Methylphenidate
(JUMYIBMBTDDLNG-UHFFFAOYSA-N)
Structure
- SMILES
- COC(=O)C(c1ccccc1)C1CCCCN1.Cl
- Molecular Formula:
- C14H20ClNO2
- Molecular Weight:
- 269.767
- Log P:
- 3.2161
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 38.33
- CAS Number(s):
- 113-45-1; 298-59-9
Synonym(s)
1.
Methylphenidate
2.
Centedrin
3.
Concerta
4.
Daytrana
5.
Equasym
6.
Metadate
7.
Methylin
8.
Methylphenidate Hydrochloride
9.
Phenidylate
10.
Ritalin
11.
Ritalin-SR
12.
Ritaline
13.
Tsentedrin
14.
Hydrochloride, Methylphenidate
15.
Ritalin SR
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 711 Canada Vigilance: 61 | Canada Vigilance US FAERS | |
| 2 | Headache | FAERS: 169 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Agitation | FAERS: 161 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 4 | Anxiety | FAERS: 148 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Feeling abnormal | FAERS: 132 | US FAERS | |
| 6 | Drug effect incomplete | FAERS: 121 | US FAERS | |
| 7 | Nausea | FAERS: 118 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Vomiting | FAERS: 110 | US FAERS | |
| 9 | Product use issue | FAERS: 109 | US FAERS | |
| 10 | Toxicity to various agents | FAERS: 99 | US FAERS | |
| 11 | Product substitution issue | FAERS: 88 | US FAERS | |
| 12 | Somnolence | FAERS: 88 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Tachycardia | FAERS: 84 | US FAERS | |
| 14 | Malaise | FAERS: 82 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Product quality issue | FAERS: 77 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 16 | Crying | FAERS: 74 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Fatigue | FAERS: 74 | US FAERS | |
| 18 | Anger | FAERS: 73 | US FAERS | |
| 19 | Drug abuse | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Drug dose omission | FAERS: 69 | US FAERS | |
| 21 | Myocardial Infarction | FAERS: 68 | US FAERS | |
| 22 | Cerebrovascular accident | FAERS: 66 | US FAERS | |
| 23 | Weight decreased | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Dizziness | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Palpitations | FAERS: 57 | US FAERS | |
| 26 | Product taste abnormal | FAERS: 57 | US FAERS | |
| 27 | Tremor | FAERS: 54 | US FAERS | |
| 28 | Emotional disorder | FAERS: 52 | US FAERS | |
| 29 | Drug Dependence | FAERS: 51 | US FAERS | |
| 30 | Overdose | FAERS: 47 | US FAERS | |
| 31 | Poor quality drug administered | FAERS: 43 | US FAERS | |
| 32 | Suicide attempt | FAERS: 43 | US FAERS | |
| 33 | Restlessness | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Abdominal Pain | FAERS: 39 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 35 | Intentional product misuse | FAERS: 39 | US FAERS | |
| 36 | Drug administered to patient of inappropriate age | FAERS: 38 | US FAERS | |
| 37 | Pharmaceutical product complaint | FAERS: 38 | US FAERS | |
| 38 | Incorrect dose administered | FAERS: 36 | US FAERS | |
| 39 | Depressed mood | FAERS: 35 | US FAERS | |
| 40 | Sudden death | FAERS: 35 | US FAERS | |
| 41 | Dysgeusia | FAERS: 33 | US FAERS | |
| 42 | Nervousness | FAERS: 33 | US FAERS | |
| 43 | Drug dispensing error | FAERS: 31 | US FAERS | |
| 44 | Mydriasis | FAERS: 31 | US FAERS | |
| 45 | Chest Pain | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Educational problem | FAERS: 29 | US FAERS | |
| 47 | Hypersensitivity | FAERS: 29 | US FAERS | |
| 48 | Syncope | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Wrong technique in product usage process | FAERS: 28 | US FAERS | |
| 50 | Abdominal discomfort | FAERS: 27 | US FAERS | |
| 51 | Adverse event | FAERS: 27 | US FAERS | |
| 52 | Mood swings | FAERS: 26 | US FAERS | |
| 53 | Apathy | FAERS: 25 | US FAERS | |
| 54 | Lethargy | FAERS: 24 | US FAERS | |
| 55 | Pain | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Euphoric mood | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Retching | FAERS: 23 | US FAERS | |
| 58 | Therapeutic response unexpected with drug substitution | FAERS: 23 | US FAERS | |
| 59 | Incorrect route of drug administration | FAERS: 22 | US FAERS | |
| 60 | Product dose omission | FAERS: 22 | US FAERS | |
| 61 | Growth retardation | FAERS: 21 | US FAERS | |
| 62 | Wrong technique in drug usage process | FAERS: 21 | US FAERS | |
| 63 | Asthenia | FAERS: 20 | US FAERS | |
| 64 | Intentional drug misuse | FAERS: 20 | US FAERS | |
| 65 | Pruritus | FAERS: 18 | US FAERS | |
| 66 | Dystonia | FAERS: 17 | US FAERS | |
| 67 | Memory impairment | FAERS: 17 | US FAERS | |
| 68 | Paranoia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Personality Change | FAERS: 17 | US FAERS | |
| 70 | Stress | FAERS: 16 | US FAERS | |
| 71 | Activities of daily living impaired | FAERS: 15 | US FAERS | |
| 72 | Drug withdrawal syndrome | FAERS: 15 | US FAERS | |
| 73 | Product use in unapproved indication | FAERS: 15 | US FAERS | |
| 74 | Amnesia | FAERS: 14 | US FAERS | |
