mirabegron
(PBAPPPCECJKMCM-IBGZPJMESA-N)
Structure
- SMILES
- O=C(Cc1csc(n1)N)Nc1ccc(cc1)CCNC[C@@H](c1ccccc1)O
- Type(s)
- Approved
- ATC code(s)
- G04BD12
- Molecular Formula:
- C21H24N4O2S
- Molecular Weight:
- 396.506
- Log P:
- 3.8173
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 128.51
- CAS Number(s):
- 223673-61-8
Synonym(s)
1.
mirabegron
2.
2-(2-aminothiazol-4-yl)-4'-(2-((2-hydroxy-2-phenylethyl)amino)ethyl)acetanilide
3.
Betanis
4.
Betmiga
5.
YM 178
6.
YM-178
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 1992 Canada Vigilance: 69 | Canada Vigilance US FAERS | |
| 2 | Intentional product misuse | FAERS: 1051 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 3 | Headache | FAERS: 423 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 4 | Drug effect incomplete | FAERS: 364 | US FAERS | |
| 5 | Nocturia | FAERS: 286 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 6 | Intentional product use issue | FAERS: 264 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Constipation | FAERS: 259 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 8 | Dizziness | FAERS: 252 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Urinary Retention | FAERS: 241 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 10 | Urinary Incontinence | FAERS: 226 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 11 | Inappropriate schedule of drug administration | FAERS: 222 | US FAERS | |
| 12 | Urinary tract infection | FAERS: 165 | SIDER US FAERS | |
| 13 | Nasopharyngitis | FAERS: 141 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 14 | Malaise | FAERS: 135 | US FAERS | |
| 15 | Fatigue | FAERS: 114 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 16 | Wrong technique in product usage process | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Nausea | FAERS: 112 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 18 | Pruritus | FAERS: 101 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Dysuria | FAERS: 100 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 20 | Intentional drug misuse | FAERS: 98 | US FAERS | |
| 21 | Drug prescribing error | FAERS: 89 | US FAERS | |
| 22 | Drug dose omission | FAERS: 87 | US FAERS | |
| 23 | Peripheral swelling | FAERS: 86 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Palpitations | FAERS: 79 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 25 | Atrial Fibrillation | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 26 | Feeling abnormal | FAERS: 72 | US FAERS | |
| 27 | Pain | FAERS: 70 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Abdominal discomfort | FAERS: 68 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Back Pain | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Somnolence | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Urticaria | FAERS: 60 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 32 | Overdose | FAERS: 57 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 33 | Arthralgia | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 34 | Hypersensitivity | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Asthenia | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 36 | Cerebrovascular accident | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Alopecia | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Abdominal Pain | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Cystitis | FAERS: 45 | SIDER US FAERS | |
| 40 | Blood glucose increased | FAERS: 44 | US FAERS | |
| 41 | Hypertensive crisis | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Joint swelling | FAERS: 43 | SIDER US FAERS | |
| 43 | Vomiting | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Tachycardia | FAERS: 39 | SIDER US FAERS | |
| 45 | Drug ineffective for unapproved indication | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 46 | Lip swelling | FAERS: 38 | US FAERS | |
| 47 | Oropharyngeal pain | FAERS: 38 | US FAERS | |
| 48 | Product use issue | FAERS: 38 | US FAERS | |
| 49 | Circumstance or information capable of leading to medication error | FAERS: 35 | US FAERS | |
| 50 | Wrong technique in drug usage process | FAERS: 35 | US FAERS | |
| 51 | Dementia | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Memory impairment | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Product packaging quantity issue | FAERS: 31 | US FAERS | |
| 54 | Urine flow decreased | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Chromaturia | FAERS: 29 | US FAERS | |
| 56 | Dyspepsia | FAERS: 29 | SIDER US FAERS | |
| 57 | Incontinence | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Anxiety | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 59 | Tremor | FAERS: 27 | US FAERS | |
