Pravastatin
(TUZYXOIXSAXUGO-PZAWKZKUSA-N)
Structure
- SMILES
- CC[C@@H](C(=O)O[C@H]1C[C@H](O)C=C2[C@H]1[C@@H](CC[C@H](C[C@H](CC(=O)O)O)O)[C@H](C=C2)C)C
- Type(s)
- Approved
- ATC code(s)
- C10AA03; C10BA03; C10BX02
- Molecular Formula:
- C23H36O7
- Molecular Weight:
- 424.528
- Log P:
- 2.4404
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 124.29
- CAS Number(s):
- 81093-37-0
Synonym(s)
1.
Pravastatin
2.
Eptastatin
3.
Apo-Pravastatin
4.
Bristacol
5.
CS-514
6.
Elisor
7.
Lin-Pravastatin
8.
Lipemol
9.
Liplat
10.
Lipostat
11.
Mevalotin
12.
Nu-Pravastatin
13.
Prareduct
14.
Pravachol
15.
Pravacol
16.
Pravasin
17.
Pravastatin Monosodium Salt, (6 beta)-Isomer
18.
Pravastatin Sodium
19.
Pravastatin Sodium Salt
20.
Pravastatin tert-Octylamine Salt
21.
Pravastatin, (6 beta)-Isomer
22.
RMS-431
23.
SQ-31,000
24.
SQ-31000
25.
Selektine
26.
Vasten
27.
Apo Pravastatin
28.
CS 514
29.
CS514
30.
Lin Pravastatin
31.
Nu Pravastatin
32.
Pravastatin tert Octylamine Salt
33.
RMS 431
34.
RMS431
35.
SQ 31,000
36.
SQ 31000
37.
SQ31,000
38.
SQ31000
39.
Sodium Salt, Pravastatin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myalgia | FAERS: 145 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 2 | Arthralgia | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 3 | Asthenia | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Rhabdomyolysis | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Fatigue | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 6 | Nausea | FAERS: 38 | OFFSIDES SIDER US FAERS | |
| 7 | Pain | FAERS: 34 Canada Vigilance: 1 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 8 | Dizziness | FAERS: 32 | SIDER US FAERS | |
| 9 | Drug ineffective | FAERS: 30 | US FAERS | |
| 10 | Product substitution issue | FAERS: 29 | US FAERS | |
| 11 | Pruritus | FAERS: 29 | SIDER US FAERS | |
| 12 | Headache | FAERS: 27 Canada Vigilance: 1 | 19167588 | CTD SIDER Canada Vigilance US FAERS |
| 13 | Malaise | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Blood creatine phosphokinase increased | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Amnesia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Feeling abnormal | FAERS: 18 | SIDER US FAERS | |
| 17 | Dyspepsia | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 18 | Hypersensitivity | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Vomiting | FAERS: 17 | SIDER US FAERS | |
| 20 | Back Pain | FAERS: 16 | US FAERS | |
| 21 | Chest Pain | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 22 | Palpitations | FAERS: 16 | US FAERS | |
| 23 | Urticaria | FAERS: 14 | SIDER US FAERS | |
| 24 | Alopecia | FAERS: 13 | 1644096 | CTD SIDER US FAERS |
| 25 | Memory impairment | FAERS: 13 | SIDER US FAERS | |
| 26 | Product quality issue | FAERS: 13 | US FAERS | |
| 27 | Adverse event | FAERS: 11 | US FAERS | |
| 28 | Chest discomfort | FAERS: 10 | US FAERS | |
| 29 | Myopathy | FAERS: 10 | SIDER US FAERS | |
| 30 | Blood cholesterol increased | FAERS: 9 | US FAERS | |
| 31 | Chromaturia | FAERS: 9 | OFFSIDES US FAERS | |
| 32 | Constipation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 34 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 35 | Joint swelling | FAERS: 8 | US FAERS | |
| 36 | Musculoskeletal stiffness | FAERS: 8 | US FAERS | |
| 37 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 38 | Weight decreased | FAERS: 8 | SIDER US FAERS | |
| 39 | Abdominal discomfort | FAERS: 7 | OFFSIDES US FAERS | |
| 40 | Alanine Aminotransferase Increased | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 41 | Dysphonia | FAERS: 7 | US FAERS | |
| 42 | Flatulence | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 43 | Lip swelling | FAERS: 7 | US FAERS | |
