temsirolimus
(CBPNZQVSJQDFBE-FUXHJELOSA-N)
Structure
- SMILES
- CO[C@@H]1C[C@@H](CC[C@H]1OC(=O)C(CO)(CO)C)C[C@H]([C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@H](CC[C@H]2C)C[C@H](OC)/C(=C/C=C/C=C/[C@H](C[C@H](C(=O)[C@@H]([C@@H](/C(=C/[C@H](C(=O)C1)C)/C)O)OC)C)C)/C)C
- Type(s)
- Approved
- ATC code(s)
- L01XE09
- Molecular Formula:
- C56H87NO16
- Molecular Weight:
- 1030.290
- Log P:
- 5.6603
- Hydrogen Bond Acceptor:
- 17
- Hydrogen Bond Donor:
- 4
- TPSA:
- 241.96
- CAS Number(s):
- 162635-04-3
Synonym(s)
1.
temsirolimus
2.
CCI 779
3.
CCI-779
4.
Torisel
5.
rapamycin, 42-(3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate)
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 310 Canada Vigilance: 7 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Renal Cell Carcinoma | FAERS: 71 | US FAERS | |
| 3 | Blood creatinine increased | FAERS: 61 | SIDER US FAERS | |
| 4 | Thrombocytopenia | FAERS: 55 | SIDER US FAERS | |
| 5 | Asthenia | FAERS: 52 | SIDER US FAERS | |
| 6 | Pneumonia | FAERS: 49 | SIDER US FAERS | |
| 7 | Fatigue | FAERS: 42 | OFFSIDES SIDER US FAERS | |
| 8 | Metastatic Renal Cell Carcinoma | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Nausea | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 10 | Malaise | FAERS: 36 | US FAERS | |
| 11 | General physical health deterioration | FAERS: 33 | US FAERS | |
| 12 | Hypersensitivity | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Pneumonitis | FAERS: 30 | US FAERS | |
| 14 | Back Pain | FAERS: 29 | SIDER US FAERS | |
| 15 | Stomatitis | FAERS: 29 | 16012795 20430774 | CTD SIDER US FAERS |
| 16 | Drug ineffective | FAERS: 26 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 17 | Erythema | FAERS: 26 Canada Vigilance: 1 | 17309148 | CTD SIDER Canada Vigilance US FAERS |
| 18 | Flushing | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Epistaxis | FAERS: 24 | SIDER US FAERS | |
| 20 | Extravasation | FAERS: 24 | SIDER US FAERS | |
| 21 | Vomiting | FAERS: 24 | SIDER US FAERS | |
| 22 | Alanine Aminotransferase Increased | FAERS: 23 | SIDER US FAERS | |
| 23 | Aspartate Aminotransferase Increased | FAERS: 23 | SIDER US FAERS | |
| 24 | Respiratory Failure | FAERS: 23 | OFFSIDES US FAERS | |
| 25 | Pruritus | FAERS: 20 | SIDER US FAERS | |
| 26 | Ascites | FAERS: 19 | US FAERS | |
| 27 | Dehydration | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 28 | Infusion Site Extravasation | FAERS: 19 | US FAERS | |
| 29 | Blood alkaline phosphatase increased | FAERS: 16 | SIDER US FAERS | |
| 30 | Pancytopenia | FAERS: 16 | US FAERS | |
| 31 | Product use in unapproved indication | FAERS: 16 | US FAERS | |
| 32 | Sepsis | FAERS: 16 | SIDER US FAERS | |
| 33 | Weight decreased | FAERS: 16 | SIDER US FAERS | |
| 34 | Abdominal Pain | FAERS: 15 | SIDER US FAERS | |
| 35 | Blood triglycerides increased | FAERS: 15 | SIDER US FAERS | |
| 36 | Myocardial Infarction | FAERS: 15 | US FAERS | |
| 37 | Blood urea increased | FAERS: 14 | US FAERS | |
| 38 | Chest discomfort | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Blood lactate dehydrogenase increased | FAERS: 13 | US FAERS | |
| 40 | Diabetes Mellitus | FAERS: 13 | SIDER US FAERS | |
| 41 | Neutropenia | FAERS: 13 | 20430774 | CTD SIDER US FAERS |
| 42 | Pain | FAERS: 12 | SIDER US FAERS | |
| 43 | Pulmonary Fibrosis | FAERS: 12 | SIDER US FAERS | |
| 44 | Intestinal Perforation | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 45 | Proteinuria | FAERS: 11 | 19212144 | CTD US FAERS |
| 46 | Arthralgia | FAERS: 10 | SIDER US FAERS | |
| 47 | Blood cholesterol increased | FAERS: 10 | US FAERS | |
| 48 | Blood glucose increased | FAERS: 10 | SIDER US FAERS | |
| 49 | Ejection Fraction Decreased | FAERS: 10 | US FAERS | |
| 50 | Peritonitis | FAERS: 10 | OFFSIDES US FAERS | |
| 51 | Somnolence | FAERS: 10 | SIDER US FAERS | |
| 52 | Urinary tract infection | FAERS: 10 | SIDER US FAERS | |
