Iloprost
(HIFJCPQKFCZDDL-ACWOEMLNSA-N)
Structure
- SMILES
- CC#CCC([C@@H](/C=C/[C@H]1[C@H](O)C[C@H]2[C@@H]1C/C(=C/CCCC(=O)O)/C2)O)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- B01AC11
- Molecular Formula:
- C22H32O4
- Molecular Weight:
- 360.487
- Log P:
- 3.5413
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 77.76
- CAS Number(s):
- 73873-87-7; 78919-13-8
Synonym(s)
1.
Iloprost
2.
Ciloprost
3.
Ventavis
4.
ZK-36374
5.
ZK 36374
6.
ZK36374
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use issue | FAERS: 82 | US FAERS | |
| 2 | Pulmonary arterial hypertension | FAERS: 81 | OFFSIDES US FAERS | |
| 3 | Pulmonary Hypertension | FAERS: 74 | OFFSIDES US FAERS | |
| 4 | Headache | FAERS: 70 | 2408809 | CTD SIDER US FAERS |
| 5 | General physical health deterioration | FAERS: 61 | US FAERS | |
| 6 | Dizziness | FAERS: 48 | OFFSIDES SIDER US FAERS | |
| 7 | Pneumonia | FAERS: 47 | SIDER US FAERS | |
| 8 | Fatigue | FAERS: 46 | OFFSIDES US FAERS | |
| 9 | Disease Progression | FAERS: 44 | OFFSIDES US FAERS | |
| 10 | Asthenia | FAERS: 41 | OFFSIDES US FAERS | |
| 11 | Nausea | FAERS: 40 | OFFSIDES SIDER US FAERS | |
| 12 | Cardiac Arrest | FAERS: 39 | US FAERS | |
| 13 | Chest Pain | FAERS: 39 | OFFSIDES SIDER US FAERS | |
| 14 | Hypotension | FAERS: 38 | 2408809 2435669 | CTD SIDER US FAERS |
| 15 | Drug ineffective | FAERS: 33 | US FAERS | |
| 16 | Drug dose omission | FAERS: 32 | US FAERS | |
| 17 | Respiratory Failure | FAERS: 31 | US FAERS | |
| 18 | Malaise | FAERS: 30 | US FAERS | |
| 19 | Myocardial Infarction | FAERS: 29 | US FAERS | |
| 20 | Syncope | FAERS: 28 | SIDER US FAERS | |
| 21 | Inappropriate schedule of drug administration | FAERS: 23 | US FAERS | |
| 22 | Right ventricular failure | FAERS: 23 | US FAERS | |
| 23 | Feeling abnormal | FAERS: 22 | US FAERS | |
| 24 | Influenza | FAERS: 20 | SIDER US FAERS | |
| 25 | Nasopharyngitis | FAERS: 20 | US FAERS | |
| 26 | Vomiting | FAERS: 20 | SIDER US FAERS | |
| 27 | Back Pain | FAERS: 19 | SIDER US FAERS | |
| 28 | Epistaxis | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 29 | Pain | FAERS: 15 | SIDER US FAERS | |
| 30 | Ascites | FAERS: 14 | US FAERS | |
| 31 | Hypoxia | FAERS: 14 | US FAERS | |
| 32 | Urinary tract infection | FAERS: 14 | US FAERS | |
| 33 | Abdominal Pain | FAERS: 13 | US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 13 | US FAERS | |
| 35 | Flushing | FAERS: 13 | 2408809 | CTD SIDER US FAERS |
| 36 | Intentional product misuse | FAERS: 12 | US FAERS | |
| 37 | Sepsis | FAERS: 12 | US FAERS | |
| 38 | Throat irritation | FAERS: 12 | SIDER US FAERS | |
| 39 | Weight decreased | FAERS: 12 | US FAERS | |
| 40 | Bronchitis | FAERS: 11 | US FAERS | |
| 41 | Infection | FAERS: 11 | US FAERS | |
| 42 | Productive Cough | FAERS: 11 | US FAERS | |
| 43 | Respiratory distress | FAERS: 11 | US FAERS | |
| 44 | Chest discomfort | FAERS: 10 | SIDER US FAERS | |
| 45 | Chills | FAERS: 10 | US FAERS | |
| 46 | Cyanosis | FAERS: 10 | OFFSIDES US FAERS | |
| 47 | Dehydration | FAERS: 10 | US FAERS | |
| 48 | Drug administered to patient of inappropriate age | FAERS: 10 | US FAERS | |
| 49 | Inflammation | FAERS: 10 | US FAERS | |
| 50 | Oropharyngeal pain | FAERS: 10 | US FAERS | |
| 51 | Swelling | FAERS: 10 | US FAERS | |
| 52 | Asphyxia | FAERS: 9 | US FAERS | |
| 53 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 54 | Cellulitis | FAERS: 9 | US FAERS | |
| 55 | Disease complication | FAERS: 9 | US FAERS | |
| 56 | Peripheral swelling | FAERS: 9 | US FAERS | |
| 57 | Pulmonary Embolism | FAERS: 9 | US FAERS | |
| 58 | Somnolence | FAERS: 9 | US FAERS | |
| 59 | Choking | FAERS: 8 | US FAERS | |
| 60 | Depressed mood | FAERS: 8 | US FAERS | |
| 61 | Discomfort | FAERS: 8 | SIDER US FAERS | |
| 62 | Erythema | FAERS: 8 | US FAERS | |
| 63 | Low birth weight baby | FAERS: 8 | US FAERS | |
| 64 | Palpitations | FAERS: 8 | SIDER US FAERS | |