| 75 | Disorientation | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 76 | Feeling jittery | FAERS: 14 | US FAERS | |
| 77 | Intentional product use issue | FAERS: 14 | US FAERS | |
| 78 | Product physical issue | FAERS: 14 | US FAERS | |
| 79 | Urticaria | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Blood creatine phosphokinase increased | FAERS: 13 | US FAERS | |
| 81 | Drug prescribing error | FAERS: 13 | US FAERS | |
| 82 | Inappropriate schedule of drug administration | FAERS: 13 | US FAERS | |
| 83 | Intentional self-injury | FAERS: 13 | US FAERS | |
| 84 | Loss of personal independence in daily activities | FAERS: 13 | US FAERS | |
| 85 | Medication Error | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Therapeutic response unexpected | FAERS: 13 | US FAERS | |
| 87 | Arthralgia | FAERS: 12 | US FAERS | |
| 88 | Asthma | FAERS: 12 | US FAERS | |
| 89 | Cardiac Arrest | FAERS: 12 | US FAERS | |
| 90 | Deafness | FAERS: 12 | US FAERS | |
| 91 | Dysarthria | FAERS: 12 | US FAERS | |
| 92 | Erythema | FAERS: 12 | US FAERS | |
| 93 | Obsessive-Compulsive Disorder | FAERS: 12 | US FAERS | |
| 94 | Performance status decreased | FAERS: 12 | US FAERS | |
| 95 | Rebound effect | FAERS: 12 | US FAERS | |
| 96 | Alopecia | FAERS: 11 | US FAERS | |
| 97 | Constipation | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Drug diversion | FAERS: 11 | US FAERS | |
| 99 | Drug ineffective for unapproved indication | FAERS: 11 | US FAERS | |
| 100 | Initial insomnia | FAERS: 11 | US FAERS | |
| 101 | nervous system disorder | FAERS: 11 | US FAERS | |
| 102 | Bipolar Disorder | FAERS: 10 | US FAERS | |
| 103 | Emotional distress | FAERS: 10 | US FAERS | |
| 104 | Excessive eye blinking | FAERS: 10 | US FAERS | |
| 105 | Inappropriate schedule of product administration | FAERS: 10 | US FAERS | |
| 106 | Incorrect product storage | FAERS: 10 | US FAERS | |
| 107 | Neutropenia | FAERS: 10 | US FAERS | |
| 108 | Psychiatric symptom | FAERS: 10 | US FAERS | |
| 109 | Screaming | FAERS: 10 | US FAERS | |
| 110 | Trismus | FAERS: 10 | US FAERS | |
| 111 | Visual Impairment | FAERS: 10 | US FAERS | |
| 112 | Accidental exposure to product by child | FAERS: 9 | US FAERS | |
| 113 | Acute myocardial infarction | FAERS: 9 | US FAERS | |
| 114 | Chest discomfort | FAERS: 9 | US FAERS | |
| 115 | Delirium | FAERS: 9 | US FAERS | |
| 116 | Depressed Level of Consciousness | FAERS: 9 | US FAERS | |
| 117 | Drug screen negative | FAERS: 9 | US FAERS | |
| 118 | Flushing | FAERS: 9 | US FAERS | |
| 119 | Myalgia | FAERS: 9 | US FAERS | |
| 120 | Nasopharyngitis | FAERS: 9 | US FAERS | |
| 121 | Sinusitis | FAERS: 9 | US FAERS | |
| 122 | Trichotillomania | FAERS: 9 | US FAERS | |
| 123 | Underweight | FAERS: 9 | US FAERS | |
| 124 | Vertigo | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Accidental exposure to product | FAERS: 8 | US FAERS | |
| 126 | Alanine Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 127 | Cataract | FAERS: 8 | US FAERS | |
| 128 | Completed Suicide | FAERS: 8 | US FAERS | |
| 129 | Discomfort | FAERS: 8 | US FAERS | |
| 130 | Hunger | FAERS: 8 | US FAERS | |
| 131 | Neck Pain | FAERS: 8 | US FAERS | |
| 132 | Sinus Tachycardia | FAERS: 8 | US FAERS | |
| 133 | Staring | FAERS: 8 | US FAERS | |
| 134 | Tinnitus | FAERS: 8 | US FAERS | |
| 135 | Cerebral Infarction | FAERS: 7 | US FAERS | |
| 136 | Drug screen positive | FAERS: 7 | US FAERS | |
| 137 | Epistaxis | FAERS: 7 | US FAERS | |
| 138 | Expired product administered | FAERS: 7 | US FAERS | |
| 139 | Fight in school | FAERS: 7 | US FAERS | |
| 140 | Formication | FAERS: 7 | US FAERS | |
| 141 | Influenza | FAERS: 7 | US FAERS | |
| 142 | Mastication disorder | FAERS: 7 | US FAERS | |
| 143 | Pallor | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Swelling | FAERS: 7 | US FAERS | |
| 145 | Therapeutic response changed | FAERS: 7 | US FAERS | |
| 146 | Throat irritation | FAERS: 7 | US FAERS | |
| 147 | Unevaluable event | FAERS: 7 | US FAERS | |
| 148 | Wheezing | FAERS: 7 | US FAERS | |
| 149 | Accidental overdose | FAERS: 6 | US FAERS | |
| 150 | Anorexia | FAERS: 6 | US FAERS | |
| 151 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 152 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 153 | Diplopia | FAERS: 6 | US FAERS | |
| 154 | Drug administration error | FAERS: 6 | US FAERS | |
| 155 | Drug effect variable | FAERS: 6 | US FAERS | |
| 156 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 157 | Dysphemia | FAERS: 6 | US FAERS | |
| 158 | Electrocardiogram abnormal | FAERS: 6 | US FAERS | |
| 159 | Frustration tolerance decreased | FAERS: 6 | US FAERS | |
| 160 | Gastrointestinal Pain | FAERS: 6 | US FAERS | |
| 161 | Hypersomnia | FAERS: 6 | US FAERS | |
| 162 | Impaired work ability | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 164 | Prescribed overdose | FAERS: 6 | US FAERS | |
