES US FAERS | |
| 515 | Multiple allergies | FAERS: 1 | US FAERS | |
| 516 | Multiple sclerosis relapse | FAERS: 1 | OFFSIDES US FAERS | |
| 517 | Muscle tightness | FAERS: 1 | US FAERS | |
| 518 | Myopathy | FAERS: 1 | US FAERS | |
| 519 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 520 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 521 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 522 | Nerve injury | FAERS: 1 | US FAERS | |
| 523 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 524 | Nipple pain | FAERS: 1 | US FAERS | |
| 525 | Nodule | FAERS: 1 | US FAERS | |
| 526 | Obstruction | FAERS: 1 | US FAERS | |
| 527 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 528 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 529 | Osteoporosis | FAERS: 1 | US FAERS | |
| 530 | Oxygen supplementation | FAERS: 1 | OFFSIDES US FAERS | |
| 531 | PO2 decreased | FAERS: 1 | US FAERS | |
| 532 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 533 | Pancreatic enzyme abnormality | FAERS: 1 | US FAERS | |
| 534 | Pancreatitis | FAERS: 1 | US FAERS | |
| 535 | Paradoxical drug reaction | FAERS: 1 | OFFSIDES US FAERS | |
| 536 | Paramnesia | FAERS: 1 | US FAERS | |
| 537 | Penile Infection | FAERS: 1 | US FAERS | |
| 538 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 539 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 540 | Post procedural complication | FAERS: 1 | US FAERS | |
| 541 | Posterior capsule opacification | FAERS: 1 | US FAERS | |
| 542 | Pregnancy | FAERS: 1 | US FAERS | |
| 543 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 544 | Product commingling | FAERS: 1 | US FAERS | |
| 545 | Product contamination | FAERS: 1 | US FAERS | |
| 546 | Product counterfeit | FAERS: 1 | US FAERS | |
| 547 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 548 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 549 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 550 | Product shape issue | FAERS: 1 | US FAERS | |
| 551 | Product size issue | FAERS: 1 | US FAERS | |
| 552 | Product supply issue | FAERS: 1 | US FAERS | |
| 553 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 554 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 555 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 556 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 557 | Pterygium | FAERS: 1 | US FAERS | |
| 558 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 559 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 560 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 561 | Pyuria | FAERS: 1 | US FAERS | |
| 562 | Quadriplegia | FAERS: 1 | US FAERS | |
| 563 | Refusal of treatment by relative | FAERS: 1 | OFFSIDES US FAERS | |
| 564 | Regurgitation | FAERS: 1 | US FAERS | |
| 565 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 566 | Residual urine volume increased | FAERS: 1 | OFFSIDES US FAERS | |
| 567 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 568 | Root canal infection | FAERS: 1 | US FAERS | |
| 569 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 570 | Sciatica | FAERS: 1 | US FAERS | |
| 571 | Scotoma | FAERS: 1 | US FAERS | |
| 572 | Semen volume decreased | FAERS: 1 | US FAERS | |
| 573 | Shock | FAERS: 1 | US FAERS | |
| 574 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 575 | Skeletal injury | FAERS: 1 | OFFSIDES US FAERS | |
| 576 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 577 | Skin reaction | FAERS: 1 | US FAERS | |
| 578 | Sleep Talking | FAERS: 1 | OFFSIDES US FAERS | |
| 579 | Slow speech | FAERS: 1 | US FAERS | |
| 580 | Sneezing | FAERS: 1 | US FAERS | |
| 581 | Snoring | FAERS: 1 | US FAERS | |
| 582 | Somnambulism | FAERS: 1 | US FAERS | |
| 583 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 584 | Sperm concentration zero | FAERS: 1 | US FAERS | |
| 585 | Spinal fusion surgery | FAERS: 1 | OFFSIDES US FAERS | |
| 586 | Spondylitis | FAERS: 1 | US FAERS | |