| 65 | Pruritus | FAERS: 8 | US FAERS | |
| 66 | Respiratory arrest | FAERS: 8 | US FAERS | |
| 67 | Transplant | FAERS: 8 | US FAERS | |
| 68 | Arthralgia | FAERS: 7 | US FAERS | |
| 69 | Device malfunction | FAERS: 7 | US FAERS | |
| 70 | Incorrect drug administration duration | FAERS: 7 | US FAERS | |
| 71 | Pulmonary Fibrosis | FAERS: 7 | US FAERS | |
| 72 | Unevaluable event | FAERS: 7 | US FAERS | |
| 73 | Amnesia | FAERS: 6 | OFFSIDES US FAERS | |
| 74 | Angina Pectoris | FAERS: 6 | 2433921 | CTD US FAERS |
| 75 | Anxiety | FAERS: 6 | US FAERS | |
| 76 | Concomitant disease aggravated | FAERS: 6 | US FAERS | |
| 77 | Device use error | FAERS: 6 | US FAERS | |
| 78 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 79 | Scleroderma | FAERS: 6 | OFFSIDES US FAERS | |
| 80 | Tachycardia | FAERS: 6 | SIDER US FAERS | |
| 81 | Therapy cessation | FAERS: 6 | US FAERS | |
| 82 | Thrombosis | FAERS: 6 | 19238875 19691487 | CTD US FAERS |
| 83 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 84 | Cor pulmonale | FAERS: 5 | OFFSIDES US FAERS | |
| 85 | Delirium | FAERS: 5 | US FAERS | |
| 86 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 87 | Dyspepsia | FAERS: 5 | US FAERS | |
| 88 | Limb injury | FAERS: 5 | US FAERS | |
| 89 | Myalgia | FAERS: 5 | US FAERS | |
| 90 | Pulmonary arterial pressure increased | FAERS: 5 | US FAERS | |
| 91 | Sudden death | FAERS: 5 | OFFSIDES US FAERS | |
| 92 | Vertigo | FAERS: 5 | US FAERS | |
| 93 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 94 | Asthma | FAERS: 4 | OFFSIDES US FAERS | |
| 95 | Atrial Flutter | FAERS: 4 | US FAERS | |
| 96 | Blood potassium decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 97 | Chemotherapy | FAERS: 4 | US FAERS | |
| 98 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 99 | Dysphonia | FAERS: 4 | OFFSIDES US FAERS | |
| 100 | Incorrect dose administered by device | FAERS: 4 | US FAERS | |
| 101 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 102 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 103 | Mechanical ventilation | FAERS: 4 | US FAERS | |
| 104 | Medical induction of coma | FAERS: 4 | US FAERS | |
| 105 | Medication Error | FAERS: 4 | US FAERS | |
| 106 | Osteoporosis | FAERS: 4 | US FAERS | |
| 107 | Pericardial effusion | FAERS: 4 | US FAERS | |
| 108 | Pleurisy | FAERS: 4 | US FAERS | |
| 109 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 110 | Product dose omission | FAERS: 4 | US FAERS | |
| 111 | Pulmonary congestion | FAERS: 4 | US FAERS | |
| 112 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 113 | Septic Shock | FAERS: 4 | US FAERS | |
| 114 | Sinusitis | FAERS: 4 | US FAERS | |
| 115 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 116 | Stress | FAERS: 4 | US FAERS | |
| 117 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 118 | Abdominal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 119 | Adverse event | FAERS: 3 | US FAERS | |
| 120 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 121 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 122 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 123 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 124 | Bradycardia | FAERS: 3 | US FAERS | |
| 125 | Cholecystitis infective | FAERS: 3 | US FAERS | |
| 126 | Constipation | FAERS: 3 | US FAERS | |
| 127 | Device related infection | FAERS: 3 | US FAERS | |
| 128 | Device use issue | FAERS: 3 | US FAERS | |
| 129 | Drug dose omission by device | FAERS: 3 | US FAERS | |
| 130 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 131 | Embolism | FAERS: 3 | US FAERS | |
| 132 | Endarterectomy | FAERS: 3 | US FAERS | |
| 133 | Endocarditis | FAERS: 3 | US FAERS | |
| 134 | Eye irritation | FAERS: 3 | US FAERS | |
| 135 | Eye pain | FAERS: 3 | OFFSIDES US FAERS | |
| 136 | Facial Pain | FAERS: 3 | US FAERS | |
| 137 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 138 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 139 | Hypersomnia | FAERS: 3 | US FAERS | |
