Losartan
(OXCMYAYHXIHQOA-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCc1nc(c(n1Cc1ccc(cc1)c1ccccc1c1[n-]nnn1)CO)Cl.[K+]
- Molecular Formula:
- C22H22ClKN6O
- Molecular Weight:
- 461.001
- Log P:
- 3.8959
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 89.61
- CAS Number(s):
- 11096-26-7; 124750-99-8
Synonym(s)
1.
Losartan
2.
2-Butyl-4-chloro-1-((2'-(1H-etrazol-5-yl) (1,1'-biphenyl)-4-yl)methyl)-1H-imidazole-5-methanol
3.
Cozaar
4.
DuP-753
5.
Losartan Monopotassium Salt
6.
Losartan Potassium
7.
MK-954
8.
MK954
9.
DuP 753
10.
DuP753
11.
MK 954
12.
Monopotassium Salt, Losartan
13.
Potassium, Losartan
14.
Salt, Losartan Monopotassium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 233 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 163 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Headache | FAERS: 101 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Product substitution issue | FAERS: 99 | US FAERS | |
| 5 | Adverse event | FAERS: 69 | US FAERS | |
| 6 | Nausea | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Fatigue | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Angioedema | FAERS: 56 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 9 | Hypotension | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Malaise | FAERS: 47 | US FAERS | |
| 11 | Chest Pain | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Feeling abnormal | FAERS: 42 | US FAERS | |
| 13 | Palpitations | FAERS: 39 | US FAERS | |
| 14 | Pruritus | FAERS: 38 | US FAERS | |
| 15 | Pneumonia | FAERS: 37 | US FAERS | |
| 16 | Hypersensitivity | FAERS: 35 | US FAERS | |
| 17 | Myalgia | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Product quality issue | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Urticaria | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Asthenia | FAERS: 31 | US FAERS | |
| 21 | Pain | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Cerebrovascular accident | FAERS: 30 | US FAERS | |
| 23 | Myocardial Infarction | FAERS: 30 | US FAERS | |
| 24 | Hypertensive crisis | FAERS: 29 | US FAERS | |
| 25 | Back Pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Blood pressure inadequately controlled | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Drug exposure during pregnancy | FAERS: 27 | US FAERS | |
| 28 | Vomiting | FAERS: 27 | US FAERS | |
| 29 | Abdominal discomfort | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Anxiety | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Lip swelling | FAERS: 24 | US FAERS | |
| 32 | Arthralgia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Weight decreased | FAERS: 21 | US FAERS | |
| 34 | Alopecia | FAERS: 20 | US FAERS | |
| 35 | Cardiac Arrest | FAERS: 20 | US FAERS | |
| 36 | Diabetes Mellitus | FAERS: 20 | US FAERS | |
| 37 | Oligohydramnios | FAERS: 20 | US FAERS | |
| 38 | Abdominal Pain | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Syncope | FAERS: 19 | US FAERS | |
| 40 | Drug dose omission | FAERS: 18 | US FAERS | |
| 41 | Dyspepsia | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | No adverse event | FAERS: 18 | US FAERS | |
| 43 | Tremor | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Lethargy | FAERS: 17 | US FAERS | |
| 45 | Recalled product administered | FAERS: 17 | US FAERS | |
| 46 | Wrong technique in drug usage process | FAERS: 17 | US FAERS | |
| 47 | Chest discomfort | FAERS: 16 | US FAERS | |
| 48 | Swelling | FAERS: 16 | US FAERS | |
| 49 | Vertigo | FAERS: 16 | US FAERS | |
| 50 | Visual Impairment | FAERS: 16 | US FAERS | |
| 51 | Blood potassium increased | FAERS: 15 | US FAERS | |
| 52 | Blood pressure fluctuation | FAERS: 15 | US FAERS | |
| 53 | Dysphonia | FAERS: 15 | US FAERS | |
| 54 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 55 | Joint swelling | FAERS: 14 | US FAERS | |
| 56 | Respiratory Failure | FAERS: 14 | US FAERS | |
| 57 | Rhabdomyolysis | FAERS: 13 | US FAERS | |
| 58 | Atrial Fibrillation | FAERS: 12 | US FAERS | |
| 59 | Blood creatinine increased | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Burning sensation | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Discomfort | FAERS: 11 | US FAERS | |
| 62 | Dehydration | FAERS: 10 | US FAERS | |
| 63 | Overdose | FAERS: 10 | US FAERS | |
| 64 | Pancreatitis | FAERS: 10 | US FAERS | |
| 65 | Peripheral swelling | FAERS: 10 | US FAERS | |
| 66 | Somnolence | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 67 | Tachycardia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Dysgeusia | FAERS: 9 | US FAERS | |