| 165 | Priapism | FAERS: 6 | US FAERS | |
| 166 | Product packaging quantity issue | FAERS: 6 | US FAERS | |
| 167 | Product preparation error | FAERS: 6 | US FAERS | |
| 168 | Abasia | FAERS: 5 | US FAERS | |
| 169 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 170 | Amphetamines positive | FAERS: 5 | US FAERS | |
| 171 | Aphasia | FAERS: 5 | US FAERS | |
| 172 | Cyanosis | FAERS: 5 | US FAERS | |
| 173 | Dysphonia | FAERS: 5 | US FAERS | |
| 174 | Epilepsy | FAERS: 5 | US FAERS | |
| 175 | Erectile dysfunction | FAERS: 5 | US FAERS | |
| 176 | Erection increased | FAERS: 5 | US FAERS | |
| 177 | Extremity necrosis | FAERS: 5 | US FAERS | |
| 178 | Feeling Cold | FAERS: 5 | US FAERS | |
| 179 | Fracture | FAERS: 5 | US FAERS | |
| 180 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 181 | Hyperphagia | FAERS: 5 | US FAERS | |
| 182 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 183 | Liquid product physical issue | FAERS: 5 | US FAERS | |
| 184 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 185 | Medication residue present | FAERS: 5 | US FAERS | |
| 186 | Mental impairment | FAERS: 5 | US FAERS | |
| 187 | Morose | FAERS: 5 | US FAERS | |
| 188 | Muscle Rigidity | FAERS: 5 | US FAERS | |
| 189 | Product container issue | FAERS: 5 | US FAERS | |
| 190 | Product formulation issue | FAERS: 5 | US FAERS | |
| 191 | Product physical consistency issue | FAERS: 5 | US FAERS | |
| 192 | Product storage error | FAERS: 5 | US FAERS | |
| 193 | Reaction to drug excipients | FAERS: 5 | US FAERS | |
| 194 | Strabismus | FAERS: 5 | US FAERS | |
| 195 | Therapeutic product effect incomplete | FAERS: 5 | US FAERS | |
| 196 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 197 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 198 | Ventricular Fibrillation | FAERS: 5 | US FAERS | |
| 199 | Accidental exposure | FAERS: 4 | US FAERS | |
| 200 | Angioedema | FAERS: 4 | US FAERS | |
| 201 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 202 | Bradycardia | FAERS: 4 | US FAERS | |
| 203 | Bruxism | FAERS: 4 | US FAERS | |
| 204 | Burning sensation | FAERS: 4 | US FAERS | |
| 205 | Cardiac enzymes increased | FAERS: 4 | US FAERS | |
| 206 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 207 | Choreoathetosis | FAERS: 4 | US FAERS | |
| 208 | Drug abuser | FAERS: 4 | US FAERS | |
| 209 | Drug effect delayed | FAERS: 4 | US FAERS | |
| 210 | Dyspepsia | FAERS: 4 | US FAERS | |
| 211 | Enuresis | FAERS: 4 | US FAERS | |
| 212 | Eye pain | FAERS: 4 | US FAERS | |
| 213 | Gingival Recession | FAERS: 4 | US FAERS | |
| 214 | Glaucoma | FAERS: 4 | US FAERS | |
| 215 | Hallucinations, mixed | FAERS: 4 | US FAERS | |
| 216 | Head discomfort | FAERS: 4 | US FAERS | |
| 217 | Hydrocephalus | FAERS: 4 | US FAERS | |
| 218 | Hypophagia | FAERS: 4 | US FAERS | |
| 219 | Hyporeflexia | FAERS: 4 | US FAERS | |
| 220 | Hypotension | FAERS: 4 | US FAERS | |
| 221 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 222 | Intercepted drug dispensing error | FAERS: 4 | US FAERS | |
| 223 | No adverse event | FAERS: 4 | US FAERS | |
| 224 | Oppositional Defiant Disorder | FAERS: 4 | US FAERS | |
| 225 | Panic Disorder | FAERS: 4 | US FAERS | |
| 226 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 227 | Pre-existing condition improved | FAERS: 4 | US FAERS | |
| 228 | Presyncope | FAERS: 4 | US FAERS | |
| 229 | Product use complaint | FAERS: 4 | US FAERS | |
| 230 | Schizophrenia | FAERS: 4 | US FAERS | |
| 231 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 232 | Ventricular arrhythmia | FAERS: 4 | US FAERS | |
| 233 | Violence-related symptom | FAERS: 4 | US FAERS | |
| 234 | jaundice | FAERS: 4 | US FAERS | |
| 235 | Akathisia | FAERS: 3 | US FAERS | |
| 236 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 237 | Arthritis | FAERS: 3 | US FAERS | |
| 238 | Ataxia | FAERS: 3 | US FAERS | |
| 239 | Blindness | FAERS: 3 | US FAERS | |
| 240 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 241 | Cerebral artery stenosis | FAERS: 3 | US FAERS | |
| 242 | Cold sweat | FAERS: 3 | US FAERS | |
| 243 | Dehydration | FAERS: 3 | US FAERS | |
| 244 | Dengue Fever | FAERS: 3 | US FAERS | |
| 245 | Dependence | FAERS: 3 | US FAERS | |
| 246 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 247 | Disease Progression | FAERS: 3 | US FAERS | |
| 248 | Dissociation | FAERS: 3 | US FAERS | |
| 249 | Drug Tolerance | FAERS: 3 | US FAERS | |
| 250 | Drug level decreased | FAERS: 3 | US FAERS | |
| 251 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 252 | Dysgraphia | FAERS: 3 | US FAERS | |
| 253 | Dyslexia | FAERS: 3 | US FAERS | |
| 254 | Dysuria | FAERS: 3 | US FAERS | |
| 255 | Ear discomfort | FAERS: 3 | US FAERS | |
| 256 | Ecchymosis | FAERS: 3 | US FAERS | |
| 257 | Electromechanical dissociation | FAERS: 3 | US FAERS | |
| 258 | Eructation | FAERS: 3 | US FAERS | |