| 53 | Angioedema | FAERS: 9 | SIDER US FAERS | |
| 54 | Chest Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Headache | FAERS: 9 | SIDER US FAERS | |
| 56 | Hypotension | FAERS: 9 | US FAERS | |
| 57 | Injection site extravasation | FAERS: 9 | US FAERS | |
| 58 | Mantle cell lymphoma | FAERS: 9 | US FAERS | |
| 59 | Pneumocystis jiroveci pneumonia | FAERS: 9 | US FAERS | |
| 60 | White blood cell count decreased | FAERS: 9 | SIDER US FAERS | |
| 61 | Angina Pectoris | FAERS: 8 | US FAERS | |
| 62 | Cerebral Infarction | FAERS: 8 | US FAERS | |
| 63 | Cerebrovascular accident | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Chills | FAERS: 8 | SIDER US FAERS | |
| 65 | Conjunctivitis | FAERS: 8 | SIDER US FAERS | |
| 66 | Dry skin | FAERS: 8 | SIDER US FAERS | |
| 67 | Infection | FAERS: 8 | SIDER US FAERS | |
| 68 | Renal cancer metastatic | FAERS: 8 | OFFSIDES US FAERS | |
| 69 | Septic Shock | FAERS: 8 | SIDER US FAERS | |
| 70 | Syncope | FAERS: 8 | US FAERS | |
| 71 | Tachycardia | FAERS: 8 | US FAERS | |
| 72 | Thrombosis | FAERS: 8 | US FAERS | |
| 73 | Urticaria | FAERS: 8 | US FAERS | |
| 74 | Drug toxicity | FAERS: 7 | OFFSIDES US FAERS | |
| 75 | Dysgeusia | FAERS: 7 | SIDER US FAERS | |
| 76 | Erythema Multiforme | FAERS: 7 | SIDER US FAERS | |
| 77 | Lip swelling | FAERS: 7 | US FAERS | |
| 78 | Malignant neoplasm progression | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Performance status decreased | FAERS: 7 | US FAERS | |
| 80 | Subileus | FAERS: 7 | OFFSIDES US FAERS | |
| 81 | Aphthous Stomatitis | FAERS: 6 | SIDER US FAERS | |
| 82 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 83 | Hypothyroidism | FAERS: 6 | US FAERS | |
| 84 | Infusion site swelling | FAERS: 6 | US FAERS | |
| 85 | Metabolic acidosis | FAERS: 6 | US FAERS | |
| 86 | Myalgia | FAERS: 6 | SIDER US FAERS | |
| 87 | Nasal discomfort | FAERS: 6 | US FAERS | |
| 88 | Pulmonary toxicity | FAERS: 6 | US FAERS | |
| 89 | Rash erythematous | FAERS: 6 | US FAERS | |
| 90 | Transaminases increased | FAERS: 6 | US FAERS | |
| 91 | Tumour haemorrhage | FAERS: 6 | US FAERS | |
| 92 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 93 | Acute respiratory failure | FAERS: 5 | OFFSIDES US FAERS | |
| 94 | Blood potassium decreased | FAERS: 5 | SIDER US FAERS | |
| 95 | Bradycardia | FAERS: 5 | US FAERS | |
| 96 | Bronchitis | FAERS: 5 | SIDER US FAERS | |
| 97 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 98 | Dermatitis acneiform | FAERS: 5 | US FAERS | |
| 99 | Dizziness | FAERS: 5 | SIDER US FAERS | |
| 100 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 101 | Hypophagia | FAERS: 5 | US FAERS | |
| 102 | Hypoxia | FAERS: 5 | OFFSIDES US FAERS | |
| 103 | Joint swelling | FAERS: 5 | US FAERS | |
| 104 | Leukopenia | FAERS: 5 | SIDER US FAERS | |
| 105 | Lymphocytosis | FAERS: 5 | US FAERS | |
| 106 | Neutrophil count decreased | FAERS: 5 | US FAERS | |
| 107 | Oral pain | FAERS: 5 | SIDER US FAERS | |
| 108 | Pericardial effusion | FAERS: 5 | SIDER US FAERS | |
| 109 | Pulmonary Embolism | FAERS: 5 | SIDER US FAERS | |
| 110 | Respiratory distress | FAERS: 5 | US FAERS | |
| 111 | Respiratory tract inflammation | FAERS: 5 | US FAERS | |
| 112 | Skin lesion | FAERS: 5 | US FAERS | |
| 113 | Tremor | FAERS: 5 | US FAERS | |
| 114 | Accidental overdose | FAERS: 4 | US FAERS | |
| 115 | Anorexia | FAERS: 4 | 20430774 | CTD SIDER US FAERS |
| 116 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 117 | Burning sensation | FAERS: 4 | US FAERS | |
| 118 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 119 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 120 | Discomfort | FAERS: 4 | US FAERS | |
| 121 | Dyspepsia | FAERS: 4 | US FAERS | |
| 122 | Epilepsy | FAERS: 4 | US FAERS | |