| 69 | Gastritis | FAERS: 9 | US FAERS | |
| 70 | Incorrect dose administered | FAERS: 9 | US FAERS | |
| 71 | Musculoskeletal stiffness | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 73 | Throat irritation | FAERS: 9 | US FAERS | |
| 74 | Tinnitus | FAERS: 9 | US FAERS | |
| 75 | Aspartate Aminotransferase Increased | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Blood glucose abnormal | FAERS: 8 | US FAERS | |
| 77 | Constipation | FAERS: 8 | US FAERS | |
| 78 | Disorientation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Epistaxis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 81 | Medication Error | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Musculoskeletal Pain | FAERS: 8 | US FAERS | |
| 83 | Pancytopenia | FAERS: 8 | US FAERS | |
| 84 | Renal pain | FAERS: 8 | US FAERS | |
| 85 | Abasia | FAERS: 7 | US FAERS | |
| 86 | Cholelithiasis | FAERS: 7 | US FAERS | |
| 87 | Drug administration error | FAERS: 7 | US FAERS | |
| 88 | Dysuria | FAERS: 7 | US FAERS | |
| 89 | Erythema | FAERS: 7 | US FAERS | |
| 90 | Flushing | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 91 | Gluten sensitivity | FAERS: 7 | US FAERS | |
| 92 | Oropharyngeal pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Respiratory distress | FAERS: 7 | US FAERS | |
| 94 | Sprue-like enteropathy | FAERS: 7 | US FAERS | |
| 95 | Stress | FAERS: 7 | US FAERS | |
| 96 | White blood cell count decreased | FAERS: 7 | US FAERS | |
| 97 | jaundice | FAERS: 7 | US FAERS | |
| 98 | Alanine Aminotransferase Increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Anaphylactic shock | FAERS: 6 | US FAERS | |
| 100 | Anuria | FAERS: 6 | US FAERS | |
| 101 | Asthma | FAERS: 6 | US FAERS | |
| 102 | Carcinogenicity | FAERS: 6 | US FAERS | |
| 103 | Disease complication | FAERS: 6 | US FAERS | |
| 104 | Influenza | FAERS: 6 | US FAERS | |
| 105 | Malabsorption | FAERS: 6 | US FAERS | |
| 106 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 107 | Productive Cough | FAERS: 6 | US FAERS | |
| 108 | Wheezing | FAERS: 6 | US FAERS | |
| 109 | Abdominal tenderness | FAERS: 5 | US FAERS | |
| 110 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 111 | Arthritis | FAERS: 5 | US FAERS | |
| 112 | Arthropathy | FAERS: 5 | US FAERS | |
| 113 | Blood cholesterol increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 115 | Chills | FAERS: 5 | US FAERS | |
| 116 | Cyanosis | FAERS: 5 | US FAERS | |
| 117 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 118 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 119 | Pallor | FAERS: 5 | US FAERS | |
| 120 | Product contamination | FAERS: 5 | US FAERS | |
| 121 | Product taste abnormal | FAERS: 5 | US FAERS | |
| 122 | Psoriasis | FAERS: 5 | US FAERS | |
| 123 | Pulmonary Fibrosis | FAERS: 5 | US FAERS | |
| 124 | Stomatitis | FAERS: 5 | US FAERS | |
| 125 | Thrombocytopenia | FAERS: 5 | US FAERS | |
| 126 | Unevaluable event | FAERS: 5 | US FAERS | |
| 127 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 128 | Accidental overdose | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Agranulocytosis | FAERS: 4 | US FAERS | |
| 130 | Aphasia | FAERS: 4 | US FAERS | |
| 131 | Atrial Flutter | FAERS: 4 | US FAERS | |
| 132 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 133 | Bradycardia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Choking | FAERS: 4 | US FAERS | |
| 135 | Cholecystitis | FAERS: 4 | US FAERS | |
| 136 | Chromaturia | FAERS: 4 | US FAERS | |
| 137 | Deafness | FAERS: 4 | US FAERS | |
| 138 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 139 | Erectile dysfunction | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Extremity contracture | FAERS: 4 | US FAERS | |
| 141 | Flatulence | FAERS: 4 | US FAERS | |
| 142 | Gamma-Glutamyltransferase Increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 144 | Growth retardation | FAERS: 4 | US FAERS | |
| 145 | Hepatitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Lymphoma | FAERS: 4 | US FAERS | |
| 147 | Memory impairment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 149 | Multiple Sclerosis | FAERS: 4 | US FAERS | |
| 150 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 151 | Post procedural complication | FAERS: 4 | US FAERS | |
| 152 | Product dose omission | FAERS: 4 | US FAERS | |
| 153 | Product formulation issue | FAERS: 4 | US FAERS | |
| 154 | Shock | FAERS: 4 | US FAERS | |
| 155 | Skin irritation | FAERS: 4 | US FAERS | |