| 259 | Hemiparesis | FAERS: 3 | US FAERS | |
| 260 | Hyperkinesia | FAERS: 3 | US FAERS | |
| 261 | Hyperreflexia | FAERS: 3 | US FAERS | |
| 262 | Hyperventilation | FAERS: 3 | US FAERS | |
| 263 | Hypomania | FAERS: 3 | US FAERS | |
| 264 | Impatience | FAERS: 3 | US FAERS | |
| 265 | Laceration | FAERS: 3 | US FAERS | |
| 266 | Leukocytosis | FAERS: 3 | US FAERS | |
| 267 | Limb discomfort | FAERS: 3 | US FAERS | |
| 268 | Limb injury | FAERS: 3 | US FAERS | |
| 269 | Lip swelling | FAERS: 3 | US FAERS | |
| 270 | Livedo Reticularis | FAERS: 3 | US FAERS | |
| 271 | Mental status changes | FAERS: 3 | US FAERS | |
| 272 | Motion Sickness | FAERS: 3 | US FAERS | |
| 273 | Myocarditis | FAERS: 3 | US FAERS | |
| 274 | Narcolepsy | FAERS: 3 | US FAERS | |
| 275 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 276 | Obesity | FAERS: 3 | US FAERS | |
| 277 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 278 | Parasomnia | FAERS: 3 | US FAERS | |
| 279 | Physical assault | FAERS: 3 | US FAERS | |
| 280 | Pneumonia | FAERS: 3 | US FAERS | |
| 281 | Poisoning | FAERS: 3 | US FAERS | |
| 282 | Product contamination physical | FAERS: 3 | US FAERS | |
| 283 | Product measured potency issue | FAERS: 3 | US FAERS | |
| 284 | Product packaging issue | FAERS: 3 | US FAERS | |
| 285 | Product size issue | FAERS: 3 | US FAERS | |
| 286 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 287 | Renal tubular acidosis | FAERS: 3 | US FAERS | |
| 288 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 289 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 290 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 291 | Tardive Dyskinesia | FAERS: 3 | US FAERS | |
| 292 | Tension | FAERS: 3 | US FAERS | |
| 293 | Thirst | FAERS: 3 | US FAERS | |
| 294 | Tonsillectomy | FAERS: 3 | US FAERS | |
| 295 | Torticollis | FAERS: 3 | US FAERS | |
| 296 | Transaminases increased | FAERS: 3 | US FAERS | |
| 297 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 298 | Urinary Retention | FAERS: 3 | US FAERS | |
| 299 | Ventricular Dysfunction | FAERS: 3 | US FAERS | |
| 300 | Visual disturbance | FAERS: 3 | US FAERS | |
| 301 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 302 | Abscess | FAERS: 2 | US FAERS | |
| 303 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 304 | Ageusia | FAERS: 2 | US FAERS | |
| 305 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 306 | Anoxic Encephalopathy | FAERS: 2 | US FAERS | |
| 307 | Aphagia | FAERS: 2 | US FAERS | |
| 308 | Aphonia | FAERS: 2 | US FAERS | |
| 309 | Appendicitis | FAERS: 2 | US FAERS | |
| 310 | Asphyxia | FAERS: 2 | US FAERS | |
| 311 | Back Pain | FAERS: 2 | US FAERS | |
| 312 | Belligerence | FAERS: 2 | US FAERS | |
| 313 | Benign Rolandic Epilepsy | FAERS: 2 | US FAERS | |
| 314 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 315 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 316 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 317 | Blood urine present | FAERS: 2 | US FAERS | |
| 318 | Body height below normal | FAERS: 2 | US FAERS | |
| 319 | Bone density decreased | FAERS: 2 | US FAERS | |
| 320 | Brain stem syndrome | FAERS: 2 | US FAERS | |
| 321 | Bronchitis | FAERS: 2 | US FAERS | |
| 322 | CD4 Lymphocytes Decreased | FAERS: 2 | US FAERS | |
| 323 | Cerebral artery occlusion | FAERS: 2 | US FAERS | |
| 324 | Choking | FAERS: 2 | US FAERS | |
| 325 | Cholestasis | FAERS: 2 | US FAERS | |
| 326 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 327 | Conduct Disorder | FAERS: 2 | US FAERS | |
| 328 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 329 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 330 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 331 | Drug toxicity | FAERS: 2 | US FAERS | |
| 332 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 333 | Encephalitis | FAERS: 2 | US FAERS | |
| 334 | Enophthalmos | FAERS: 2 | US FAERS | |
| 335 | Eye inflammation | FAERS: 2 | US FAERS | |
| 336 | Facial Paresis | FAERS: 2 | US FAERS | |
| 337 | Frustration | FAERS: 2 | US FAERS | |
| 338 | Gait inability | FAERS: 2 | US FAERS | |
| 339 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 340 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 341 | Head titubation | FAERS: 2 | US FAERS | |
| 342 | Hepatitis A | FAERS: 2 | US FAERS | |
| 343 | Hepatitis E | FAERS: 2 | US FAERS | |
| 344 | Hepatitis | FAERS: 2 | US FAERS | |
| 345 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 346 | Hostility | FAERS: 2 | US FAERS | |
| 347 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 348 | Incontinence | FAERS: 2 | US FAERS | |
| 349 | Inflammation | FAERS: 2 | US FAERS | |
| 350 | Intention tremor | FAERS: 2 | US FAERS | |
| 351 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 352 | Intentional misuse | FAERS: 2 | US FAERS | |
| 353 | Joint swelling | FAERS: 2 | US FAERS | |
