eletriptan
(PWVXXGRKLHYWKM-LJQANCHMSA-N)
Structure
- SMILES
- CN1CCC[C@@H]1Cc1c[nH]c2c1cc(cc2)CCS(=O)(=O)c1ccccc1
- Type(s)
- Approved; Investigational
- ATC code(s)
- N02CC06
- Molecular Formula:
- C22H26N2O2S
- Molecular Weight:
- 382.519
- Log P:
- 4.8397
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 61.55
- CAS Number(s):
- 143322-58-1
Synonym(s)
1.
eletriptan
2.
(R)-3-((1-methyl-2-pyrrolidinyl)methyl)-5-(2-(phenylsulfonyl)ethyl)-1H-indole
3.
(R)-3-((1-methyl-2-pyrrolidinyl)methyl)-5-(2-(phenylsulfonyl)ethyl)-1H-indole monohydrobromide
4.
3-(1-methyl-2-pyrrolidinylmethyl)-5-(2-(phenylsulfonyl)ethyl)-1H-indole hydrobromide
5.
Relpax
6.
UK 166,044
7.
UK 166044
8.
UK-116,044-04
9.
UK-116044-04
10.
UK-166,044
11.
UK-166044
12.
eletriptan hydrobromide
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 216 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 2 | Headache | FAERS: 214 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Malaise | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 4 | Nausea | FAERS: 77 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Pain | FAERS: 62 | 15836966 | CTD SIDER US FAERS |
| 6 | Vomiting | FAERS: 57 | SIDER US FAERS | |
| 7 | Drug Dependence | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Dizziness | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Drug effect incomplete | FAERS: 36 | US FAERS | |
| 10 | Chest Pain | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Feeling abnormal | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 12 | Urticaria | FAERS: 30 | SIDER US FAERS | |
| 13 | Somnolence | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Chest discomfort | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 15 | Drug dispensing error | FAERS: 23 | US FAERS | |
| 16 | Fatigue | FAERS: 21 | SIDER US FAERS | |
| 17 | Intentional product misuse | FAERS: 18 | US FAERS | |
| 18 | Myocardial Infarction | FAERS: 18 | SIDER US FAERS | |
| 19 | Nasopharyngitis | FAERS: 17 | US FAERS | |
| 20 | Syncope | FAERS: 17 | SIDER US FAERS | |
| 21 | Asthenia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Muscle tightness | FAERS: 16 | OFFSIDES US FAERS | |
| 23 | Neck Pain | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Product use in unapproved indication | FAERS: 16 | US FAERS | |
| 25 | Hypersensitivity | FAERS: 15 | SIDER US FAERS | |
| 26 | Arthralgia | FAERS: 14 | SIDER US FAERS | |
| 27 | Cerebrovascular accident | FAERS: 14 | US FAERS | |
| 28 | Drug abuse | FAERS: 14 | US FAERS | |
| 29 | Intentional drug misuse | FAERS: 14 | OFFSIDES US FAERS | |
| 30 | Palpitations | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 31 | Product use issue | FAERS: 12 | US FAERS | |
| 32 | Activities of daily living impaired | FAERS: 11 | US FAERS | |
| 33 | Anxiety | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Drug prescribing error | FAERS: 11 | OFFSIDES US FAERS | |
| 35 | Therapeutic response unexpected | FAERS: 11 | US FAERS | |
| 36 | Dystonia | FAERS: 10 | OFFSIDES US FAERS | |
| 37 | Drug effect delayed | FAERS: 9 | US FAERS | |
| 38 | Impaired driving ability | FAERS: 9 | US FAERS | |
| 39 | Memory impairment | FAERS: 9 | US FAERS | |
| 40 | Oropharyngeal pain | FAERS: 9 | US FAERS | |
| 41 | Stress | FAERS: 9 | US FAERS | |
| 42 | Thrombosis | FAERS: 9 | US FAERS | |
| 43 | Amnesia | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 44 | Colitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Impaired work ability | FAERS: 8 | US FAERS | |
| 46 | Influenza | FAERS: 8 | SIDER US FAERS | |