| 140 | Infarction | FAERS: 3 | US FAERS | |
| 141 | Laceration | FAERS: 3 | US FAERS | |
| 142 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 143 | Memory impairment | FAERS: 3 | US FAERS | |
| 144 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 145 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 146 | Overdose | FAERS: 3 | US FAERS | |
| 147 | Pharyngolaryngeal Pain | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 148 | Pneumothorax | FAERS: 3 | US FAERS | |
| 149 | Presyncope | FAERS: 3 | US FAERS | |
| 150 | Product prescribing issue | FAERS: 3 | US FAERS | |
| 151 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 152 | Secretion discharge | FAERS: 3 | US FAERS | |
| 153 | Tinnitus | FAERS: 3 | US FAERS | |
| 154 | Wheezing | FAERS: 3 | SIDER US FAERS | |
| 155 | Abdominal cavity drainage | FAERS: 2 | US FAERS | |
| 156 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 157 | Accidental exposure | FAERS: 2 | US FAERS | |
| 158 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 159 | Acute sinusitis | FAERS: 2 | OFFSIDES US FAERS | |
| 160 | Ammonia increased | FAERS: 2 | US FAERS | |
| 161 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 162 | Arthritis | FAERS: 2 | US FAERS | |
| 163 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 164 | Bladder Neoplasm | FAERS: 2 | OFFSIDES US FAERS | |
| 165 | Bladder neoplasm surgery | FAERS: 2 | US FAERS | |
| 166 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 167 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 168 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 169 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 170 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 171 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 172 | Bronchospasm | FAERS: 2 | SIDER US FAERS | |
| 173 | Burning sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 174 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 175 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 176 | Cataract operation | FAERS: 2 | US FAERS | |
| 177 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 178 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 179 | Cystitis | FAERS: 2 | US FAERS | |
| 180 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 181 | Deafness | FAERS: 2 | US FAERS | |
| 182 | Device battery issue | FAERS: 2 | US FAERS | |
| 183 | Device breakage | FAERS: 2 | US FAERS | |
| 184 | Diverticulitis | FAERS: 2 | US FAERS | |
| 185 | Dysarthria | FAERS: 2 | US FAERS | |
| 186 | Dysgeusia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 187 | Ear discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 188 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 189 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 190 | Flank Pain | FAERS: 2 | US FAERS | |
| 191 | Flatulence | FAERS: 2 | US FAERS | |
| 192 | Glaucoma | FAERS: 2 | US FAERS | |
| 193 | Gout | FAERS: 2 | OFFSIDES US FAERS | |
| 194 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 195 | Hypersensitivity | FAERS: 2 | SIDER US FAERS | |
| 196 | Inappropriate Prescribing | FAERS: 2 | US FAERS | |
| 197 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 198 | Incorrect dose administered | FAERS: 2 | OFFSIDES US FAERS | |
| 199 | Inflammatory pain | FAERS: 2 | US FAERS | |
| 200 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 201 | Joint swelling | FAERS: 2 | US FAERS | |
| 202 | Jugular vein distension | FAERS: 2 | OFFSIDES US FAERS | |
| 203 | Medical device implantation | FAERS: 2 | US FAERS | |
| 204 | Micturition frequency decreased | FAERS: 2 | US FAERS | |
| 205 | Musculoskeletal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 206 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 207 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 208 | No adverse event | FAERS: 2 | US FAERS | |
