Droxidopa
(QXWYKJLNLSIPIN-JGVFFNPUSA-N)
Structure
- SMILES
- OC(=O)[C@H]([C@@H](c1ccc(c(c1)O)O)O)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- C01CA27
- Molecular Formula:
- C9H11NO5
- Molecular Weight:
- 213.187
- Log P:
- 0.2434
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 5
- TPSA:
- 124.01
- CAS Number(s):
- 492-46-6; 3916-18-5; 23651-95-8
Synonym(s)
1.
Droxidopa
2.
3,4-Dihydroxyphenylserine
3.
3,4-threo-DOPS
4.
DL-threo-3,4-Dihydroxyphenylserine
5.
Droxidopa, (DL-Tyr)-Isomer
6.
erythro-3,4-Dihydroxyphenylserine
7.
threo-DOPS
8.
3,4 Dihydroxyphenylserine
9.
3,4 threo DOPS
10.
DL threo 3,4 Dihydroxyphenylserine
11.
erythro 3,4 Dihydroxyphenylserine
12.
threo DOPS
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 2054 | SIDER US FAERS | |
| 2 | Drug ineffective | FAERS: 1232 | US FAERS | |
| 3 | Headache | FAERS: 1215 | SIDER US FAERS | |
| 4 | Fatigue | FAERS: 886 | US FAERS | |
| 5 | Drug dose omission | FAERS: 831 | US FAERS | |
| 6 | Nausea | FAERS: 754 | SIDER US FAERS | |
| 7 | Hypotension | FAERS: 750 | US FAERS | |
| 8 | Blood pressure fluctuation | FAERS: 582 | US FAERS | |
| 9 | Malaise | FAERS: 572 | US FAERS | |
| 10 | Asthenia | FAERS: 486 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 380 | SIDER US FAERS | |
| 12 | Somnolence | FAERS: 246 | US FAERS | |
| 13 | Syncope | FAERS: 246 | SIDER US FAERS | |
| 14 | Presyncope | FAERS: 228 | US FAERS | |
| 15 | Vomiting | FAERS: 222 | US FAERS | |
| 16 | Incorrect dose administered | FAERS: 214 | US FAERS | |
| 17 | Tremor | FAERS: 214 | 986992 | CTD US FAERS |
| 18 | Palpitations | FAERS: 176 | US FAERS | |
| 19 | Chest Pain | FAERS: 175 | US FAERS | |
| 20 | Urinary tract infection | FAERS: 171 | SIDER US FAERS | |
| 21 | Abdominal discomfort | FAERS: 131 | US FAERS | |
| 22 | Inappropriate schedule of drug administration | FAERS: 131 | US FAERS | |
| 23 | Memory impairment | FAERS: 117 | US FAERS | |
| 24 | Product dose omission | FAERS: 106 | US FAERS | |
| 25 | Pneumonia | FAERS: 104 | US FAERS | |
| 26 | Chest discomfort | FAERS: 93 | US FAERS | |
| 27 | Drug dose titration not performed | FAERS: 93 | US FAERS | |
| 28 | Pain | FAERS: 92 | US FAERS | |
| 29 | Cerebrovascular accident | FAERS: 90 | US FAERS | |
| 30 | Nasopharyngitis | FAERS: 86 | US FAERS | |
| 31 | Supine hypertension | FAERS: 83 | US FAERS | |
| 32 | Anxiety | FAERS: 82 | US FAERS | |
| 33 | Lethargy | FAERS: 81 | US FAERS | |
| 34 | Back Pain | FAERS: 78 | US FAERS | |
| 35 | Peripheral swelling | FAERS: 77 | US FAERS | |
| 36 | Drug titration error | FAERS: 76 | US FAERS | |
| 37 | Pruritus | FAERS: 76 | US FAERS | |
| 38 | Dehydration | FAERS: 73 | US FAERS | |
| 39 | Constipation | FAERS: 72 | US FAERS | |
| 40 | Musculoskeletal stiffness | FAERS: 70 | US FAERS | |
| 41 | Abdominal Pain | FAERS: 68 | US FAERS | |
| 42 | Visual Impairment | FAERS: 65 | US FAERS | |
| 43 | Disorientation | FAERS: 62 | US FAERS | |
| 44 | Blood pressure orthostatic decreased | FAERS: 60 | US FAERS | |
| 45 | Flushing | FAERS: 52 | US FAERS | |
| 46 | Hypersomnia | FAERS: 51 | US FAERS | |
| 47 | Influenza | FAERS: 51 | US FAERS | |
| 48 | Myalgia | FAERS: 49 | US FAERS | |
| 49 | Arthralgia | FAERS: 48 | US FAERS | |
| 50 | Drug administration error | FAERS: 47 | US FAERS | |
| 51 | Head discomfort | FAERS: 47 | US FAERS | |
| 52 | Nervousness | FAERS: 47 | US FAERS | |
| 53 | Myocardial Infarction | FAERS: 46 | US FAERS | |
| 54 | Wrong technique in product usage process | FAERS: 43 | US FAERS | |
| 55 | Intentional product use issue | FAERS: 41 | US FAERS | |
| 56 | Therapeutic response unexpected | FAERS: 41 | US FAERS | |
| 57 | Hypersensitivity | FAERS: 39 | US FAERS | |
| 58 | Neck Pain | FAERS: 39 | US FAERS | |
| 59 | Vertigo | FAERS: 39 | US FAERS | |
| 60 | Weight decreased | FAERS: 38 | US FAERS | |
| 61 | Abasia | FAERS: 37 | US FAERS | |
| 62 | Epistaxis | FAERS: 37 | US FAERS | |
| 63 | Dyspepsia | FAERS: 36 | US FAERS | |
| 64 | Erythema | FAERS: 35 | US FAERS | |
| 65 | Feeling jittery | FAERS: 35 | US FAERS | |
| 66 | Labile blood pressure | FAERS: 35 | US FAERS | |
| 67 | Prescribed overdose | FAERS: 33 | US FAERS | |
| 68 | Sinusitis | FAERS: 33 | US FAERS | |
| 69 | Agitation | FAERS: 30 | US FAERS | |
| 70 | Dysarthria | FAERS: 30 | US FAERS | |
| 71 | General physical health deterioration | FAERS: 30 | US FAERS | |
| 72 | Urticaria | FAERS: 30 | US FAERS | |
| 73 | Sepsis | FAERS: 29 | US FAERS | |
| 74 | Amnesia | FAERS: 28 | US FAERS | |
| 75 | Atrial Fibrillation | FAERS: 28 | US FAERS | |
| 76 | Blood glucose increased | FAERS: 28 | US FAERS | |