| 60 | Blood urine present | FAERS: 26 | US FAERS | |
| 61 | Chest Pain | FAERS: 26 | US FAERS | |
| 62 | Epistaxis | FAERS: 26 | US FAERS | |
| 63 | Myocardial Infarction | FAERS: 26 | US FAERS | |
| 64 | Syncope | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 65 | Visual Impairment | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Adverse event | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 67 | Weight decreased | FAERS: 25 | US FAERS | |
| 68 | Erythema | FAERS: 24 | US FAERS | |
| 69 | Influenza | FAERS: 24 | SIDER US FAERS | |
| 70 | Burning sensation | FAERS: 23 | US FAERS | |
| 71 | Drug dispensing error | FAERS: 23 | US FAERS | |
| 72 | Tinnitus | FAERS: 23 | US FAERS | |
| 73 | Amnesia | FAERS: 22 | US FAERS | |
| 74 | Hypotension | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Flatulence | FAERS: 21 | US FAERS | |
| 76 | Myalgia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Nervousness | FAERS: 20 | US FAERS | |
| 78 | Product storage error | FAERS: 19 | US FAERS | |
| 79 | Urine output increased | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Incorrect dose administered | FAERS: 18 | US FAERS | |
| 81 | Angioedema | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Pneumonia | FAERS: 17 | US FAERS | |
| 83 | Sneezing | FAERS: 17 | US FAERS | |
| 84 | Swelling | FAERS: 17 | US FAERS | |
| 85 | Accidental overdose | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Bladder pain | FAERS: 16 | SIDER US FAERS | |
| 87 | Bladder spasm | FAERS: 16 | US FAERS | |
| 88 | Chest discomfort | FAERS: 15 | US FAERS | |
| 89 | Eye pain | FAERS: 14 | US FAERS | |
| 90 | Night sweats | FAERS: 14 | US FAERS | |
| 91 | Sinusitis | FAERS: 14 | SIDER US FAERS | |
| 92 | Thirst | FAERS: 14 | US FAERS | |
| 93 | Blood pressure fluctuation | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 94 | Dehydration | FAERS: 13 | US FAERS | |
| 95 | Discomfort | FAERS: 13 | US FAERS | |
| 96 | Dysphonia | FAERS: 13 | US FAERS | |
| 97 | Head discomfort | FAERS: 13 | US FAERS | |
| 98 | Incorrect product storage | FAERS: 13 | US FAERS | |
| 99 | Multiple Sclerosis | FAERS: 13 | US FAERS | |
| 100 | Arthritis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Disorientation | FAERS: 12 | US FAERS | |
| 102 | Dysgeusia | FAERS: 12 | US FAERS | |
| 103 | Expired product administered | FAERS: 12 | US FAERS | |
| 104 | Lethargy | FAERS: 12 | US FAERS | |
| 105 | No adverse event | FAERS: 12 | US FAERS | |
| 106 | Therapeutic response unexpected | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Thrombosis | FAERS: 12 | US FAERS | |
| 108 | Vulvovaginal pruritus | FAERS: 12 | SIDER US FAERS | |
| 109 | Blood sodium decreased | FAERS: 11 | US FAERS | |
| 110 | General physical health deterioration | FAERS: 11 | US FAERS | |
| 111 | Infection | FAERS: 11 | SIDER US FAERS | |
| 112 | Laryngitis | FAERS: 11 | US FAERS | |
| 113 | Urge Incontinence | FAERS: 11 | US FAERS | |
| 114 | Vertigo | FAERS: 11 | US FAERS | |
| 115 | Blindness | FAERS: 10 | US FAERS | |
| 116 | Bronchitis | FAERS: 10 | US FAERS | |
| 117 | Delirium | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Diabetes Mellitus | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Dry skin | FAERS: 10 | US FAERS | |
| 120 | Feeling jittery | FAERS: 10 | US FAERS | |
| 121 | Neck Pain | FAERS: 10 | US FAERS | |
| 122 | Prescribed overdose | FAERS: 10 | US FAERS | |
| 123 | Product use in unapproved indication | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 124 | Throat irritation | FAERS: 10 | US FAERS | |
| 125 | Urinary hesitation | FAERS: 10 | US FAERS | |
| 126 | Angina Pectoris | FAERS: 9 | US FAERS | |
| 127 | Cataract operation | FAERS: 9 | US FAERS | |
| 128 | Limb injury | FAERS: 9 | US FAERS | |
| 129 | Musculoskeletal stiffness | FAERS: 9 | US FAERS | |
| 130 | Unevaluable event | FAERS: 9 | US FAERS | |
| 131 | Chills | FAERS: 8 | US FAERS | |
| 132 | Diplopia | FAERS: 8 | US FAERS | |
| 133 | Flank Pain | FAERS: 8 | US FAERS | |
| 134 | Gastritis | FAERS: 8 | SIDER US FAERS | |
| 135 | Medication residue present | FAERS: 8 | US FAERS | |
| 136 | Oral pain | FAERS: 8 | US FAERS | |
| 137 | Pelvic Pain | FAERS: 8 | US FAERS | |
| 138 | Rash erythematous | FAERS: 8 | US FAERS | |
| 139 | Restlessness | FAERS: 8 | US FAERS | |
| 140 | Rheumatoid Arthritis | FAERS: 8 | US FAERS | |
| 141 | nervous system disorder | FAERS: 8 | US FAERS | |
| 142 | Acute kidney injury | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Back disorder | FAERS: 7 | US FAERS | |
| 144 | Bladder discomfort | FAERS: 7 | US FAERS | |