| 47 | Myalgia | FAERS: 8 | SIDER US FAERS | |
| 48 | Photophobia | FAERS: 8 | SIDER US FAERS | |
| 49 | Drug exposure during pregnancy | FAERS: 7 | US FAERS | |
| 50 | Drug withdrawal syndrome | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Dysphonia | FAERS: 7 | OFFSIDES US FAERS | |
| 52 | Intentional product use issue | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Musculoskeletal stiffness | FAERS: 7 | OFFSIDES US FAERS | |
| 54 | Pre-existing condition improved | FAERS: 7 | US FAERS | |
| 55 | Supraventricular tachycardia | FAERS: 7 | US FAERS | |
| 56 | Trismus | FAERS: 7 | US FAERS | |
| 57 | Abdominal discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 58 | Agitation | FAERS: 6 | SIDER US FAERS | |
| 59 | Angioedema | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 60 | Arthropathy | FAERS: 6 | SIDER US FAERS | |
| 61 | Back Pain | FAERS: 6 | SIDER US FAERS | |
| 62 | Back disorder | FAERS: 6 | US FAERS | |
| 63 | Bedridden | FAERS: 6 | US FAERS | |
| 64 | Blindness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Drug abuser | FAERS: 6 | OFFSIDES US FAERS | |
| 66 | Fibromyalgia | FAERS: 6 | US FAERS | |
| 67 | Lip swelling | FAERS: 6 | US FAERS | |
| 68 | No adverse event | FAERS: 6 | US FAERS | |
| 69 | Overdose | FAERS: 6 | OFFSIDES US FAERS | |
| 70 | Pruritus | FAERS: 6 | SIDER US FAERS | |
| 71 | Unevaluable event | FAERS: 6 | OFFSIDES US FAERS | |
| 72 | Visual Impairment | FAERS: 6 | SIDER US FAERS | |
| 73 | Angina Pectoris | FAERS: 5 | SIDER US FAERS | |
| 74 | Arthritis | FAERS: 5 | SIDER US FAERS | |
| 75 | Burning sensation | FAERS: 5 | SIDER US FAERS | |
| 76 | Emotional disorder | FAERS: 5 | US FAERS | |
| 77 | Euphoric mood | FAERS: 5 | SIDER US FAERS | |
| 78 | Eye pain | FAERS: 5 | SIDER US FAERS | |
| 79 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 80 | Musculoskeletal discomfort | FAERS: 5 | SIDER US FAERS | |
| 81 | Product dispensing error | FAERS: 5 | US FAERS | |
| 82 | Tremor | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 83 | Weight decreased | FAERS: 5 | SIDER US FAERS | |
| 84 | Alopecia | FAERS: 4 | SIDER US FAERS | |
| 85 | Aphasia | FAERS: 4 | SIDER US FAERS | |
| 86 | Bipolar Disorder | FAERS: 4 | US FAERS | |
| 87 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 88 | Cheilitis | FAERS: 4 | US FAERS | |
| 89 | Crying | FAERS: 4 | US FAERS | |
| 90 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 91 | Diplopia | FAERS: 4 | SIDER US FAERS | |
| 92 | Dyspepsia | FAERS: 4 | SIDER US FAERS | |
| 93 | Hypotension | FAERS: 4 | SIDER US FAERS | |
| 94 | Incoherent | FAERS: 4 | US FAERS | |
| 95 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 96 | Inflammation | FAERS: 4 | US FAERS | |
| 97 | Joint swelling | FAERS: 4 | US FAERS | |
| 98 | Mental impairment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 99 | Product packaging issue | FAERS: 4 | US FAERS | |
| 100 | Pulmonary Embolism | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Rebound effect | FAERS: 4 | OFFSIDES US FAERS | |
| 102 | Serotonin Syndrome | FAERS: 4 | SIDER US FAERS | |
| 103 | Tachycardia | FAERS: 4 | SIDER US FAERS | |
| 104 | Tinnitus | FAERS: 4 | SIDER US FAERS | |
| 105 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 106 | nervous system disorder | FAERS: 4 | SIDER US FAERS | |
| 107 | Abdominal Pain | FAERS: 3 | SIDER US FAERS | |
| 108 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 109 | Atrial Fibrillation | FAERS: 3 | SIDER US FAERS | |
