Methadone
(FJQXCDYVZAHXNS-UHFFFAOYSA-N)
Structure
- SMILES
- CCC(=O)C(c1ccccc1)(c1ccccc1)CC(N(C)C)C.Cl
- Molecular Formula:
- C21H28ClNO
- Molecular Weight:
- 345.906
- Log P:
- 5.0940
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 20.31
- CAS Number(s):
- 125-56-4; 1095-90-5
Synonym(s)
1.
Methadone
2.
Amidone
3.
Biodone
4.
Dolophine
5.
Metadol
6.
Metasedin
7.
Methaddict
8.
Methadone Hydrochloride
9.
Methadose
10.
Methex
11.
Phenadone
12.
Phymet
13.
Physeptone
14.
Pinadone
15.
Symoron
16.
Hydrochloride, Methadone
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 571 | US FAERS | |
| 2 | Maternal exposure during pregnancy | FAERS: 267 | US FAERS | |
| 3 | Overdose | FAERS: 196 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Drug exposure during pregnancy | FAERS: 165 | US FAERS | |
| 5 | Completed Suicide | FAERS: 145 | US FAERS | |
| 6 | Suicide attempt | FAERS: 129 | US FAERS | |
| 7 | Cardiac Arrest | FAERS: 101 | US FAERS | |
| 8 | Respiratory arrest | FAERS: 97 | US FAERS | |
| 9 | Drug abuse | FAERS: 66 | US FAERS | |
| 10 | Drug toxicity | FAERS: 63 | US FAERS | |
| 11 | Accidental overdose | FAERS: 59 | US FAERS | |
| 12 | Drug diversion | FAERS: 57 | US FAERS | |
| 13 | Drug ineffective | FAERS: 49 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 14 | Respiratory Depression | FAERS: 40 | US FAERS | |
| 15 | Somnolence | FAERS: 39 | US FAERS | |
| 16 | Rhabdomyolysis | FAERS: 38 | US FAERS | |
| 17 | Bronchopneumonia | FAERS: 34 | US FAERS | |
| 18 | Hypotension | FAERS: 34 | US FAERS | |
| 19 | Medication Error | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Nausea | FAERS: 30 | US FAERS | |
| 21 | Intentional drug misuse | FAERS: 28 | US FAERS | |
| 22 | Pneumonia | FAERS: 26 | US FAERS | |
| 23 | Vomiting | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Accidental exposure to product | FAERS: 25 | US FAERS | |
| 25 | Accidental exposure | FAERS: 25 | US FAERS | |
| 26 | Sudden Cardiac Death | FAERS: 25 | US FAERS | |
| 27 | Drug abuser | FAERS: 24 | US FAERS | |
| 28 | Feeling abnormal | FAERS: 24 | US FAERS | |
| 29 | Unresponsive to stimuli | FAERS: 24 | US FAERS | |
| 30 | Malaise | FAERS: 23 | US FAERS | |
| 31 | Respiratory Failure | FAERS: 23 | US FAERS | |
| 32 | Drug withdrawal syndrome | FAERS: 21 | US FAERS | |
| 33 | Delirium | FAERS: 20 | US FAERS | |
| 34 | Anxiety | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Constipation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Pain | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Depressed Level of Consciousness | FAERS: 17 | US FAERS | |
| 38 | Hydrocephalus | FAERS: 15 | US FAERS | |
| 39 | Nystagmus | FAERS: 15 | US FAERS | |
| 40 | Strabismus | FAERS: 15 | US FAERS | |
| 41 | Sudden infant death syndrome | FAERS: 15 | US FAERS | |
| 42 | Cyanosis | FAERS: 14 | US FAERS | |
| 43 | Incorrect dose administered | FAERS: 14 | US FAERS | |
| 44 | Leukoencephalopathy | FAERS: 13 | US FAERS | |
| 45 | Agitation | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Drug Dependence | FAERS: 12 | US FAERS | |
| 47 | Drug screen positive | FAERS: 12 | US FAERS | |
| 48 | Fatigue | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Intentional misuse | FAERS: 12 | US FAERS | |
| 50 | Lethargy | FAERS: 12 | US FAERS | |
| 51 | Mental status changes | FAERS: 12 | US FAERS | |
| 52 | Poisoning | FAERS: 12 | US FAERS | |
| 53 | Asthenia | FAERS: 11 | US FAERS | |
| 54 | Bradycardia | FAERS: 11 | US FAERS | |
| 55 | Syncope | FAERS: 11 | US FAERS | |
| 56 | Accidental exposure to product by child | FAERS: 10 | US FAERS | |