| 44 | Musculoskeletal Pain | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 45 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 46 | Product use issue | FAERS: 7 | US FAERS | |
| 47 | Abasia | FAERS: 6 | US FAERS | |
| 48 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 49 | Chills | FAERS: 6 | SIDER US FAERS | |
| 50 | Therapeutic response unexpected with drug substitution | FAERS: 6 | US FAERS | |
| 51 | Visual Impairment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 52 | Activities of daily living impaired | FAERS: 5 | OFFSIDES US FAERS | |
| 53 | Blood lactate dehydrogenase increased | FAERS: 5 | US FAERS | |
| 54 | Erythema | FAERS: 5 | US FAERS | |
| 55 | Lethargy | FAERS: 5 | US FAERS | |
| 56 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 57 | Polymyositis | FAERS: 5 | 15199734 | CTD US FAERS |
| 58 | Somnolence | FAERS: 5 | US FAERS | |
| 59 | Swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Acute kidney injury | FAERS: 4 | 20368269 20650967 | CTD US FAERS |
| 61 | Asthma | FAERS: 4 | OFFSIDES US FAERS | |
| 62 | Burning sensation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 63 | Discomfort | FAERS: 4 | SIDER US FAERS | |
| 64 | Dysgeusia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 65 | Impaired work ability | FAERS: 4 | US FAERS | |
| 66 | Nervousness | FAERS: 4 | SIDER US FAERS | |
| 67 | Pancreatitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 68 | Pneumonia | FAERS: 4 | US FAERS | |
| 69 | Product use complaint | FAERS: 4 | US FAERS | |
| 70 | Skin Ulcer | FAERS: 4 | 19323663 | CTD US FAERS |
| 71 | Tinnitus | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 72 | Tremor | FAERS: 4 | SIDER US FAERS | |
| 73 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 74 | muscle injury | FAERS: 4 | OFFSIDES US FAERS | |
| 75 | Anger | FAERS: 3 | US FAERS | |
| 76 | Angioedema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 77 | Ascites | FAERS: 3 | US FAERS | |
| 78 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 79 | Autoimmune hepatitis | FAERS: 3 | US FAERS | |
| 80 | Blood creatinine increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 81 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 82 | Blood urea increased | FAERS: 3 | US FAERS | |
| 83 | Choking | FAERS: 3 | US FAERS | |
| 84 | Dehydration | FAERS: 3 | US FAERS | |
| 85 | Disability | FAERS: 3 | US FAERS | |
| 86 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 87 | Ear discomfort | FAERS: 3 | US FAERS | |
| 88 | Emotional distress | FAERS: 3 | OFFSIDES US FAERS | |
| 89 | Erectile dysfunction | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 90 | Eye pain | FAERS: 3 | US FAERS | |
| 91 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 92 | Hypotension | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Intestinal Obstruction | FAERS: 3 | OFFSIDES US FAERS | |
| 94 | Joint stiffness | FAERS: 3 | US FAERS | |
| 95 | Low density lipoprotein increased | FAERS: 3 | US FAERS | |
| 96 | Muscle tightness | FAERS: 3 | US FAERS | |
| 97 | Myositis | FAERS: 3 | 7604176 12528328 | CTD US FAERS |
| 98 | Neck Pain | FAERS: 3 | US FAERS | |
| 99 | Ocular icterus | FAERS: 3 | US FAERS | |
| 100 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 101 | Product physical issue | FAERS: 3 | US FAERS | |
| 102 | Product size issue | FAERS: 3 | US FAERS | |
| 103 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 104 | Restlessness | FAERS: 3 | US FAERS | |
| 105 | Skin necrosis | FAERS: 3 | US FAERS | |
| 106 | Throat irritation | FAERS: 3 | US FAERS | |
| 107 | Transaminases increased | FAERS: 3 | SIDER US FAERS | |
