dolutegravir
(RHWKPHLQXYSBKR-BMIGLBTASA-N)
Structure
- SMILES
- Fc1ccc(c(c1)F)CNC(=O)c1cn2C[C@@H]3OCC[C@H](N3C(=O)c2c(c1=O)O)C
- Type(s)
- Approved
- ATC code(s)
- J05AR13; J05AR21; J05AX12
- Molecular Formula:
- C20H19F2N3O5
- Molecular Weight:
- 419.379
- Log P:
- 1.6816
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 100.87
- CAS Number(s):
- 1051375-16-6
Synonym(s)
1.
dolutegravir
2.
(4R,9aS)-5-hydroxy-2-methyl-6,10-dioxo-3,4,6,9,9a,10-hexahydro-2H-1-oxa-4a,8a-diaza-anthracene-7-carboxylic acid- 2,4 difluorobenzylamide
3.
GSK 1349572A
4.
GSK-1349572
5.
GSK1349572A
6.
S-GSK1349572
7.
Tivicay
8.
dolutegravir sodium
9.
dolutegravir sodium monohydrate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Virologic failure | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Headache | FAERS: 27 | SIDER US FAERS | |
| 3 | Drug dose omission | FAERS: 25 | US FAERS | |
| 4 | Drug resistance | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Fatigue | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Malaise | FAERS: 19 | US FAERS | |
| 7 | Myalgia | FAERS: 19 | US FAERS | |
| 8 | Product dose omission | FAERS: 18 | US FAERS | |
| 9 | Viral mutation identified | FAERS: 16 | US FAERS | |
| 10 | Dizziness | FAERS: 15 | SIDER US FAERS | |
| 11 | Nausea | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Pneumonia | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Arthralgia | FAERS: 12 | US FAERS | |
| 14 | Umbilical hernia | FAERS: 12 | US FAERS | |
| 15 | Birth mark | FAERS: 9 | US FAERS | |
| 16 | Hypersensitivity | FAERS: 9 | SIDER US FAERS | |
| 17 | Immune Reconstitution Inflammatory Syndrome | FAERS: 9 | US FAERS | |
| 18 | Abdominal discomfort | FAERS: 8 | SIDER US FAERS | |
| 19 | Asthenia | FAERS: 8 | SIDER US FAERS | |
| 20 | Blood creatinine increased | FAERS: 8 | SIDER US FAERS | |
| 21 | Drug ineffective | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Hepatotoxicity | FAERS: 8 | US FAERS | |
| 23 | Anxiety | FAERS: 7 | US FAERS | |
| 24 | Therapy cessation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Blood creatine phosphokinase increased | FAERS: 6 | US FAERS | |
| 26 | Live Birth | FAERS: 6 | US FAERS | |
| 27 | Lymphoma | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 29 | Viral load increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Vomiting | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 31 | Agitation | FAERS: 5 | US FAERS | |
| 32 | Cholestasis | FAERS: 5 | US FAERS | |
| 33 | Economic problem | FAERS: 5 | US FAERS | |
| 34 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 35 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 36 | Pruritus | FAERS: 5 | SIDER US FAERS | |
| 37 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 38 | nervous system disorder | FAERS: 5 | SIDER US FAERS | |
| 39 | Abdominal Pain | FAERS: 4 | SIDER US FAERS | |
| 40 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 41 | Bipolar Disorder | FAERS: 4 | US FAERS | |
| 42 | Blood HIV RNA increased | FAERS: 4 | US FAERS | |
| 43 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 44 | Completed Suicide | FAERS: 4 | US FAERS | |
| 45 | Cystic Fibrosis | FAERS: 4 | US FAERS | |
| 46 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 47 | Insurance issue | FAERS: 4 | US FAERS | |
| 48 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 49 | Myocarditis | FAERS: 4 | US FAERS | |
| 50 | Pain | FAERS: 4 | US FAERS | |
| 51 | Pancreatitis | FAERS: 4 | US FAERS | |
| 52 | Pathogen resistance | FAERS: 4 | US FAERS | |
| 53 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 54 | Tuberculosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Urticaria | FAERS: 4 | US FAERS | |
| 56 | Acquired gene mutation | FAERS: 3 | US FAERS | |
| 57 | Angioedema | FAERS: 3 | US FAERS | |
| 58 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 59 | Bronchiolitis | FAERS: 3 | US FAERS | |
| 60 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 61 | Congenital cystic kidney disease | FAERS: 3 | US FAERS | |