| 145 | Bladder prolapse | FAERS: 7 | US FAERS | |
| 146 | Blood glucose decreased | FAERS: 7 | US FAERS | |
| 147 | Bone pain | FAERS: 7 | US FAERS | |
| 148 | Cataract | FAERS: 7 | US FAERS | |
| 149 | Cerebral Infarction | FAERS: 7 | US FAERS | |
| 150 | Depressed mood | FAERS: 7 | US FAERS | |
| 151 | Enuresis | FAERS: 7 | US FAERS | |
| 152 | Eye irritation | FAERS: 7 | US FAERS | |
| 153 | Flushing | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Gait inability | FAERS: 7 | US FAERS | |
| 155 | Mouth swelling | FAERS: 7 | US FAERS | |
| 156 | Nephrolithiasis | FAERS: 7 | SIDER US FAERS | |
| 157 | Petechiae | FAERS: 7 | US FAERS | |
| 158 | Product size issue | FAERS: 7 | US FAERS | |
| 159 | Residual urine volume increased | FAERS: 7 | US FAERS | |
| 160 | Stomatitis | FAERS: 7 | US FAERS | |
| 161 | Therapy cessation | FAERS: 7 | US FAERS | |
| 162 | Agitation | FAERS: 6 | US FAERS | |
| 163 | Asthma | FAERS: 6 | US FAERS | |
| 164 | Cold sweat | FAERS: 6 | US FAERS | |
| 165 | Fracture | FAERS: 6 | US FAERS | |
| 166 | Glaucoma | FAERS: 6 | SIDER US FAERS | |
| 167 | Ileus | FAERS: 6 | US FAERS | |
| 168 | Limb discomfort | FAERS: 6 | US FAERS | |
| 169 | Macular degeneration | FAERS: 6 | US FAERS | |
| 170 | Middle insomnia | FAERS: 6 | US FAERS | |
| 171 | Presyncope | FAERS: 6 | US FAERS | |
| 172 | Product label issue | FAERS: 6 | US FAERS | |
| 173 | Product packaging issue | FAERS: 6 | US FAERS | |
| 174 | Stress | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Acne | FAERS: 5 | US FAERS | |
| 176 | Ankle Fracture | FAERS: 5 | US FAERS | |
| 177 | Apathy | FAERS: 5 | US FAERS | |
| 178 | Arthropathy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Blood creatinine increased | FAERS: 5 | US FAERS | |
| 180 | Disability | FAERS: 5 | US FAERS | |
| 181 | Drug administration error | FAERS: 5 | US FAERS | |
| 182 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 183 | Erectile dysfunction | FAERS: 5 | US FAERS | |
| 184 | Feeling Cold | FAERS: 5 | US FAERS | |
| 185 | Increased upper airway secretion | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 186 | Initial insomnia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 187 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 188 | Nerve injury | FAERS: 5 | US FAERS | |
| 189 | Neuralgia | FAERS: 5 | US FAERS | |
| 190 | Poor quality sleep | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Product quality issue | FAERS: 5 | US FAERS | |
| 192 | Renal pain | FAERS: 5 | US FAERS | |
| 193 | Sepsis | FAERS: 5 | US FAERS | |
| 194 | Skin lesion | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Upper-airway cough syndrome | FAERS: 5 | US FAERS | |
| 196 | Vasculitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Vitreous floaters | FAERS: 5 | US FAERS | |
| 198 | Vulvovaginal burning sensation | FAERS: 5 | US FAERS | |
| 199 | Vulvovaginal pain | FAERS: 5 | US FAERS | |
| 200 | Ageusia | FAERS: 4 | US FAERS | |
| 201 | Alanine Aminotransferase Increased | FAERS: 4 | SIDER US FAERS | |
| 202 | Aspartate Aminotransferase Increased | FAERS: 4 | SIDER US FAERS | |
| 203 | Atrial Flutter | FAERS: 4 | US FAERS | |
| 204 | Bipolar Disorder | FAERS: 4 | US FAERS | |
| 205 | Blepharospasm | FAERS: 4 | US FAERS | |
| 206 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 207 | Bradycardia | FAERS: 4 | US FAERS | |
| 208 | Crying | FAERS: 4 | US FAERS | |
| 209 | Deafness | FAERS: 4 | US FAERS | |
| 210 | Drug effect variable | FAERS: 4 | US FAERS | |
| 211 | Dysarthria | FAERS: 4 | US FAERS | |
| 212 | Eczema | FAERS: 4 | US FAERS | |
| 213 | Emotional disorder | FAERS: 4 | US FAERS | |
| 214 | Epilepsy | FAERS: 4 | US FAERS | |
| 215 | Gastrointestinal Pain | FAERS: 4 | SIDER US FAERS | |
| 216 | Gout | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Intercepted medication error | FAERS: 4 | US FAERS | |
| 218 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 219 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 220 | Joint stiffness | FAERS: 4 | US FAERS | |
| 221 | Muscle tightness | FAERS: 4 | US FAERS | |
| 222 | Product physical issue | FAERS: 4 | US FAERS | |
| 223 | Rhinitis | FAERS: 4 | SIDER US FAERS | |
| 224 | Rosacea | FAERS: 4 | US FAERS | |
| 225 | Sciatica | FAERS: 4 | US FAERS | |
| 226 | Vulvovaginal dryness | FAERS: 4 | US FAERS | |
| 227 | Wheezing | FAERS: 4 | US FAERS | |
| 228 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 229 | Anosmia | FAERS: 3 | US FAERS | |
| 230 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 3 | US FAERS | |
| 231 | Apparent death | FAERS: 3 | US FAERS | |
| 232 | Benign Prostatic Hyperplasia | FAERS: 3 | US FAERS | |