| 156 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 157 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 158 | treatment failure | FAERS: 4 | US FAERS | |
| 159 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 160 | Ageusia | FAERS: 3 | US FAERS | |
| 161 | Amnesia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 163 | Apparent death | FAERS: 3 | US FAERS | |
| 164 | Bedridden | FAERS: 3 | US FAERS | |
| 165 | Bilirubin conjugated increased | FAERS: 3 | US FAERS | |
| 166 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 167 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 168 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 169 | Cauda Equina Syndrome | FAERS: 3 | US FAERS | |
| 170 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 171 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 172 | Dry skin | FAERS: 3 | US FAERS | |
| 173 | Economic problem | FAERS: 3 | US FAERS | |
| 174 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 175 | Eye irritation | FAERS: 3 | US FAERS | |
| 176 | Eye pain | FAERS: 3 | US FAERS | |
| 177 | Feeling Cold | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Gout | FAERS: 3 | US FAERS | |
| 179 | Intestinal angioedema | FAERS: 3 | US FAERS | |
| 180 | Limb discomfort | FAERS: 3 | US FAERS | |
| 181 | Myopathy | FAERS: 3 | US FAERS | |
| 182 | Neonatal anuria | FAERS: 3 | US FAERS | |
| 183 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 184 | Nervousness | FAERS: 3 | US FAERS | |
| 185 | Oliguria | FAERS: 3 | US FAERS | |
| 186 | Peritoneal Dialysis | FAERS: 3 | US FAERS | |
| 187 | Polyarthritis | FAERS: 3 | US FAERS | |
| 188 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 189 | Pregnancy | FAERS: 3 | US FAERS | |
| 190 | Product physical issue | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 191 | Protein urine present | FAERS: 3 | US FAERS | |
| 192 | Pseudocyst | FAERS: 3 | US FAERS | |
| 193 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 194 | Rash erythematous | FAERS: 3 | US FAERS | |
| 195 | Reaction to excipient | FAERS: 3 | US FAERS | |
| 196 | Restlessness | FAERS: 3 | US FAERS | |
| 197 | Sepsis | FAERS: 3 | US FAERS | |
| 198 | Septic Shock | FAERS: 3 | US FAERS | |
| 199 | Sinusitis | FAERS: 3 | US FAERS | |
| 200 | Sluggishness | FAERS: 3 | US FAERS | |
| 201 | Sneezing | FAERS: 3 | US FAERS | |
| 202 | Supraclavicular retraction | FAERS: 3 | US FAERS | |
| 203 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 204 | Therapeutic response unexpected with drug substitution | FAERS: 3 | US FAERS | |
| 205 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 206 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 207 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 208 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 209 | Agitation | FAERS: 2 | US FAERS | |
| 210 | Alanine aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 211 | Amaurosis | FAERS: 2 | US FAERS | |
| 212 | Amniotic fluid volume decreased | FAERS: 2 | US FAERS | |
| 213 | Anger | FAERS: 2 | US FAERS | |
| 214 | Anorexia | FAERS: 2 | US FAERS | |
| 215 | Aphagia | FAERS: 2 | US FAERS | |
| 216 | Aphonia | FAERS: 2 | US FAERS | |
| 217 | Asphyxia | FAERS: 2 | US FAERS | |
| 218 | Back disorder | FAERS: 2 | US FAERS | |
| 219 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 220 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 221 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 222 | Blood glucose increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 223 | Blood urea increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Bone pain | FAERS: 2 | US FAERS | |
| 225 | Breast cancer stage III | FAERS: 2 | US FAERS | |
| 226 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 227 | Congenital intestinal malformation | FAERS: 2 | US FAERS | |
| 228 | Contracted bladder | FAERS: 2 | US FAERS | |
| 229 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 230 | Craniofacial Dysostosis | FAERS: 2 | US FAERS | |
| 231 | Dementia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Depressed mood | FAERS: 2 | US FAERS | |
| 233 | Dermatitis | FAERS: 2 | US FAERS | |
| 234 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 235 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 236 | Drug level increased | FAERS: 2 | US FAERS | |
| 237 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 238 | Dysarthria | FAERS: 2 | US FAERS | |
| 239 | Ear discomfort | FAERS: 2 | US FAERS | |
| 240 | Eczema | FAERS: 2 | US FAERS | |