| 110 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 111 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 112 | Bradycardia | FAERS: 3 | SIDER US FAERS | |
| 113 | Cataract | FAERS: 3 | OFFSIDES US FAERS | |
| 114 | Cerebellar infarction | FAERS: 3 | US FAERS | |
| 115 | Coagulation factor VIII level increased | FAERS: 3 | OFFSIDES US FAERS | |
| 116 | Cold sweat | FAERS: 3 | US FAERS | |
| 117 | Dehydration | FAERS: 3 | US FAERS | |
| 118 | Delirium | FAERS: 3 | US FAERS | |
| 119 | Dependence | FAERS: 3 | US FAERS | |
| 120 | Depressed Level of Consciousness | FAERS: 3 | SIDER US FAERS | |
| 121 | Drug effective for unapproved indication | FAERS: 3 | US FAERS | |
| 122 | Dysarthria | FAERS: 3 | US FAERS | |
| 123 | Dysgeusia | FAERS: 3 | SIDER US FAERS | |
| 124 | Emotional distress | FAERS: 3 | US FAERS | |
| 125 | Expired drug administered | FAERS: 3 | US FAERS | |
| 126 | Feeling jittery | FAERS: 3 | US FAERS | |
| 127 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 128 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 129 | Head discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Hernia | FAERS: 3 | SIDER US FAERS | |
| 131 | Joint injury | FAERS: 3 | US FAERS | |
| 132 | Laryngitis | FAERS: 3 | SIDER US FAERS | |
| 133 | Leukocytosis | FAERS: 3 | US FAERS | |
| 134 | Lipoma | FAERS: 3 | US FAERS | |
| 135 | Loss of personal independence in daily activities | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Medication Error | FAERS: 3 | US FAERS | |
| 137 | Medication overuse headache | FAERS: 3 | SIDER US FAERS | |
| 138 | Meningitis | FAERS: 3 | US FAERS | |
| 139 | Multiple Sclerosis | FAERS: 3 | OFFSIDES US FAERS | |
| 140 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 141 | Nervousness | FAERS: 3 | SIDER US FAERS | |
| 142 | Pallor | FAERS: 3 | US FAERS | |
| 143 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 144 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 145 | Prescription drug used without a prescription | FAERS: 3 | US FAERS | |
| 146 | Retinal Vascular Disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 147 | Sinusitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 148 | Spondylitis | FAERS: 3 | US FAERS | |
| 149 | Abasia | FAERS: 2 | US FAERS | |
| 150 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 151 | Akinesia | FAERS: 2 | OFFSIDES US FAERS | |
| 152 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 153 | Aneurysm | FAERS: 2 | US FAERS | |
| 154 | Anger | FAERS: 2 | US FAERS | |
| 155 | Appendicitis | FAERS: 2 | US FAERS | |
| 156 | Asthma | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 157 | Blood creatine phosphokinase increased | FAERS: 2 | SIDER US FAERS | |
| 158 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 159 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 160 | Blood potassium decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 161 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 162 | Carcinoma | FAERS: 2 | US FAERS | |
| 163 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 164 | Carotid artery aneurysm | FAERS: 2 | US FAERS | |
| 165 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 166 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 167 | Cluster Headache | FAERS: 2 | US FAERS | |
| 168 | Completed Suicide | FAERS: 2 | US FAERS | |
| 169 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 170 | Depressed mood | FAERS: 2 | US FAERS | |
| 171 | Dextrocardia | FAERS: 2 | US FAERS | |
| 172 | Disability | FAERS: 2 | US FAERS | |