| 354 | Leukopenia | FAERS: 2 | US FAERS | |
| 355 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 356 | Meningitis | FAERS: 2 | US FAERS | |
| 357 | Mental Retardation | FAERS: 2 | US FAERS | |
| 358 | Middle insomnia | FAERS: 2 | US FAERS | |
| 359 | Mutism | FAERS: 2 | US FAERS | |
| 360 | Myopathy | FAERS: 2 | US FAERS | |
| 361 | Nail picking | FAERS: 2 | US FAERS | |
| 362 | Negative thoughts | FAERS: 2 | US FAERS | |
| 363 | No adverse effect | FAERS: 2 | US FAERS | |
| 364 | Obsessive thoughts | FAERS: 2 | US FAERS | |
| 365 | Obsessive-compulsive symptom | FAERS: 2 | US FAERS | |
| 366 | Pericarditis | FAERS: 2 | US FAERS | |
| 367 | Photophobia | FAERS: 2 | US FAERS | |
| 368 | Pneumothorax | FAERS: 2 | US FAERS | |
| 369 | Polydipsia | FAERS: 2 | US FAERS | |
| 370 | Polyuria | FAERS: 2 | US FAERS | |
| 371 | Postural Orthostatic Tachycardia Syndrome | FAERS: 2 | US FAERS | |
| 372 | Pregnancy | FAERS: 2 | US FAERS | |
| 373 | Product administration error | FAERS: 2 | US FAERS | |
| 374 | Product availability issue | FAERS: 2 | US FAERS | |
| 375 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 376 | Product dispensing error | FAERS: 2 | US FAERS | |
| 377 | Psychotic symptom | FAERS: 2 | US FAERS | |
| 378 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 379 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 380 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 381 | Quadriplegia | FAERS: 2 | US FAERS | |
| 382 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 383 | Rash erythematous | FAERS: 2 | US FAERS | |
| 384 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 385 | School refusal | FAERS: 2 | US FAERS | |
| 386 | Shock | FAERS: 2 | US FAERS | |
| 387 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 388 | Sluggishness | FAERS: 2 | US FAERS | |
| 389 | Sneezing | FAERS: 2 | US FAERS | |
| 390 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 391 | Sympathomimetic Effect | FAERS: 2 | US FAERS | |
| 392 | Tetany | FAERS: 2 | US FAERS | |
| 393 | Therapy change | FAERS: 2 | US FAERS | |
| 394 | Thrombosis | FAERS: 2 | US FAERS | |
| 395 | treatment failure | FAERS: 2 | US FAERS | |
| 396 | Accelerated Idioventricular Rhythm | FAERS: 1 | US FAERS | |
| 397 | Acne fulminans | FAERS: 1 | US FAERS | |
| 398 | Activated Protein C Resistance | FAERS: 1 | US FAERS | |
| 399 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 400 | Acute psychosis | FAERS: 1 | US FAERS | |
| 401 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 402 | Agitated depression | FAERS: 1 | US FAERS | |
| 403 | Alopecia universalis | FAERS: 1 | US FAERS | |
| 404 | Amblyopia | FAERS: 1 | US FAERS | |
| 405 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 406 | Amylase increased | FAERS: 1 | US FAERS | |
| 407 | Angioplasty | FAERS: 1 | US FAERS | |
| 408 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 409 | Anhidrosis | FAERS: 1 | US FAERS | |
| 410 | Anisometropia | FAERS: 1 | US FAERS | |
| 411 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 412 | Aortic embolus | FAERS: 1 | US FAERS | |
| 413 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 414 | Application site pain | FAERS: 1 | US FAERS | |
| 415 | Arthropod bite | FAERS: 1 | US FAERS | |
| 416 | Astrocytoma | FAERS: 1 | US FAERS | |
| 417 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 418 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 419 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 420 | Bedridden | FAERS: 1 | US FAERS | |
| 421 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 422 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 423 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 424 | Blood blister | FAERS: 1 | US FAERS | |
| 425 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 426 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 427 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 428 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 429 | Blood growth hormone increased | FAERS: 1 | US FAERS | |
| 430 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 431 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 432 | Blood prolactin decreased | FAERS: 1 | US FAERS | |
| 433 | Blunted affect | FAERS: 1 | US FAERS | |
| 434 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 435 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 436 | Brain Abscess | FAERS: 1 | US FAERS | |
| 437 | Breast Cyst | FAERS: 1 | US FAERS | |
| 438 | Bronchitis mycoplasmal | FAERS: 1 | US FAERS | |
| 439 | Bronchospasm | FAERS: 1 | US FAERS | |
| 440 | Cachexia | FAERS: 1 | US FAERS | |
| 441 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 442 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 443 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 444 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 445 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 446 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 447 | Catatonia | FAERS: 1 | US FAERS | |