| 108 | Transcription medication error | FAERS: 3 | US FAERS | |
| 109 | Unevaluable event | FAERS: 3 | US FAERS | |
| 110 | Vertigo | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 111 | Abdominal Pain | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 112 | Angina Pectoris | FAERS: 2 | SIDER US FAERS | |
| 113 | Anorexia | FAERS: 2 | SIDER US FAERS | |
| 114 | Anxiety | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 115 | Arthritis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 116 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 117 | Bone pain | FAERS: 2 | OFFSIDES US FAERS | |
| 118 | Cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 119 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 120 | Crying | FAERS: 2 | US FAERS | |
| 121 | Dementia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Diabetes Mellitus | FAERS: 2 | 16472047 | CTD US FAERS |
| 123 | Diplopia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 124 | Dysarthria | FAERS: 2 | 15596782 | CTD US FAERS |
| 125 | Epistaxis | FAERS: 2 | US FAERS | |
| 126 | Expired product administered | FAERS: 2 | US FAERS | |
| 127 | Extraocular Muscle Paresis | FAERS: 2 | US FAERS | |
| 128 | Flushing | FAERS: 2 | SIDER US FAERS | |
| 129 | Gait inability | FAERS: 2 | US FAERS | |
| 130 | Gamma-Glutamyltransferase Increased | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 131 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 132 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 133 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 134 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 135 | Inflammation | FAERS: 2 | US FAERS | |
| 136 | Limb discomfort | FAERS: 2 | US FAERS | |
| 137 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 138 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 139 | Mental status changes | FAERS: 2 | OFFSIDES US FAERS | |
| 140 | Middle insomnia | FAERS: 2 | US FAERS | |
| 141 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 142 | Musculoskeletal discomfort | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 143 | Nerve injury | FAERS: 2 | US FAERS | |
| 144 | Nocturia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 145 | Polyarthritis | FAERS: 2 | US FAERS | |
| 146 | Product contamination | FAERS: 2 | US FAERS | |
| 147 | Product packaging issue | FAERS: 2 | US FAERS | |
| 148 | Purpura Fulminans | FAERS: 2 | US FAERS | |
| 149 | Purpura | FAERS: 2 | SIDER US FAERS | |
| 150 | Rash erythematous | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 152 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 153 | Rheumatoid Arthritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Sinusitis | FAERS: 2 | 19167588 | CTD OFFSIDES SIDER US FAERS |
| 155 | Stomatitis | FAERS: 2 | US FAERS | |
| 156 | Therapy change | FAERS: 2 | US FAERS | |
| 157 | Ubiquinone decreased | FAERS: 2 | US FAERS | |
| 158 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 159 | Vulvovaginal mycotic infection | FAERS: 2 | OFFSIDES US FAERS | |
| 160 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 161 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 162 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 163 | Accidental overdose | FAERS: 1 | US FAERS | |
| 164 | Acidosis | FAERS: 1 | US FAERS | |
| 165 | Acne | FAERS: 1 | US FAERS | |
| 166 | Agitation | FAERS: 1 | US FAERS | |
| 167 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 168 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 169 | Anosmia | FAERS: 1 | US FAERS | |
| 170 | Antinuclear antibody increased | FAERS: 1 | OFFSIDES US FAERS | |
| 171 | Aphasia | FAERS: 1 | US FAERS | |
| 172 | Apparent death | FAERS: 1 | US FAERS | |