| 173 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 174 | Disease recurrence | FAERS: 2 | US FAERS | |
| 175 | Disorientation | FAERS: 2 | US FAERS | |
| 176 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 177 | Drug administration error | FAERS: 2 | US FAERS | |
| 178 | Drug dose omission | FAERS: 2 | US FAERS | |
| 179 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 180 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 181 | Drug screen positive | FAERS: 2 | US FAERS | |
| 182 | Dysphemia | FAERS: 2 | US FAERS | |
| 183 | Ear discomfort | FAERS: 2 | US FAERS | |
| 184 | Encephalomalacia | FAERS: 2 | US FAERS | |
| 185 | Erectile dysfunction | FAERS: 2 | SIDER US FAERS | |
| 186 | Erythema | FAERS: 2 | US FAERS | |
| 187 | Flatulence | FAERS: 2 | SIDER US FAERS | |
| 188 | Flushing | FAERS: 2 | SIDER US FAERS | |
| 189 | Glaucoma | FAERS: 2 | US FAERS | |
| 190 | Hepatitis | FAERS: 2 | US FAERS | |
| 191 | Hunger | FAERS: 2 | US FAERS | |
| 192 | Hyperacusis | FAERS: 2 | US FAERS | |
| 193 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 194 | Joint stiffness | FAERS: 2 | US FAERS | |
| 195 | Macular degeneration | FAERS: 2 | US FAERS | |
| 196 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 197 | Meningeal disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 198 | Menorrhagia | FAERS: 2 | SIDER US FAERS | |
| 199 | Migraine with Aura | FAERS: 2 | OFFSIDES US FAERS | |
| 200 | Muscle Fatigue | FAERS: 2 | OFFSIDES US FAERS | |
| 201 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 202 | Optic Neuritis | FAERS: 2 | OFFSIDES US FAERS | |
| 203 | Pericarditis | FAERS: 2 | US FAERS | |
| 204 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 205 | Phlebitis | FAERS: 2 | US FAERS | |
| 206 | Pneumonia | FAERS: 2 | US FAERS | |
| 207 | Poisoning | FAERS: 2 | US FAERS | |
| 208 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 209 | Product blister packaging issue | FAERS: 2 | US FAERS | |
| 210 | Product quality issue | FAERS: 2 | US FAERS | |
| 211 | Retching | FAERS: 2 | US FAERS | |
| 212 | Rheumatoid Arthritis | FAERS: 2 | SIDER US FAERS | |
| 213 | Schizophrenia | FAERS: 2 | US FAERS | |
| 214 | Swelling | FAERS: 2 | US FAERS | |
| 215 | Tension Headache | FAERS: 2 | US FAERS | |
| 216 | Throat irritation | FAERS: 2 | US FAERS | |
| 217 | Troponin increased | FAERS: 2 | OFFSIDES US FAERS | |
| 218 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 219 | Vasospasm | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 220 | Wheezing | FAERS: 2 | US FAERS | |
| 221 | Adverse event | FAERS: 1 | US FAERS | |
| 222 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 223 | Aphagia | FAERS: 1 | US FAERS | |
| 224 | Aphonia | FAERS: 1 | US FAERS | |
| 225 | Apparent death | FAERS: 1 | US FAERS | |
| 226 | Aura | FAERS: 1 | US FAERS | |
| 227 | Auricular swelling | FAERS: 1 | OFFSIDES US FAERS | |
| 228 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 229 | Blepharospasm | FAERS: 1 | OFFSIDES US FAERS | |
| 230 | Bone pain | FAERS: 1 | SIDER US FAERS | |
| 231 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 232 | Brain Abscess | FAERS: 1 | US FAERS | |
| 233 | Breast tenderness | FAERS: 1 | OFFSIDES US FAERS | |
| 234 | Bronchitis | FAERS: 1 | SIDER US FAERS | |
| 235 | Bruxism | FAERS: 1 | US FAERS | |
| 236 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 237 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 238 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 239 | Cerebral vasoconstriction | FAERS: 1 | OFFSIDES US FAERS | |