| 62 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 63 | Disease Progression | FAERS: 3 | US FAERS | |
| 64 | Disease complication | FAERS: 3 | US FAERS | |
| 65 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 66 | Gastrectomy | FAERS: 3 | US FAERS | |
| 67 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 68 | Neutropenia | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 69 | No adverse event | FAERS: 3 | US FAERS | |
| 70 | Product storage error | FAERS: 3 | US FAERS | |
| 71 | Product use issue | FAERS: 3 | US FAERS | |
| 72 | Renal dysplasia | FAERS: 3 | US FAERS | |
| 73 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 74 | Sepsis | FAERS: 3 | US FAERS | |
| 75 | Stillbirth | FAERS: 3 | US FAERS | |
| 76 | Tinnitus | FAERS: 3 | US FAERS | |
| 77 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 78 | jaundice | FAERS: 3 | US FAERS | |
| 79 | Acne | FAERS: 2 | US FAERS | |
| 80 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 81 | Adverse event | FAERS: 2 | US FAERS | |
| 82 | Amnesia | FAERS: 2 | US FAERS | |
| 83 | Arthropathy | FAERS: 2 | US FAERS | |
| 84 | Ascites | FAERS: 2 | US FAERS | |
| 85 | Back Pain | FAERS: 2 | US FAERS | |
| 86 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 87 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 88 | Bone pain | FAERS: 2 | US FAERS | |
| 89 | Bradycardia | FAERS: 2 | US FAERS | |
| 90 | CD4 Lymphocytes Decreased | FAERS: 2 | US FAERS | |
| 91 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 92 | Chills | FAERS: 2 | US FAERS | |
| 93 | Congenital renal cyst | FAERS: 2 | US FAERS | |
| 94 | Congenital skin dimples | FAERS: 2 | US FAERS | |
| 95 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 96 | Delirium | FAERS: 2 | US FAERS | |
| 97 | Depressed mood | FAERS: 2 | US FAERS | |
| 98 | Disorientation | FAERS: 2 | US FAERS | |
| 99 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 100 | Drug screen negative | FAERS: 2 | US FAERS | |
| 101 | Eczema | FAERS: 2 | US FAERS | |
| 102 | Encephalitis | FAERS: 2 | US FAERS | |
| 103 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 104 | Eosinophilia | FAERS: 2 | US FAERS | |
| 105 | Epilepsy | FAERS: 2 | US FAERS | |
| 106 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 107 | Erythema | FAERS: 2 | US FAERS | |
| 108 | False negative investigation result | FAERS: 2 | US FAERS | |
| 109 | Fat redistribution | FAERS: 2 | SIDER US FAERS | |
| 110 | Feeling jittery | FAERS: 2 | US FAERS | |
| 111 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 112 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 113 | Hepatitis C | FAERS: 2 | SIDER US FAERS | |
| 114 | Immune reconstitution inflammatory syndrome associated tuberculosis | FAERS: 2 | US FAERS | |
| 115 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 116 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 117 | Influenza | FAERS: 2 | US FAERS | |
| 118 | Iniencephaly | FAERS: 2 | US FAERS | |
| 119 | Joint swelling | FAERS: 2 | US FAERS | |
| 120 | Lipoma | FAERS: 2 | US FAERS | |
| 121 | Lissencephaly | FAERS: 2 | US FAERS | |
| 122 | Malnutrition | FAERS: 2 | US FAERS | |
| 123 | Meningitis | FAERS: 2 | US FAERS | |
| 124 | Myopathy | FAERS: 2 | US FAERS | |
| 125 | Nervousness | FAERS: 2 | US FAERS | |
| 126 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 127 | Product dispensing error | FAERS: 2 | US FAERS | |
| 128 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 129 | Suicide attempt | FAERS: 2 | US FAERS | |
| 130 | Thrombocytopenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Transaminases increased | FAERS: 2 | US FAERS | |
| 132 | Tremor | FAERS: 2 | US FAERS | |
| 133 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 134 | Abdominal cavity drainage | FAERS: 1 | US FAERS | |
| 135 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 136 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 137 | Ageusia | FAERS: 1 | US FAERS | |
| 138 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 139 | Amylase increased | FAERS: 1 | US FAERS | |
