entecavir
(QDGZDCVAUDNJFG-FXQIFTODSA-N)
Structure
- SMILES
- OC[C@@H]1[C@@H](O)C[C@@H](C1=C)n1cnc2c1nc(N)[nH]c2=O
- Type(s)
- Approved; Investigational
- ATC code(s)
- J05AF10
- Molecular Formula:
- C12H15N5O3
- Molecular Weight:
- 277.279
- Log P:
- -0.2466
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 130.05
- CAS Number(s):
- 142217-69-4; 209216-23-9; 1333204-94-6
Synonym(s)
1.
entecavir
2.
Baraclude
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pregnancy | FAERS: 127 | US FAERS | |
| 2 | Hepatitis B | FAERS: 91 |
10418752
12121928 15328117 15388423 16152756 16230074 16448446 17133475 17178796 17573951 17854030 18380715 18816503 18940786 19758269 | CTD SIDER US FAERS |
| 3 | Maternal exposure during pregnancy | FAERS: 87 | US FAERS | |
| 4 | Drug dose omission | FAERS: 70 | US FAERS | |
| 5 | Fatigue | FAERS: 66 | 19457141 | CTD SIDER US FAERS |
| 6 | Drug resistance | FAERS: 62 | US FAERS | |
| 7 | Alanine Aminotransferase Increased | FAERS: 61 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Drug ineffective | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Adverse event | FAERS: 55 | US FAERS | |
| 10 | Headache | FAERS: 52 | 19457141 | CTD SIDER US FAERS |
| 11 | Malaise | FAERS: 51 | US FAERS | |
| 12 | Exposure via body fluid | FAERS: 41 | US FAERS | |
| 13 | Blood creatine phosphokinase increased | FAERS: 40 | US FAERS | |
| 14 | Dizziness | FAERS: 39 | SIDER US FAERS | |
| 15 | Viral load increased | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Myalgia | FAERS: 35 | US FAERS | |
| 17 | Exposure via father | FAERS: 34 | US FAERS | |
| 18 | Blood HIV RNA decreased | FAERS: 32 | US FAERS | |
| 19 | Nausea | FAERS: 31 | SIDER US FAERS | |
| 20 | Asthenia | FAERS: 29 | SIDER US FAERS | |
| 21 | Sepsis | FAERS: 29 | US FAERS | |
| 22 | Hepatitis B DNA increased | FAERS: 27 | US FAERS | |
| 23 | Pruritus | FAERS: 27 | US FAERS | |
| 24 | Arthralgia | FAERS: 24 | US FAERS | |
| 25 | Abdominal Pain | FAERS: 23 | SIDER US FAERS | |
| 26 | Alopecia | FAERS: 23 | SIDER US FAERS | |
| 27 | Myocardial Infarction | FAERS: 23 | US FAERS | |
| 28 | Pneumonia | FAERS: 23 | US FAERS | |
| 29 | Hepatic Encephalopathy | FAERS: 22 | SIDER US FAERS | |
| 30 | Vomiting | FAERS: 22 | SIDER US FAERS | |
| 31 | jaundice | FAERS: 22 | US FAERS | |
| 32 | Ascites | FAERS: 21 | SIDER US FAERS | |
| 33 | Transaminases increased | FAERS: 20 | SIDER US FAERS | |
| 34 | Thrombocytopenia | FAERS: 18 | US FAERS | |
| 35 | Pancreatitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Weight decreased | FAERS: 17 | US FAERS | |
| 37 | Aspartate Aminotransferase Increased | FAERS: 16 | US FAERS | |
| 38 | Drug exposure during pregnancy | FAERS: 16 | US FAERS | |
| 39 | Memory impairment | FAERS: 15 | US FAERS | |
| 40 | Diabetes Mellitus | FAERS: 14 | US FAERS | |
| 41 | Ileus | FAERS: 14 | US FAERS | |
| 42 | Pain | FAERS: 14 | US FAERS | |
| 43 | Splenomegaly | FAERS: 14 | US FAERS | |
| 44 | Abdominal discomfort | FAERS: 13 | US FAERS | |
| 45 | Blood creatinine increased | FAERS: 13 | SIDER US FAERS | |
| 46 | Cerebrovascular accident | FAERS: 13 | US FAERS | |
| 47 | Product use in unapproved indication | FAERS: 13 | US FAERS | |
| 48 | Infection | FAERS: 12 | SIDER US FAERS | |
| 49 | White blood cell count decreased | FAERS: 12 | US FAERS | |
| 50 | Wrong technique in product usage process | FAERS: 12 | US FAERS | |
| 51 | Back Pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Diplopia | FAERS: 11 | US FAERS | |
| 53 | Urticaria | FAERS: 11 | US FAERS | |
| 54 | Virologic failure | FAERS: 11 | US FAERS | |
| 55 | Drug Tolerance | FAERS: 10 | US FAERS | |
| 56 | General physical health deterioration | FAERS: 10 | US FAERS | |
| 57 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 58 | Leukopenia | FAERS: 10 | SIDER US FAERS | |
| 59 | Lipase increased | FAERS: 10 | US FAERS | |
| 60 | Live Birth | FAERS: 10 | US FAERS | |
| 61 | Myopathy | FAERS: 10 | US FAERS | |
| 62 | Pancytopenia | FAERS: 10 | US FAERS | |