| 209 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 210 | Oral pain | FAERS: 2 | US FAERS | |
| 211 | Pallor | FAERS: 2 | US FAERS | |
| 212 | Pancreatitis | FAERS: 2 | US FAERS | |
| 213 | Pancytopenia | FAERS: 2 | US FAERS | |
| 214 | Post procedural complication | FAERS: 2 | US FAERS | |
| 215 | Pregnancy | FAERS: 2 | US FAERS | |
| 216 | Procedural complication | FAERS: 2 | US FAERS | |
| 217 | Respiratory fremitus | FAERS: 2 | US FAERS | |
| 218 | Respiratory fume inhalation disorder | FAERS: 2 | US FAERS | |
| 219 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 220 | Retching | FAERS: 2 | US FAERS | |
| 221 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 222 | Shock | FAERS: 2 | SIDER US FAERS | |
| 223 | Sinus headache | FAERS: 2 | US FAERS | |
| 224 | Sleep Paralysis | FAERS: 2 | US FAERS | |
| 225 | Stomatitis | FAERS: 2 | US FAERS | |
| 226 | Terminal state | FAERS: 2 | US FAERS | |
| 227 | Thermal burn | FAERS: 2 | US FAERS | |
| 228 | Thoracotomy | FAERS: 2 | US FAERS | |
| 229 | Tremor | FAERS: 2 | US FAERS | |
| 230 | Vena cava filter insertion | FAERS: 2 | US FAERS | |
| 231 | Visual Impairment | FAERS: 2 | US FAERS | |
| 232 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 233 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 234 | colonoscopy | FAERS: 2 | US FAERS | |
| 235 | jaundice | FAERS: 2 | US FAERS | |
| 236 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 237 | Abasia | FAERS: 1 | US FAERS | |
| 238 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 239 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 240 | Ageusia | FAERS: 1 | US FAERS | |
| 241 | Allergy test negative | FAERS: 1 | US FAERS | |
| 242 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 243 | Amputation | FAERS: 1 | US FAERS | |
| 244 | Aneurysm | FAERS: 1 | US FAERS | |
| 245 | Anorexia | FAERS: 1 | US FAERS | |
| 246 | Anuria | FAERS: 1 | US FAERS | |
| 247 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 248 | Aphagia | FAERS: 1 | US FAERS | |
| 249 | Aphasia | FAERS: 1 | US FAERS | |
| 250 | Aphonia | FAERS: 1 | US FAERS | |
| 251 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 252 | Arthropathy | FAERS: 1 | US FAERS | |
| 253 | Astigmatism | FAERS: 1 | US FAERS | |
| 254 | Atelectasis | FAERS: 1 | US FAERS | |
| 255 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 256 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 257 | Bedridden | FAERS: 1 | US FAERS | |
| 258 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 259 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 260 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 261 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 262 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 263 | Breast Cyst | FAERS: 1 | US FAERS | |
| 264 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 265 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 266 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 267 | Bronchopulmonary Dysplasia | FAERS: 1 | US FAERS | |
| 268 | Capillary nail refill test abnormal | FAERS: 1 | US FAERS | |
| 269 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 270 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 271 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 272 | Cardiac cirrhosis | FAERS: 1 | US FAERS | |
| 273 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 274 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 275 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 276 | Cataract | FAERS: 1 | US FAERS | |
| 277 | Catheter placement | FAERS: 1 | US FAERS | |
| 278 | Cheilitis | FAERS: 1 | US FAERS | |
| 279 | Choking sensation | FAERS: 1 | US FAERS | |
| 280 | Chromaturia | FAERS: 1 | US FAERS | |
| 281 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 282 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 283 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 284 | Coagulation time abnormal | FAERS: 1 | US FAERS | |