| 233 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 234 | Breast tenderness | FAERS: 3 | US FAERS | |
| 235 | Choking | FAERS: 3 | US FAERS | |
| 236 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 237 | Drug effective for unapproved indication | FAERS: 3 | US FAERS | |
| 238 | Emotional distress | FAERS: 3 | US FAERS | |
| 239 | Food Allergy | FAERS: 3 | US FAERS | |
| 240 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 241 | Gluten sensitivity | FAERS: 3 | US FAERS | |
| 242 | Inflammation | FAERS: 3 | US FAERS | |
| 243 | Joint injury | FAERS: 3 | US FAERS | |
| 244 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 245 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 246 | Medication Error | FAERS: 3 | US FAERS | |
| 247 | Mental status changes | FAERS: 3 | US FAERS | |
| 248 | Multiple sclerosis relapse | FAERS: 3 | US FAERS | |
| 249 | Musculoskeletal discomfort | FAERS: 3 | SIDER US FAERS | |
| 250 | Myasthenia Gravis | FAERS: 3 | US FAERS | |
| 251 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 252 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 253 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 254 | Pharyngitis | FAERS: 3 | US FAERS | |
| 255 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 256 | Productive Cough | FAERS: 3 | US FAERS | |
| 257 | Psoriasis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 258 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 259 | Sinus headache | FAERS: 3 | US FAERS | |
| 260 | Toothache | FAERS: 3 | US FAERS | |
| 261 | Urinary incontinence surgery | FAERS: 3 | US FAERS | |
| 262 | Vulvovaginal discomfort | FAERS: 3 | US FAERS | |
| 263 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 264 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 265 | Abasia | FAERS: 2 | US FAERS | |
| 266 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 267 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 268 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 269 | Aneurysm | FAERS: 2 | US FAERS | |
| 270 | Animal bite | FAERS: 2 | US FAERS | |
| 271 | Anuria | FAERS: 2 | US FAERS | |
| 272 | Aphagia | FAERS: 2 | US FAERS | |
| 273 | Aphasia | FAERS: 2 | US FAERS | |
| 274 | Basal ganglia stroke | FAERS: 2 | US FAERS | |
| 275 | Biliary cirrhosis | FAERS: 2 | US FAERS | |
| 276 | Bladder cancer recurrent | FAERS: 2 | US FAERS | |
| 277 | Bladder dysfunction | FAERS: 2 | US FAERS | |
| 278 | Bladder neck suspension | FAERS: 2 | US FAERS | |
| 279 | Blepharitis | FAERS: 2 | US FAERS | |
| 280 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 281 | Blood blister | FAERS: 2 | US FAERS | |
| 282 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 283 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 284 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 285 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 286 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 287 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 288 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 289 | Cheilitis | FAERS: 2 | US FAERS | |
| 290 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 291 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 292 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 293 | Dental caries | FAERS: 2 | US FAERS | |
| 294 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 295 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 296 | Device leakage | FAERS: 2 | US FAERS | |
| 297 | Drooling | FAERS: 2 | US FAERS | |
| 298 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 299 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 300 | Endocarditis | FAERS: 2 | US FAERS | |
| 301 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 302 | Extra dose administered | FAERS: 2 | US FAERS | |
| 303 | Food Poisoning | FAERS: 2 | US FAERS | |
| 304 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 305 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 306 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 307 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 308 | Genital burning sensation | FAERS: 2 | US FAERS | |
| 309 | Genital rash | FAERS: 2 | US FAERS | |
| 310 | Glioblastoma | FAERS: 2 | US FAERS | |
| 311 | Hepatitis | FAERS: 2 | US FAERS | |
| 312 | Hernia | FAERS: 2 | US FAERS | |
| 313 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 314 | Hypokinesia | FAERS: 2 | US FAERS | |
| 315 | Hysterectomy | FAERS: 2 | US FAERS | |
| 316 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 317 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 318 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 319 | Impaired work ability | FAERS: 2 | US FAERS | |