| 57 | Congenital nystagmus | FAERS: 10 | US FAERS | |
| 58 | Dizziness | FAERS: 10 | US FAERS | |
| 59 | Encephalitis | FAERS: 10 | US FAERS | |
| 60 | Hypoxia | FAERS: 10 | US FAERS | |
| 61 | Multiple drug overdose | FAERS: 10 | US FAERS | |
| 62 | Accidental drug intake by child | FAERS: 9 | US FAERS | |
| 63 | Asphyxia | FAERS: 9 | US FAERS | |
| 64 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 65 | Blood potassium decreased | FAERS: 9 | US FAERS | |
| 66 | Chest Pain | FAERS: 9 | US FAERS | |
| 67 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 68 | Drug level increased | FAERS: 9 | US FAERS | |
| 69 | Hypoventilation | FAERS: 9 | US FAERS | |
| 70 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 71 | Pruritus | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Amnesia | FAERS: 8 | US FAERS | |
| 73 | Blood pressure fluctuation | FAERS: 8 | US FAERS | |
| 74 | Headache | FAERS: 8 | US FAERS | |
| 75 | Incorrect route of drug administration | FAERS: 8 | US FAERS | |
| 76 | Product quality issue | FAERS: 8 | US FAERS | |
| 77 | Restlessness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | nervous system disorder | FAERS: 8 | US FAERS | |
| 79 | Acute myocardial infarction | FAERS: 7 | US FAERS | |
| 80 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 81 | Intentional product misuse | FAERS: 7 | US FAERS | |
| 82 | Pharmaceutical product complaint | FAERS: 7 | US FAERS | |
| 83 | Product substitution issue | FAERS: 7 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 84 | Ventricular Fibrillation | FAERS: 7 | US FAERS | |
| 85 | Weight decreased | FAERS: 7 | US FAERS | |
| 86 | Accidental death | FAERS: 6 | US FAERS | |
| 87 | Blood magnesium decreased | FAERS: 6 | US FAERS | |
| 88 | Brain Death | FAERS: 6 | US FAERS | |
| 89 | Product taste abnormal | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Sudden death | FAERS: 6 | US FAERS | |
| 91 | Thrombocytosis | FAERS: 6 | US FAERS | |
| 92 | Tremor | FAERS: 6 | US FAERS | |
| 93 | Victim of homicide | FAERS: 6 | US FAERS | |
| 94 | Cardiomegaly | FAERS: 5 | US FAERS | |
| 95 | Cerebellar infarction | FAERS: 5 | US FAERS | |
| 96 | Dependence | FAERS: 5 | US FAERS | |
| 97 | Dysarthria | FAERS: 5 | US FAERS | |
| 98 | Dyspepsia | FAERS: 5 | US FAERS | |
| 99 | Hypersensitivity | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 101 | Memory impairment | FAERS: 5 | US FAERS | |
| 102 | Palpitations | FAERS: 5 | US FAERS | |
| 103 | Sexual Dysfunction | FAERS: 5 | US FAERS | |
| 104 | Sinus Tachycardia | FAERS: 5 | US FAERS | |
| 105 | Snoring | FAERS: 5 | US FAERS | |
| 106 | Stillbirth | FAERS: 5 | US FAERS | |
| 107 | Tooth Loss | FAERS: 5 | US FAERS | |
| 108 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 109 | Arteriosclerosis | FAERS: 4 | US FAERS | |
| 110 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 111 | Blood pH decreased | FAERS: 4 | US FAERS | |
| 112 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 113 | Dementia | FAERS: 4 | US FAERS | |
| 114 | Diabetic Ketoacidosis | FAERS: 4 | US FAERS | |
| 115 | Hepatomegaly | FAERS: 4 | US FAERS | |
| 116 | Hypercapnia | FAERS: 4 | US FAERS | |
| 117 | Hypertensive heart disease | FAERS: 4 | US FAERS | |
| 118 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 119 | Narcotic intoxication | FAERS: 4 | US FAERS | |
| 120 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 121 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 122 | Respiratory distress | FAERS: 4 | US FAERS | |
| 123 | Urinary Retention | FAERS: 4 | US FAERS | |