| 63 | Product substitution issue | FAERS: 10 | US FAERS | |
| 64 | Retinal toxicity | FAERS: 10 | US FAERS | |
| 65 | Somnolence | FAERS: 10 | SIDER US FAERS | |
| 66 | Suspected counterfeit product | FAERS: 10 | US FAERS | |
| 67 | Tremor | FAERS: 10 | US FAERS | |
| 68 | Wrong technique in drug usage process | FAERS: 10 | US FAERS | |
| 69 | Deafness | FAERS: 9 | US FAERS | |
| 70 | Dementia | FAERS: 9 | US FAERS | |
| 71 | Hepatomegaly | FAERS: 9 | SIDER US FAERS | |
| 72 | Lymphoma | FAERS: 9 | US FAERS | |
| 73 | No adverse event | FAERS: 9 | US FAERS | |
| 74 | Pregnancy on contraceptive | FAERS: 9 | US FAERS | |
| 75 | Accidental overdose | FAERS: 8 | US FAERS | |
| 76 | Chest Pain | FAERS: 8 | US FAERS | |
| 77 | Chest discomfort | FAERS: 8 | US FAERS | |
| 78 | Chills | FAERS: 8 | US FAERS | |
| 79 | Chromaturia | FAERS: 8 | US FAERS | |
| 80 | Epilepsy | FAERS: 8 | US FAERS | |
| 81 | Gestational Diabetes | FAERS: 8 | US FAERS | |
| 82 | Incorrect product storage | FAERS: 8 | US FAERS | |
| 83 | Neutropenia | FAERS: 8 | SIDER US FAERS | |
| 84 | Overdose | FAERS: 8 | US FAERS | |
| 85 | Palpitations | FAERS: 8 | US FAERS | |
| 86 | Product use issue | FAERS: 8 | US FAERS | |
| 87 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 88 | Rhabdomyolysis | FAERS: 8 | US FAERS | |
| 89 | Urinary tract infection | FAERS: 8 | US FAERS | |
| 90 | Viral mutation identified | FAERS: 8 | US FAERS | |
| 91 | Acute kidney injury | FAERS: 7 | US FAERS | |
| 92 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 93 | Blood glucose increased | FAERS: 7 | US FAERS | |
| 94 | Constipation | FAERS: 7 | US FAERS | |
| 95 | Ectopic Pregnancy | FAERS: 7 | US FAERS | |
| 96 | Fracture | FAERS: 7 | US FAERS | |
| 97 | Hepatitis | FAERS: 7 | SIDER US FAERS | |
| 98 | Influenza | FAERS: 7 | US FAERS | |
| 99 | Product storage error | FAERS: 7 | US FAERS | |
| 100 | Acidosis | FAERS: 6 | US FAERS | |
| 101 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 102 | Atrioventricular Septal Defect | FAERS: 6 | US FAERS | |
| 103 | Bradycardia | FAERS: 6 | US FAERS | |
| 104 | Dry skin | FAERS: 6 | US FAERS | |
| 105 | Dyspepsia | FAERS: 6 | SIDER US FAERS | |
| 106 | Erectile dysfunction | FAERS: 6 | US FAERS | |
| 107 | Listeria encephalitis | FAERS: 6 | US FAERS | |
| 108 | Proteinuria | FAERS: 6 | US FAERS | |
| 109 | Blood amylase increased | FAERS: 5 | US FAERS | |
| 110 | Blood lactate dehydrogenase increased | FAERS: 5 | US FAERS | |
| 111 | Blood phosphorus decreased | FAERS: 5 | US FAERS | |
| 112 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 113 | Feeling Cold | FAERS: 5 | US FAERS | |
| 114 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 115 | Fixed eruption | FAERS: 5 | US FAERS | |
| 116 | Flatulence | FAERS: 5 | US FAERS | |
| 117 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 118 | Hypotension | FAERS: 5 | US FAERS | |
| 119 | Medication Error | FAERS: 5 | US FAERS | |
| 120 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 121 | Ocular icterus | FAERS: 5 | US FAERS | |
| 122 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 123 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 124 | Syncope | FAERS: 5 | US FAERS | |
| 125 | Tachycardia | FAERS: 5 | US FAERS | |
| 126 | Vertigo | FAERS: 5 | US FAERS | |
| 127 | cancer surgery | FAERS: 5 | US FAERS | |
| 128 | Anxiety | FAERS: 4 | US FAERS | |
| 129 | Blood alkaline phosphatase increased | FAERS: 4 | US FAERS | |
| 130 | Cardiac perforation | FAERS: 4 | US FAERS | |
| 131 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 132 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 133 | Cholestasis | FAERS: 4 | US FAERS | |
| 134 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 135 | Disease Progression | FAERS: 4 | US FAERS | |
| 136 | Drug administration error | FAERS: 4 | US FAERS | |
| 137 | Hepatic cancer metastatic | FAERS: 4 | US FAERS | |
| 138 | Maternal exposure before pregnancy | FAERS: 4 | US FAERS | |
| 139 | Mental impairment | FAERS: 4 | US FAERS | |