| 240 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 241 | Chills | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 242 | Choking sensation | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 243 | Choking | FAERS: 1 | US FAERS | |
| 244 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 245 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 246 | Clumsiness | FAERS: 1 | OFFSIDES US FAERS | |
| 247 | Constipation | FAERS: 1 | SIDER US FAERS | |
| 248 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 249 | Cystocele | FAERS: 1 | US FAERS | |
| 250 | Deafness | FAERS: 1 | US FAERS | |
| 251 | Device leakage | FAERS: 1 | US FAERS | |
| 252 | Diplegia | FAERS: 1 | US FAERS | |
| 253 | Disease Progression | FAERS: 1 | US FAERS | |
| 254 | Dissociation | FAERS: 1 | US FAERS | |
| 255 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 256 | Drug effect variable | FAERS: 1 | US FAERS | |
| 257 | Drug withdrawal headache | FAERS: 1 | OFFSIDES US FAERS | |
| 258 | Dry skin | FAERS: 1 | SIDER US FAERS | |
| 259 | Economic problem | FAERS: 1 | OFFSIDES US FAERS | |
| 260 | Epilepsy | FAERS: 1 | US FAERS | |
| 261 | Epistaxis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 262 | Extra dose administered | FAERS: 1 | US FAERS | |
| 263 | Extravasation | FAERS: 1 | US FAERS | |
| 264 | Eye Burns | FAERS: 1 | US FAERS | |
| 265 | Facial Pain | FAERS: 1 | US FAERS | |
| 266 | Facial paralysis | FAERS: 1 | US FAERS | |
| 267 | Feeling Cold | FAERS: 1 | US FAERS | |
| 268 | Fibromuscular Dysplasia | FAERS: 1 | US FAERS | |
| 269 | Food Allergy | FAERS: 1 | US FAERS | |
| 270 | Gait inability | FAERS: 1 | US FAERS | |
| 271 | Galactostasis | FAERS: 1 | US FAERS | |
| 272 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 273 | Granulomatous liver disease | FAERS: 1 | OFFSIDES US FAERS | |
| 274 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 275 | Hemiparesis | FAERS: 1 | US FAERS | |
| 276 | Hemiplegia | FAERS: 1 | SIDER US FAERS | |
| 277 | Hordeolum | FAERS: 1 | US FAERS | |
| 278 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 279 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 280 | Hypersomnia | FAERS: 1 | US FAERS | |
| 281 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 282 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 283 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 284 | Infarction | FAERS: 1 | US FAERS | |
| 285 | Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 286 | Infertility | FAERS: 1 | US FAERS | |
| 287 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 288 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 289 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 290 | Laceration | FAERS: 1 | US FAERS | |
| 291 | Lethargy | FAERS: 1 | US FAERS | |
| 292 | Leukocyte antigen B-27 positive | FAERS: 1 | US FAERS | |
| 293 | Lipoma of breast | FAERS: 1 | US FAERS | |
| 294 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 295 | Lyme Disease | FAERS: 1 | OFFSIDES US FAERS | |
| 296 | Lymphadenopathy | FAERS: 1 | SIDER US FAERS | |
| 297 | Lymphoma | FAERS: 1 | US FAERS | |
| 298 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 299 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 300 | Metastasis | FAERS: 1 | US FAERS | |
| 301 | Middle insomnia | FAERS: 1 | US FAERS | |
| 302 | Monoplegia | FAERS: 1 | US FAERS | |
| 303 | Mood swings | FAERS: 1 | SIDER US FAERS | |
| 304 | Mydriasis | FAERS: 1 | US FAERS | |
| 305 | Myocarditis | FAERS: 1 | US FAERS | |
| 306 | Myoclonus | FAERS: 1 | US FAERS | |