| 124 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 125 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 126 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 127 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 128 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 129 | Disorientation | FAERS: 3 | US FAERS | |
| 130 | Dysuria | FAERS: 3 | US FAERS | |
| 131 | Electromechanical dissociation | FAERS: 3 | US FAERS | |
| 132 | Exposure during breast feeding | FAERS: 3 | US FAERS | |
| 133 | Feeling Cold | FAERS: 3 | US FAERS | |
| 134 | Flushing | FAERS: 3 | US FAERS | |
| 135 | Hemiplegia | FAERS: 3 | US FAERS | |
| 136 | Impaired work ability | FAERS: 3 | US FAERS | |
| 137 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 138 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 139 | Middle insomnia | FAERS: 3 | US FAERS | |
| 140 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 141 | Mutism | FAERS: 3 | US FAERS | |
| 142 | Mydriasis | FAERS: 3 | US FAERS | |
| 143 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 144 | Pallor | FAERS: 3 | US FAERS | |
| 145 | Post procedural complication | FAERS: 3 | US FAERS | |
| 146 | Productive Cough | FAERS: 3 | US FAERS | |
| 147 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 148 | Toxic leukoencephalopathy | FAERS: 3 | US FAERS | |
| 149 | Visual Impairment | FAERS: 3 | US FAERS | |
| 150 | Abasia | FAERS: 2 | US FAERS | |
| 151 | Acidosis | FAERS: 2 | US FAERS | |
| 152 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 153 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 154 | Anger | FAERS: 2 | US FAERS | |
| 155 | Anorexia | FAERS: 2 | US FAERS | |
| 156 | Arthralgia | FAERS: 2 | US FAERS | |
| 157 | Astigmatism | FAERS: 2 | US FAERS | |
| 158 | Back Pain | FAERS: 2 | US FAERS | |
| 159 | Bedridden | FAERS: 2 | US FAERS | |
| 160 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 161 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 162 | Burning sensation | FAERS: 2 | US FAERS | |
| 163 | Chills | FAERS: 2 | US FAERS | |
| 164 | Craniosynostosis | FAERS: 2 | US FAERS | |
| 165 | Deafness | FAERS: 2 | US FAERS | |
| 166 | Death of relative | FAERS: 2 | US FAERS | |
| 167 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 168 | Dehydration | FAERS: 2 | US FAERS | |
| 169 | Dental caries | FAERS: 2 | US FAERS | |
| 170 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 171 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 172 | Drowning | FAERS: 2 | US FAERS | |
| 173 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 174 | Drug screen negative | FAERS: 2 | US FAERS | |
| 175 | Dysgeusia | FAERS: 2 | US FAERS | |
| 176 | Ear, nose and throat examination abnormal | FAERS: 2 | US FAERS | |
| 177 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 178 | Eschar | FAERS: 2 | US FAERS | |
| 179 | Flatulence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Gaze palsy | FAERS: 2 | US FAERS | |
| 181 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 182 | Heat Stroke | FAERS: 2 | US FAERS | |
| 183 | Hemiparesis | FAERS: 2 | US FAERS | |
| 184 | Hepatopulmonary Syndrome | FAERS: 2 | US FAERS | |
| 185 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 186 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 187 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 188 | Incoherent | FAERS: 2 | US FAERS | |
| 189 | Infection | FAERS: 2 | US FAERS | |
| 190 | Infectious peritonitis | FAERS: 2 | US FAERS | |
| 191 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 192 | Intoxication by breast feeding | FAERS: 2 | US FAERS | |