| 77 | Pallor | FAERS: 28 | US FAERS | |
| 78 | Activities of daily living impaired | FAERS: 27 | US FAERS | |
| 79 | Adverse event | FAERS: 27 | US FAERS | |
| 80 | Urinary Incontinence | FAERS: 27 | US FAERS | |
| 81 | Limb discomfort | FAERS: 26 | US FAERS | |
| 82 | Tachycardia | FAERS: 26 | US FAERS | |
| 83 | Dementia | FAERS: 25 | US FAERS | |
| 84 | Dysphonia | FAERS: 25 | US FAERS | |
| 85 | Infection | FAERS: 25 | US FAERS | |
| 86 | Joint swelling | FAERS: 25 | US FAERS | |
| 87 | Bronchitis | FAERS: 24 | US FAERS | |
| 88 | Loss of personal independence in daily activities | FAERS: 24 | US FAERS | |
| 89 | Chills | FAERS: 23 | US FAERS | |
| 90 | Gait inability | FAERS: 23 | US FAERS | |
| 91 | Overdose | FAERS: 23 | US FAERS | |
| 92 | Sluggishness | FAERS: 22 | US FAERS | |
| 93 | Unresponsive to stimuli | FAERS: 22 | US FAERS | |
| 94 | Aphasia | FAERS: 21 | US FAERS | |
| 95 | Blood urine present | FAERS: 21 | US FAERS | |
| 96 | Cystitis | FAERS: 21 | US FAERS | |
| 97 | Eye pain | FAERS: 21 | US FAERS | |
| 98 | Poor quality sleep | FAERS: 21 | US FAERS | |
| 99 | Freezing phenomenon | FAERS: 20 | US FAERS | |
| 100 | Tinnitus | FAERS: 20 | US FAERS | |
| 101 | Accidental overdose | FAERS: 19 | US FAERS | |
| 102 | Cardiac Arrest | FAERS: 19 | US FAERS | |
| 103 | Discomfort | FAERS: 19 | US FAERS | |
| 104 | Inappropriate schedule of product administration | FAERS: 19 | US FAERS | |
| 105 | Muscle tightness | FAERS: 19 | US FAERS | |
| 106 | Product preparation error | FAERS: 19 | US FAERS | |
| 107 | Swelling | FAERS: 19 | US FAERS | |
| 108 | Hypokinesia | FAERS: 18 | US FAERS | |
| 109 | Musculoskeletal Pain | FAERS: 18 | US FAERS | |
| 110 | Product use complaint | FAERS: 18 | US FAERS | |
| 111 | Alopecia | FAERS: 17 | US FAERS | |
| 112 | Blood glucose decreased | FAERS: 17 | US FAERS | |
| 113 | Blood pressure immeasurable | FAERS: 17 | US FAERS | |
| 114 | Muscle Rigidity | FAERS: 17 | US FAERS | |
| 115 | Photophobia | FAERS: 17 | US FAERS | |
| 116 | Cold sweat | FAERS: 16 | US FAERS | |
| 117 | Mental status changes | FAERS: 16 | US FAERS | |
| 118 | Nephrolithiasis | FAERS: 16 | US FAERS | |
| 119 | Bedridden | FAERS: 15 | US FAERS | |
| 120 | Burning sensation | FAERS: 15 | US FAERS | |
| 121 | Disease Progression | FAERS: 15 | US FAERS | |
| 122 | Dysuria | FAERS: 15 | US FAERS | |
| 123 | Flatulence | FAERS: 15 | US FAERS | |
| 124 | Impaired gastric emptying | FAERS: 15 | US FAERS | |
| 125 | Night sweats | FAERS: 15 | US FAERS | |
| 126 | Blood potassium decreased | FAERS: 14 | US FAERS | |
| 127 | Blood pressure inadequately controlled | FAERS: 14 | US FAERS | |
| 128 | Joint injury | FAERS: 14 | US FAERS | |
| 129 | Mental impairment | FAERS: 14 | US FAERS | |
| 130 | Pregnancy | FAERS: 14 | US FAERS | |
| 131 | Stress | FAERS: 14 | US FAERS | |
| 132 | Anger | FAERS: 13 | US FAERS | |
| 133 | Oropharyngeal pain | FAERS: 13 | US FAERS | |
| 134 | Restless Legs Syndrome | FAERS: 13 | US FAERS | |
| 135 | Seizure like phenomena | FAERS: 13 | US FAERS | |
| 136 | Chromaturia | FAERS: 12 | US FAERS | |
| 137 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 138 | Incontinence | FAERS: 12 | US FAERS | |
| 139 | Musculoskeletal discomfort | FAERS: 12 | US FAERS | |
| 140 | Nocturia | FAERS: 12 | US FAERS | |
| 141 | Product difficult to swallow | FAERS: 12 | US FAERS | |
| 142 | Restlessness | FAERS: 12 | US FAERS | |
| 143 | Retching | FAERS: 12 | US FAERS | |
| 144 | Temperature intolerance | FAERS: 12 | US FAERS | |
| 145 | Terminal state | FAERS: 12 | US FAERS | |
| 146 | Aphonia | FAERS: 11 | US FAERS | |
| 147 | Feeling Cold | FAERS: 11 | US FAERS | |
| 148 | Limb injury | FAERS: 11 | US FAERS | |
| 149 | Multiple System Atrophy | FAERS: 11 | US FAERS | |
| 150 | Ankle Fracture | FAERS: 10 | US FAERS | |
| 151 | Depressed Level of Consciousness | FAERS: 10 | US FAERS | |
| 152 | Depressed mood | FAERS: 10 | US FAERS | |
| 153 | Diplopia | FAERS: 10 | US FAERS | |
| 154 | Hypophagia | FAERS: 10 | US FAERS | |
| 155 | Thrombosis | FAERS: 10 | US FAERS | |
| 156 | Autonomic nervous system imbalance | FAERS: 9 | US FAERS | |
| 157 | Blindness | FAERS: 9 | US FAERS | |
| 158 | Cellulitis | FAERS: 9 | US FAERS | |
| 159 | Fibromyalgia | FAERS: 9 | US FAERS | |
| 160 | Intentional dose omission | FAERS: 9 | US FAERS | |
| 161 | Laceration | FAERS: 9 | US FAERS | |
| 162 | Medication Error | FAERS: 9 | US FAERS | |
| 163 | Pancreatitis | FAERS: 9 | US FAERS | |
| 164 | Staring | FAERS: 9 | US FAERS | |
| 165 | Cardiac Flutter | FAERS: 8 | US FAERS | |