| 587 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 588 | Stoma complication | FAERS: 1 | US FAERS | |
| 589 | Strabismus | FAERS: 1 | US FAERS | |
| 590 | Strawberry tongue | FAERS: 1 | US FAERS | |
| 591 | Stupor | FAERS: 1 | US FAERS | |
| 592 | Sudden death | FAERS: 1 | US FAERS | |
| 593 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 594 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 595 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 596 | Tension Headache | FAERS: 1 | US FAERS | |
| 597 | Tension | FAERS: 1 | US FAERS | |
| 598 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 599 | Therapy change | FAERS: 1 | US FAERS | |
| 600 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 601 | Throat cancer | FAERS: 1 | US FAERS | |
| 602 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 603 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 604 | Tooth Extraction | FAERS: 1 | OFFSIDES US FAERS | |
| 605 | Tooth Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 606 | Toothache | FAERS: 1 | US FAERS | |
| 607 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 608 | Tracheostomy malfunction | FAERS: 1 | US FAERS | |
| 609 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 610 | Trichiasis | FAERS: 1 | US FAERS | |
| 611 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 612 | Unhealthy diet | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 613 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 614 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 615 | Urethritis | FAERS: 1 | US FAERS | |
| 616 | Urinary incontinence surgery | FAERS: 1 | US FAERS | |
| 617 | Urinary straining | FAERS: 1 | US FAERS | |
| 618 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 619 | Uveitis | FAERS: 1 | US FAERS | |
| 620 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 621 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 622 | Vaginal pain | FAERS: 1 | US FAERS | |
| 623 | Vascular rupture | FAERS: 1 | US FAERS | |
| 624 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 625 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 626 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 627 | Walking aid user | FAERS: 1 | US FAERS | |
| 628 | Wheelchair user | FAERS: 1 | US FAERS | |
| 629 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 630 | cancer surgery | FAERS: 1 | US FAERS | |
| 631 | colonoscopy | FAERS: 1 | US FAERS | |
| 632 | fibroma | FAERS: 1 | US FAERS | |
| 633 | Acid reflux | OFFSIDES | ||
| 634 | Acoustic Neuroma | OFFSIDES | ||
| 635 | Actinomycosis | OFFSIDES | ||
| 636 | Acute myocardial infarction | OFFSIDES | ||
| 637 | Acute psychosis | OFFSIDES | ||
| 638 | Alveoloplasty | OFFSIDES | ||
| 639 | Amphetamines | OFFSIDES | ||
| 640 | Anal sphincter atony | OFFSIDES | ||
| 641 | Anhedonia | OFFSIDES | ||
| 642 | Anoxic Encephalopathy | OFFSIDES | ||
| 643 | Artificial crown procedure | OFFSIDES | ||
| 644 | Autoimmune thyroiditis | OFFSIDES | ||
| 645 | Autologous bone marrow transplantation therapy | OFFSIDES | ||
| 646 | Blood alkaline phosphatase decreased | OFFSIDES | ||
| 647 | Blood cholinesterase decreased | OFFSIDES | ||
| 648 | Blood creatine phosphokinase MB increased | OFFSIDES | ||
| 649 | Blood prolactin increased | OFFSIDES | ||
| 650 | Blood uric acid | OFFSIDES | ||
| 651 | Blurred vision | OFFSIDES | ||
| 652 | Bone lesion | OFFSIDES | ||
| 653 | Brain Concussion | OFFSIDES | ||
| 654 | Breast Cyst | OFFSIDES | ||
| 655 | Breast cancer stage II | OFFSIDES | ||
| 656 | Bronchial Obstruction | OFFSIDES | ||
| 657 | Cardiothoracic ratio increased | OFFSIDES | ||
| 658 | Carotid artery occlusion | OFFSIDES | ||
| 659 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 660 | Chronic sinusitis | OFFSIDES | ||
| 661 | Cold sweat | OFFSIDES | ||
| 662 | Compulsive shopping | OFFSIDES | ||
| 663 | Congenital hypertrichosis | OFFSIDES | ||
| 664 | Contracted bladder | OFFSIDES | ||
| 665 | Cystocele | OFFSIDES | ||
| 666 | Debridement | OFFSIDES | ||