| 140 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 141 | Nephrotic Syndrome | FAERS: 4 | US FAERS | |
| 142 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 143 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 144 | Pathogen resistance | FAERS: 4 | US FAERS | |
| 145 | Petechiae | FAERS: 4 | US FAERS | |
| 146 | Portal Vein Thrombosis | FAERS: 4 | US FAERS | |
| 147 | Product quality issue | FAERS: 4 | US FAERS | |
| 148 | Renal Cell Carcinoma | FAERS: 4 | US FAERS | |
| 149 | Rubella in pregnancy | FAERS: 4 | US FAERS | |
| 150 | Septic Shock | FAERS: 4 | US FAERS | |
| 151 | Stress | FAERS: 4 | US FAERS | |
| 152 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 153 | Toxoplasma serology positive | FAERS: 4 | US FAERS | |
| 154 | Transmission of drug via semen | FAERS: 4 | US FAERS | |
| 155 | Visual Impairment | FAERS: 4 | US FAERS | |
| 156 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 157 | Ammonia increased | FAERS: 3 | US FAERS | |
| 158 | Amnesia | FAERS: 3 | US FAERS | |
| 159 | Anencephaly | FAERS: 3 | US FAERS | |
| 160 | Aneurysm | FAERS: 3 | US FAERS | |
| 161 | Arthritis | FAERS: 3 | US FAERS | |
| 162 | Asthma | FAERS: 3 | US FAERS | |
| 163 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 164 | Carcinoembryonic antigen increased | FAERS: 3 | US FAERS | |
| 165 | Cardiac Hypertrophy | FAERS: 3 | US FAERS | |
| 166 | Colitis | FAERS: 3 | US FAERS | |
| 167 | Cytolytic hepatitis | FAERS: 3 | US FAERS | |
| 168 | Dehydration | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 170 | Eczema | FAERS: 3 | US FAERS | |
| 171 | Endocarditis | FAERS: 3 | US FAERS | |
| 172 | Epistaxis | FAERS: 3 | US FAERS | |
| 173 | Erythema | FAERS: 3 | US FAERS | |
| 174 | Flushing | FAERS: 3 | US FAERS | |
| 175 | Gastrectomy | FAERS: 3 | US FAERS | |
| 176 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 177 | Hepatitis C RNA increased | FAERS: 3 | US FAERS | |
| 178 | Hepatitis C | FAERS: 3 | US FAERS | |
| 179 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 180 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 181 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 182 | Infertility | FAERS: 3 | US FAERS | |
| 183 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 184 | Lethargy | FAERS: 3 | US FAERS | |
| 185 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 186 | Malignant neoplasm progression | FAERS: 3 | US FAERS | |
| 187 | Mental status changes | FAERS: 3 | US FAERS | |
| 188 | Monoplegia | FAERS: 3 | US FAERS | |
| 189 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 190 | Myocarditis | FAERS: 3 | US FAERS | |
| 191 | Myositis | FAERS: 3 | US FAERS | |
| 192 | Neck Pain | FAERS: 3 | US FAERS | |
| 193 | Obesity | FAERS: 3 | US FAERS | |
| 194 | Platelet Transfusion | FAERS: 3 | US FAERS | |
| 195 | Retinopathy of Prematurity | FAERS: 3 | US FAERS | |
| 196 | Seroconversion test negative | FAERS: 3 | US FAERS | |
| 197 | Stomatitis | FAERS: 3 | US FAERS | |
| 198 | Vasculitis | FAERS: 3 | US FAERS | |
| 199 | Abasia | FAERS: 2 | US FAERS | |
| 200 | Accessory spleen | FAERS: 2 | US FAERS | |
| 201 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 202 | Alanine aminotransferase decreased | FAERS: 2 | US FAERS | |
| 203 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 204 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 205 | Anger | FAERS: 2 | US FAERS | |
| 206 | Anorexia | FAERS: 2 | US FAERS | |
| 207 | Arthropathy | FAERS: 2 | US FAERS | |
| 208 | Aspergillosis | FAERS: 2 | US FAERS | |
| 209 | Ataxia | FAERS: 2 | US FAERS | |
| 210 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 211 | Blindness | FAERS: 2 | US FAERS | |
| 212 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 213 | Bronchitis | FAERS: 2 | US FAERS | |
| 214 | Burning sensation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 216 | Cellulitis | FAERS: 2 | US FAERS | |
| 217 | Chronic gastritis | FAERS: 2 | US FAERS | |
| 218 | Cluster Headache | FAERS: 2 | US FAERS | |