| 123 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 124 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 125 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 126 | Metastasis | FAERS: 4 | US FAERS | |
| 127 | Onychoclasis | FAERS: 4 | US FAERS | |
| 128 | Pancreatitis | FAERS: 4 | OFFSIDES US FAERS | |
| 129 | Product use issue | FAERS: 4 | US FAERS | |
| 130 | Stevens-Johnson Syndrome | FAERS: 4 Canada Vigilance: 1 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 131 | Swelling | FAERS: 4 | SIDER US FAERS | |
| 132 | Type III immune complex mediated reaction | FAERS: 4 | OFFSIDES US FAERS | |
| 133 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 134 | Acidosis | FAERS: 3 | US FAERS | |
| 135 | Acute prerenal failure | FAERS: 3 | US FAERS | |
| 136 | Alopecia | FAERS: 3 | US FAERS | |
| 137 | Arthritis | FAERS: 3 | US FAERS | |
| 138 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 139 | Bone pain | FAERS: 3 | US FAERS | |
| 140 | Cardiac enzymes increased | FAERS: 3 | US FAERS | |
| 141 | Cholecystitis | FAERS: 3 | OFFSIDES US FAERS | |
| 142 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 143 | Colitis | FAERS: 3 | OFFSIDES US FAERS | |
| 144 | Cyanosis | FAERS: 3 | OFFSIDES US FAERS | |
| 145 | Cyst | FAERS: 3 | OFFSIDES US FAERS | |
| 146 | Cytolytic hepatitis | FAERS: 3 | US FAERS | |
| 147 | Deafness | FAERS: 3 | US FAERS | |
| 148 | Deep Vein Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 149 | Fibrin D dimer increased | FAERS: 3 | US FAERS | |
| 150 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 151 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 152 | Hepatitis | FAERS: 3 | US FAERS | |
| 153 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 154 | Ileus | FAERS: 3 | US FAERS | |
| 155 | Infusion site erythema | FAERS: 3 | US FAERS | |
| 156 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 157 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 158 | Leukocytosis | FAERS: 3 | US FAERS | |
| 159 | Limb discomfort | FAERS: 3 | US FAERS | |
| 160 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 161 | Lung consolidation | FAERS: 3 | US FAERS | |
| 162 | Lymphangiosis carcinomatosa | FAERS: 3 | US FAERS | |
| 163 | Lymphocyte count decreased | FAERS: 3 | SIDER US FAERS | |
| 164 | Lymphocytic infiltration | FAERS: 3 | US FAERS | |
| 165 | Muscle tightness | FAERS: 3 | US FAERS | |
| 166 | Paraneoplastic Cerebellar Degeneration | FAERS: 3 | OFFSIDES US FAERS | |
| 167 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 168 | Polyuria | FAERS: 3 | US FAERS | |
| 169 | Pulmonary Infarction | FAERS: 3 | US FAERS | |
| 170 | Pyopneumothorax | FAERS: 3 | US FAERS | |
| 171 | Silent myocardial infarction | FAERS: 3 | US FAERS | |
| 172 | Skin reaction | FAERS: 3 | US FAERS | |
| 173 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 174 | Toothache | FAERS: 3 | US FAERS | |
| 175 | Ulcer | FAERS: 3 | US FAERS | |
| 176 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 177 | Urinary Retention | FAERS: 3 | US FAERS | |
| 178 | Varicocele | FAERS: 3 | US FAERS | |
| 179 | Vertigo | FAERS: 3 | US FAERS | |
| 180 | jaundice | FAERS: 3 | US FAERS | |
| 181 | treatment failure | FAERS: 3 | US FAERS | |
| 182 | Abasia | FAERS: 2 | OFFSIDES US FAERS | |
| 183 | Abdominal adhesions | FAERS: 2 | OFFSIDES US FAERS | |
| 184 | Accidental exposure | FAERS: 2 | US FAERS | |
| 185 | Acne | FAERS: 2 | SIDER US FAERS | |
| 186 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 187 | Ageusia | FAERS: 2 | SIDER US FAERS | |
| 188 | Alkalosis | FAERS: 2 | US FAERS | |
| 189 | Anal abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 190 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 191 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 192 | Anxiety | FAERS: 2 | SIDER US FAERS | |
| 193 | Asthma | FAERS: 2 | US FAERS | |
| 194 | Atelectasis | FAERS: 2 | US FAERS | |