| 448 | Cellulitis | FAERS: 1 | US FAERS | |
| 449 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 450 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 451 | Cerebral arteritis | FAERS: 1 | US FAERS | |
| 452 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 453 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 454 | Cheilitis | FAERS: 1 | US FAERS | |
| 455 | Chills | FAERS: 1 | US FAERS | |
| 456 | Chorea | FAERS: 1 | US FAERS | |
| 457 | Claustrophobia | FAERS: 1 | US FAERS | |
| 458 | Cluster Headache | FAERS: 1 | US FAERS | |
| 459 | Complications of limb reattachment surgery | FAERS: 1 | US FAERS | |
| 460 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 461 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 462 | Conversion disorder | FAERS: 1 | US FAERS | |
| 463 | Coprolalia | FAERS: 1 | US FAERS | |
| 464 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 465 | Dementia | FAERS: 1 | US FAERS | |
| 466 | Dental caries | FAERS: 1 | US FAERS | |
| 467 | Depression suicidal | FAERS: 1 | US FAERS | |
| 468 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 469 | Diastolic hypertension | FAERS: 1 | US FAERS | |
| 470 | Diet refusal | FAERS: 1 | US FAERS | |
| 471 | Disruptive mood dysregulation disorder | FAERS: 1 | US FAERS | |
| 472 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 473 | Diverticulitis | FAERS: 1 | US FAERS | |
| 474 | Drooling | FAERS: 1 | US FAERS | |
| 475 | Drug resistance | FAERS: 1 | US FAERS | |
| 476 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 477 | Dural tear | FAERS: 1 | US FAERS | |
| 478 | Dysentery | FAERS: 1 | US FAERS | |
| 479 | Dysthymic Disorder | FAERS: 1 | US FAERS | |
| 480 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 481 | Electrocardiogram PQ interval prolonged | FAERS: 1 | US FAERS | |
| 482 | Electrocardiogram T wave peaked | FAERS: 1 | US FAERS | |
| 483 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 484 | Elevated mood | FAERS: 1 | US FAERS | |
| 485 | Emotional poverty | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 486 | Eosinophilia | FAERS: 1 | US FAERS | |
| 487 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 488 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 489 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 490 | Expired drug administered | FAERS: 1 | US FAERS | |
| 491 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 492 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 493 | Extra dose administered | FAERS: 1 | US FAERS | |
| 494 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 495 | Eye Burns | FAERS: 1 | US FAERS | |
| 496 | Eye Infection | FAERS: 1 | US FAERS | |
| 497 | Eye irritation | FAERS: 1 | US FAERS | |
| 498 | Eye symptom | FAERS: 1 | US FAERS | |
| 499 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 500 | Facial paralysis | FAERS: 1 | US FAERS | |
| 501 | Factor V Leiden mutation | FAERS: 1 | US FAERS | |
| 502 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 1 | US FAERS | |
| 503 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 504 | False negative investigation result | FAERS: 1 | US FAERS | |
| 505 | Female sex hormone level abnormal | FAERS: 1 | US FAERS | |
| 506 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 507 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 508 | Flat affect | FAERS: 1 | US FAERS | |
| 509 | Fundoscopy abnormal | FAERS: 1 | US FAERS | |
| 510 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 511 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 512 | Gaze palsy | FAERS: 1 | US FAERS | |
| 513 | Genital discomfort | FAERS: 1 | US FAERS | |
| 514 | Gingival erythema | FAERS: 1 | US FAERS | |
| 515 | Global Amnesia | FAERS: 1 | US FAERS | |
| 516 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 517 | Growth failure | FAERS: 1 | US FAERS | |
| 518 | Hemiplegia | FAERS: 1 | US FAERS | |
| 519 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 520 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 521 | Hepatitis C | FAERS: 1 | US FAERS | |
| 522 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 523 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 524 | Histrionic Personality Disorder | FAERS: 1 | US FAERS | |
| 525 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 526 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 527 | Hyperacusis | FAERS: 1 | US FAERS | |
| 528 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 529 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 530 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 531 | Hypoaldosteronism | FAERS: 1 | US FAERS | |
| 532 | Hypokinesia | FAERS: 1 | US FAERS | |
| 533 | Ideas of reference | FAERS: 1 | US FAERS | |
| 534 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 535 | Immobile | FAERS: 1 | US FAERS | |