| 307 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 308 | Negative thoughts | FAERS: 1 | US FAERS | |
| 309 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 310 | Nerve injury | FAERS: 1 | US FAERS | |
| 311 | Neuralgia | FAERS: 1 | US FAERS | |
| 312 | No adverse effect | FAERS: 1 | US FAERS | |
| 313 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 314 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 315 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 316 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 317 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 318 | Overweight | FAERS: 1 | US FAERS | |
| 319 | Packaging design issue | FAERS: 1 | US FAERS | |
| 320 | Pancreatic Insufficiency | FAERS: 1 | US FAERS | |
| 321 | Pancreatitis | FAERS: 1 | US FAERS | |
| 322 | Paradoxical drug reaction | FAERS: 1 | OFFSIDES US FAERS | |
| 323 | Pericardial effusion | FAERS: 1 | OFFSIDES US FAERS | |
| 324 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 325 | Personality Change | FAERS: 1 | US FAERS | |
| 326 | Phonophobia | FAERS: 1 | US FAERS | |
| 327 | Polyarthritis | FAERS: 1 | US FAERS | |
| 328 | Polyuria | FAERS: 1 | SIDER US FAERS | |
| 329 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 330 | Proctitis | FAERS: 1 | US FAERS | |
| 331 | Product container issue | FAERS: 1 | US FAERS | |
| 332 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 333 | Product lot number issue | FAERS: 1 | US FAERS | |
| 334 | Product package associated injury | FAERS: 1 | US FAERS | |
| 335 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 336 | Product prescribing error | FAERS: 1 | US FAERS | |
| 337 | Product size issue | FAERS: 1 | US FAERS | |
| 338 | Product substitution issue | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 339 | Proteinuria | FAERS: 1 | US FAERS | |
| 340 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 341 | Pulmonary thrombosis | FAERS: 1 | OFFSIDES US FAERS | |
| 342 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 343 | Rash erythematous | FAERS: 1 | US FAERS | |
| 344 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 345 | Respiratory distress | FAERS: 1 | US FAERS | |
| 346 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 347 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 348 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 349 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 350 | Sciatic Nerve Palsy | FAERS: 1 | US FAERS | |
| 351 | Scleroderma | FAERS: 1 | US FAERS | |
| 352 | Screaming | FAERS: 1 | US FAERS | |
| 353 | Sinus pain | FAERS: 1 | US FAERS | |
| 354 | Skin test positive | FAERS: 1 | US FAERS | |
| 355 | Skin tightness | FAERS: 1 | US FAERS | |
| 356 | Spinal column injury | FAERS: 1 | US FAERS | |
| 357 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 358 | Splenic Infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Starvation | FAERS: 1 | US FAERS | |
| 360 | Status Migrainosus | FAERS: 1 | OFFSIDES US FAERS | |
| 361 | Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 362 | Stupor | FAERS: 1 | SIDER US FAERS | |
| 363 | Sudden death | FAERS: 1 | US FAERS | |
| 364 | Sunburn | FAERS: 1 | US FAERS | |
| 365 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 366 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 367 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 368 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 369 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 370 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 371 | Throat cancer | FAERS: 1 | US FAERS | |