| 285 | Colitis | FAERS: 1 | US FAERS | |
| 286 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 287 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 288 | Dementia | FAERS: 1 | US FAERS | |
| 289 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 290 | Device Failure | FAERS: 1 | US FAERS | |
| 291 | Device damage | FAERS: 1 | US FAERS | |
| 292 | Device defective | FAERS: 1 | US FAERS | |
| 293 | Device dislocation | FAERS: 1 | US FAERS | |
| 294 | Disability | FAERS: 1 | US FAERS | |
| 295 | Disease recurrence | FAERS: 1 | US FAERS | |
| 296 | Disorientation | FAERS: 1 | US FAERS | |
| 297 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 298 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 299 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 300 | Drug withdrawal headache | FAERS: 1 | OFFSIDES US FAERS | |
| 301 | Dysuria | FAERS: 1 | OFFSIDES US FAERS | |
| 302 | Ecchymosis | FAERS: 1 | US FAERS | |
| 303 | Emergency Care | FAERS: 1 | US FAERS | |
| 304 | Emotional disorder | FAERS: 1 | US FAERS | |
| 305 | Emotional distress | FAERS: 1 | US FAERS | |
| 306 | Encephalitis | FAERS: 1 | US FAERS | |
| 307 | Endolymphatic Hydrops | FAERS: 1 | US FAERS | |
| 308 | Endometrial Hyperplasia | FAERS: 1 | US FAERS | |
| 309 | Enteritis | FAERS: 1 | US FAERS | |
| 310 | Extremity necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 311 | Eye allergy | FAERS: 1 | US FAERS | |
| 312 | Eye inflammation | FAERS: 1 | US FAERS | |
| 313 | Feeling Cold | FAERS: 1 | OFFSIDES US FAERS | |
| 314 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 315 | Food aversion | FAERS: 1 | US FAERS | |
| 316 | Fracture | FAERS: 1 | US FAERS | |
| 317 | Gastrectomy | FAERS: 1 | US FAERS | |
| 318 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 319 | Gastritis | FAERS: 1 | US FAERS | |
| 320 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 321 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 322 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 323 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 324 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 325 | Head discomfort | FAERS: 1 | US FAERS | |
| 326 | Hemiparesis | FAERS: 1 | US FAERS | |
| 327 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 328 | Hernia | FAERS: 1 | US FAERS | |
| 329 | Hip surgery | FAERS: 1 | US FAERS | |
| 330 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 331 | Hypophagia | FAERS: 1 | US FAERS | |
| 332 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 333 | Ileus | FAERS: 1 | US FAERS | |
| 334 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 335 | Implantable defibrillator replacement | FAERS: 1 | US FAERS | |
| 336 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 337 | Increased upper airway secretion | FAERS: 1 | OFFSIDES US FAERS | |
| 338 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 339 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 340 | Intentional drug misuse | FAERS: 1 | OFFSIDES US FAERS | |
| 341 | Joint stiffness | FAERS: 1 | US FAERS | |
| 342 | Laryngitis | FAERS: 1 | US FAERS | |
| 343 | Larynx irritation | FAERS: 1 | US FAERS | |
| 344 | Live Birth | FAERS: 1 | OFFSIDES US FAERS | |
| 345 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 346 | Lower respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 347 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 348 | Malnutrition | FAERS: 1 | US FAERS | |
| 349 | Mastication disorder | FAERS: 1 | US FAERS | |
| 350 | Medical device change | FAERS: 1 | US FAERS | |
| 351 | Medical device site reaction | FAERS: 1 | US FAERS | |
| 352 | Medical observation | FAERS: 1 | US FAERS | |
| 353 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 354 | Mental impairment | FAERS: 1 | US FAERS | |
| 355 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 356 | Muscle strain | FAERS: 1 | US FAERS | |