| 320 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 321 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 322 | Locked-In Syndrome | FAERS: 2 | US FAERS | |
| 323 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 324 | Malignant Hypertension | FAERS: 2 | US FAERS | |
| 325 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 326 | Micturition frequency decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 327 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 328 | Mood swings | FAERS: 2 | US FAERS | |
| 329 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 330 | Nasal pruritus | FAERS: 2 | US FAERS | |
| 331 | Neutropenia | FAERS: 2 | US FAERS | |
| 332 | Noninfective gingivitis | FAERS: 2 | US FAERS | |
| 333 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 334 | Onychoclasis | FAERS: 2 | US FAERS | |
| 335 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 336 | Pain of skin | FAERS: 2 | US FAERS | |
| 337 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 338 | Pelvic abscess | FAERS: 2 | US FAERS | |
| 339 | Pelvic discomfort | FAERS: 2 | US FAERS | |
| 340 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 341 | Photophobia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 342 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 343 | Post procedural complication | FAERS: 2 | US FAERS | |
| 344 | Product commingling | FAERS: 2 | US FAERS | |
| 345 | Product dose omission | FAERS: 2 | US FAERS | |
| 346 | Product prescribing error | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 347 | Product use complaint | FAERS: 2 | US FAERS | |
| 348 | Pulmonary Embolism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 349 | Purpura | FAERS: 2 | SIDER US FAERS | |
| 350 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 351 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 352 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 353 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 354 | Secretion discharge | FAERS: 2 | US FAERS | |
| 355 | Sick Sinus Syndrome | FAERS: 2 | US FAERS | |
| 356 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 357 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 358 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 359 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 360 | Tachyphylaxis | FAERS: 2 | US FAERS | |
| 361 | Therapeutic response delayed | FAERS: 2 | US FAERS | |
| 362 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 363 | Tongue blistering | FAERS: 2 | US FAERS | |
| 364 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 365 | Trismus | FAERS: 2 | US FAERS | |
| 366 | Urinary tract obstruction | FAERS: 2 | US FAERS | |
| 367 | Uterine Prolapse | FAERS: 2 | US FAERS | |
| 368 | Vulvovaginal swelling | FAERS: 2 | US FAERS | |
| 369 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 370 | treatment failure | FAERS: 2 | US FAERS | |
| 371 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 372 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 373 | Acquired corneal dystrophy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 374 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 375 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 376 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 377 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 378 | Ammonia increased | FAERS: 1 | US FAERS | |
| 379 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 380 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 381 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 382 | Anger | FAERS: 1 | US FAERS | |
| 383 | Anhedonia | FAERS: 1 | US FAERS | |
| 384 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 385 | Anorgasmia | FAERS: 1 | US FAERS | |
| 386 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 387 | Aphonia | FAERS: 1 | US FAERS | |
| 388 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 389 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 390 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 391 | Balanoposthitis | FAERS: 1 | US FAERS | |
| 392 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 393 | Bedridden | FAERS: 1 | US FAERS | |
| 394 | Biliary Colic | FAERS: 1 | US FAERS | |
| 395 | Biopsy | FAERS: 1 | US FAERS | |
| 396 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 397 | Bladder trabeculation | FAERS: 1 | US FAERS | |