| 219 | Completed Suicide | FAERS: 2 | US FAERS | |
| 220 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 221 | Creatinine renal clearance increased | FAERS: 2 | US FAERS | |
| 222 | Cytopenia | FAERS: 2 | US FAERS | |
| 223 | Depressed mood | FAERS: 2 | US FAERS | |
| 224 | Device loosening | FAERS: 2 | US FAERS | |
| 225 | Device material issue | FAERS: 2 | US FAERS | |
| 226 | Device related infection | FAERS: 2 | US FAERS | |
| 227 | Disability | FAERS: 2 | US FAERS | |
| 228 | Disorientation | FAERS: 2 | US FAERS | |
| 229 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 230 | Drug screen positive | FAERS: 2 | US FAERS | |
| 231 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 232 | Dysgraphia | FAERS: 2 | US FAERS | |
| 233 | Emotional distress | FAERS: 2 | US FAERS | |
| 234 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 235 | Flank Pain | FAERS: 2 | US FAERS | |
| 236 | Gastric Lavage | FAERS: 2 | US FAERS | |
| 237 | Gastric pH decreased | FAERS: 2 | US FAERS | |
| 238 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 239 | Hepatectomy | FAERS: 2 | US FAERS | |
| 240 | Hepatitis B DNA assay positive | FAERS: 2 | US FAERS | |
| 241 | Hepatitis B antigen positive | FAERS: 2 | US FAERS | |
| 242 | Hepatitis B e antigen positive | FAERS: 2 | SIDER US FAERS | |
| 243 | High frequency ablation | FAERS: 2 | US FAERS | |
| 244 | Hospice Care | FAERS: 2 | US FAERS | |
| 245 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 246 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 247 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 248 | Joint swelling | FAERS: 2 | US FAERS | |
| 249 | Limb injury | FAERS: 2 | US FAERS | |
| 250 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 251 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 252 | Malabsorption | FAERS: 2 | US FAERS | |
| 253 | Meconium peritonitis | FAERS: 2 | US FAERS | |
| 254 | Multiple Myeloma | FAERS: 2 | US FAERS | |
| 255 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 256 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 257 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 258 | Placental Insufficiency | FAERS: 2 | US FAERS | |
| 259 | Pneumonitis | FAERS: 2 | US FAERS | |
| 260 | Premature Menopause | FAERS: 2 | US FAERS | |
| 261 | Presyncope | FAERS: 2 | US FAERS | |
| 262 | Product dose omission | FAERS: 2 | US FAERS | |
| 263 | Pseudocyst | FAERS: 2 | US FAERS | |
| 264 | Psoriasis | FAERS: 2 | US FAERS | |
| 265 | Renal cyst | FAERS: 2 | US FAERS | |
| 266 | Renal tubular disorder | FAERS: 2 | US FAERS | |
| 267 | Retinal depigmentation | FAERS: 2 | US FAERS | |
| 268 | Rheumatic disorder | FAERS: 2 | US FAERS | |
| 269 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 270 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 271 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 272 | Spermatozoa progressive motility abnormal | FAERS: 2 | US FAERS | |
| 273 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 274 | Stupor | FAERS: 2 | US FAERS | |
| 275 | Suicide attempt | FAERS: 2 | US FAERS | |
| 276 | Swelling | FAERS: 2 | US FAERS | |
| 277 | Thirst | FAERS: 2 | US FAERS | |
| 278 | Tinnitus | FAERS: 2 | US FAERS | |
| 279 | Toothache | FAERS: 2 | US FAERS | |
| 280 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 281 | Transplant | FAERS: 2 | US FAERS | |
| 282 | Transplantation complication | FAERS: 2 | US FAERS | |
| 283 | Troponin increased | FAERS: 2 | US FAERS | |
| 284 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 285 | Viral test negative | FAERS: 2 | US FAERS | |
| 286 | muscle injury | FAERS: 2 | US FAERS | |
| 287 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 288 | treatment failure | FAERS: 2 | US FAERS | |
| 289 | Acanthosis | FAERS: 1 | US FAERS | |
| 290 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 291 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 292 | Acne | FAERS: 1 | US FAERS | |