| 372 | Toothache | FAERS: 1 | US FAERS | |
| 373 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 374 | Ulcer | FAERS: 1 | US FAERS | |
| 375 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 376 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 377 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 378 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 379 | Vertebral artery occlusion | FAERS: 1 | US FAERS | |
| 380 | Victim of sexual abuse | FAERS: 1 | US FAERS | |
| 381 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 382 | Visual disturbance | FAERS: 1 | US FAERS | |
| 383 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 384 | West Nile viral infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 385 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 386 | Wrong dose | FAERS: 1 | US FAERS | |
| 387 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 388 | treatment failure | FAERS: 1 | US FAERS | |
| 389 | Abnormal vision | SIDER | ||
| 390 | Abscess | SIDER | ||
| 391 | Abuse | OFFSIDES | ||
| 392 | Acute Coronary Syndrome | OFFSIDES SIDER | ||
| 393 | Adenoma | OFFSIDES | ||
| 394 | Adnexa uteri pain | OFFSIDES | ||
| 395 | Ageusia | OFFSIDES | ||
| 396 | Ammonia increased | OFFSIDES | ||
| 397 | Angiogram cerebral abnormal | OFFSIDES | ||
| 398 | Ankle Fracture | OFFSIDES | ||
| 399 | Anorexia | SIDER | ||
| 400 | Antiphospholipid antibodies positive | OFFSIDES | ||
| 401 | Apathy | OFFSIDES SIDER | ||
| 402 | Apnea | OFFSIDES | ||
| 403 | Application site urticaria | OFFSIDES | ||
| 404 | Aspartate aminotransferase decreased | OFFSIDES | ||
| 405 | Ataxia | SIDER | ||
| 406 | Atelectasis | OFFSIDES | ||
| 407 | Atrioventricular Block | SIDER | ||
| 408 | Automatism | OFFSIDES | ||
| 409 | Biliary Dyskinesia | OFFSIDES | ||
| 410 | Biopsy | OFFSIDES | ||
| 411 | Bladder spasm | OFFSIDES | ||
| 412 | Blood alkaline phosphatase increased | SIDER | ||
| 413 | Blood creatinine increased | OFFSIDES | ||
| 414 | Blood phosphorus decreased | OFFSIDES | ||
| 415 | Blood pressure immeasurable | OFFSIDES | ||
| 416 | Blood testosterone decreased | OFFSIDES | ||
| 417 | Brain Concussion | OFFSIDES | ||
| 418 | Brain Death | OFFSIDES | ||
| 419 | Breast discomfort | OFFSIDES | ||
| 420 | Cardiac discomfort | OFFSIDES | ||
| 421 | Catatonia | SIDER | ||
| 422 | Catatonic reaction | SIDER | ||
| 423 | Cellulitis | OFFSIDES | ||
| 424 | Central nervous system lesion | OFFSIDES | ||
| 425 | Cerebral calcification | OFFSIDES | ||
| 426 | Chest tightness | SIDER | ||
| 427 | Cogwheel Rigidity | OFFSIDES | ||
| 428 | Complex partial seizures | OFFSIDES | ||
| 429 | Confabulation | OFFSIDES | ||
| 430 | Congenital heart disease | OFFSIDES | ||
| 431 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 432 | Conjunctivitis | SIDER | ||
| 433 | Conversion disorder | OFFSIDES SIDER | ||
| 434 | Creatine Phosphokinase Increased | SIDER | ||
| 435 | Cyanosis | OFFSIDES SIDER | ||
| 436 | Dementia | SIDER | ||
| 437 | Demyelination | OFFSIDES | ||
| 438 | Dermatitis | SIDER | ||
| 439 | Device dislocation | OFFSIDES | ||
| 440 | Device related infection | OFFSIDES | ||
| 441 | Drowsiness | OFFSIDES SIDER | ||
| 442 | Drug addict | OFFSIDES | ||
| 443 | Eczema | SIDER | ||
| 444 | Endometriosis | OFFSIDES | ||
| 445 | Enlargement abdomen | SIDER | ||
| 446 | Enteritis | OFFSIDES | ||
| 447 | Eructation | SIDER | ||
| 448 | Fasciitis | OFFSIDES | ||
| 449 | Feelings of worthlessness | OFFSIDES | ||
| 450 | Flat affect | SIDER | ||