| 173 | Arthropod bite | FAERS: 1 | US FAERS | |
| 174 | Aspiration pleural cavity abnormal | FAERS: 1 | US FAERS | |
| 175 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 176 | Bedridden | FAERS: 1 | US FAERS | |
| 177 | Bladder pain | FAERS: 1 | US FAERS | |
| 178 | Blindness | FAERS: 1 | US FAERS | |
| 179 | Blood blister | FAERS: 1 | US FAERS | |
| 180 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 181 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 182 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 183 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 184 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 185 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 186 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 187 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 188 | Breast tenderness | FAERS: 1 | US FAERS | |
| 189 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 190 | Cardiac Death | FAERS: 1 | US FAERS | |
| 191 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 192 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 193 | Cold sweat | FAERS: 1 | US FAERS | |
| 194 | Colitis | FAERS: 1 | US FAERS | |
| 195 | Congenital choroid plexus cyst | FAERS: 1 | US FAERS | |
| 196 | Coronary angioplasty | FAERS: 1 | OFFSIDES US FAERS | |
| 197 | Cyanopsia | FAERS: 1 | US FAERS | |
| 198 | Cystitis | FAERS: 1 | US FAERS | |
| 199 | Cyst | FAERS: 1 | US FAERS | |
| 200 | Dawn phenomenon | FAERS: 1 | US FAERS | |
| 201 | Demyelination | FAERS: 1 | US FAERS | |
| 202 | Depressed Level of Consciousness | FAERS: 1 | OFFSIDES US FAERS | |
| 203 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 204 | Dermatomyositis | FAERS: 1 | 1640970 16154665 | CTD SIDER US FAERS |
| 205 | Diplegia | FAERS: 1 | US FAERS | |
| 206 | Disorientation | FAERS: 1 | US FAERS | |
| 207 | Dissociation | FAERS: 1 | US FAERS | |
| 208 | Diverticulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 209 | Diverticulum | FAERS: 1 | US FAERS | |
| 210 | Drug dose omission | FAERS: 1 | US FAERS | |
| 211 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 212 | Dry skin | FAERS: 1 | SIDER US FAERS | |
| 213 | Dysgraphia | FAERS: 1 | US FAERS | |
| 214 | Dysuria | FAERS: 1 | SIDER US FAERS | |
| 215 | Ecchymosis | FAERS: 1 | US FAERS | |
| 216 | Economic problem | FAERS: 1 | US FAERS | |
| 217 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 218 | Eosinophilic Fasciitis | FAERS: 1 | US FAERS | |
| 219 | Epilepsy | FAERS: 1 | US FAERS | |
| 220 | Eructation | FAERS: 1 | US FAERS | |
| 221 | Eye allergy | FAERS: 1 | US FAERS | |
| 222 | Eye irritation | FAERS: 1 | US FAERS | |
| 223 | Feeling jittery | FAERS: 1 | US FAERS | |
| 224 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 225 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 226 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 227 | Gastric ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 228 | Gastrostomy | FAERS: 1 | US FAERS | |
| 229 | Gene Mutation | FAERS: 1 | US FAERS | |
| 230 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 231 | Hemiplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 232 | Hepatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 233 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 234 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 235 | Hunger | FAERS: 1 | US FAERS | |
| 236 | Hypersomnia | FAERS: 1 | US FAERS | |
| 237 | Hypoxia | FAERS: 1 | US FAERS | |
| 238 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 239 | Influenza | FAERS: 1 | SIDER US FAERS | |