| 398 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 399 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 400 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 401 | Blood phosphorus decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 402 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 403 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 404 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 405 | Blood urea increased | FAERS: 1 | US FAERS | |
| 406 | Bradykinesia | FAERS: 1 | US FAERS | |
| 407 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 408 | Bronchospasm | FAERS: 1 | US FAERS | |
| 409 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 410 | Bursitis | FAERS: 1 | US FAERS | |
| 411 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 412 | Cardiac Flutter | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 413 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 414 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 415 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 416 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 417 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 418 | Catheter placement | FAERS: 1 | US FAERS | |
| 419 | Cellulitis | FAERS: 1 | US FAERS | |
| 420 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 421 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 422 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 423 | Choking sensation | FAERS: 1 | US FAERS | |
| 424 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 425 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 426 | Colitis | FAERS: 1 | US FAERS | |
| 427 | Compression fracture | FAERS: 1 | US FAERS | |
| 428 | Corneal erosion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 429 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 430 | Cystopexy | FAERS: 1 | US FAERS | |
| 431 | Dental discomfort | FAERS: 1 | US FAERS | |
| 432 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 433 | Device malfunction | FAERS: 1 | US FAERS | |
| 434 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 435 | Diabetes mellitus management | FAERS: 1 | US FAERS | |
| 436 | Diaphragmatic spasm | FAERS: 1 | US FAERS | |
| 437 | Disease complication | FAERS: 1 | US FAERS | |
| 438 | Dissociation | FAERS: 1 | US FAERS | |
| 439 | Diverticulum | FAERS: 1 | US FAERS | |
| 440 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 441 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 442 | Drug dispensing issue | FAERS: 1 | US FAERS | |
| 443 | Drug resistance | FAERS: 1 | US FAERS | |
| 444 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 445 | Dysentery | FAERS: 1 | US FAERS | |
| 446 | Dyspareunia | FAERS: 1 | US FAERS | |
| 447 | Economic problem | FAERS: 1 | US FAERS | |
| 448 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 449 | Embolism | FAERS: 1 | US FAERS | |
| 450 | Emergency Care | FAERS: 1 | US FAERS | |
| 451 | Endometriosis | FAERS: 1 | US FAERS | |
| 452 | Eosinophilia | FAERS: 1 | US FAERS | |
| 453 | Epididymitis | FAERS: 1 | US FAERS | |
| 454 | Eructation | FAERS: 1 | US FAERS | |
| 455 | Erysipelas | FAERS: 1 | US FAERS | |
| 456 | Escherichia infection | FAERS: 1 | US FAERS | |
| 457 | Exposure via father | FAERS: 1 | US FAERS | |
| 458 | Eye Infection | FAERS: 1 | US FAERS | |
| 459 | Eye ulcer | FAERS: 1 | US FAERS | |
| 460 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 461 | Eyelid infection | FAERS: 1 | US FAERS | |
| 462 | Face Lift | FAERS: 1 | US FAERS | |
| 463 | Factor XI Deficiency | FAERS: 1 | US FAERS | |
| 464 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 465 | Fluid overload | FAERS: 1 | US FAERS | |
| 466 | Folliculitis | FAERS: 1 | US FAERS | |
| 467 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 468 | Freezing phenomenon | FAERS: 1 | US FAERS | |
| 469 | Frustration | FAERS: 1 | US FAERS | |
| 470 | Gastrectomy | FAERS: 1 | US FAERS | |
| 471 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 472 | Gastric Dilatation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 473 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 474 | Gastrooesophageal sphincter insufficiency | FAERS: 1 | US FAERS | |
| 475 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 476 | Genital discharge | FAERS: 1 | US FAERS | |
| 477 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 478 | Genital swelling | FAERS: 1 | US FAERS | |
| 479 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 480 | Gingival blister | FAERS: 1 | US FAERS | |
| 481 | Gingival erythema | FAERS: 1 | US FAERS | |
| 482 | Glutathione peroxidase increased | FAERS: 1 | US FAERS | |
| 483 | Granuloma | FAERS: 1 | US FAERS | |
| 484 | Hemiplegia | FAERS: 1 | US FAERS | |
| 485 | Hepatitis A | FAERS: 1 | US FAERS | |