| 451 | Gastritis | SIDER | ||
| 452 | Gastrointestinal Pain | SIDER | ||
| 453 | Gastrointestinal discomfort | SIDER | ||
| 454 | Genital erosion | OFFSIDES | ||
| 455 | Gingivitis | SIDER | ||
| 456 | Glossitis | SIDER | ||
| 457 | Hallucinations, mixed | OFFSIDES | ||
| 458 | Hay fever | OFFSIDES | ||
| 459 | Hepatosplenomegaly | OFFSIDES | ||
| 460 | Histoplasmosis | OFFSIDES | ||
| 461 | Hyperkinesia | SIDER | ||
| 462 | Hypertensive crisis | SIDER | ||
| 463 | Hyperventilation | OFFSIDES SIDER | ||
| 464 | Hypokinesia | SIDER | ||
| 465 | Hysteria | SIDER | ||
| 466 | Immobile | OFFSIDES | ||
| 467 | Incontinence | OFFSIDES | ||
| 468 | Increased bronchial secretion | SIDER | ||
| 469 | Injection site infection | OFFSIDES | ||
| 470 | Injection site nodule | OFFSIDES | ||
| 471 | Intentional misuse | OFFSIDES | ||
| 472 | Intracranial Hypotension | OFFSIDES | ||
| 473 | Lacrimal structural disorder | SIDER | ||
| 474 | Leukopenia | SIDER | ||
| 475 | Leukorrhea | SIDER | ||
| 476 | Lividity | OFFSIDES | ||
| 477 | Lymphomatoid Papulosis | OFFSIDES | ||
| 478 | Lysosomal Storage Diseases | 28551711 | CTD | |
| 479 | Manic psychosis | SIDER | ||
| 480 | Mastoiditis | OFFSIDES | ||
| 481 | Metabolic acidosis | OFFSIDES | ||
| 482 | Migraine Disorders | 11993610 15529793 18377383 | CTD | |
| 483 | Monocytosis | SIDER | ||
| 484 | Morbid thoughts | OFFSIDES | ||
| 485 | Mucosal erosion | OFFSIDES | ||
| 486 | Myopathy | SIDER | ||
| 487 | Nervous tension | OFFSIDES | ||
| 488 | Neuropathy | SIDER | ||
| 489 | Numbness | SIDER | ||
| 490 | Obsessive thoughts | OFFSIDES | ||
| 491 | Obstruction | OFFSIDES | ||
| 492 | Oculogyric crisis | SIDER | ||
| 493 | Oligomenorrhea | OFFSIDES | ||
| 494 | Open wound | OFFSIDES | ||
| 495 | Otitis Media | SIDER | ||
| 496 | Ovarian Hyperstimulation Syndrome | OFFSIDES | ||
| 497 | Panic Disorder | OFFSIDES | ||
| 498 | Pharyngitis | SIDER | ||
| 499 | Pilonidal cyst congenital | OFFSIDES | ||
| 500 | Pleurisy | OFFSIDES | ||
| 501 | Post procedural infection | OFFSIDES | ||
| 502 | Potassium chloride sensitivity test abnormal | OFFSIDES | ||
| 503 | Product counterfeit | OFFSIDES | ||
| 504 | Pseudomeningocele | OFFSIDES | ||
| 505 | Psoriasis | SIDER | ||
| 506 | Pulmonary Infarction | OFFSIDES | ||
| 507 | Purpura | SIDER | ||
| 508 | Quadriplegia | OFFSIDES | ||
| 509 | Radiation skin injury | OFFSIDES | ||
| 510 | Renal pain | SIDER | ||
| 511 | Respiratory Failure | OFFSIDES | ||
| 512 | Rhinitis | SIDER | ||
| 513 | Risus sardonicus | OFFSIDES | ||
| 514 | Sensation of warmth | SIDER | ||
| 515 | Shock | SIDER | ||
| 516 | Sigmoiditis | OFFSIDES | ||
| 517 | Skin hypertrophy | SIDER | ||
| 518 | Spontaneous penile erection | OFFSIDES | ||
| 519 | Status Epilepticus | OFFSIDES | ||
| 520 | Stomach ache | SIDER | ||
| 521 | Sweating | SIDER | ||
| 522 | Tenosynovitis | SIDER | ||
| 523 | Tension | SIDER | ||
| 524 | Thirst | SIDER | ||
| 525 | Thrombophlebitis | SIDER | ||
| 526 | Thyroiditis | SIDER | ||
| 527 | Tobacco withdrawal symptoms | OFFSIDES | ||
| 528 | Tooth Infection | OFFSIDES | ||
| 529 | Trigeminal Nerve Disorder | OFFSIDES | ||
| 530 | Ultrasound abdomen abnormal | OFFSIDES | ||
| 531 | Urine output increased | SIDER | ||
| 532 | Vaginal Discharge | SIDER | ||
| 533 | Vascular purpura | SIDER | ||
| 534 | Ventricular Fibrillation | SIDER | ||
| 535 | Ventricular arrhythmia | SIDER | ||
| 536 | Vertigo | SIDER | ||
| 537 | Yawning | SIDER | ||
| 538 | colonoscopy | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.