| 240 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 241 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 242 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 243 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 244 | Joint injury | FAERS: 1 | OFFSIDES US FAERS | |
| 245 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 246 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 247 | Lymphocyte percentage increased | FAERS: 1 | US FAERS | |
| 248 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 249 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 250 | Medication Error | FAERS: 1 | US FAERS | |
| 251 | Mental impairment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Mononeuropathy Multiplex | FAERS: 1 | US FAERS | |
| 253 | Muscle Cramp | FAERS: 1 | 23858814 | CTD US FAERS |
| 254 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 255 | Myasthenia Gravis | FAERS: 1 | 16609346 | CTD US FAERS |
| 256 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 257 | Nasopharyngitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 258 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 259 | Neutropenia | FAERS: 1 | US FAERS | |
| 260 | Neutrophil percentage decreased | FAERS: 1 | US FAERS | |
| 261 | Night sweats | FAERS: 1 | US FAERS | |
| 262 | No adverse event | FAERS: 1 | US FAERS | |
| 263 | Onychomycosis | FAERS: 1 | US FAERS | |
| 264 | Oral mucosal exfoliation | FAERS: 1 | OFFSIDES US FAERS | |
| 265 | Oral pain | FAERS: 1 | US FAERS | |
| 266 | Panic Disorder | FAERS: 1 | US FAERS | |
| 267 | Papule | FAERS: 1 | US FAERS | |
| 268 | Parasite stool test positive | FAERS: 1 | US FAERS | |
| 269 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 270 | Pharyngolaryngeal Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 271 | Piloerection | FAERS: 1 | US FAERS | |
| 272 | Polymyalgia Rheumatica | FAERS: 1 | 10084510 | CTD SIDER US FAERS |
| 273 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 274 | Presyncope | FAERS: 1 | US FAERS | |
| 275 | Product coating issue | FAERS: 1 | US FAERS | |
| 276 | Product commingling | FAERS: 1 | US FAERS | |
| 277 | Product counterfeit | FAERS: 1 | US FAERS | |
| 278 | Product label issue | FAERS: 1 | US FAERS | |
| 279 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 280 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 281 | Psoriasis | FAERS: 1 | US FAERS | |
| 282 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 283 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 284 | Rash papulosquamous | FAERS: 1 | US FAERS | |
| 285 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 286 | Renal pain | FAERS: 1 | US FAERS | |
| 287 | Retching | FAERS: 1 | US FAERS | |
| 288 | Skin discomfort | FAERS: 1 | US FAERS | |
| 289 | Skin nodule | FAERS: 1 | US FAERS | |
| 290 | Sluggishness | FAERS: 1 | US FAERS | |
| 291 | Suicide attempt | FAERS: 1 | US FAERS | |
| 292 | Tachycardia | FAERS: 1 | US FAERS | |
| 293 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 294 | Tetany | FAERS: 1 | US FAERS | |
| 295 | Therapeutic product effect increased | FAERS: 1 | US FAERS | |
| 296 | Thirst | FAERS: 1 | US FAERS | |
| 297 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 298 | Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 299 | Urinary Retention | FAERS: 1 | US FAERS | |
| 300 | Urinary tract infection | FAERS: 1 | SIDER US FAERS | |
| 301 | Urine output increased | FAERS: 1 | US FAERS | |
| 302 | Vasculitis | FAERS: 1 | SIDER US FAERS | |
| 303 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 304 | Wheelchair user | FAERS: 1 | US FAERS | |
| 305 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 306 | jaundice | FAERS: 1 | 10235223 | CTD SIDER US FAERS |
| 307 | treatment failure | FAERS: 1 | US FAERS | |