| 486 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 487 | Hip surgery | FAERS: 1 | US FAERS | |
| 488 | Hyperacusis | FAERS: 1 | US FAERS | |
| 489 | Hypercapnia | FAERS: 1 | US FAERS | |
| 490 | Hypersomnia | FAERS: 1 | US FAERS | |
| 491 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 492 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 493 | Implant site mass | FAERS: 1 | US FAERS | |
| 494 | Inappropriate schedule of product administration | FAERS: 1 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 495 | Incoherent | FAERS: 1 | US FAERS | |
| 496 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 497 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 498 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 499 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 500 | Joint Instability | FAERS: 1 | US FAERS | |
| 501 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 502 | Laceration | FAERS: 1 | US FAERS | |
| 503 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 504 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 505 | Laziness | FAERS: 1 | US FAERS | |
| 506 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 507 | Leukocytosis | FAERS: 1 | US FAERS | |
| 508 | Leukopenia | FAERS: 1 | US FAERS | |
| 509 | Lichen Planus | FAERS: 1 | US FAERS | |
| 510 | Ligament rupture | FAERS: 1 | US FAERS | |
| 511 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 512 | Lithotripsy | FAERS: 1 | US FAERS | |
| 513 | Liver Abscess | FAERS: 1 | US FAERS | |
| 514 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 515 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 516 | Lumbar hernia | FAERS: 1 | US FAERS | |
| 517 | Lymphoma | FAERS: 1 | US FAERS | |
| 518 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 519 | Mastication disorder | FAERS: 1 | US FAERS | |
| 520 | Mechanical ileus | FAERS: 1 | US FAERS | |
| 521 | Medical device removal | FAERS: 1 | US FAERS | |
| 522 | Meibomian gland dysfunction | FAERS: 1 | US FAERS | |
| 523 | Menorrhagia | FAERS: 1 | US FAERS | |
| 524 | Mental impairment | FAERS: 1 | US FAERS | |
| 525 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 526 | Muscle strain | FAERS: 1 | US FAERS | |
| 527 | Mydriasis | FAERS: 1 | US FAERS | |
| 528 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 529 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 530 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 531 | Neurostimulator implantation | FAERS: 1 | US FAERS | |
| 532 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 533 | Neutrophilic dermatosis | FAERS: 1 | US FAERS | |
| 534 | Nipple pain | FAERS: 1 | US FAERS | |
| 535 | Ocular icterus | FAERS: 1 | US FAERS | |
| 536 | Oliguria | FAERS: 1 | US FAERS | |
| 537 | Omental infarction | FAERS: 1 | US FAERS | |
| 538 | Onychomycosis | FAERS: 1 | US FAERS | |
| 539 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 540 | Oral pruritus | FAERS: 1 | US FAERS | |
| 541 | Orchitis | FAERS: 1 | US FAERS | |
| 542 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 543 | Osteoporosis | FAERS: 1 | US FAERS | |
| 544 | Overweight | FAERS: 1 | US FAERS | |
| 545 | Packaging design issue | FAERS: 1 | US FAERS | |
| 546 | Pallor | FAERS: 1 | US FAERS | |
| 547 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 548 | Pancreatitis | FAERS: 1 | US FAERS | |
| 549 | Pancytopenia | FAERS: 1 | US FAERS | |
| 550 | Panic Disorder | FAERS: 1 | US FAERS | |
| 551 | Paracentesis | FAERS: 1 | US FAERS | |
| 552 | Paranoia | FAERS: 1 | US FAERS | |
| 553 | Paraparesis | FAERS: 1 | US FAERS | |
| 554 | Paraplegia | FAERS: 1 | US FAERS | |
| 555 | Parotitis | FAERS: 1 | US FAERS | |
| 556 | Pelvic mass | FAERS: 1 | US FAERS | |
| 557 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 558 | Perineal rash | FAERS: 1 | US FAERS | |
| 559 | Personality Change | FAERS: 1 | US FAERS | |
| 560 | Physical disability | FAERS: 1 | US FAERS | |
| 561 | Poisoning | FAERS: 1 | US FAERS | |
| 562 | Polydipsia | FAERS: 1 | US FAERS | |
| 563 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 564 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 565 | Priapism | FAERS: 1 | US FAERS | |
| 566 | Product administration error | FAERS: 1 | US FAERS | |
| 567 | Product container seal issue | FAERS: 1 | US FAERS | |
| 568 | Product formulation issue | FAERS: 1 | US FAERS | |
| 569 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 570 | Product lot number issue | FAERS: 1 | US FAERS | |
| 571 | Product name confusion | FAERS: 1 | US FAERS | |