| 293 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 294 | Acute hepatitis C | FAERS: 1 | US FAERS | |
| 295 | Agitation | FAERS: 1 | US FAERS | |
| 296 | Albuminuria | FAERS: 1 | US FAERS | |
| 297 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 298 | Amylase increased | FAERS: 1 | US FAERS | |
| 299 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 300 | Anti-GAD antibody positive | FAERS: 1 | US FAERS | |
| 301 | Antibody test positive | FAERS: 1 | US FAERS | |
| 302 | Aortitis | FAERS: 1 | US FAERS | |
| 303 | Aphasia | FAERS: 1 | US FAERS | |
| 304 | Auricular swelling | FAERS: 1 | US FAERS | |
| 305 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 306 | Back disorder | FAERS: 1 | US FAERS | |
| 307 | Bedridden | FAERS: 1 | US FAERS | |
| 308 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 309 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 310 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 311 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 312 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 313 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 314 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 315 | Blood iron increased | FAERS: 1 | US FAERS | |
| 316 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 317 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 318 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 319 | Bone density decreased | FAERS: 1 | US FAERS | |
| 320 | Breast tenderness | FAERS: 1 | US FAERS | |
| 321 | Cachexia | FAERS: 1 | US FAERS | |
| 322 | Cardiomyopathy acute | FAERS: 1 | US FAERS | |
| 323 | Cataract | FAERS: 1 | US FAERS | |
| 324 | Catheter placement | FAERS: 1 | US FAERS | |
| 325 | Cell Death | FAERS: 1 | US FAERS | |
| 326 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 327 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 328 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 329 | Cheilitis | FAERS: 1 | US FAERS | |
| 330 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 331 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 332 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 333 | Compression fracture | FAERS: 1 | US FAERS | |
| 334 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 335 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 336 | Cystitis | FAERS: 1 | US FAERS | |
| 337 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 338 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 339 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 340 | Delirium | FAERS: 1 | US FAERS | |
| 341 | Device occlusion | FAERS: 1 | US FAERS | |
| 342 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 343 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 344 | Disease complication | FAERS: 1 | US FAERS | |
| 345 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 346 | Drug Dependence | FAERS: 1 | US FAERS | |
| 347 | Drug abuse | FAERS: 1 | US FAERS | |
| 348 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 349 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 350 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 351 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 352 | Dysgeusia | FAERS: 1 | US FAERS | |
| 353 | Dysphonia | FAERS: 1 | US FAERS | |
| 354 | Dysuria | FAERS: 1 | US FAERS | |
| 355 | Economic problem | FAERS: 1 | US FAERS | |
| 356 | Electrocardiogram T wave amplitude increased | FAERS: 1 | US FAERS | |
| 357 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 358 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 359 | Extra dose administered | FAERS: 1 | US FAERS | |
| 360 | Facial paralysis | FAERS: 1 | US FAERS | |
| 361 | Feeling jittery | FAERS: 1 | US FAERS | |
| 362 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 363 | Gangrene | FAERS: 1 | US FAERS | |
| 364 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 365 | Gastritis | FAERS: 1 | US FAERS | |