| 308 | Ache | SIDER | ||
| 309 | Acid reflux | OFFSIDES | ||
| 310 | Activated partial thromboplastin time shortened | OFFSIDES | ||
| 311 | Acute Coronary Syndrome | SIDER | ||
| 312 | Acute myocardial infarction | OFFSIDES | ||
| 313 | Adenoma | 10813127 | CTD | |
| 314 | Anaphylactic shock | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 315 | Angiolipoma | OFFSIDES | ||
| 316 | Angioplasty | OFFSIDES | ||
| 317 | Ankylosing spondylitis | OFFSIDES | ||
| 318 | Antimicrobial susceptibility test resistant | OFFSIDES | ||
| 319 | Appendectomy | OFFSIDES | ||
| 320 | Appendicitis | OFFSIDES | ||
| 321 | Arterial therapeutic procedure | OFFSIDES | ||
| 322 | Arteriosclerosis Obliterans | OFFSIDES | ||
| 323 | Arteriosclerosis | OFFSIDES | ||
| 324 | Arteriovenous fistula | OFFSIDES | ||
| 325 | Arteriovenous graft thrombosis | OFFSIDES | ||
| 326 | Ataxia | Canada Vigilance: 1 | Canada Vigilance | |
| 327 | Atherosclerosis | 7586340 19330073 26950217 | CTD | |
| 328 | Atrial tachycardia | OFFSIDES | ||
| 329 | Atrophic vulvovaginitis | OFFSIDES | ||
| 330 | Automatism | OFFSIDES | ||
| 331 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 332 | Bladder discomfort | OFFSIDES | ||
| 333 | Blepharitis | OFFSIDES | ||
| 334 | Blood Glucose | OFFSIDES | ||
| 335 | Blood alkaline phosphatase increased | OFFSIDES SIDER | ||
| 336 | Blood cholesterol | OFFSIDES | ||
| 337 | Blood creatine phosphokinase MB | OFFSIDES | ||
| 338 | Blood fibrinogen increased | OFFSIDES | ||
| 339 | Blood glucose fluctuation | OFFSIDES | ||
| 340 | Blood magnesium decreased | OFFSIDES | ||
| 341 | Blood urine present | OFFSIDES | ||
| 342 | Blurred vision | OFFSIDES | ||
| 343 | Body fat disorder | OFFSIDES | ||
| 344 | Bone Sarcoma | OFFSIDES | ||
| 345 | Bone erosion | OFFSIDES | ||
| 346 | Bone fragmentation | OFFSIDES | ||
| 347 | Borderline glaucoma | OFFSIDES | ||
| 348 | Bradycardia | OFFSIDES | ||
| 349 | Brain Concussion | OFFSIDES | ||
| 350 | Breast Feeding | SIDER | ||
| 351 | Bronchopneumonia | OFFSIDES | ||
| 352 | Bursitis | OFFSIDES | ||
| 353 | Cardiac pain | SIDER | ||
| 354 | Cardiomegaly | 17170375 | CTD | |
| 355 | Cardiovascular Diseases | 11770708 | CTD | |
| 356 | Cataract operation | OFFSIDES | ||
| 357 | Cataract | OFFSIDES SIDER | ||
| 358 | Causalgia | OFFSIDES | ||
| 359 | Cerebrovascular Disorders | 12409635 | CTD | |
| 360 | Cerebrovascular accident prophylaxis | OFFSIDES | ||
| 361 | Chemical and Drug Induced Liver Injury | 1520752 | CTD | |
| 362 | Cholestasis | 10235223 12064992 | CTD | |
| 363 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 364 | Chronic ulcerative colitis | OFFSIDES | ||
| 365 | Colectomy | OFFSIDES | ||
| 366 | Common Cold | SIDER | ||
| 367 | Completed Suicide | Canada Vigilance: 1 | Canada Vigilance | |
| 368 | Concomitant disease progression | OFFSIDES | ||
| 369 | Confabulation | OFFSIDES | ||
| 370 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 371 | Conjunctival deposit | OFFSIDES | ||
| 372 | Coronary Artery Disease | CTD | ||
| 373 | Craniotomy | OFFSIDES | ||
| 374 | Creatine Phosphokinase Increased | SIDER | ||
| 375 | Creatinine renal clearance increased | OFFSIDES | ||
| 376 | Cyanosis | OFFSIDES | ||
| 377 | Cytomegalovirus enterocolitis | OFFSIDES | ||
| 378 | Deafness Neurosensory | OFFSIDES | ||
| 379 | Deafness | SIDER | ||
| 380 | Debridement | OFFSIDES | ||
| 381 | Deep Vein Thrombosis | Canada Vigilance: 1 | Canada Vigilance | |
| 382 | Deja Vu | OFFSIDES | ||
| 383 | Dental abscess | OFFSIDES | ||
| 384 | Dental caries | OFFSIDES | ||
| 385 | Depressive disorder | 1357315 | CTD | |
| 386 | Device Failure | OFFSIDES | ||