| 166 | Deep Vein Thrombosis | FAERS: 8 | US FAERS | |
| 167 | Feeling of body temperature change | FAERS: 8 | US FAERS | |
| 168 | Incoherent | FAERS: 8 | US FAERS | |
| 169 | Initial insomnia | FAERS: 8 | US FAERS | |
| 170 | Joint stiffness | FAERS: 8 | US FAERS | |
| 171 | Orthostatic intolerance | FAERS: 8 | US FAERS | |
| 172 | Therapy cessation | FAERS: 8 | US FAERS | |
| 173 | Viral upper respiratory tract infection | FAERS: 8 | US FAERS | |
| 174 | Amyloidosis | FAERS: 7 | US FAERS | |
| 175 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 176 | Arthritis | FAERS: 7 | US FAERS | |
| 177 | Back disorder | FAERS: 7 | US FAERS | |
| 178 | Cataract | FAERS: 7 | US FAERS | |
| 179 | Choking | FAERS: 7 | US FAERS | |
| 180 | Crying | FAERS: 7 | US FAERS | |
| 181 | Drug administered to patient of inappropriate age | FAERS: 7 | US FAERS | |
| 182 | Dysgeusia | FAERS: 7 | US FAERS | |
| 183 | Emotional disorder | FAERS: 7 | US FAERS | |
| 184 | Gastritis | FAERS: 7 | US FAERS | |
| 185 | Intestinal Obstruction | FAERS: 7 | US FAERS | |
| 186 | Musculoskeletal chest pain | FAERS: 7 | US FAERS | |
| 187 | Product storage error | FAERS: 7 | US FAERS | |
| 188 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 189 | Pulmonary Embolism | FAERS: 7 | US FAERS | |
| 190 | Pulmonary congestion | FAERS: 7 | US FAERS | |
| 191 | Unevaluable event | FAERS: 7 | US FAERS | |
| 192 | Urinary Retention | FAERS: 7 | US FAERS | |
| 193 | Acne | FAERS: 6 | US FAERS | |
| 194 | Bone pain | FAERS: 6 | US FAERS | |
| 195 | Bradyphrenia | FAERS: 6 | US FAERS | |
| 196 | Clostridium difficile infection | FAERS: 6 | US FAERS | |
| 197 | Cyanosis | FAERS: 6 | US FAERS | |
| 198 | Delirium | FAERS: 6 | US FAERS | |
| 199 | Dry skin | FAERS: 6 | US FAERS | |
| 200 | Gastrointestinal Pain | FAERS: 6 | US FAERS | |
| 201 | Increased tendency to bruise | FAERS: 6 | US FAERS | |
| 202 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 203 | Neuralgia | FAERS: 6 | US FAERS | |
| 204 | Product label confusion | FAERS: 6 | US FAERS | |
| 205 | Wheezing | FAERS: 6 | US FAERS | |
| 206 | skin abrasion | FAERS: 6 | US FAERS | |
| 207 | Aneurysm | FAERS: 5 | US FAERS | |
| 208 | Arthropathy | FAERS: 5 | US FAERS | |
| 209 | Asthma | FAERS: 5 | US FAERS | |
| 210 | Bowel movement irregularity | FAERS: 5 | US FAERS | |
| 211 | Carpal Tunnel Syndrome | FAERS: 5 | US FAERS | |
| 212 | Cataract operation | FAERS: 5 | US FAERS | |
| 213 | Colitis | FAERS: 5 | US FAERS | |
| 214 | Disease complication | FAERS: 5 | US FAERS | |
| 215 | Drooling | FAERS: 5 | US FAERS | |
| 216 | Ear discomfort | FAERS: 5 | US FAERS | |
| 217 | Electrocardiogram abnormal | FAERS: 5 | US FAERS | |
| 218 | Erectile dysfunction | FAERS: 5 | US FAERS | |
| 219 | Gastrointestinal infection | FAERS: 5 | US FAERS | |
| 220 | Limb operation | FAERS: 5 | US FAERS | |
| 221 | Lip swelling | FAERS: 5 | US FAERS | |
| 222 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 223 | Rebound effect | FAERS: 5 | US FAERS | |
| 224 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 225 | Slow speech | FAERS: 5 | US FAERS | |
| 226 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 227 | Tension Headache | FAERS: 5 | US FAERS | |
| 228 | Therapeutic response delayed | FAERS: 5 | US FAERS | |
| 229 | Apathy | FAERS: 4 | US FAERS | |
| 230 | Bladder pain | FAERS: 4 | US FAERS | |
| 231 | Blood creatinine increased | FAERS: 4 | US FAERS | |
| 232 | Bradycardia | FAERS: 4 | US FAERS | |
| 233 | Device related infection | FAERS: 4 | US FAERS | |
| 234 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 235 | Drug effect delayed | FAERS: 4 | US FAERS | |
| 236 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 237 | Drug withdrawal convulsions | FAERS: 4 | US FAERS | |
| 238 | Early satiety | FAERS: 4 | US FAERS | |
| 239 | Epilepsy | FAERS: 4 | US FAERS | |
| 240 | Eye irritation | FAERS: 4 | US FAERS | |
| 241 | Fear of falling | FAERS: 4 | US FAERS | |
| 242 | Fluid overload | FAERS: 4 | US FAERS | |
| 243 | Fracture | FAERS: 4 | US FAERS | |
| 244 | Hernia | FAERS: 4 | US FAERS | |
| 245 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 246 | Medical device implantation | FAERS: 4 | US FAERS | |
| 247 | Muscle Spasticity | FAERS: 4 | US FAERS | |
| 248 | Mydriasis | FAERS: 4 | US FAERS | |
| 249 | Pain of skin | FAERS: 4 | US FAERS | |
| 250 | Paranoia | FAERS: 4 | US FAERS | |
| 251 | Personality Change | FAERS: 4 | US FAERS | |
| 252 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 253 | Septic Shock | FAERS: 4 | US FAERS | |
| 254 | Skin irritation | FAERS: 4 | US FAERS | |