| 241 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 242 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 243 | Epididymitis | FAERS: 2 | US FAERS | |
| 244 | Epilepsy | FAERS: 2 | US FAERS | |
| 245 | Exophthalmos | FAERS: 2 | US FAERS | |
| 246 | Flank Pain | FAERS: 2 | US FAERS | |
| 247 | Food Poisoning | FAERS: 2 | US FAERS | |
| 248 | Formication | FAERS: 2 | US FAERS | |
| 249 | Gait inability | FAERS: 2 | US FAERS | |
| 250 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 251 | Gastrointestinal hypomotility | FAERS: 2 | US FAERS | |
| 252 | Head discomfort | FAERS: 2 | US FAERS | |
| 253 | Hemiparesis | FAERS: 2 | US FAERS | |
| 254 | Hepatitis C virus test positive | FAERS: 2 | US FAERS | |
| 255 | Hypertrophy | FAERS: 2 | US FAERS | |
| 256 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 257 | Hypoxia | FAERS: 2 | US FAERS | |
| 258 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 259 | Impaired work ability | FAERS: 2 | US FAERS | |
| 260 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 261 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 262 | Increased bronchial secretion | FAERS: 2 | US FAERS | |
| 263 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 264 | Infarction | FAERS: 2 | US FAERS | |
| 265 | Inflammation | FAERS: 2 | US FAERS | |
| 266 | Intestinal villi atrophy | FAERS: 2 | US FAERS | |
| 267 | Invasive Ductal Breast Carcinoma | FAERS: 2 | US FAERS | |
| 268 | Joint stiffness | FAERS: 2 | US FAERS | |
| 269 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 270 | Lipase increased | FAERS: 2 | US FAERS | |
| 271 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 272 | Low Cardiac Output Syndrome | FAERS: 2 | US FAERS | |
| 273 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 274 | Medication residue | FAERS: 2 | US FAERS | |
| 275 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 276 | Mood swings | FAERS: 2 | US FAERS | |
| 277 | Mouth swelling | FAERS: 2 | US FAERS | |
| 278 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 279 | Myoclonus | FAERS: 2 | US FAERS | |
| 280 | Nail Infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Neck Pain | FAERS: 2 | US FAERS | |
| 282 | Nocturia | FAERS: 2 | US FAERS | |
| 283 | Oral pain | FAERS: 2 | US FAERS | |
| 284 | Pain of skin | FAERS: 2 | US FAERS | |
| 285 | Petechiae | FAERS: 2 | US FAERS | |
| 286 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 287 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 288 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 289 | Post-anoxic myoclonus | FAERS: 2 | US FAERS | |
| 290 | Prerenal failure | FAERS: 2 | US FAERS | |
| 291 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 292 | Presyncope | FAERS: 2 | US FAERS | |
| 293 | Product availability issue | FAERS: 2 | US FAERS | |
| 294 | Product complaint | FAERS: 2 | US FAERS | |
| 295 | Product contamination chemical | FAERS: 2 | US FAERS | |
| 296 | Product counterfeit | FAERS: 2 | US FAERS | |
| 297 | Product prescribing error | FAERS: 2 | US FAERS | |
| 298 | Product shape issue | FAERS: 2 | US FAERS | |
| 299 | Product supply issue | FAERS: 2 | US FAERS | |
| 300 | Pulmonary function test decreased | FAERS: 2 | US FAERS | |
| 301 | Renal dysplasia | FAERS: 2 | US FAERS | |
| 302 | Renal failure neonatal | FAERS: 2 | US FAERS | |
| 303 | Renal tubular acidosis | FAERS: 2 | US FAERS | |
| 304 | Renal vein occlusion | FAERS: 2 | US FAERS | |
| 305 | Renin increased | FAERS: 2 | US FAERS | |
| 306 | Retching | FAERS: 2 | US FAERS | |
| 307 | Secretion discharge | FAERS: 2 | US FAERS | |
| 308 | Skin Erosion | FAERS: 2 | US FAERS | |
| 309 | Skin lesion | FAERS: 2 | US FAERS | |
| 310 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 311 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 312 | Sudden death | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 313 | Sunburn | FAERS: 2 | US FAERS | |
| 314 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 315 | Therapy change | FAERS: 2 | US FAERS | |
| 316 | Toothache | FAERS: 2 | US FAERS | |
| 317 | Ulcer | FAERS: 2 | US FAERS | |
| 318 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 319 | Uterine Cancer | FAERS: 2 | US FAERS | |
| 320 | Vasculitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 321 | muscle injury | FAERS: 2 | US FAERS | |
| 322 | nervous system disorder | FAERS: 2 | US FAERS | |
| 323 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 324 | Acne | FAERS: 1 | US FAERS | |
| 325 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 326 | Allergic cough | FAERS: 1 | US FAERS | |