| 387 | Device leakage | OFFSIDES | ||
| 388 | Diabetes | OFFSIDES | ||
| 389 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 390 | Diabetic Nephropathy | OFFSIDES | ||
| 391 | Diabetic Retinopathy | OFFSIDES | ||
| 392 | Diarrhea | OFFSIDES | ||
| 393 | Diastolic dysfunction | OFFSIDES | ||
| 394 | Disease recurrence | OFFSIDES | ||
| 395 | Distention | SIDER | ||
| 396 | Diverticular perforation | OFFSIDES | ||
| 397 | Drug Eruptions | 19323663 | CTD | |
| 398 | Drug administration error | OFFSIDES | ||
| 399 | Drug withdrawal maintenance therapy | OFFSIDES | ||
| 400 | Dyslipidemias | 19167588 | CTD | |
| 401 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 402 | Electrocardiogram ST-T change | OFFSIDES | ||
| 403 | Endarterectomy | OFFSIDES | ||
| 404 | Endodontic procedure | OFFSIDES | ||
| 405 | Endophthalmitis | SIDER | ||
| 406 | Enteritis | OFFSIDES | ||
| 407 | Enterobacter pneumonia | OFFSIDES | ||
| 408 | Enterococcal infection | OFFSIDES | ||
| 409 | Eosinophilia | SIDER | ||
| 410 | Erosive gastritis | OFFSIDES | ||
| 411 | Erythema Multiforme | SIDER | ||
| 412 | Eschar | OFFSIDES | ||
| 413 | Escherichia infection | OFFSIDES | ||
| 414 | Eye laser surgery | OFFSIDES | ||
| 415 | Facial Neuralgia | OFFSIDES | ||
| 416 | Facial Paresis | SIDER | ||
| 417 | Femoral arterial stenosis | OFFSIDES | ||
| 418 | Fibrosis | 17170375 | CTD | |
| 419 | Gastroduodenitis | OFFSIDES | ||
| 420 | Gastroenteritis | OFFSIDES | ||
| 421 | Gastrointestinal perforation | OFFSIDES | ||
| 422 | Gingival erythema | OFFSIDES | ||
| 423 | Glioblastoma | OFFSIDES | ||
| 424 | Gout | OFFSIDES | ||
| 425 | Granulocytosis | OFFSIDES | ||
| 426 | Granuloma | OFFSIDES | ||
| 427 | Guillain-Barre Syndrome | 15389662 | CTD | |
| 428 | HBV-DNA polymerase increased | OFFSIDES | ||
| 429 | Heart Diseases | 18483861 | CTD | |
| 430 | Heartburn | SIDER | ||
| 431 | Hepatic necrosis | SIDER | ||
| 432 | Hepatitis B | OFFSIDES | ||
| 433 | Hernia | OFFSIDES | ||
| 434 | Hypercholesterolemia |
1682723
2492189 7909021 8172444 8238075 8593127 10027656 10751747 11189483 11770708 12409635 15199031 16029366 17188708 26875785 | CTD | |
| 435 | Hypersensitive syndrome | SIDER | ||
| 436 | Hypertensive emergency | OFFSIDES | ||
| 437 | Hypertensive heart disease | OFFSIDES | ||
| 438 | Hypertriglyceridemia | 10751747 | CTD | |
| 439 | Hypesthesia | 10027656 | CTD | |
| 440 | Hypoalphalipoproteinemias | 8238075 | CTD | |
| 441 | Hypothalamo-pituitary disorder | OFFSIDES | ||
| 442 | Iliac artery stenosis | OFFSIDES | ||
| 443 | Infection | SIDER | ||
| 444 | Injection site pruritus | OFFSIDES | ||
| 445 | Joint abscess | OFFSIDES | ||
| 446 | Kidney Failure | OFFSIDES | ||
| 447 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 448 | Leukopenia | SIDER | ||
| 449 | Limb operation | OFFSIDES | ||
| 450 | Lumbar radiculopathy | OFFSIDES | ||
| 451 | Lupus Erythematosus | SIDER | ||
| 452 | Lupus-like syndrome | OFFSIDES | ||
| 453 | Lymphocytic infiltration | OFFSIDES | ||
| 454 | Malocclusion | OFFSIDES | ||
| 455 | Medication residue | OFFSIDES | ||
| 456 | Memory Loss | SIDER | ||
| 457 | Metabolic acidosis | OFFSIDES | ||
| 458 | Metastatic Neoplasm | OFFSIDES | ||
| 459 | Mononeuropathies | 17133326 | CTD | |
| 460 | Mood swings | SIDER | ||
| 461 | Mouth Breathing | OFFSIDES | ||
| 462 | Multiple Myeloma | OFFSIDES | ||
| 463 | Multiple sclerosis relapse | OFFSIDES | ||
| 464 | Muscle necrosis | OFFSIDES | ||
| 465 | Musculoskeletal Diseases | 19167588 | CTD | |
| 466 | Myelofibrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 467 | Myocardial Infarction | 7586340 8647574 17188708 | CTD SIDER | |
| 468 | Myoclonus | 11160978 | CTD | |
