rizatriptan
(JPRXYLQNJJVCMZ-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)c1ccccc1.CN(CCc1c[nH]c2c1cc(cc2)Cn1cncn1)C
- Molecular Formula:
- C22H25N5O2
- Molecular Weight:
- 391.466
- Log P:
- 3.2966
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 87.04
- CAS Number(s):
- 145202-66-0
Synonym(s)
1.
rizatriptan
2.
L 705,126
3.
L 705126
4.
L-705,126
5.
L-705126
6.
MK 0462
7.
MK 462
8.
MK-0462
9.
MK-462
10.
Maxalt
11.
N,N-dimethyl-2-(5-(1,2,4-triazol-1-ylmethyl)-1H-indole-3-yl)ethylamine
12.
rizatriptan benzoate
External Link(s)
| MeSH | C093622 |
| PubChem Compound | 77997 |
| ChEBI | 8875 |
| CHEMBL | CHEMBL1201032 |
| KEGG | dr:D00675 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 137 Canada Vigilance: 18 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Headache | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Nausea | FAERS: 36 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | No adverse event | FAERS: 30 | US FAERS | |
| 5 | Myocardial Infarction | FAERS: 25 | US FAERS | |
| 6 | Product substitution issue | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Vomiting | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 8 | Chest Pain | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Drug exposure during pregnancy | FAERS: 20 | OFFSIDES US FAERS | |
| 10 | Chest discomfort | FAERS: 19 | US FAERS | |
| 11 | Malaise | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Adverse event | FAERS: 15 | OFFSIDES US FAERS | |
| 13 | Dizziness | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Hypersensitivity | FAERS: 13 | SIDER US FAERS | |
| 16 | Drug effect incomplete | FAERS: 12 | US FAERS | |
| 17 | Expired product administered | FAERS: 12 | US FAERS | |
| 18 | Cerebrovascular accident | FAERS: 10 | US FAERS | |
| 19 | Feeling abnormal | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 20 | Anxiety | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 21 | Asthenia | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 22 | Overdose | FAERS: 8 | OFFSIDES US FAERS | |
| 23 | Product solubility abnormal | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 25 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 26 | Acute myocardial infarction | FAERS: 7 | OFFSIDES US FAERS | |
| 27 | Disability | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Intentional drug misuse | FAERS: 7 | OFFSIDES US FAERS | |
| 29 | Myalgia | FAERS: 7 | SIDER US FAERS | |
| 30 | Prescribed overdose | FAERS: 7 | OFFSIDES US FAERS | |
| 31 | Product physical issue | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 33 | Somnolence | FAERS: 7 | SIDER US FAERS | |
| 34 | Drug dose omission | FAERS: 6 | US FAERS | |
| 35 | Dysgeusia | FAERS: 6 | SIDER US FAERS | |
| 36 | Fatigue | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 37 | Hypotension | FAERS: 6 | US FAERS | |
| 38 | Medication Error | FAERS: 6 | US FAERS | |
| 39 | Palpitations | FAERS: 6 | SIDER US FAERS | |
| 40 | Product quality issue | FAERS: 6 | US FAERS | |
| 41 | Tachycardia | FAERS: 6 | SIDER US FAERS | |
| 42 | Tremor | FAERS: 6 | SIDER US FAERS | |
| 43 | Abdominal Pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 44 | Abdominal discomfort | FAERS: 5 | OFFSIDES US FAERS | |
| 45 | Disorientation | FAERS: 5 | SIDER US FAERS | |
| 46 | Hepatitis | FAERS: 5 | US FAERS | |
| 47 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 48 | Lip swelling | FAERS: 5 | US FAERS | |