| 327 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 328 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 329 | Alveolitis | FAERS: 1 | US FAERS | |
| 330 | Ammonia increased | FAERS: 1 | US FAERS | |
| 331 | Anal polyp | FAERS: 1 | US FAERS | |
| 332 | Aneurysm | FAERS: 1 | US FAERS | |
| 333 | Angiotensin converting enzyme increased | FAERS: 1 | US FAERS | |
| 334 | Angiotensin converting enzyme inhibitor foetopathy | FAERS: 1 | US FAERS | |
| 335 | Animal bite | FAERS: 1 | US FAERS | |
| 336 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 337 | Anosmia | FAERS: 1 | US FAERS | |
| 338 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 339 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 340 | Arterial bypass operation | FAERS: 1 | US FAERS | |
| 341 | Arteritis obliterans | FAERS: 1 | US FAERS | |
| 342 | Ataxia | FAERS: 1 | US FAERS | |
| 343 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 344 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 345 | Beta 2 microglobulin increased | FAERS: 1 | US FAERS | |
| 346 | Blepharospasm | FAERS: 1 | US FAERS | |
| 347 | Blindness | FAERS: 1 | US FAERS | |
| 348 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 349 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 350 | Blood aldosterone increased | FAERS: 1 | US FAERS | |
| 351 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 352 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 353 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 354 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 355 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 356 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 357 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 358 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 359 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 360 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 361 | Blood urine present | FAERS: 1 | US FAERS | |
| 362 | Blood zinc decreased | FAERS: 1 | US FAERS | |
| 363 | Bone formation decreased | FAERS: 1 | US FAERS | |
| 364 | Bronchitis | FAERS: 1 | US FAERS | |
| 365 | Bursitis | FAERS: 1 | US FAERS | |
| 366 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 367 | Candidiasis | FAERS: 1 | US FAERS | |
| 368 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 369 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 370 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 371 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 372 | Cataract | FAERS: 1 | US FAERS | |
| 373 | Catheter related complication | FAERS: 1 | US FAERS | |
| 374 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 375 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 376 | Cold sweat | FAERS: 1 | US FAERS | |
| 377 | Colitis | FAERS: 1 | US FAERS | |
| 378 | Congenital renal cyst | FAERS: 1 | US FAERS | |
| 379 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 380 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 381 | Crying | FAERS: 1 | US FAERS | |
| 382 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 383 | Delirium | FAERS: 1 | US FAERS | |
| 384 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 385 | Diplopia | FAERS: 1 | US FAERS | |
| 386 | Diverticulitis | FAERS: 1 | US FAERS | |
| 387 | Drug abuser | FAERS: 1 | US FAERS | |
| 388 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 389 | Drug effect variable | FAERS: 1 | US FAERS | |
| 390 | Drug resistance | FAERS: 1 | US FAERS | |
| 391 | Drug toxicity | FAERS: 1 | US FAERS | |
| 392 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 393 | Dysgraphia | FAERS: 1 | US FAERS | |
| 394 | Dysmorphism | FAERS: 1 | US FAERS | |
| 395 | Educational problem | FAERS: 1 | US FAERS | |
| 396 | Embolism | FAERS: 1 | US FAERS | |
| 397 | Endolymphatic Hydrops | FAERS: 1 | US FAERS | |
| 398 | Enterocolitis | FAERS: 1 | US FAERS | |
| 399 | Eosinophilia | FAERS: 1 | US FAERS | |
| 400 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 401 | Epiglottitis | FAERS: 1 | US FAERS | |
| 402 | Eructation | FAERS: 1 | US FAERS | |
| 403 | Expired drug administered | FAERS: 1 | US FAERS | |
| 404 | Expired product administered | FAERS: 1 | US FAERS | |
| 405 | Eye inflammation | FAERS: 1 | US FAERS | |
| 406 | Fear of falling | FAERS: 1 | US FAERS | |
| 407 | Feeding intolerance | FAERS: 1 | US FAERS | |
| 408 | Feeling jittery | FAERS: 1 | US FAERS | |
| 409 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 410 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 411 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 412 | Food Allergy | FAERS: 1 | US FAERS | |