| 195 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 196 | Blood cholesterol abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 197 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 198 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 199 | Blood urine present | FAERS: 2 | US FAERS | |
| 200 | Cachexia | FAERS: 2 | US FAERS | |
| 201 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 202 | Cell marker increased | FAERS: 2 | US FAERS | |
| 203 | Cellulitis | FAERS: 2 | SIDER US FAERS | |
| 204 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 205 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 206 | Constipation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 207 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 208 | Cytokine Release Syndrome | FAERS: 2 | US FAERS | |
| 209 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 210 | Delirium | FAERS: 2 | US FAERS | |
| 211 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 212 | Disease recurrence | FAERS: 2 | US FAERS | |
| 213 | Disorientation | FAERS: 2 | US FAERS | |
| 214 | Diverticulitis | FAERS: 2 | US FAERS | |
| 215 | Dysuria | FAERS: 2 | SIDER US FAERS | |
| 216 | Ear congestion | FAERS: 2 | US FAERS | |
| 217 | Eosinophilia | FAERS: 2 | US FAERS | |
| 218 | Escherichia test positive | FAERS: 2 | US FAERS | |
| 219 | Febrile Neutropenia | FAERS: 2 | SIDER US FAERS | |
| 220 | Flank Pain | FAERS: 2 | US FAERS | |
| 221 | Folliculitis | FAERS: 2 | SIDER US FAERS | |
| 222 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 223 | Gastrointestinal toxicity | FAERS: 2 | US FAERS | |
| 224 | Gout | FAERS: 2 | US FAERS | |
| 225 | Hemiparesis | FAERS: 2 | US FAERS | |
| 226 | Hepatic enzyme decreased | FAERS: 2 | US FAERS | |
| 227 | Hepatitis B | FAERS: 2 | OFFSIDES US FAERS | |
| 228 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 229 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 230 | Iatrogenic infection | FAERS: 2 | US FAERS | |
| 231 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 232 | Inflammation | FAERS: 2 | US FAERS | |
| 233 | Infusion site pain | FAERS: 2 | US FAERS | |
| 234 | Infusion site warmth | FAERS: 2 | US FAERS | |
| 235 | Injection site erythema | FAERS: 2 | US FAERS | |
| 236 | Laryngitis | FAERS: 2 | SIDER US FAERS | |
| 237 | Ligamentitis | FAERS: 2 | US FAERS | |
| 238 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 239 | Lymphangitis | FAERS: 2 | US FAERS | |
| 240 | Mastication disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 241 | Mastitis | FAERS: 2 | US FAERS | |
| 242 | Medication Error | FAERS: 2 | US FAERS | |
| 243 | Mental status changes | FAERS: 2 | US FAERS | |
| 244 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 245 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 246 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 247 | Onychomycosis | FAERS: 2 | US FAERS | |
| 248 | Osteolysis | FAERS: 2 | US FAERS | |
| 249 | Overdose | FAERS: 2 | US FAERS | |
| 250 | Productive Cough | FAERS: 2 | US FAERS | |
| 251 | Pulmonary Hypertension | FAERS: 2 | OFFSIDES US FAERS | |
| 252 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 253 | Pulmonary sepsis | FAERS: 2 | US FAERS | |
| 254 | Purpura | FAERS: 2 | US FAERS | |
| 255 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 256 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 257 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 258 | Rhabdomyolysis | FAERS: 2 | SIDER US FAERS | |
| 259 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 260 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 261 | Skin toxicity | FAERS: 2 | US FAERS | |
| 262 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 263 | Sudden death | FAERS: 2 | OFFSIDES US FAERS | |
| 264 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 265 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 266 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 267 | Throat irritation | FAERS: 2 | US FAERS | |