| 572 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 573 | Product substitution issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 574 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 575 | Pseudoangina | FAERS: 1 | US FAERS | |
| 576 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 577 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 578 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 579 | Purulence | FAERS: 1 | US FAERS | |
| 580 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 581 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 582 | Reduced bladder capacity | FAERS: 1 | US FAERS | |
| 583 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 584 | Renal Colic | FAERS: 1 | US FAERS | |
| 585 | Renal cyst | FAERS: 1 | US FAERS | |
| 586 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 587 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 588 | Respiratory distress | FAERS: 1 | US FAERS | |
| 589 | Respiratory tract congestion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 590 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 591 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 592 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 593 | Rhinalgia | FAERS: 1 | US FAERS | |
| 594 | Scab | FAERS: 1 | US FAERS | |
| 595 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 596 | Septic Shock | FAERS: 1 | US FAERS | |
| 597 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 598 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 599 | Sinus pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 600 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 601 | Skin cosmetic procedure | FAERS: 1 | US FAERS | |
| 602 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 603 | Skin irritation | FAERS: 1 | US FAERS | |
| 604 | Skin reaction | FAERS: 1 | US FAERS | |
| 605 | Skin toxicity | FAERS: 1 | US FAERS | |
| 606 | Sluggishness | FAERS: 1 | US FAERS | |
| 607 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 608 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 609 | Stevens-Johnson Syndrome | FAERS: 1 | 25811541 | CTD SIDER US FAERS |
| 610 | Sudden death | FAERS: 1 | US FAERS | |
| 611 | Suicide attempt | FAERS: 1 | US FAERS | |
| 612 | Sunburn | FAERS: 1 | US FAERS | |
| 613 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 614 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 615 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 616 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 617 | Tension | FAERS: 1 | US FAERS | |
| 618 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 619 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 620 | Therapy change | FAERS: 1 | US FAERS | |
| 621 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 622 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 623 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 624 | Tongue pigmentation | FAERS: 1 | US FAERS | |
| 625 | Tooth Loss | FAERS: 1 | US FAERS | |
| 626 | Troponin increased | FAERS: 1 | US FAERS | |
| 627 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 628 | Ureterocele | FAERS: 1 | US FAERS | |
| 629 | Urinary straining | FAERS: 1 | US FAERS | |
| 630 | Urinary tract infection staphylococcal | FAERS: 1 | US FAERS | |
| 631 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 632 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 633 | Uveitis | FAERS: 1 | US FAERS | |
| 634 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 635 | Vascular pain | FAERS: 1 | US FAERS | |
| 636 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 637 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 638 | Vocal Cord Dysfunction | FAERS: 1 | US FAERS | |
| 639 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 640 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 641 | Walking aid user | FAERS: 1 | US FAERS | |
| 642 | Wedge resection toenail | FAERS: 1 | US FAERS | |
| 643 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 644 | Wrong product administered | FAERS: 1 | US FAERS | |
| 645 | Wrong strength | FAERS: 1 | US FAERS | |
| 646 | cancer surgery | FAERS: 1 | US FAERS | |
| 647 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 648 | Application site rash | Canada Vigilance: 1 | Canada Vigilance | |
| 649 | Blood lactate dehydrogenase increased | SIDER | ||
| 650 | Erythema Multiforme | SIDER | ||
| 651 | Gamma-Glutamyltransferase Increased | SIDER | ||
| 652 | Infestation | SIDER | ||
| 653 | Lactic dehydrogenase activity increased | SIDER | ||
| 654 | Leukocytoclastic vasculitis | SIDER | ||
| 655 | Potentiating drug interaction | Canada Vigilance: 1 | Canada Vigilance | |
| 656 | Vascular purpura | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.