| 413 | Fracture | FAERS: 1 | US FAERS | |
| 414 | Frustration | FAERS: 1 | US FAERS | |
| 415 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 416 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 417 | Genital rash | FAERS: 1 | US FAERS | |
| 418 | Glossitis | FAERS: 1 | US FAERS | |
| 419 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 420 | Guttate psoriasis | FAERS: 1 | US FAERS | |
| 421 | Head titubation | FAERS: 1 | US FAERS | |
| 422 | Heat Stroke | FAERS: 1 | US FAERS | |
| 423 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 424 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 425 | Hernia | FAERS: 1 | US FAERS | |
| 426 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 427 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 428 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 429 | Hypogeusia | FAERS: 1 | US FAERS | |
| 430 | Hysterectomy | FAERS: 1 | US FAERS | |
| 431 | Ileus | FAERS: 1 | US FAERS | |
| 432 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 433 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 434 | Incontinence | FAERS: 1 | US FAERS | |
| 435 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 436 | Infection | FAERS: 1 | US FAERS | |
| 437 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 438 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 439 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 440 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 441 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 442 | Joint injury | FAERS: 1 | US FAERS | |
| 443 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 444 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 445 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 446 | Leukocytosis | FAERS: 1 | US FAERS | |
| 447 | Lichen Planus | FAERS: 1 | US FAERS | |
| 448 | Limb injury | FAERS: 1 | US FAERS | |
| 449 | Limb mass | FAERS: 1 | US FAERS | |
| 450 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 451 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 452 | Liver Abscess | FAERS: 1 | US FAERS | |
| 453 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 454 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 455 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 456 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 457 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 458 | Lymphangitis | FAERS: 1 | US FAERS | |
| 459 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 460 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 461 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 462 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 463 | Manufacturing process control procedure issue | FAERS: 1 | US FAERS | |
| 464 | Mastectomy | FAERS: 1 | US FAERS | |
| 465 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 466 | Meningioma | FAERS: 1 | US FAERS | |
| 467 | Mental impairment | FAERS: 1 | US FAERS | |
| 468 | Mental status changes | FAERS: 1 | US FAERS | |
| 469 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 470 | Middle insomnia | FAERS: 1 | US FAERS | |
| 471 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 472 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 473 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 474 | Muscle tightness | FAERS: 1 | US FAERS | |
| 475 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 476 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 477 | Negative thoughts | FAERS: 1 | US FAERS | |
| 478 | Neonatal hypotension | FAERS: 1 | US FAERS | |
| 479 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 480 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 481 | Night sweats | FAERS: 1 | US FAERS | |
| 482 | Occult blood positive | FAERS: 1 | US FAERS | |
| 483 | Onychoclasis | FAERS: 1 | US FAERS | |
| 484 | Onychomalacia | FAERS: 1 | US FAERS | |
| 485 | Oral administration complication | FAERS: 1 | US FAERS | |
| 486 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 487 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 488 | Osteopenia | FAERS: 1 | US FAERS | |
| 489 | PO2 decreased | FAERS: 1 | US FAERS | |
| 490 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 491 | Paradoxical pressor response | FAERS: 1 | US FAERS | |
| 492 | Paranoia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 493 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 494 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 495 | Pemphigus | FAERS: 1 | US FAERS | |