| 268 | Tinnitus | FAERS: 2 | US FAERS | |
| 269 | Tonsillitis | FAERS: 2 | US FAERS | |
| 270 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 271 | Tuberculosis | FAERS: 2 | US FAERS | |
| 272 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 273 | Visual Impairment | FAERS: 2 | US FAERS | |
| 274 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 275 | nervous system disorder | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 276 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 277 | Agitation | FAERS: 1 | US FAERS | |
| 278 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 279 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 280 | Ammonia increased | FAERS: 1 | US FAERS | |
| 281 | Amylase increased | FAERS: 1 | US FAERS | |
| 282 | Anal Fistula | FAERS: 1 | OFFSIDES US FAERS | |
| 283 | Anal inflammation | FAERS: 1 | US FAERS | |
| 284 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 285 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 286 | Anuria | FAERS: 1 | OFFSIDES US FAERS | |
| 287 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 288 | Apathy | FAERS: 1 | US FAERS | |
| 289 | Arterial fibrosis | FAERS: 1 | US FAERS | |
| 290 | Asphyxia | FAERS: 1 | US FAERS | |
| 291 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 292 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 293 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 294 | Bedridden | FAERS: 1 | US FAERS | |
| 295 | Blindness | FAERS: 1 | US FAERS | |
| 296 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 297 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 298 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 299 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 300 | Blood magnesium decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 301 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 302 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 303 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 304 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 305 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 306 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 307 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 308 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 309 | Bronchospasm | FAERS: 1 | US FAERS | |
| 310 | Cancer Pain | FAERS: 1 | US FAERS | |
| 311 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 312 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 313 | Cardiotoxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 314 | Cataract | FAERS: 1 | SIDER US FAERS | |
| 315 | Catheter related infection | FAERS: 1 | US FAERS | |
| 316 | Central nervous system lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 317 | Cheilitis | FAERS: 1 | US FAERS | |
| 318 | Chemical injury | FAERS: 1 | US FAERS | |
| 319 | Choking | FAERS: 1 | US FAERS | |
| 320 | Cholestasis | FAERS: 1 | US FAERS | |
| 321 | Chondrosis | FAERS: 1 | US FAERS | |
| 322 | Chylothorax | FAERS: 1 | US FAERS | |
| 323 | Clubbing | FAERS: 1 | US FAERS | |
| 324 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 325 | Colitis erosive | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 327 | Culture urine positive | FAERS: 1 | US FAERS | |
| 328 | Cytopenia | FAERS: 1 | US FAERS | |
| 329 | Device occlusion | FAERS: 1 | US FAERS | |
| 330 | Device related infection | FAERS: 1 | US FAERS | |
| 331 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 332 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 333 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 334 | Drug dose omission | FAERS: 1 | US FAERS | |
| 335 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 336 | Drug label confusion | FAERS: 1 | US FAERS | |
| 337 | Dysarthria | FAERS: 1 | US FAERS | |
| 338 | Dysphonia | FAERS: 1 | US FAERS | |