| 469 | Myoglobin urine present | SIDER | ||
| 470 | Myoglobinuria | SIDER | ||
| 471 | Myotonia | 10367184 | CTD | |
| 472 | Neuromyelitis Optica | OFFSIDES | ||
| 473 | Neuropathy | SIDER | ||
| 474 | Nodule | SIDER | ||
| 475 | Numbness | SIDER | ||
| 476 | Oliguria | OFFSIDES | ||
| 477 | Ophthalmoplegia | SIDER | ||
| 478 | Optic Neuritis | OFFSIDES | ||
| 479 | Optic Neuropathy | OFFSIDES | ||
| 480 | Oropharyngeal blistering | OFFSIDES | ||
| 481 | Osteitis Deformans | OFFSIDES | ||
| 482 | Osteolysis | OFFSIDES | ||
| 483 | Osteomyelitis | OFFSIDES | ||
| 484 | Osteopenia | OFFSIDES | ||
| 485 | Osteoporosis | OFFSIDES | ||
| 486 | PROTHROMBIN TIME | OFFSIDES | ||
| 487 | Panophthalmitis | SIDER | ||
| 488 | Paresthesia | 8172444 10027656 12639733 | CTD | |
| 489 | Perianal abscess | OFFSIDES | ||
| 490 | Periarthritis | OFFSIDES | ||
| 491 | Periodontitis | OFFSIDES | ||
| 492 | Peripheral Nervous System Diseases | 9671841 10027656 12639733 | CTD | |
| 493 | Peripheral arterial occlusive disease | OFFSIDES | ||
| 494 | Peripheral nerve palsy | SIDER | ||
| 495 | Pharmacokinetic interaction | SIDER | ||
| 496 | Pharyngitis | SIDER | ||
| 497 | Phlebitis | OFFSIDES | ||
| 498 | Polymyalgia | SIDER | ||
| 499 | Polyuria | Canada Vigilance: 1 | Canada Vigilance | |
| 500 | Poor dental condition | OFFSIDES | ||
| 501 | Poor quality sleep | Canada Vigilance: 1 | Canada Vigilance | |
| 502 | Porphyria Cutanea Tarda | 7631993 9801704 | CTD | |
| 503 | Post procedural cellulitis | OFFSIDES | ||
| 504 | Postoperative wound complication | OFFSIDES | ||
| 505 | Prescribed overdose | OFFSIDES | ||
| 506 | Proteinuria | 12105140 | CTD | |
| 507 | Psoas Abscess | OFFSIDES | ||
| 508 | Rales | OFFSIDES | ||
| 509 | Renal Artery Stenosis | OFFSIDES | ||
| 510 | Respiratory Tract Infections | 19167588 | CTD | |
| 511 | Retinal Artery Occlusion | OFFSIDES | ||
| 512 | Retinal Vascular Disorder | OFFSIDES | ||
| 513 | Rheumatoid Nodule | OFFSIDES | ||
| 514 | Rhinitis | SIDER | ||
| 515 | Salivary gland adenoma | OFFSIDES | ||
| 516 | Scab | OFFSIDES | ||
| 517 | Scan bone marrow abnormal | OFFSIDES | ||
| 518 | Scleroderma | OFFSIDES | ||
| 519 | Scotoma | OFFSIDES | ||
| 520 | Sexual Dysfunction | SIDER | ||
| 521 | Shunt malfunction | OFFSIDES | ||
| 522 | Sinus bradycardia | OFFSIDES | ||
| 523 | Sinus headache | OFFSIDES | ||
| 524 | Small intestine carcinoma | OFFSIDES | ||
| 525 | Snoring | OFFSIDES | ||
| 526 | Stevens-Johnson Syndrome | 25811541 | CTD SIDER | |
| 527 | Subcutaneous nodule | OFFSIDES | ||
| 528 | Sudden Cardiac Death | OFFSIDES | ||
| 529 | Tension | SIDER | ||
| 530 | Thrombocytopenia | SIDER | ||
| 531 | Tooth Extraction | OFFSIDES | ||
| 532 | Tooth Loss | OFFSIDES | ||
| 533 | Toxic Epidermal Necrolysis | SIDER | ||
| 534 | Tracheobronchitis | SIDER | ||
| 535 | Transferrin decreased | OFFSIDES | ||
| 536 | Transferrin saturation increased | OFFSIDES | ||
| 537 | Trauma | SIDER | ||
| 538 | Troponin T | OFFSIDES | ||
| 539 | Troponin increased | OFFSIDES | ||
| 540 | Umbilical hernia | OFFSIDES | ||
| 541 | Underweight | OFFSIDES | ||
| 542 | VIIth nerve paralysis | SIDER | ||
| 543 | Vascular purpura | SIDER | ||
| 544 | Ventricular Fibrillation | OFFSIDES | ||
| 545 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 546 | Vitreous Detachment | OFFSIDES | ||
| 547 | Vulvovaginal pain | OFFSIDES | ||
| 548 | Vulvovaginal pruritus | OFFSIDES | ||
| 549 | Wound infection bacterial | OFFSIDES | ||
| 550 | Wound infection staphylococcal | OFFSIDES | ||
| 551 | Wound sepsis | OFFSIDES | ||
| 552 | Zinc deficiency | OFFSIDES | ||
| 553 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.