| 49 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 50 | Pharmaceutical product complaint | FAERS: 5 | OFFSIDES US FAERS | |
| 51 | Tinnitus | FAERS: 5 | OFFSIDES US FAERS | |
| 52 | Ventricular Fibrillation | FAERS: 5 | OFFSIDES US FAERS | |
| 53 | Agitation | FAERS: 4 | US FAERS | |
| 54 | Cerebral vasoconstriction | FAERS: 4 | OFFSIDES US FAERS | |
| 55 | Chills | FAERS: 4 | US FAERS | |
| 56 | Deafness | FAERS: 4 | OFFSIDES US FAERS | |
| 57 | Depressed Level of Consciousness | FAERS: 4 | OFFSIDES US FAERS | |
| 58 | Discomfort | FAERS: 4 | SIDER US FAERS | |
| 59 | Eczema | FAERS: 4 | US FAERS | |
| 60 | Hemiparesis | FAERS: 4 | US FAERS | |
| 61 | Mental status changes | FAERS: 4 | OFFSIDES US FAERS | |
| 62 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 63 | Neck Pain | FAERS: 4 | SIDER US FAERS | |
| 64 | Product blister packaging issue | FAERS: 4 | US FAERS | |
| 65 | Product use issue | FAERS: 4 | US FAERS | |
| 66 | Urticaria | FAERS: 4 | SIDER US FAERS | |
| 67 | Vascular occlusion | FAERS: 4 | US FAERS | |
| 68 | Vasospasm | FAERS: 4 | OFFSIDES US FAERS | |
| 69 | Ageusia | FAERS: 3 | US FAERS | |
| 70 | Anosmia | FAERS: 3 | US FAERS | |
| 71 | Aphasia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Arthralgia | FAERS: 3 | US FAERS | |
| 73 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 74 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 75 | Bradycardia | FAERS: 3 | SIDER US FAERS | |
| 76 | Drug administration error | FAERS: 3 | OFFSIDES US FAERS | |
| 77 | Drug effect delayed | FAERS: 3 | US FAERS | |
| 78 | Dysarthria | FAERS: 3 | US FAERS | |
| 79 | Epilepsy | FAERS: 3 | US FAERS | |
| 80 | Erythema | FAERS: 3 | US FAERS | |
| 81 | Expired drug administered | FAERS: 3 | US FAERS | |
| 82 | Facial Pain | FAERS: 3 | SIDER US FAERS | |
| 83 | Inappropriate schedule of drug administration | FAERS: 3 | OFFSIDES US FAERS | |
| 84 | Lethargy | FAERS: 3 | OFFSIDES US FAERS | |
| 85 | Pregnancy | FAERS: 3 | US FAERS | |
| 86 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 87 | Sinusitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 88 | Thrombosis | FAERS: 3 | US FAERS | |
| 89 | Trisomy 21 | FAERS: 3 | OFFSIDES US FAERS | |
| 90 | Vasculitis | FAERS: 3 | US FAERS | |
| 91 | Visual disturbance | FAERS: 3 | OFFSIDES US FAERS | |
| 92 | Accidental overdose | FAERS: 2 | OFFSIDES US FAERS | |
| 93 | Amnesia | FAERS: 2 | OFFSIDES US FAERS | |
| 94 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 95 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 96 | Apathy | FAERS: 2 | OFFSIDES US FAERS | |
| 97 | Blindness | FAERS: 2 | US FAERS | |
| 98 | Breast Feeding | FAERS: 2 | US FAERS | |
| 99 | Cold sweat | FAERS: 2 | US FAERS | |
| 100 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 101 | Cystitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Eosinophilia | FAERS: 2 | US FAERS | |
| 103 | Exophthalmos | FAERS: 2 | US FAERS | |
| 104 | Extra dose administered | FAERS: 2 | US FAERS | |
| 105 | Flatulence | FAERS: 2 | US FAERS | |
| 106 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 107 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 108 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 109 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 110 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 111 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 112 | Lower respiratory tract infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Medication overuse headache | FAERS: 2 | US FAERS | |