| 255 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 256 | Thirst | FAERS: 4 | US FAERS | |
| 257 | Throat irritation | FAERS: 4 | US FAERS | |
| 258 | Ulcer | FAERS: 4 | US FAERS | |
| 259 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 260 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 261 | Ageusia | FAERS: 3 | US FAERS | |
| 262 | Angioedema | FAERS: 3 | US FAERS | |
| 263 | Autonomic neuropathy | FAERS: 3 | US FAERS | |
| 264 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 265 | Blood potassium abnormal | FAERS: 3 | US FAERS | |
| 266 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 267 | Blood pressure orthostatic abnormal | FAERS: 3 | US FAERS | |
| 268 | Blood pressure orthostatic increased | FAERS: 3 | US FAERS | |
| 269 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 270 | Catatonia | FAERS: 3 | US FAERS | |
| 271 | Chemotherapy | FAERS: 3 | US FAERS | |
| 272 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 273 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 274 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 275 | Dysgraphia | FAERS: 3 | US FAERS | |
| 276 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 277 | Eructation | FAERS: 3 | US FAERS | |
| 278 | Expired product administered | FAERS: 3 | US FAERS | |
| 279 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 280 | Food Poisoning | FAERS: 3 | US FAERS | |
| 281 | Head titubation | FAERS: 3 | US FAERS | |
| 282 | Hip surgery | FAERS: 3 | US FAERS | |
| 283 | Immobile | FAERS: 3 | US FAERS | |
| 284 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 285 | Incorrect route of product administration | FAERS: 3 | US FAERS | |
| 286 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 287 | Intracranial Aneurysm | FAERS: 3 | US FAERS | |
| 288 | Mood swings | FAERS: 3 | US FAERS | |
| 289 | Muscle strain | FAERS: 3 | US FAERS | |
| 290 | Nipple pain | FAERS: 3 | US FAERS | |
| 291 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 292 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 293 | Peripheral arterial occlusive disease | FAERS: 3 | US FAERS | |
| 294 | Poor peripheral circulation | FAERS: 3 | US FAERS | |
| 295 | Post procedural complication | FAERS: 3 | US FAERS | |
| 296 | Product use issue | FAERS: 3 | US FAERS | |
| 297 | Productive Cough | FAERS: 3 | US FAERS | |
| 298 | Rash erythematous | FAERS: 3 | US FAERS | |
| 299 | Renal pain | FAERS: 3 | US FAERS | |
| 300 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 301 | Sinus headache | FAERS: 3 | US FAERS | |
| 302 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 303 | Snoring | FAERS: 3 | US FAERS | |
| 304 | Somnambulism | FAERS: 3 | US FAERS | |
| 305 | Spondylitis | FAERS: 3 | US FAERS | |
| 306 | Stupor | FAERS: 3 | US FAERS | |
| 307 | Temperature regulation disorder | FAERS: 3 | US FAERS | |
| 308 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 309 | Wheelchair user | FAERS: 3 | US FAERS | |
| 310 | nervous system disorder | FAERS: 3 | US FAERS | |
| 311 | Accidental underdose | FAERS: 2 | US FAERS | |
| 312 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 313 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 314 | Altered visual depth perception | FAERS: 2 | US FAERS | |
| 315 | Amputation | FAERS: 2 | US FAERS | |
| 316 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 317 | Asthenopia | FAERS: 2 | US FAERS | |
| 318 | Ataxia | FAERS: 2 | US FAERS | |
| 319 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 320 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 321 | Autonomic Dysreflexia | FAERS: 2 | US FAERS | |
| 322 | Benign Neoplasm | FAERS: 2 | US FAERS | |
| 323 | Biliary tract infection | FAERS: 2 | US FAERS | |
| 324 | Bladder dysfunction | FAERS: 2 | US FAERS | |
| 325 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 326 | Bone abscess | FAERS: 2 | US FAERS | |
| 327 | Bronchospasm | FAERS: 2 | US FAERS | |
| 328 | Burning feet syndrome | FAERS: 2 | US FAERS | |
| 329 | Cardiac ablation | FAERS: 2 | US FAERS | |
| 330 | Catheter site infection | FAERS: 2 | US FAERS | |
| 331 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 332 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 333 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 334 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 335 | Cyst | FAERS: 2 | US FAERS | |
| 336 | Deafness | FAERS: 2 | US FAERS | |
| 337 | Dystonia | FAERS: 2 | 16277235 | CTD US FAERS |
| 338 | Embolic stroke | FAERS: 2 | US FAERS | |
| 339 | Emotional distress | FAERS: 2 | US FAERS | |