| 357 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 358 | Mydriasis | FAERS: 1 | US FAERS | |
| 359 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 360 | Myocarditis | FAERS: 1 | US FAERS | |
| 361 | Myopia | FAERS: 1 | US FAERS | |
| 362 | N-terminal prohormone brain natriuretic peptide | FAERS: 1 | US FAERS | |
| 363 | Neck Pain | FAERS: 1 | US FAERS | |
| 364 | Nephritis | FAERS: 1 | US FAERS | |
| 365 | Night sweats | FAERS: 1 | US FAERS | |
| 366 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 367 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 368 | Oligohydramnios | FAERS: 1 | OFFSIDES US FAERS | |
| 369 | Oliguria | FAERS: 1 | US FAERS | |
| 370 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 371 | Osteitis | FAERS: 1 | US FAERS | |
| 372 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 373 | Ototoxicity | FAERS: 1 | US FAERS | |
| 374 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 375 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 376 | Pancreatic calcification | FAERS: 1 | US FAERS | |
| 377 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 378 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 379 | Paranoia | FAERS: 1 | US FAERS | |
| 380 | Paraplegia | FAERS: 1 | US FAERS | |
| 381 | Pathological fracture | FAERS: 1 | US FAERS | |
| 382 | Petechiae | FAERS: 1 | US FAERS | |
| 383 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 384 | Physical disability | FAERS: 1 | US FAERS | |
| 385 | Physical product label issue | FAERS: 1 | US FAERS | |
| 386 | Pneumonitis | FAERS: 1 | US FAERS | |
| 387 | Polyarthritis | FAERS: 1 | US FAERS | |
| 388 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 389 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 390 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 391 | Product administration error | FAERS: 1 | US FAERS | |
| 392 | Product cleaning inadequate | FAERS: 1 | US FAERS | |
| 393 | Product supply issue | FAERS: 1 | US FAERS | |
| 394 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 395 | Protein total decreased | FAERS: 1 | US FAERS | |
| 396 | Pulmonary arterial pressure decreased | FAERS: 1 | US FAERS | |
| 397 | Pulmonary endarterectomy | FAERS: 1 | US FAERS | |
| 398 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 399 | Purulence | FAERS: 1 | US FAERS | |
| 400 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 401 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 402 | Quadriplegia | FAERS: 1 | US FAERS | |
| 403 | Rales | FAERS: 1 | US FAERS | |
| 404 | Respiratory muscle weakness | FAERS: 1 | US FAERS | |
| 405 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 406 | Restlessness | FAERS: 1 | US FAERS | |
| 407 | Right atrial pressure increased | FAERS: 1 | US FAERS | |
| 408 | Sclerotherapy | FAERS: 1 | US FAERS | |
| 409 | Skin irritation | FAERS: 1 | US FAERS | |
| 410 | Somnambulism | FAERS: 1 | US FAERS | |
| 411 | Stillbirth | FAERS: 1 | US FAERS | |
| 412 | Stupor | FAERS: 1 | US FAERS | |
| 413 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 414 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 415 | Supraventricular tachycardia | FAERS: 1 | SIDER US FAERS | |
| 416 | Surgical vascular shunt | FAERS: 1 | US FAERS | |
| 417 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 418 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 419 | Therapy change | FAERS: 1 | US FAERS | |
| 420 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 421 | Thrombocytopenia | FAERS: 1 | 1722991 | CTD SIDER US FAERS |
| 422 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 423 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 424 | Transplant evaluation | FAERS: 1 | US FAERS | |
| 425 | Trismus | FAERS: 1 | SIDER US FAERS | |
| 426 | Tuberculosis | FAERS: 1 | US FAERS | |
| 427 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 428 | Umbilical hernia perforation | FAERS: 1 | US FAERS | |