| 114 | Memory impairment | FAERS: 2 | US FAERS | |
| 115 | Multiple Sclerosis | FAERS: 2 | OFFSIDES US FAERS | |
| 116 | Musculoskeletal stiffness | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 117 | Myopathy | FAERS: 2 | US FAERS | |
| 118 | Neuropathy | FAERS: 2 | US FAERS | |
| 119 | Pain of skin | FAERS: 2 | US FAERS | |
| 120 | Petechiae | FAERS: 2 | US FAERS | |
| 121 | Pharmaceutical product counterfeit | FAERS: 2 | OFFSIDES US FAERS | |
| 122 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 123 | Product formulation issue | FAERS: 2 | US FAERS | |
| 124 | Product packaging issue | FAERS: 2 | US FAERS | |
| 125 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 126 | Pruritus | FAERS: 2 | SIDER US FAERS | |
| 127 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 128 | Screaming | FAERS: 2 | OFFSIDES US FAERS | |
| 129 | Sneezing | FAERS: 2 | US FAERS | |
| 130 | Sudden death | FAERS: 2 | US FAERS | |
| 131 | Therapy cessation | FAERS: 2 | US FAERS | |
| 132 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 133 | Toxic Epidermal Necrolysis | FAERS: 2 | SIDER US FAERS | |
| 134 | Vertigo | FAERS: 2 | SIDER US FAERS | |
| 135 | Visual Impairment | FAERS: 2 | US FAERS | |
| 136 | Weight decreased | FAERS: 2 | US FAERS | |
| 137 | jaundice | FAERS: 2 | US FAERS | |
| 138 | treatment failure | FAERS: 2 | US FAERS | |
| 139 | Aborted pregnancy | FAERS: 1 | US FAERS | |
| 140 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 141 | Accidental exposure | FAERS: 1 | US FAERS | |
| 142 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 143 | Acute Coronary Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 144 | Allodynia | FAERS: 1 | US FAERS | |
| 145 | Alopecia | FAERS: 1 | US FAERS | |
| 146 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 147 | Anger | FAERS: 1 | OFFSIDES US FAERS | |
| 148 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 149 | Antidepressant therapy | FAERS: 1 | US FAERS | |
| 150 | Aura | FAERS: 1 | US FAERS | |
| 151 | Blepharospasm | FAERS: 1 | OFFSIDES US FAERS | |
| 152 | Blunted affect | FAERS: 1 | US FAERS | |
| 153 | Burning sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 154 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 155 | Cervicobrachial syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 156 | Chromaturia | FAERS: 1 | US FAERS | |
| 157 | Circumstance or information capable of leading to medication error | FAERS: 1 | OFFSIDES US FAERS | |
| 158 | Colectomy | FAERS: 1 | US FAERS | |
| 159 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 160 | Constipation | FAERS: 1 | US FAERS | |
| 161 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 162 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 163 | Cranial operation | FAERS: 1 | US FAERS | |
| 164 | Crying | FAERS: 1 | US FAERS | |
| 165 | Dehydration | FAERS: 1 | US FAERS | |
| 166 | Delirium | FAERS: 1 | US FAERS | |
| 167 | Depressed mood | FAERS: 1 | US FAERS | |
| 168 | Diplopia | FAERS: 1 | OFFSIDES US FAERS | |
| 169 | Drug abuser | FAERS: 1 | OFFSIDES US FAERS | |
| 170 | Drug abuse | FAERS: 1 | US FAERS | |