| 340 | Exophthalmos | FAERS: 2 | US FAERS | |
| 341 | Exposure to toxic agent | FAERS: 2 | US FAERS | |
| 342 | Facial paralysis | FAERS: 2 | US FAERS | |
| 343 | Flank Pain | FAERS: 2 | US FAERS | |
| 344 | Formication | FAERS: 2 | US FAERS | |
| 345 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 346 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 347 | Hemiplegia | FAERS: 2 | US FAERS | |
| 348 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 349 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 350 | Hypoxia | FAERS: 2 | US FAERS | |
| 351 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 352 | Incorrect drug dosage form administered | FAERS: 2 | US FAERS | |
| 353 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 354 | Labile hypertension | FAERS: 2 | US FAERS | |
| 355 | Lack of spontaneous speech | FAERS: 2 | US FAERS | |
| 356 | Laryngitis | FAERS: 2 | US FAERS | |
| 357 | Malabsorption | FAERS: 2 | US FAERS | |
| 358 | Malnutrition | FAERS: 2 | US FAERS | |
| 359 | Mental Fatigue | FAERS: 2 | US FAERS | |
| 360 | Middle insomnia | FAERS: 2 | US FAERS | |
| 361 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 362 | Myoclonus | FAERS: 2 | US FAERS | |
| 363 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 364 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 365 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 366 | Oropharyngeal surgery | FAERS: 2 | US FAERS | |
| 367 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 368 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 369 | Peritonitis | FAERS: 2 | US FAERS | |
| 370 | Poisoning | FAERS: 2 | US FAERS | |
| 371 | Post procedural infection | FAERS: 2 | US FAERS | |
| 372 | Postural Orthostatic Tachycardia Syndrome | FAERS: 2 | US FAERS | |
| 373 | Product administration error | FAERS: 2 | US FAERS | |
| 374 | Product dispensing error | FAERS: 2 | US FAERS | |
| 375 | Psychogenic seizure | FAERS: 2 | US FAERS | |
| 376 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 377 | Pulmonary pain | FAERS: 2 | US FAERS | |
| 378 | Respiratory distress | FAERS: 2 | US FAERS | |
| 379 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 380 | Reversible cerebral vasoconstriction syndrome | FAERS: 2 | US FAERS | |
| 381 | Rosacea | FAERS: 2 | US FAERS | |
| 382 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 383 | Skin reaction | FAERS: 2 | US FAERS | |
| 384 | Sleep Talking | FAERS: 2 | US FAERS | |
| 385 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 386 | Sneezing | FAERS: 2 | US FAERS | |
| 387 | Temperature difference of extremities | FAERS: 2 | US FAERS | |
| 388 | Thought insertion | FAERS: 2 | US FAERS | |
| 389 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 390 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 391 | Urinary tract infection pseudomonal | FAERS: 2 | US FAERS | |
| 392 | Vascular stenosis | FAERS: 2 | US FAERS | |
| 393 | colonoscopy | FAERS: 2 | US FAERS | |
| 394 | furuncle | FAERS: 2 | US FAERS | |
| 395 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 396 | Abscess | FAERS: 1 | US FAERS | |
| 397 | Abulia | FAERS: 1 | US FAERS | |
| 398 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 399 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 400 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 401 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 402 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 403 | Ammonia increased | FAERS: 1 | US FAERS | |
| 404 | Anticoagulation drug level increased | FAERS: 1 | US FAERS | |
| 405 | Appendicitis | FAERS: 1 | US FAERS | |
| 406 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 407 | Ascites | FAERS: 1 | US FAERS | |
| 408 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 409 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 410 | Autonomic failure syndrome | FAERS: 1 | US FAERS | |
| 411 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 412 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 413 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 414 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 415 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 416 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 417 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 418 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 419 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 420 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 421 | Blood parathyroid hormone abnormal | FAERS: 1 | US FAERS | |
| 422 | Blood phosphorus abnormal | FAERS: 1 | US FAERS | |