| 140 | Anal chlamydia infection | FAERS: 1 | US FAERS | |
| 141 | Anencephaly | FAERS: 1 | US FAERS | |
| 142 | Aphasia | FAERS: 1 | US FAERS | |
| 143 | Arthritis | FAERS: 1 | US FAERS | |
| 144 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 145 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 146 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 147 | Blood urea increased | FAERS: 1 | US FAERS | |
| 148 | Body fat disorder | FAERS: 1 | US FAERS | |
| 149 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 150 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 151 | Brain Abscess | FAERS: 1 | US FAERS | |
| 152 | Burning sensation | FAERS: 1 | US FAERS | |
| 153 | Cellulitis | FAERS: 1 | US FAERS | |
| 154 | Central nervous system immune reconstitution inflammatory response | FAERS: 1 | US FAERS | |
| 155 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 156 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 157 | Chemical eye injury | FAERS: 1 | US FAERS | |
| 158 | Chest discomfort | FAERS: 1 | US FAERS | |
| 159 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 160 | Cold sweat | FAERS: 1 | US FAERS | |
| 161 | Colitis | FAERS: 1 | US FAERS | |
| 162 | Complication associated with device | FAERS: 1 | US FAERS | |
| 163 | Craniopharyngioma | FAERS: 1 | US FAERS | |
| 164 | Cytomegalovirus chorioretinitis | FAERS: 1 | US FAERS | |
| 165 | Dementia | FAERS: 1 | US FAERS | |
| 166 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 167 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 168 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 169 | Discomfort | FAERS: 1 | US FAERS | |
| 170 | Drug Dependence | FAERS: 1 | US FAERS | |
| 171 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 172 | Drug level increased | FAERS: 1 | US FAERS | |
| 173 | Dysphonia | FAERS: 1 | US FAERS | |
| 174 | Emergency care examination | FAERS: 1 | US FAERS | |
| 175 | Emotional disorder | FAERS: 1 | US FAERS | |
| 176 | Endocardial Fibroelastosis | FAERS: 1 | US FAERS | |
| 177 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 178 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 179 | Flank Pain | FAERS: 1 | US FAERS | |
| 180 | Flatulence | FAERS: 1 | SIDER US FAERS | |
| 181 | Gastritis | FAERS: 1 | US FAERS | |
| 182 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 183 | Gastrostomy | FAERS: 1 | US FAERS | |
| 184 | Gene Mutation | FAERS: 1 | US FAERS | |
| 185 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 186 | Gout | FAERS: 1 | US FAERS | |
| 187 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 188 | Hemiplegia | FAERS: 1 | US FAERS | |
| 189 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 190 | Hepatitis A | FAERS: 1 | US FAERS | |
| 191 | Hepatitis | FAERS: 1 | SIDER US FAERS | |
| 192 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 193 | Hernia pain | FAERS: 1 | US FAERS | |
| 194 | Heterochromia iridis | FAERS: 1 | US FAERS | |
| 195 | Hypotension | FAERS: 1 | US FAERS | |
| 196 | Impaired work ability | FAERS: 1 | US FAERS | |
| 197 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 198 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 199 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 200 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 201 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 202 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 203 | Intussusception | FAERS: 1 | US FAERS | |
| 204 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 205 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 206 | Laryngeal Obstruction | FAERS: 1 | US FAERS | |
| 207 | Laryngomalacia | FAERS: 1 | US FAERS | |
| 208 | Laziness | FAERS: 1 | US FAERS | |
| 209 | Libido disorder | FAERS: 1 | US FAERS | |
| 210 | Limb discomfort | FAERS: 1 | US FAERS | |
| 211 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 212 | Lipase increased | FAERS: 1 | US FAERS | |