| 171 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 172 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 173 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 174 | Dry skin | FAERS: 1 | US FAERS | |
| 175 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 176 | Emergency Care | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Encephalitis | FAERS: 1 | OFFSIDES US FAERS | |
| 178 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 179 | Euphoric mood | FAERS: 1 | OFFSIDES US FAERS | |
| 180 | Eye irritation | FAERS: 1 | US FAERS | |
| 181 | Feeling jittery | FAERS: 1 | US FAERS | |
| 182 | Flushing | FAERS: 1 | SIDER US FAERS | |
| 183 | General symptom | FAERS: 1 | OFFSIDES US FAERS | |
| 184 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 185 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 186 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 187 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 188 | Head discomfort | FAERS: 1 | US FAERS | |
| 189 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 190 | Hyperventilation | FAERS: 1 | US FAERS | |
| 191 | Hypothenar hammer syndrome | FAERS: 1 | US FAERS | |
| 192 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 193 | Impaired work ability | FAERS: 1 | US FAERS | |
| 194 | Incoherent | FAERS: 1 | US FAERS | |
| 195 | Infection | FAERS: 1 | US FAERS | |
| 196 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 197 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 198 | Menorrhagia | FAERS: 1 | US FAERS | |
| 199 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 200 | Milk Allergy | FAERS: 1 | US FAERS | |
| 201 | Muscle tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 202 | Mutism | FAERS: 1 | US FAERS | |
| 203 | Myocarditis | FAERS: 1 | US FAERS | |
| 204 | Myositis | FAERS: 1 | US FAERS | |
| 205 | No adverse effect | FAERS: 1 | OFFSIDES US FAERS | |
| 206 | No adverse reaction | FAERS: 1 | US FAERS | |
| 207 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 208 | Pallor | FAERS: 1 | OFFSIDES US FAERS | |
| 209 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 210 | Personality Change | FAERS: 1 | OFFSIDES US FAERS | |
| 211 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 212 | Photophobia | FAERS: 1 | US FAERS | |
| 213 | Poisoning | FAERS: 1 | US FAERS | |
| 214 | Polydactyly | FAERS: 1 | US FAERS | |
| 215 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 216 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 217 | Post procedural complication | FAERS: 1 | OFFSIDES US FAERS | |
| 218 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 219 | Procedural complication | FAERS: 1 | OFFSIDES US FAERS | |
| 220 | Product availability issue | FAERS: 1 | US FAERS | |
| 221 | Product dose omission | FAERS: 1 | US FAERS | |
| 222 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 223 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 224 | Product storage error | FAERS: 1 | US FAERS | |
| 225 | Product supply issue | FAERS: 1 | US FAERS | |
| 226 | Psoriasis | FAERS: 1 | US FAERS | |
| 227 | Psychomotor Agitation | FAERS: 1 | US FAERS | |
| 228 | Rash erythematous | FAERS: 1 | US FAERS | |
| 229 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 230 | Respiratory distress | FAERS: 1 | US FAERS | |
| 231 | Restlessness | FAERS: 1 | US FAERS | |
| 232 | Retching | FAERS: 1 | US FAERS | |