| 429 | Urinary Retention | FAERS: 1 | US FAERS | |
| 430 | Urticaria | FAERS: 1 | US FAERS | |
| 431 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 432 | Vascular graft complication | FAERS: 1 | US FAERS | |
| 433 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 434 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 435 | Ventilation perfusion mismatch | FAERS: 1 | US FAERS | |
| 436 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 437 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 438 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 439 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 440 | Wound Infection | FAERS: 1 | US FAERS | |
| 441 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 442 | furuncle | FAERS: 1 | US FAERS | |
| 443 | gallbladder neoplasm | FAERS: 1 | US FAERS | |
| 444 | intensive care | FAERS: 1 | US FAERS | |
| 445 | Acute right ventricular failure | OFFSIDES | ||
| 446 | Arterial Occlusive Diseases | 17357385 | CTD | |
| 447 | Arthropod bite | OFFSIDES | ||
| 448 | Blood alkaline phosphatase increased | SIDER | ||
| 449 | Blood and lymphatic system disorders | SIDER | ||
| 450 | Blood creatine phosphokinase MB increased | OFFSIDES | ||
| 451 | Blood pH decreased | OFFSIDES | ||
| 452 | Blood sodium | OFFSIDES | ||
| 453 | Blurred vision | OFFSIDES | ||
| 454 | Body Temperature | OFFSIDES | ||
| 455 | Bowel movement irregularity | OFFSIDES | ||
| 456 | Brain Concussion | OFFSIDES | ||
| 457 | CREST Syndrome | OFFSIDES | ||
| 458 | Carcinoma, Lewis Lung | 16624831 | CTD | |
| 459 | Cardioactive drug level above therapeutic | OFFSIDES | ||
| 460 | Cardiomyopathies | 11518732 16624831 17018546 | CTD | |
| 461 | Collagen-vascular disease | OFFSIDES | ||
| 462 | Colonic Pseudo-Obstruction | OFFSIDES | ||
| 463 | Conjunctival deposit | OFFSIDES | ||
| 464 | Craniotomy | OFFSIDES | ||
| 465 | Dermatitis | SIDER | ||
| 466 | Diarrhea | OFFSIDES | ||
| 467 | Drowsiness | OFFSIDES | ||
| 468 | Drug abuser | OFFSIDES | ||
| 469 | Drug screen positive | OFFSIDES | ||
| 470 | Ejection Fraction Decreased | OFFSIDES | ||
| 471 | Ergotism | 9631897 | CTD | |
| 472 | Erythromelalgia | OFFSIDES | ||
| 473 | Eschar | OFFSIDES | ||
| 474 | Escherichia infection | OFFSIDES | ||
| 475 | Finger Injuries | 11642523 | CTD | |
| 476 | Flat affect | OFFSIDES | ||
| 477 | Formication | OFFSIDES | ||
| 478 | Gamma-Glutamyltransferase Increased | SIDER | ||
| 479 | Gangrene | OFFSIDES | ||
| 480 | Gastric Bypass | OFFSIDES | ||
| 481 | Gene mutation identification test | OFFSIDES | ||
| 482 | Glossitis | SIDER | ||
| 483 | Hyperemia | 2435669 | CTD | |
| 484 | Hyperkeratosis | OFFSIDES | ||
| 485 | Hyperventilation | OFFSIDES | ||
| 486 | Ischemia | 2433921 11642523 17357385 | CTD | |
| 487 | Large intestine perforation | OFFSIDES | ||
| 488 | Lethargy | OFFSIDES | ||
| 489 | Mouth plaque | OFFSIDES | ||
| 490 | Myocardial Ischemia | 2408809 | CTD | |
| 491 | Necrosis | 11642523 | CTD | |
| 492 | Obesity surgery | OFFSIDES | ||
| 493 | Ocular Hypertension | 2435669 | CTD | |
| 494 | Peripheral Vascular Diseases | 17357385 | CTD | |
| 495 | Postural Orthostatic Tachycardia Syndrome | OFFSIDES | ||
| 496 | Pre-Eclampsia | 10329876 | CTD | |
| 497 | Procedural hypotension | OFFSIDES | ||
| 498 | Prostate examination abnormal | OFFSIDES | ||
| 499 | Pulmonary Infarction | OFFSIDES | ||
| 500 | Raynaud Disease | 16363279 | CTD | |
| 501 | Respiratory tract irritation | OFFSIDES | ||
| 502 | Right Ventricular Hypertrophy | OFFSIDES | ||
| 503 | Sclerodactylia | OFFSIDES | ||
| 504 | Soft Tissue Injuries | OFFSIDES | ||
| 505 | Tongue irritation | SIDER | ||
| 506 | Troponin increased | OFFSIDES | ||
| 507 | Unresponsive to pain stimuli | OFFSIDES | ||
| 508 | Vasodilation procedure | SIDER | ||
| 509 | Vasodilation | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.