| 423 | Blood pressure ambulatory decreased | FAERS: 1 | US FAERS | |
| 424 | Blood pressure ambulatory increased | FAERS: 1 | US FAERS | |
| 425 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 426 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 427 | Blood viscosity abnormal | FAERS: 1 | US FAERS | |
| 428 | Bradykinesia | FAERS: 1 | US FAERS | |
| 429 | Brain Abscess | FAERS: 1 | US FAERS | |
| 430 | Cachexia | FAERS: 1 | US FAERS | |
| 431 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 432 | Cell Death | FAERS: 1 | US FAERS | |
| 433 | Central venous catheter removal | FAERS: 1 | US FAERS | |
| 434 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 435 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 436 | Cervical myelopathy | FAERS: 1 | US FAERS | |
| 437 | Change in seizure presentation | FAERS: 1 | US FAERS | |
| 438 | Cholecystitis | FAERS: 1 | US FAERS | |
| 439 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 440 | Cluster Headache | FAERS: 1 | US FAERS | |
| 441 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 442 | Completed Suicide | FAERS: 1 | US FAERS | |
| 443 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 444 | Complication associated with device | FAERS: 1 | US FAERS | |
| 445 | Compression fracture | FAERS: 1 | US FAERS | |
| 446 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 447 | Cyst removal | FAERS: 1 | US FAERS | |
| 448 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 449 | Delusional perception | FAERS: 1 | US FAERS | |
| 450 | Device connection issue | FAERS: 1 | US FAERS | |
| 451 | Device malfunction | FAERS: 1 | US FAERS | |
| 452 | Device occlusion | FAERS: 1 | US FAERS | |
| 453 | Diet refusal | FAERS: 1 | US FAERS | |
| 454 | Diplegia | FAERS: 1 | US FAERS | |
| 455 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 456 | Diverticulitis | FAERS: 1 | US FAERS | |
| 457 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 458 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 459 | Drug dispensing issue | FAERS: 1 | US FAERS | |
| 460 | Drug effect variable | FAERS: 1 | US FAERS | |
| 461 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 462 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 463 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 464 | Dysphemia | FAERS: 1 | US FAERS | |
| 465 | Ear congestion | FAERS: 1 | US FAERS | |
| 466 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 467 | Electroconvulsive Therapy | FAERS: 1 | US FAERS | |
| 468 | Endometrial cancer stage III | FAERS: 1 | US FAERS | |
| 469 | Epididymitis | FAERS: 1 | US FAERS | |
| 470 | Escherichia infection | FAERS: 1 | US FAERS | |
| 471 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 472 | Euphoric mood | FAERS: 1 | US FAERS | |
| 473 | Excessive cerumen production | FAERS: 1 | US FAERS | |
| 474 | Extra dose administered | FAERS: 1 | US FAERS | |
| 475 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 476 | Eye Infection | FAERS: 1 | US FAERS | |
| 477 | Eye inflammation | FAERS: 1 | US FAERS | |
| 478 | Eye symptom | FAERS: 1 | US FAERS | |
| 479 | Eyelid pain | FAERS: 1 | US FAERS | |
| 480 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 481 | Facial Pain | FAERS: 1 | US FAERS | |
| 482 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 483 | Feeding tube user | FAERS: 1 | US FAERS | |
| 484 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 485 | Female sex hormone level abnormal | FAERS: 1 | US FAERS | |
| 486 | Food craving | FAERS: 1 | US FAERS | |
| 487 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 488 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 489 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 490 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 491 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 492 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 493 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 494 | Gastrostomy | FAERS: 1 | US FAERS | |
| 495 | Gaze palsy | FAERS: 1 | US FAERS | |
| 496 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 497 | General symptom | FAERS: 1 | US FAERS | |
| 498 | Glaucoma | FAERS: 1 | US FAERS | |
| 499 | Gout | FAERS: 1 | US FAERS | |
| 500 | Grief reaction | FAERS: 1 | US FAERS | |
| 501 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 502 | Hand-eye coordination impaired | FAERS: 1 | US FAERS | |
| 503 | Head and neck cancer stage IV | FAERS: 1 | US FAERS | |
| 504 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 505 | Hemiparesis | FAERS: 1 | US FAERS | |