| 233 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 234 | Reversible cerebral vasoconstriction syndrome | FAERS: 1 | US FAERS | |
| 235 | Serotonin Syndrome | FAERS: 1 | SIDER US FAERS | |
| 236 | Shock | FAERS: 1 | SIDER US FAERS | |
| 237 | Skin lesion | FAERS: 1 | US FAERS | |
| 238 | Sopor | FAERS: 1 | US FAERS | |
| 239 | Stillbirth | FAERS: 1 | US FAERS | |
| 240 | Stress | FAERS: 1 | US FAERS | |
| 241 | Stupor | FAERS: 1 | US FAERS | |
| 242 | Suicide attempt | FAERS: 1 | US FAERS | |
| 243 | Supraventricular tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 244 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 245 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 246 | Tension Headache | FAERS: 1 | OFFSIDES US FAERS | |
| 247 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Throat cancer | FAERS: 1 | US FAERS | |
| 249 | Throat irritation | FAERS: 1 | US FAERS | |
| 250 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 251 | Type II hypersensitivity | FAERS: 1 | US FAERS | |
| 252 | Unevaluable event | FAERS: 1 | OFFSIDES US FAERS | |
| 253 | Urine output increased | FAERS: 1 | US FAERS | |
| 254 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 255 | nervous system disorder | FAERS: 1 | US FAERS | |
| 256 | Abdominal tenderness | OFFSIDES | ||
| 257 | Abuse | OFFSIDES | ||
| 258 | Acid reflux | OFFSIDES | ||
| 259 | Actinomycosis | OFFSIDES | ||
| 260 | Acute prerenal failure | OFFSIDES | ||
| 261 | Acute respiratory failure | OFFSIDES | ||
| 262 | Adenocarcinoma | OFFSIDES | ||
| 263 | Agraphia | OFFSIDES | ||
| 264 | Alcohol withdrawal syndrome | OFFSIDES | ||
| 265 | Altered bowel function | OFFSIDES | ||
| 266 | Amphetamines | OFFSIDES | ||
| 267 | Anaphylactoid Reaction | SIDER | ||
| 268 | Anhidrosis | OFFSIDES | ||
| 269 | Ankle Fracture | OFFSIDES | ||
| 270 | Anoxic Encephalopathy | OFFSIDES | ||
| 271 | Anticholinergic Syndrome | OFFSIDES | ||
| 272 | Antidepressant drug level increased | OFFSIDES | ||
| 273 | Appendicitis | OFFSIDES | ||
| 274 | Arthritis | OFFSIDES | ||
| 275 | Arthropathy | OFFSIDES | ||
| 276 | Arthroscopy | OFFSIDES | ||
| 277 | Asthma | OFFSIDES | ||
| 278 | Ataxia | SIDER | ||
| 279 | Autoimmune inner ear disease | OFFSIDES | ||
| 280 | Automatism | OFFSIDES | ||
| 281 | Belligerence | OFFSIDES | ||
| 282 | Bipolar Disorder | OFFSIDES | ||
| 283 | Bipolar I disorder | OFFSIDES | ||
| 284 | Bladder prolapse | OFFSIDES | ||
| 285 | Blepharoptosis | OFFSIDES | ||
| 286 | Blood Glucose | OFFSIDES | ||
| 287 | Blood alkaline phosphatase increased | OFFSIDES | ||
| 288 | Blood cholesterol | OFFSIDES | ||
| 289 | Blood homocysteine decreased | OFFSIDES | ||
| 290 | Blood pH decreased | OFFSIDES | ||
| 291 | Blood potassium decreased | OFFSIDES | ||
| 292 | Blood prolactin increased | OFFSIDES | ||
| 293 | Blurred vision | OFFSIDES | ||
| 294 | Bone density decreased | OFFSIDES | ||
| 295 | Brain Hypoxia | OFFSIDES | ||
| 296 | Breast Cyst | OFFSIDES | ||
| 297 | Bronchitis | OFFSIDES | ||
| 298 | Brucellosis | OFFSIDES | ||
| 299 | Bulbar palsy | OFFSIDES | ||
| 300 | Bursitis | OFFSIDES | ||
| 301 | Calcific deposits removal | OFFSIDES | ||
| 302 | Catheter bacteraemia | OFFSIDES | ||
| 303 | Central nervous system lesion | OFFSIDES | ||
| 304 | Cerebral artery occlusion | OFFSIDES | ||
| 305 | Cervical dysplasia | OFFSIDES | ||
| 306 | Choking sensation | OFFSIDES | ||
| 307 | Chronic left ventricular failure | OFFSIDES | ||