| 339 | Ear discomfort | FAERS: 1 | US FAERS | |
| 340 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 341 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 342 | Embolism | FAERS: 1 | US FAERS | |
| 343 | Enteritis | FAERS: 1 | US FAERS | |
| 344 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 345 | Enterocolitis | FAERS: 1 | US FAERS | |
| 346 | Epiglottitis | FAERS: 1 | US FAERS | |
| 347 | Erysipelas | FAERS: 1 | US FAERS | |
| 348 | Exfoliative rash | FAERS: 1 | SIDER US FAERS | |
| 349 | Eye irritation | FAERS: 1 | US FAERS | |
| 350 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 351 | Febrile bone marrow aplasia | FAERS: 1 | US FAERS | |
| 352 | Fluid overload | FAERS: 1 | US FAERS | |
| 353 | Gastric Antral Vascular Ectasia | FAERS: 1 | US FAERS | |
| 354 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 355 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 356 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 357 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 358 | Genital Herpes | FAERS: 1 | US FAERS | |
| 359 | Glaucoma | FAERS: 1 | US FAERS | |
| 360 | Glioblastoma | FAERS: 1 | 21267448 | CTD US FAERS |
| 361 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 362 | Hemiplegia | FAERS: 1 | US FAERS | |
| 363 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 364 | Hypocapnia | FAERS: 1 | US FAERS | |
| 365 | Hypokinesia | FAERS: 1 | US FAERS | |
| 366 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 367 | Influenza A virus test positive | FAERS: 1 | US FAERS | |
| 368 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 369 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 370 | Injection site warmth | FAERS: 1 | US FAERS | |
| 371 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 372 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 373 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 374 | Joint abscess | FAERS: 1 | US FAERS | |
| 375 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 376 | Lipase increased | FAERS: 1 | US FAERS | |
| 377 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 378 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 379 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 380 | Malignant ascites | FAERS: 1 | US FAERS | |
| 381 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 382 | Memory impairment | FAERS: 1 | US FAERS | |
| 383 | Meningitis herpes | FAERS: 1 | US FAERS | |
| 384 | Mental impairment | FAERS: 1 | US FAERS | |
| 385 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 386 | Mouth swelling | FAERS: 1 | US FAERS | |
| 387 | Mucosal Infection | FAERS: 1 | US FAERS | |
| 388 | Mumps | FAERS: 1 | US FAERS | |
| 389 | Muscle strain | FAERS: 1 | US FAERS | |
| 390 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 391 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 392 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 393 | Myoclonic Epilepsy | FAERS: 1 | OFFSIDES US FAERS | |
| 394 | Myopathy | FAERS: 1 | US FAERS | |
| 395 | Myositis | FAERS: 1 | US FAERS | |
| 396 | Neck Pain | FAERS: 1 | US FAERS | |
| 397 | Neisseria infection | FAERS: 1 | US FAERS | |
| 398 | Nephritis | FAERS: 1 | US FAERS | |
| 399 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 400 | Neuralgia | FAERS: 1 | US FAERS | |
| 401 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 402 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 403 | Night sweats | FAERS: 1 | US FAERS | |
| 404 | No adverse event | FAERS: 1 | US FAERS | |
| 405 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 406 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 407 | Oncologic complication | FAERS: 1 | US FAERS | |
| 408 | Onycholysis | FAERS: 1 | US FAERS | |