| 506 | Hemiplegic migraine | FAERS: 1 | US FAERS | |
| 507 | Histoplasmosis | FAERS: 1 | US FAERS | |
| 508 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 509 | Hostility | FAERS: 1 | US FAERS | |
| 510 | Hunger | FAERS: 1 | US FAERS | |
| 511 | Hyperpituitarism | FAERS: 1 | US FAERS | |
| 512 | Hyperventilation | FAERS: 1 | US FAERS | |
| 513 | Hypobarism | FAERS: 1 | US FAERS | |
| 514 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 515 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 516 | Impaired self-care | FAERS: 1 | US FAERS | |
| 517 | Impaired work ability | FAERS: 1 | US FAERS | |
| 518 | Implant site pain | FAERS: 1 | US FAERS | |
| 519 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 520 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 521 | Inappropriate Prescribing | FAERS: 1 | US FAERS | |
| 522 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 523 | Incision site pain | FAERS: 1 | US FAERS | |
| 524 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 525 | Injection site pain | FAERS: 1 | US FAERS | |
| 526 | Insurance issue | FAERS: 1 | US FAERS | |
| 527 | Intermittent Explosive Disorder | FAERS: 1 | US FAERS | |
| 528 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 529 | Intestinal resection | FAERS: 1 | US FAERS | |
| 530 | Intracranial mass | FAERS: 1 | US FAERS | |
| 531 | Joint Instability | FAERS: 1 | US FAERS | |
| 532 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 533 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 534 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 535 | Lateral Medullary Syndrome | FAERS: 1 | US FAERS | |
| 536 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 537 | Light chain analysis increased | FAERS: 1 | US FAERS | |
| 538 | Lumbar radiculopathy | FAERS: 1 | US FAERS | |
| 539 | Lyme Disease | FAERS: 1 | US FAERS | |
| 540 | Lymph node palpable | FAERS: 1 | US FAERS | |
| 541 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 542 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 543 | Mastication disorder | FAERS: 1 | US FAERS | |
| 544 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 545 | Medical procedure | FAERS: 1 | US FAERS | |
| 546 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 547 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 548 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 549 | Monoplegia | FAERS: 1 | US FAERS | |
| 550 | Motion Sickness | FAERS: 1 | US FAERS | |
| 551 | Mouth swelling | FAERS: 1 | US FAERS | |
| 552 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 553 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 554 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 555 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 556 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 557 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 558 | Nerve injury | FAERS: 1 | US FAERS | |
| 559 | Nodule | FAERS: 1 | US FAERS | |
| 560 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 561 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 562 | Norepinephrine increased | FAERS: 1 | US FAERS | |
| 563 | Nystagmus | FAERS: 1 | US FAERS | |
| 564 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 565 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 566 | Ophthalmological examination abnormal | FAERS: 1 | US FAERS | |
| 567 | Oral administration complication | FAERS: 1 | US FAERS | |
| 568 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 569 | Oral pain | FAERS: 1 | US FAERS | |
| 570 | Orthodontic procedure | FAERS: 1 | US FAERS | |
| 571 | Orthostatic heart rate response increased | FAERS: 1 | US FAERS | |
| 572 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 573 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 574 | Pacemaker generated rhythm | FAERS: 1 | US FAERS | |
| 575 | Parkinsonian rest tremor | FAERS: 1 | US FAERS | |
| 576 | Patient restraint | FAERS: 1 | US FAERS | |
| 577 | Patient uncooperative | FAERS: 1 | US FAERS | |
| 578 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 579 | Pharyngitis | FAERS: 1 | US FAERS | |
| 580 | Phlebitis | FAERS: 1 | US FAERS | |
| 581 | Phonophobia | FAERS: 1 | US FAERS | |
| 582 | Physical product label issue | FAERS: 1 | US FAERS | |
| 583 | Piloerection | FAERS: 1 | US FAERS | |
| 584 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 585 | Pneumothorax | FAERS: 1 | US FAERS | |
| 586 | Polydipsia | FAERS: 1 | US FAERS | |
| 587 | Polyuria | FAERS: 1 | US FAERS | |
| 588 | Post lumbar puncture syndrome | FAERS: 1 | US FAERS | |
| 589 | Postoperative abscess | FAERS: 1 | US FAERS | |