| 308 | Chronic sinusitis | OFFSIDES | ||
| 309 | Colitis | OFFSIDES | ||
| 310 | Colonic Stenosis | OFFSIDES | ||
| 311 | Completed Suicide | OFFSIDES | ||
| 312 | Complication of delivery | OFFSIDES | ||
| 313 | Confabulation | OFFSIDES | ||
| 314 | Culture positive | OFFSIDES | ||
| 315 | Cyst | OFFSIDES | ||
| 316 | Debridement | OFFSIDES | ||
| 317 | Demyelination | OFFSIDES | ||
| 318 | Dental abscess | OFFSIDES | ||
| 319 | Dental caries | OFFSIDES | ||
| 320 | Dental discomfort | OFFSIDES | ||
| 321 | Dependence | OFFSIDES | ||
| 322 | Dermatitis | SIDER | ||
| 323 | Device breakage | OFFSIDES | ||
| 324 | Diarrhea | OFFSIDES | ||
| 325 | Diverticulosis | OFFSIDES | ||
| 326 | Drowsiness | OFFSIDES | ||
| 327 | Drug addict | OFFSIDES | ||
| 328 | Drug screen positive | OFFSIDES | ||
| 329 | Drug withdrawal headache | OFFSIDES | ||
| 330 | Duodenal Ulcer | OFFSIDES | ||
| 331 | Duodenitis | OFFSIDES | ||
| 332 | Dyspareunia | OFFSIDES | ||
| 333 | Dysphemia | OFFSIDES | ||
| 334 | Dyspnoea exacerbated | OFFSIDES | ||
| 335 | Dysthymic Disorder | OFFSIDES | ||
| 336 | Dystonia | OFFSIDES | ||
| 337 | Dysuria | OFFSIDES | ||
| 338 | Economic problem | OFFSIDES | ||
| 339 | Emotional distress | OFFSIDES | ||
| 340 | Endodontic procedure | OFFSIDES | ||
| 341 | Epicondylitis | OFFSIDES | ||
| 342 | Eschar | OFFSIDES | ||
| 343 | Eye inflammation | OFFSIDES | ||
| 344 | Eye pain | OFFSIDES | ||
| 345 | Facial Neuralgia | OFFSIDES | ||
| 346 | Factor VIII inhibition | OFFSIDES | ||
| 347 | Failure of implant | OFFSIDES | ||
| 348 | Fatty Liver | OFFSIDES | ||
| 349 | Feeding disorder neonatal | OFFSIDES | ||
| 350 | Fibromyalgia | OFFSIDES | ||
| 351 | Flank Pain | OFFSIDES | ||
| 352 | Fluid overload | OFFSIDES | ||
| 353 | Folliculitis | OFFSIDES | ||
| 354 | Food Allergy | OFFSIDES | ||
| 355 | Formication | OFFSIDES | ||
| 356 | Galactorrhea | OFFSIDES | ||
| 357 | Gallop rhythm present | OFFSIDES | ||
| 358 | Gastric Bypass | OFFSIDES | ||
| 359 | Gastroenteritis | OFFSIDES | ||
| 360 | Gastrointestinal Pain | SIDER | ||
| 361 | Gastrointestinal inflammation | OFFSIDES | ||
| 362 | Genital Herpes | OFFSIDES | ||
| 363 | Genital rash | OFFSIDES | ||
| 364 | Gestational Diabetes | OFFSIDES | ||
| 365 | Gingival blister | OFFSIDES | ||
| 366 | Glioblastoma | OFFSIDES | ||
| 367 | Heart-lung transplant rejection | OFFSIDES | ||
| 368 | Hostility | OFFSIDES | ||
| 369 | Hydronephrosis | OFFSIDES | ||
| 370 | Hypophonesis | OFFSIDES | ||
| 371 | Hypospadias | OFFSIDES | ||
| 372 | Incorrect product dosage form administered | Canada Vigilance: 1 | Canada Vigilance | |
| 373 | Infusion site mobility decreased | OFFSIDES | ||
| 374 | Injection site urticaria | OFFSIDES | ||
| 375 | Intention tremor | OFFSIDES | ||
| 376 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 377 | Intestinal Perforation | OFFSIDES | ||
| 378 | Joint Instability | OFFSIDES | ||
| 379 | Joint Range of Motion Decreased | OFFSIDES | ||
| 380 | Joint sprain | OFFSIDES | ||
| 381 | Leukopenia neonatal | OFFSIDES | ||
| 382 | Life expectancy shortened | OFFSIDES | ||
| 383 | Ligament rupture | OFFSIDES | ||
| 384 | Lipoma of breast | OFFSIDES | ||
| 385 | Low turnover osteopathy | OFFSIDES | ||
| 386 | Lumbar radiculopathy | OFFSIDES | ||
| 387 | Mass excision | OFFSIDES | ||
| 388 | Mechanical urticaria | OFFSIDES | ||
| 389 | Meniscus removal | OFFSIDES | ||