| 496 | Pneumopericardium | FAERS: 1 | US FAERS | |
| 497 | Pneumothorax | FAERS: 1 | US FAERS | |
| 498 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 499 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 500 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 501 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 502 | Product commingling | FAERS: 1 | US FAERS | |
| 503 | Product contamination physical | FAERS: 1 | US FAERS | |
| 504 | Product dispensing error | FAERS: 1 | US FAERS | |
| 505 | Product label issue | FAERS: 1 | US FAERS | |
| 506 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 507 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 508 | Product packaging issue | FAERS: 1 | US FAERS | |
| 509 | Product residue present | FAERS: 1 | US FAERS | |
| 510 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 511 | Prostatism | FAERS: 1 | US FAERS | |
| 512 | Proteinuria | FAERS: 1 | US FAERS | |
| 513 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 514 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 515 | Purpura | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 516 | Pyuria | FAERS: 1 | US FAERS | |
| 517 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 518 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 519 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 520 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 521 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 522 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 523 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 524 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 525 | Rosacea | FAERS: 1 | US FAERS | |
| 526 | Screaming | FAERS: 1 | US FAERS | |
| 527 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 528 | Sperm concentration zero | FAERS: 1 | US FAERS | |
| 529 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 530 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 531 | Stillbirth | FAERS: 1 | US FAERS | |
| 532 | Stupor | FAERS: 1 | US FAERS | |
| 533 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 534 | Suicide attempt | FAERS: 1 | US FAERS | |
| 535 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 536 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 537 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 538 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 539 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 540 | Therapeutic product effect increased | FAERS: 1 | US FAERS | |
| 541 | Therapy cessation | FAERS: 1 | US FAERS | |
| 542 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 543 | Thirst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 544 | Throat cancer | FAERS: 1 | US FAERS | |
| 545 | Thrombosis | FAERS: 1 | US FAERS | |
| 546 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 547 | Tongue biting | FAERS: 1 | US FAERS | |
| 548 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 549 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 550 | Tooth Loss | FAERS: 1 | US FAERS | |
| 551 | Transaminases increased | FAERS: 1 | US FAERS | |
| 552 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 553 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 554 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 555 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 556 | Urticarial vasculitis | FAERS: 1 | US FAERS | |
| 557 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 558 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 559 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 560 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 561 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 562 | Weight below normal | FAERS: 1 | US FAERS | |
| 563 | Withdrawal hypertension | FAERS: 1 | US FAERS | |
| 564 | Wrong product administered | FAERS: 1 | US FAERS | |
| 565 | colonoscopy | FAERS: 1 | US FAERS | |
| 566 | furuncle | FAERS: 1 | US FAERS | |
| 567 | liposarcoma | FAERS: 1 | US FAERS | |
| 568 | Eye Burns | Canada Vigilance: 1 | Canada Vigilance | |
| 569 | Hypertrichosis | Canada Vigilance: 1 | Canada Vigilance | |
| 570 | Iritis | Canada Vigilance: 1 | Canada Vigilance | |
| 571 | Piloerection | Canada Vigilance: 1 | Canada Vigilance | |
| 572 | Sexual Dysfunction | Canada Vigilance: 1 | Canada Vigilance | |
| 573 | Therapeutic product effect decreased | Canada Vigilance: 3 | Canada Vigilance | |
| 574 | Urinary Retention | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.