| 213 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 214 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 215 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 216 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 217 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 218 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 219 | Memory impairment | FAERS: 1 | US FAERS | |
| 220 | Meningocele | FAERS: 1 | US FAERS | |
| 221 | Meningomyelocele | FAERS: 1 | US FAERS | |
| 222 | Mental impairment | FAERS: 1 | US FAERS | |
| 223 | Mental status changes | FAERS: 1 | US FAERS | |
| 224 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 225 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 226 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 227 | Otitis Media | FAERS: 1 | US FAERS | |
| 228 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 229 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 230 | Polyarthritis | FAERS: 1 | US FAERS | |
| 231 | Polydactyly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 233 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 234 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 235 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 236 | Prehypertension | FAERS: 1 | US FAERS | |
| 237 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 238 | Presyncope | FAERS: 1 | US FAERS | |
| 239 | Product complaint | FAERS: 1 | US FAERS | |
| 240 | Product contamination physical | FAERS: 1 | US FAERS | |
| 241 | Product prescribing error | FAERS: 1 | US FAERS | |
| 242 | Product quality issue | FAERS: 1 | US FAERS | |
| 243 | Product substitution issue | FAERS: 1 | US FAERS | |
| 244 | Productive Cough | FAERS: 1 | US FAERS | |
| 245 | Prurigo | FAERS: 1 | SIDER US FAERS | |
| 246 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 247 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 248 | Rash erythematous | FAERS: 1 | US FAERS | |
| 249 | Renal cyst | FAERS: 1 | US FAERS | |
| 250 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 251 | Respiratory distress | FAERS: 1 | US FAERS | |
| 252 | Reticulocyte count increased | FAERS: 1 | US FAERS | |
| 253 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 254 | Rosacea | FAERS: 1 | US FAERS | |
| 255 | Scab | FAERS: 1 | US FAERS | |
| 256 | Skin irritation | FAERS: 1 | US FAERS | |
| 257 | Skin lesion | FAERS: 1 | US FAERS | |
| 258 | Skin reaction | FAERS: 1 | US FAERS | |
| 259 | Somnolence | FAERS: 1 | US FAERS | |
| 260 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 261 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 262 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 263 | Stomatitis | FAERS: 1 | US FAERS | |
| 264 | Stress | FAERS: 1 | US FAERS | |
| 265 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 266 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 267 | Swelling | FAERS: 1 | US FAERS | |
| 268 | Tachycardia | FAERS: 1 | US FAERS | |
| 269 | Terminal state | FAERS: 1 | US FAERS | |
| 270 | Therapy change | FAERS: 1 | US FAERS | |
| 271 | Throat cancer | FAERS: 1 | US FAERS | |
| 272 | Throat irritation | FAERS: 1 | US FAERS | |
| 273 | Thrombosis | FAERS: 1 | US FAERS | |
| 274 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 275 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 276 | Ulcer | FAERS: 1 | US FAERS | |
| 277 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 278 | Unemployment | FAERS: 1 | US FAERS | |
| 279 | Unevaluable event | FAERS: 1 | US FAERS | |
| 280 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 281 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 282 | Weight decreased | FAERS: 1 | US FAERS | |
| 283 | Alanine Aminotransferase Increased | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 284 | Aspartate Aminotransferase Increased | Canada Vigilance: 1 | Canada Vigilance | |
| 285 | Gastrointestinal Pain | SIDER | ||
| 286 | Inflammation | SIDER | ||
| 287 | Myositis | SIDER | ||
| 288 | Vertigo | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.