| 390 | Mental impairment | OFFSIDES | ||
| 391 | Metatarsalgia | OFFSIDES | ||
| 392 | Microalbuminuria | OFFSIDES | ||
| 393 | Migraine with Aura | OFFSIDES | ||
| 394 | Monoplegia | OFFSIDES | ||
| 395 | Multiple drug overdose | OFFSIDES | ||
| 396 | Multiple sclerosis relapse | OFFSIDES | ||
| 397 | Muscle Fatigue | OFFSIDES | ||
| 398 | Muscle Weakness | OFFSIDES | ||
| 399 | Musculoskeletal discomfort | SIDER | ||
| 400 | Nervousness | SIDER | ||
| 401 | Neuralgia | OFFSIDES | ||
| 402 | Onychalgia | OFFSIDES | ||
| 403 | Opisthotonus | OFFSIDES | ||
| 404 | Optic Atrophy | OFFSIDES | ||
| 405 | Oropharyngeal blistering | OFFSIDES | ||
| 406 | Oropharyngeal discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 407 | Osteolysis | OFFSIDES | ||
| 408 | Osteoma | OFFSIDES | ||
| 409 | Osteosclerosis | OFFSIDES | ||
| 410 | Otosclerosis | OFFSIDES | ||
| 411 | PCO2 increased | OFFSIDES | ||
| 412 | Panic Disorder | OFFSIDES | ||
| 413 | Paranoia | OFFSIDES | ||
| 414 | Physical assault | OFFSIDES | ||
| 415 | Physical disability | OFFSIDES | ||
| 416 | Pneumonia | Canada Vigilance: 1 | Canada Vigilance | |
| 417 | Pneumoperitoneum | OFFSIDES | ||
| 418 | Polysubstance abuse | OFFSIDES | ||
| 419 | Post-traumatic pain | OFFSIDES | ||
| 420 | Postoperative abscess | OFFSIDES | ||
| 421 | Pregnancy on oral contraceptive | OFFSIDES | ||
| 422 | Primary sequestrum | OFFSIDES | ||
| 423 | Protein C increased | OFFSIDES | ||
| 424 | Protein S decreased | OFFSIDES | ||
| 425 | Pseudoporphyria | OFFSIDES | ||
| 426 | Pterygium | OFFSIDES | ||
| 427 | Pulmonary congestion | OFFSIDES | ||
| 428 | Pulmonary thrombosis | OFFSIDES | ||
| 429 | Purulent discharge | OFFSIDES | ||
| 430 | Radicular pain | OFFSIDES | ||
| 431 | Rectal Prolapse | OFFSIDES | ||
| 432 | Rectocele | OFFSIDES | ||
| 433 | Respiratory tract congestion | OFFSIDES | ||
| 434 | Retinal vascular occlusion | OFFSIDES | ||
| 435 | Retrocollis | OFFSIDES | ||
| 436 | Rhinitis | OFFSIDES | ||
| 437 | Risus sardonicus | OFFSIDES | ||
| 438 | Salpingo-oophorectomy | OFFSIDES | ||
| 439 | Schizoaffective Disorder | OFFSIDES | ||
| 440 | Serum Sickness | OFFSIDES | ||
| 441 | Shoulder Pain | OFFSIDES | ||
| 442 | Somnambulism | Canada Vigilance: 1 | Canada Vigilance | |
| 443 | Spondylolisthesis | OFFSIDES | ||
| 444 | Staring | OFFSIDES | ||
| 445 | Stenotrophomonas infection | OFFSIDES | ||
| 446 | Stiffness | SIDER | ||
| 447 | Stomatocytes present | OFFSIDES | ||
| 448 | Superficial Thrombophlebitis | OFFSIDES | ||
| 449 | Sweating | SIDER | ||
| 450 | Syncope | SIDER | ||
| 451 | Synovial Cyst | OFFSIDES | ||
| 452 | Synovitis | OFFSIDES | ||
| 453 | Tarsal Tunnel Syndrome | OFFSIDES | ||
| 454 | Tendinitis | OFFSIDES | ||
| 455 | Tenosynovitis | OFFSIDES | ||
| 456 | Tension | SIDER | ||
| 457 | Therapeutic response unexpected | OFFSIDES | ||
| 458 | Thirst | SIDER | ||
| 459 | Tooth Extraction | OFFSIDES | ||
| 460 | Ulcer | OFFSIDES | ||
| 461 | Ventricular arrhythmia | Canada Vigilance: 2 | Canada Vigilance | |
| 462 | Viral upper respiratory tract infection | OFFSIDES | ||
| 463 | Vitamin A Deficiency | OFFSIDES | ||
| 464 | Vulvovaginal pruritus | OFFSIDES | ||
| 465 | Weight Gain | OFFSIDES | ||
| 466 | Wheezing | SIDER | ||
| 467 | Wound Debridement | OFFSIDES | ||
| 468 | Wound Infection | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.