| 590 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 591 | Posturing | FAERS: 1 | US FAERS | |
| 592 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 593 | Procedural complication | FAERS: 1 | US FAERS | |
| 594 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 595 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 596 | Product physical issue | FAERS: 1 | US FAERS | |
| 597 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 598 | Proteinuria | FAERS: 1 | US FAERS | |
| 599 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 600 | Pseudostroke | FAERS: 1 | US FAERS | |
| 601 | Psychiatric evaluation | FAERS: 1 | US FAERS | |
| 602 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 603 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 604 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 605 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 606 | Radicular pain | FAERS: 1 | US FAERS | |
| 607 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 608 | Regurgitation | FAERS: 1 | US FAERS | |
| 609 | Renal mass | FAERS: 1 | US FAERS | |
| 610 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 611 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 612 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 613 | Rhinitis | FAERS: 1 | US FAERS | |
| 614 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 615 | Salt craving | FAERS: 1 | US FAERS | |
| 616 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 617 | Sciatica | FAERS: 1 | US FAERS | |
| 618 | Screaming | FAERS: 1 | US FAERS | |
| 619 | Secretion discharge | FAERS: 1 | US FAERS | |
| 620 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 621 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 622 | Sinus operation | FAERS: 1 | US FAERS | |
| 623 | Skin Erosion | FAERS: 1 | US FAERS | |
| 624 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 625 | Skin discomfort | FAERS: 1 | US FAERS | |
| 626 | Skin laceration | FAERS: 1 | US FAERS | |
| 627 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 628 | Spinal column injury | FAERS: 1 | US FAERS | |
| 629 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 630 | Stress at work | FAERS: 1 | US FAERS | |
| 631 | Stridor | FAERS: 1 | US FAERS | |
| 632 | Stubbornness | FAERS: 1 | US FAERS | |
| 633 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 634 | Sudden death | FAERS: 1 | US FAERS | |
| 635 | Suicide attempt | FAERS: 1 | US FAERS | |
| 636 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 637 | Tetany | FAERS: 1 | US FAERS | |
| 638 | Therapeutic reaction time decreased | FAERS: 1 | US FAERS | |
| 639 | Therapy change | FAERS: 1 | US FAERS | |
| 640 | Thoracic outlet surgery | FAERS: 1 | US FAERS | |
| 641 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 642 | Toe operation | FAERS: 1 | US FAERS | |
| 643 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 644 | Tooth Loss | FAERS: 1 | US FAERS | |
| 645 | Toothache | FAERS: 1 | US FAERS | |
| 646 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 647 | Transcription medication error | FAERS: 1 | US FAERS | |
| 648 | Transferrin abnormal | FAERS: 1 | US FAERS | |
| 649 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 650 | Troponin increased | FAERS: 1 | US FAERS | |
| 651 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 652 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 653 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 654 | Urine output increased | FAERS: 1 | US FAERS | |
| 655 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 656 | Venous valve ruptured | FAERS: 1 | US FAERS | |
| 657 | Viral test positive | FAERS: 1 | US FAERS | |
| 658 | Visceral congestion | FAERS: 1 | US FAERS | |
| 659 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 660 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 661 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 662 | Vulvovaginitis | FAERS: 1 | US FAERS | |
| 663 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 664 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 665 | jaundice | FAERS: 1 | US FAERS | |
| 666 | treatment failure | FAERS: 1 | US FAERS | |
| 667 | Catalepsy | 8216760 | CTD | |
| 668 | Diarrhea | 986992 | CTD | |
| 669 | Fever | 9198091 | CTD | |
| 670 | Gait Disorders, Neurologic | 2511378 | CTD | |
| 671 | Hyperpyrexia | SIDER | ||
| 672 | Hypotension, Orthostatic | 2511378 3133573 11145175 | CTD | |
| 673 | Lacrimal Apparatus Diseases | 986992 | CTD | |
| 674 | Seizures | 8224101 | CTD | |
| 675 | Shock | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.