| 366 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 367 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 368 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 369 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 370 | Gastrostomy | FAERS: 1 | US FAERS | |
| 371 | Gene Mutation | FAERS: 1 | US FAERS | |
| 372 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 373 | Glycosuria | FAERS: 1 | SIDER US FAERS | |
| 374 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 375 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 376 | HBV DNA increased | FAERS: 1 | US FAERS | |
| 377 | Head discomfort | FAERS: 1 | US FAERS | |
| 378 | Head titubation | FAERS: 1 | US FAERS | |
| 379 | Heat Stroke | FAERS: 1 | US FAERS | |
| 380 | Hepatitis B Virus | FAERS: 1 | US FAERS | |
| 381 | Hepatitis B antibody abnormal | FAERS: 1 | US FAERS | |
| 382 | Hepatitis B surface antigen positive | FAERS: 1 | US FAERS | |
| 383 | Hepatorenal Syndrome | FAERS: 1 | SIDER US FAERS | |
| 384 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 385 | Hernia | FAERS: 1 | US FAERS | |
| 386 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 387 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 388 | Hysterectomy | FAERS: 1 | US FAERS | |
| 389 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 390 | Incontinence | FAERS: 1 | US FAERS | |
| 391 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 392 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 393 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 394 | Intestinal resection | FAERS: 1 | US FAERS | |
| 395 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 396 | Laparotomy | FAERS: 1 | US FAERS | |
| 397 | Leukocytosis | FAERS: 1 | US FAERS | |
| 398 | Leukoplakia | FAERS: 1 | US FAERS | |
| 399 | Limy bile syndrome | FAERS: 1 | US FAERS | |
| 400 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 401 | Lip swelling | FAERS: 1 | US FAERS | |
| 402 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 403 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 404 | Macular degeneration | FAERS: 1 | US FAERS | |
| 405 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 406 | Malocclusion | FAERS: 1 | US FAERS | |
| 407 | Mastectomy | FAERS: 1 | US FAERS | |
| 408 | Meniscus injury | FAERS: 1 | US FAERS | |
| 409 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 410 | Middle insomnia | FAERS: 1 | US FAERS | |
| 411 | Model for end stage liver disease score abnormal | FAERS: 1 | US FAERS | |
| 412 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 413 | Monocytosis | FAERS: 1 | US FAERS | |
| 414 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 415 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 416 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 417 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 418 | Nephrectomy | FAERS: 1 | US FAERS | |
| 419 | Nephritic syndrome | FAERS: 1 | US FAERS | |
| 420 | Nerve injury | FAERS: 1 | US FAERS | |
| 421 | Neuropathy | FAERS: 1 | US FAERS | |
| 422 | Night sweats | FAERS: 1 | US FAERS | |
| 423 | Nipple pain | FAERS: 1 | US FAERS | |
| 424 | Nodule | FAERS: 1 | US FAERS | |
| 425 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 426 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 427 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 428 | Osteoporosis | FAERS: 1 | US FAERS | |
| 429 | Ovarian adenoma | FAERS: 1 | US FAERS | |
| 430 | Palmar erythema | FAERS: 1 | US FAERS | |
| 431 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 432 | Papillophlebitis | FAERS: 1 | US FAERS | |
| 433 | Paraparesis | FAERS: 1 | US FAERS | |
| 434 | Paternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 435 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 436 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 437 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 438 | Photophobia | FAERS: 1 | US FAERS | |
| 439 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 440 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 441 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 442 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 443 | Poisoning | FAERS: 1 | US FAERS | |