| 409 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 410 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 411 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 412 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 413 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 414 | Pain of skin | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 415 | Palpitations | FAERS: 1 | US FAERS | |
| 416 | Papule | FAERS: 1 | US FAERS | |
| 417 | Pathological fracture | FAERS: 1 | US FAERS | |
| 418 | Periodontitis | FAERS: 1 | US FAERS | |
| 419 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 420 | Perirectal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 421 | Petechiae | FAERS: 1 | SIDER US FAERS | |
| 422 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 423 | Pharyngeal lesion | FAERS: 1 | US FAERS | |
| 424 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 425 | Platelet aggregation abnormal | FAERS: 1 | US FAERS | |
| 426 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 427 | Pneumothorax | FAERS: 1 | US FAERS | |
| 428 | Polydipsia | FAERS: 1 | US FAERS | |
| 429 | Poriomania | FAERS: 1 | US FAERS | |
| 430 | Post-anoxic myoclonus | FAERS: 1 | US FAERS | |
| 431 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 432 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 433 | Product dispensing error | FAERS: 1 | US FAERS | |
| 434 | Product packaging issue | FAERS: 1 | US FAERS | |
| 435 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 436 | Product preparation issue | FAERS: 1 | US FAERS | |
| 437 | Product use complaint | FAERS: 1 | US FAERS | |
| 438 | Protein total decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 439 | Protein total increased | FAERS: 1 | US FAERS | |
| 440 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 441 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 442 | Purulence | FAERS: 1 | OFFSIDES US FAERS | |
| 443 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 444 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 445 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 446 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 447 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 448 | Serratia test positive | FAERS: 1 | US FAERS | |
| 449 | Shock | FAERS: 1 | US FAERS | |
| 450 | Sinus headache | FAERS: 1 | US FAERS | |
| 451 | Sinusitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 452 | Skin necrosis | FAERS: 1 | US FAERS | |
| 453 | Skin tightness | FAERS: 1 | US FAERS | |
| 454 | Spinal column injury | FAERS: 1 | US FAERS | |
| 455 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 456 | Splenomegaly | FAERS: 1 | US FAERS | |
| 457 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 458 | Sunburn | FAERS: 1 | US FAERS | |
| 459 | Superinfection | FAERS: 1 | US FAERS | |
| 460 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 461 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 462 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 463 | Troponin increased | FAERS: 1 | OFFSIDES US FAERS | |
| 464 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 465 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 466 | Vein collapse | FAERS: 1 | US FAERS | |
| 467 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 468 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 469 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 470 | Wound Complication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 471 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 472 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 473 | Abnormal vision | OFFSIDES | ||
| 474 | Abscess | SIDER | ||
| 475 | Activities of daily living impaired | OFFSIDES | ||
| 476 | Adrenal gland cancer metastatic | OFFSIDES | ||
| 477 | Alveolitis | SIDER | ||
| 478 | Anal Fissure | OFFSIDES | ||
| 479 | Anal candidiasis | SIDER | ||
| 480 | Anger | OFFSIDES | ||
| 481 | Anhedonia | OFFSIDES | ||
| 482 | Ataxia | OFFSIDES | ||