| 536 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 537 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 538 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 539 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 540 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 541 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 542 | Infection | FAERS: 1 | US FAERS | |
| 543 | Injection site abscess | FAERS: 1 | US FAERS | |
| 544 | Injection site erythema | FAERS: 1 | US FAERS | |
| 545 | Injection site infection | FAERS: 1 | US FAERS | |
| 546 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 547 | Injection site necrosis | FAERS: 1 | US FAERS | |
| 548 | Injection site warmth | FAERS: 1 | US FAERS | |
| 549 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 550 | Intelligence test abnormal | FAERS: 1 | US FAERS | |
| 551 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 552 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 553 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 554 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 555 | Iron deficiency | FAERS: 1 | US FAERS | |
| 556 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 557 | Juvenile arthritis | FAERS: 1 | US FAERS | |
| 558 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 559 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 560 | Laryngitis | FAERS: 1 | US FAERS | |
| 561 | Laziness | FAERS: 1 | US FAERS | |
| 562 | Lichen Planus | FAERS: 1 | US FAERS | |
| 563 | Limb girth decreased | FAERS: 1 | US FAERS | |
| 564 | Low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 565 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 566 | Lyme Disease | FAERS: 1 | US FAERS | |
| 567 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 568 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 569 | Lymphomatoid Papulosis | FAERS: 1 | US FAERS | |
| 570 | Macrocephaly | FAERS: 1 | US FAERS | |
| 571 | Malabsorption | FAERS: 1 | US FAERS | |
| 572 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 573 | Mastitis | FAERS: 1 | US FAERS | |
| 574 | Meningioma | FAERS: 1 | US FAERS | |
| 575 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 576 | Metanephrine urine increased | FAERS: 1 | US FAERS | |
| 577 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 578 | Microcephaly | FAERS: 1 | US FAERS | |
| 579 | Microcytosis | FAERS: 1 | US FAERS | |
| 580 | Monoparesis | FAERS: 1 | US FAERS | |
| 581 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 582 | Multiple allergies | FAERS: 1 | US FAERS | |
| 583 | Muscle tightness | FAERS: 1 | US FAERS | |
| 584 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 585 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 586 | Myopia | FAERS: 1 | US FAERS | |
| 587 | Narcissistic Personality Disorder | FAERS: 1 | US FAERS | |
| 588 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 589 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 590 | Negativism | FAERS: 1 | US FAERS | |
| 591 | Nerve injury | FAERS: 1 | US FAERS | |
| 592 | Nocturia | FAERS: 1 | US FAERS | |
| 593 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 594 | Normetanephrine urine increased | FAERS: 1 | US FAERS | |
| 595 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 596 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 597 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 598 | Oromandibular dystonia | FAERS: 1 | US FAERS | |
| 599 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 600 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 601 | Pancreatitis | FAERS: 1 | US FAERS | |
| 602 | Paresis | FAERS: 1 | US FAERS | |
| 603 | Patient uncooperative | FAERS: 1 | US FAERS | |
| 604 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 605 | Pertussis | FAERS: 1 | US FAERS | |
| 606 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 607 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 608 | Poriomania | FAERS: 1 | US FAERS | |
| 609 | Poverty of speech | FAERS: 1 | US FAERS | |
| 610 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 611 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 612 | Pressure of speech | FAERS: 1 | US FAERS | |
| 613 | Product closure issue | FAERS: 1 | US FAERS | |
| 614 | Product container seal issue | FAERS: 1 | US FAERS | |
| 615 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 616 | Product label confusion | FAERS: 1 | US FAERS | |
| 617 | Product label issue | FAERS: 1 | US FAERS | |
| 618 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 619 | Product package associated injury | FAERS: 1 | US FAERS | |
| 620 | Product shape issue | FAERS: 1 | US FAERS | |
| 621 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 622 | Product tampering | FAERS: 1 | US FAERS | |
| 623 | Productive Cough | FAERS: 1 | US FAERS | |