| 444 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 445 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 446 | Portal hypertensive gastropathy | FAERS: 1 | US FAERS | |
| 447 | Portal shunt procedure | FAERS: 1 | US FAERS | |
| 448 | Post procedural complication | FAERS: 1 | US FAERS | |
| 449 | Pregnancy on oral contraceptive | FAERS: 1 | US FAERS | |
| 450 | Prerenal failure | FAERS: 1 | US FAERS | |
| 451 | Procedural complication | FAERS: 1 | US FAERS | |
| 452 | Product counterfeit | FAERS: 1 | US FAERS | |
| 453 | Product distribution issue | FAERS: 1 | US FAERS | |
| 454 | Product substitution | FAERS: 1 | US FAERS | |
| 455 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 456 | Protein urine present | FAERS: 1 | US FAERS | |
| 457 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 458 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 459 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 460 | Purpura | FAERS: 1 | US FAERS | |
| 461 | Purulent discharge | FAERS: 1 | US FAERS | |
| 462 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 463 | Radioembolisation | FAERS: 1 | US FAERS | |
| 464 | Renal Replacement Therapy | FAERS: 1 | US FAERS | |
| 465 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 466 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 467 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 468 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 469 | Salivary gland adenoma | FAERS: 1 | US FAERS | |
| 470 | Salpingectomy | FAERS: 1 | US FAERS | |
| 471 | Seroconversion test positive | FAERS: 1 | US FAERS | |
| 472 | Serum Sickness | FAERS: 1 | US FAERS | |
| 473 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 474 | Shock | FAERS: 1 | US FAERS | |
| 475 | Sinusitis | FAERS: 1 | US FAERS | |
| 476 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 477 | Skin lesion | FAERS: 1 | US FAERS | |
| 478 | Skin nodule | FAERS: 1 | US FAERS | |
| 479 | Skin reaction | FAERS: 1 | US FAERS | |
| 480 | Sluggishness | FAERS: 1 | US FAERS | |
| 481 | Spinal column injury | FAERS: 1 | US FAERS | |
| 482 | Splenectomy | FAERS: 1 | US FAERS | |
| 483 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 484 | Stillbirth | FAERS: 1 | US FAERS | |
| 485 | Subretinal fibrosis | FAERS: 1 | US FAERS | |
| 486 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 487 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 488 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 489 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 490 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 491 | Thermal burn | FAERS: 1 | US FAERS | |
| 492 | Throat cancer | FAERS: 1 | US FAERS | |
| 493 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 494 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 495 | Ulcer | FAERS: 1 | US FAERS | |
| 496 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 497 | Urinary Retention | FAERS: 1 | US FAERS | |
| 498 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 499 | Viral load decreased | FAERS: 1 | US FAERS | |
| 500 | Visual disturbance | FAERS: 1 | US FAERS | |
| 501 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 502 | Anaphylactoid Reaction | SIDER | ||
| 503 | Blood and lymphatic system disorders | SIDER | ||
| 504 | Chemical and Drug Induced Liver Injury | 19620818 | CTD | |
| 505 | Discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 506 | Gastrointestinal Pain | SIDER | ||
| 507 | Hepatitis B, Chronic |
12454840
16762627 17244451 17653304 17917412 18537189 18554238 19070393 19226381 19457141 19669332 19704174 20305760 20659226 21186528 | CTD | |
| 508 | Lactose Intolerance | SIDER | ||
| 509 | Liver Failure, Acute | 21186528 | CTD | |
| 510 | Malnutrition | SIDER | ||
| 511 | Product taste abnormal | SIDER | ||
| 512 | Semen viscosity increased | Canada Vigilance: 1 | Canada Vigilance | |
| 513 | pH urine decreased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.