| 483 | Atrial thrombosis | OFFSIDES | ||
| 484 | Bacterial test positive | OFFSIDES | ||
| 485 | Base excess decreased | OFFSIDES | ||
| 486 | Bladder pain | SIDER | ||
| 487 | Bladder spasm | OFFSIDES | ||
| 488 | Blood Glucose | OFFSIDES | ||
| 489 | Blood and lymphatic system disorders | SIDER | ||
| 490 | Blood creatine phosphokinase MB increased | OFFSIDES | ||
| 491 | Blood phosphorus decreased | SIDER | ||
| 492 | Blood sodium | OFFSIDES | ||
| 493 | Blood testosterone decreased | OFFSIDES | ||
| 494 | Blood triglycerides | OFFSIDES | ||
| 495 | Bone density decreased | OFFSIDES | ||
| 496 | Brain Death | OFFSIDES | ||
| 497 | Bulbar palsy | OFFSIDES | ||
| 498 | Cardiac Tamponade | OFFSIDES | ||
| 499 | Cardiac function test abnormal | OFFSIDES | ||
| 500 | Cerebrospinal fistula | OFFSIDES | ||
| 501 | Cervicobrachial syndrome | SIDER | ||
| 502 | Creatinine increased | SIDER | ||
| 503 | Cystitis | SIDER | ||
| 504 | Dermatitis | SIDER | ||
| 505 | Diabetes | OFFSIDES | ||
| 506 | Diarrhea | 20430774 | CTD | |
| 507 | Drug withdrawal headache | OFFSIDES | ||
| 508 | Duodenal perforation | SIDER | ||
| 509 | Early satiety | OFFSIDES | ||
| 510 | Ecchymosis | SIDER | ||
| 511 | Eczema | SIDER | ||
| 512 | Electrocardiogram ST-T change | OFFSIDES | ||
| 513 | Empyema | OFFSIDES | ||
| 514 | Enterococcal sepsis | OFFSIDES | ||
| 515 | Eosinophilic Pneumonia | SIDER | ||
| 516 | Escherichia sepsis | OFFSIDES | ||
| 517 | Escherichia urinary tract infection | OFFSIDES | ||
| 518 | Exanthema | 20430774 | CTD | |
| 519 | Fever | 20430774 | CTD | |
| 520 | Fungal test positive | OFFSIDES | ||
| 521 | Gastrointestinal Pain | SIDER | ||
| 522 | General physical condition | OFFSIDES | ||
| 523 | Gingivitis | SIDER | ||
| 524 | Globulinuria | OFFSIDES | ||
| 525 | Glossitis | SIDER | ||
| 526 | Glucose increased | SIDER | ||
| 527 | Granulocytosis | OFFSIDES | ||
| 528 | Herpes simplex serology positive | OFFSIDES | ||
| 529 | Hypercapnia | OFFSIDES | ||
| 530 | Hyperglycemia | 20430774 | CTD | |
| 531 | Hypertriglyceridemia | 20430774 | CTD | |
| 532 | Hypophosphatemia | 20430774 | CTD | |
| 533 | Immunosuppression | OFFSIDES | ||
| 534 | Infestation | SIDER | ||
| 535 | Influenza | SIDER | ||
| 536 | Inspiratory capacity decreased | OFFSIDES | ||
| 537 | Intervertebral disc disorder | OFFSIDES | ||
| 538 | Intestinal ulcer perforation | OFFSIDES | ||
| 539 | Kidney Failure | OFFSIDES | ||
| 540 | Lacrimal structural disorder | SIDER | ||
| 541 | Left atrial dilatation | OFFSIDES | ||
| 542 | Liver Abscess | OFFSIDES | ||
| 543 | Loose tooth | OFFSIDES | ||
| 544 | Loss of proprioception | OFFSIDES | ||
| 545 | Lung Abscess | OFFSIDES | ||
| 546 | Lymphopenia | 16012795 | CTD SIDER | |
| 547 | Mesothelioma | 21358348 | CTD | |
| 548 | Necrosis | 20828385 | CTD | |
| 549 | Neoplasms, Experimental | CTD | ||
| 550 | Neoplasms | 17309148 | CTD | |
| 551 | Nephrectomy | OFFSIDES | ||
| 552 | Nephrotic Syndrome | OFFSIDES | ||
| 553 | Osteomyelitis | OFFSIDES | ||
| 554 | Perineal fistula | OFFSIDES | ||
| 555 | Periostitis | OFFSIDES | ||
| 556 | Periproctitis | OFFSIDES | ||
| 557 | Phosphorus low | SIDER | ||
| 558 | Potassium low | SIDER | ||
| 559 | Proctitis | OFFSIDES | ||
| 560 | Prostatic Neoplasms | 19706800 22532600 | CTD | |
| 561 | Prurigo | SIDER | ||
| 562 | Reflex Sympathetic Dystrophy | SIDER | ||
| 563 | Rhinitis | SIDER | ||
| 564 | Soft tissue necrosis | OFFSIDES | ||
| 565 | Thrombophlebitis | SIDER | ||
| 566 | Troponin I increased | OFFSIDES | ||
| 567 | Tuberous Sclerosis | 16845661 | CTD | |
| 568 | Venous Thromboembolism | SIDER | ||
| 569 | Venous Thrombosis | SIDER | ||
| 570 | Vertebroplasty | OFFSIDES | ||
| 571 | Vesiculobullous rash | SIDER | ||
| 572 | Wound Infection | SIDER | ||
| 573 | furuncle | OFFSIDES | ||
| 574 | melanoma | 17508024 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.