| 667 | Dementia of the Alzheimer's type, with delusions | OFFSIDES | ||
| 668 | Dental abscess | OFFSIDES | ||
| 669 | Dependence | OFFSIDES | ||
| 670 | Dialysis disequilibrium syndrome | OFFSIDES | ||
| 671 | Diarrhea | 11488427 | CTD | |
| 672 | Diverticulum | OFFSIDES | ||
| 673 | Drowsiness | OFFSIDES | ||
| 674 | Drug screen negative | OFFSIDES | ||
| 675 | Drug withdrawal headache | OFFSIDES | ||
| 676 | Economic problem | OFFSIDES | ||
| 677 | Eczema Herpeticum | OFFSIDES | ||
| 678 | Ejection Fraction Decreased | OFFSIDES | ||
| 679 | Endometrial Hyperplasia | OFFSIDES | ||
| 680 | Epinephrine increased | OFFSIDES | ||
| 681 | Fistula repair | OFFSIDES | ||
| 682 | Heat illness | OFFSIDES | ||
| 683 | Hepatic congestion | OFFSIDES | ||
| 684 | Hiccough | OFFSIDES | ||
| 685 | Hyperkinetic Heart Syndrome | OFFSIDES | ||
| 686 | Hypoxia | OFFSIDES | ||
| 687 | Hysterosalpingo-oophorectomy | OFFSIDES | ||
| 688 | Incision site pain | OFFSIDES | ||
| 689 | Infective spondylitis | OFFSIDES | ||
| 690 | Injury asphyxiation | OFFSIDES | ||
| 691 | Insulin-like growth factor increased | OFFSIDES | ||
| 692 | Long QT Syndrome | OFFSIDES | ||
| 693 | Lung consolidation | OFFSIDES | ||
| 694 | Marasmus | OFFSIDES | ||
| 695 | Medical device change | OFFSIDES | ||
| 696 | Mouth Diseases | 19837435 | CTD | |
| 697 | Muscle Weakness | OFFSIDES | ||
| 698 | Myeloma recurrence | OFFSIDES | ||
| 699 | Negative thoughts | OFFSIDES | ||
| 700 | Nerve Block | OFFSIDES | ||
| 701 | Obsessive thoughts | Canada Vigilance: 1 | Canada Vigilance | |
| 702 | Open reduction of fracture | OFFSIDES | ||
| 703 | Oral Cavity Fistula | OFFSIDES | ||
| 704 | Oral fungal infection | OFFSIDES | ||
| 705 | Oropharyngeal plaque | OFFSIDES | ||
| 706 | Osteomyelitis | OFFSIDES | ||
| 707 | Papilloma | OFFSIDES | ||
| 708 | Papule | Canada Vigilance: 1 | Canada Vigilance | |
| 709 | Paraparesis | OFFSIDES | ||
| 710 | Parasomnia | OFFSIDES | ||
| 711 | Parathyroidectomy | OFFSIDES | ||
| 712 | Paresis anal sphincter | OFFSIDES | ||
| 713 | Periarthritis | OFFSIDES | ||
| 714 | Pharyngolaryngeal discomfort | OFFSIDES | ||
| 715 | Physical disability | OFFSIDES | ||
| 716 | Polyneuropathy | OFFSIDES | ||
| 717 | Post procedural dizziness | OFFSIDES | ||
| 718 | Postmenopause | OFFSIDES | ||
| 719 | Postoperative thrombosis | OFFSIDES | ||
| 720 | Postoperative wound complication | OFFSIDES | ||
| 721 | Postrenal failure | OFFSIDES | ||
| 722 | Pre-Eclampsia | OFFSIDES | ||
| 723 | Precancerous cells present | OFFSIDES | ||
| 724 | Primary sequestrum | OFFSIDES | ||
| 725 | Progesterone receptor assay | OFFSIDES | ||
| 726 | Pseudomonal sepsis | OFFSIDES | ||
| 727 | Punctate keratitis | OFFSIDES | ||
| 728 | Purulent discharge | OFFSIDES | ||
| 729 | QRS axis abnormal | OFFSIDES | ||
| 730 | Rectal Prolapse | OFFSIDES | ||
| 731 | Rectal polyp | OFFSIDES | ||
| 732 | Renal cyst | OFFSIDES | ||
| 733 | Retinal exudates | OFFSIDES | ||
| 734 | Septal panniculitis | OFFSIDES | ||
| 735 | Sick Sinus Syndrome | OFFSIDES | ||
| 736 | Sinus bradycardia | OFFSIDES | ||
| 737 | Skin Induration | OFFSIDES | ||
| 738 | Soft Tissue Injuries | OFFSIDES | ||
| 739 | Soft tissue inflammation | OFFSIDES | ||
| 740 | Stem cell transplant | OFFSIDES | ||
| 741 | Synovial Cyst | OFFSIDES | ||
| 742 | Tardive Dyskinesia | OFFSIDES | ||
| 743 | Thalamic infarction | OFFSIDES | ||
| 744 | Thrombotic stroke | OFFSIDES | ||
| 745 | Tinea Versicolor | OFFSIDES | ||
| 746 | Tonsillectomy | OFFSIDES | ||
| 747 | Urinary tract infection enterococcal | OFFSIDES | ||
| 748 | Vaginal abscess | OFFSIDES | ||
| 749 | Vulvovaginal erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 750 | Weight Gain | OFFSIDES | ||
| 751 | Zinc deficiency | OFFSIDES | ||
| 752 | effusion | OFFSIDES | ||
| 753 | kyphosis | OFFSIDES | ||
| 754 | oligodendroglioma | OFFSIDES | ||
| 755 | pH urine increased | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.