| 624 | Progressive supranuclear palsy | FAERS: 1 | US FAERS | |
| 625 | Prolactinoma | FAERS: 1 | US FAERS | |
| 626 | Proteinuria | FAERS: 1 | US FAERS | |
| 627 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 628 | Psoriasis | FAERS: 1 | US FAERS | |
| 629 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 630 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 631 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 632 | Purpura | FAERS: 1 | US FAERS | |
| 633 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 634 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 635 | Regurgitation | FAERS: 1 | US FAERS | |
| 636 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 637 | Renal pain | FAERS: 1 | US FAERS | |
| 638 | Respiratory distress | FAERS: 1 | US FAERS | |
| 639 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 640 | Restrictive cardiomyopathy | FAERS: 1 | US FAERS | |
| 641 | Retinitis Pigmentosa | FAERS: 1 | US FAERS | |
| 642 | Reversible cerebral vasoconstriction syndrome | FAERS: 1 | US FAERS | |
| 643 | Rheumatic Fever | FAERS: 1 | US FAERS | |
| 644 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 645 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 646 | Rhinitis | FAERS: 1 | US FAERS | |
| 647 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 648 | Scab | FAERS: 1 | US FAERS | |
| 649 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 650 | Self Mutilation | FAERS: 1 | US FAERS | |
| 651 | Semenuria | FAERS: 1 | US FAERS | |
| 652 | Sensory processing disorder | FAERS: 1 | US FAERS | |
| 653 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 654 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 655 | Skin irritation | FAERS: 1 | US FAERS | |
| 656 | Skin reaction | FAERS: 1 | US FAERS | |
| 657 | Soliloquy | FAERS: 1 | US FAERS | |
| 658 | Somnambulism | FAERS: 1 | US FAERS | |
| 659 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 660 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 661 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 662 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 663 | Stillbirth | FAERS: 1 | US FAERS | |
| 664 | Stomatitis | FAERS: 1 | US FAERS | |
| 665 | Stubbornness | FAERS: 1 | US FAERS | |
| 666 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 667 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 668 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 669 | Suicide threat | FAERS: 1 | US FAERS | |
| 670 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 671 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 672 | Teratoma | FAERS: 1 | US FAERS | |
| 673 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 674 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 675 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 676 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 677 | Therapy cessation | FAERS: 1 | US FAERS | |
| 678 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 679 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 680 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 681 | Tongue biting | FAERS: 1 | US FAERS | |
| 682 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 683 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 684 | Tooth Loss | FAERS: 1 | US FAERS | |
| 685 | Toothache | FAERS: 1 | US FAERS | |
| 686 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 687 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 688 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 689 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 690 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 691 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 692 | Urine output increased | FAERS: 1 | US FAERS | |
| 693 | Uterine Rupture | FAERS: 1 | US FAERS | |
| 694 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 695 | Vasculitis | FAERS: 1 | US FAERS | |
| 696 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 697 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 698 | Ventricular parasystole | FAERS: 1 | US FAERS | |
| 699 | Verbigeration | FAERS: 1 | US FAERS | |
| 700 | Visual brightness | FAERS: 1 | US FAERS | |
| 701 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 702 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 703 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 704 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 705 | X-ray limb abnormal | FAERS: 1 | US FAERS | |
| 706 | Yawning | FAERS: 1 | US FAERS | |
| 707 | furuncle | FAERS: 1 | US FAERS | |
| 708 | muscle injury | FAERS: 1 | US FAERS | |
| 709 | Adjustment disorder with depressed mood | Canada Vigilance: 1 | Canada Vigilance | |
| 710 | Flatulence | Canada Vigilance: 1 | Canada Vigilance | |
| 711 | Product complaint | Canada Vigilance: 3 | Canada Vigilance | |
| 712 | Sudden onset of sleep | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.