| 193 | Joint swelling | FAERS: 2 | US FAERS | |
| 194 | Leukocytosis | FAERS: 2 | US FAERS | |
| 195 | Lividity | FAERS: 2 | US FAERS | |
| 196 | Mental impairment | FAERS: 2 | US FAERS | |
| 197 | Mood swings | FAERS: 2 | US FAERS | |
| 198 | Myoclonus | FAERS: 2 | US FAERS | |
| 199 | Nervousness | FAERS: 2 | US FAERS | |
| 200 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 201 | Obesity | FAERS: 2 | US FAERS | |
| 202 | Partner stress | FAERS: 2 | US FAERS | |
| 203 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 204 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 205 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 206 | Rectal Prolapse | FAERS: 2 | US FAERS | |
| 207 | Sedation complication | FAERS: 2 | US FAERS | |
| 208 | Sepsis | FAERS: 2 | US FAERS | |
| 209 | Splenomegaly | FAERS: 2 | US FAERS | |
| 210 | Stupor | FAERS: 2 | US FAERS | |
| 211 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 212 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 213 | Toothache | FAERS: 2 | US FAERS | |
| 214 | Torticollis | FAERS: 2 | US FAERS | |
| 215 | Toxicologic test abnormal | FAERS: 2 | US FAERS | |
| 216 | Troponin I increased | FAERS: 2 | US FAERS | |
| 217 | Unevaluable event | FAERS: 2 | US FAERS | |
| 218 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 219 | Urticaria | FAERS: 2 | US FAERS | |
| 220 | Vasospasm | FAERS: 2 | US FAERS | |
| 221 | Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 222 | Wrong product administered | FAERS: 2 | US FAERS | |
| 223 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 224 | Abdominal Compartment Syndrome | FAERS: 1 | US FAERS | |
| 225 | Acanthosis | FAERS: 1 | US FAERS | |
| 226 | Actinomycosis | FAERS: 1 | US FAERS | |
| 227 | Acute Chest Syndrome | FAERS: 1 | US FAERS | |
| 228 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 229 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 230 | Adverse event | FAERS: 1 | US FAERS | |
| 231 | Ageusia | FAERS: 1 | US FAERS | |
| 232 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 233 | Alopecia | FAERS: 1 | US FAERS | |
| 234 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 235 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 236 | Angioedema | FAERS: 1 | US FAERS | |
| 237 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 238 | Anuria | FAERS: 1 | US FAERS | |
| 239 | Aphasia | FAERS: 1 | US FAERS | |
| 240 | Asthma | FAERS: 1 | US FAERS | |
| 241 | Atherosclerosis | FAERS: 1 | US FAERS | |
| 242 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 243 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 244 | Autonomic failure syndrome | FAERS: 1 | US FAERS | |
| 245 | Blood bicarbonate abnormal | FAERS: 1 | US FAERS | |
| 246 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 247 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 248 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 249 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 250 | Blood ethanol increased | FAERS: 1 | US FAERS | |
| 251 | Blood pH increased | FAERS: 1 | US FAERS | |
| 252 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 253 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 254 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 255 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 256 | Blood urine present | FAERS: 1 | US FAERS | |
| 257 | Bone pain | FAERS: 1 | US FAERS | |
| 258 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 259 | Bronchitis | FAERS: 1 | US FAERS | |
| 260 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 261 | Bronchospasm | FAERS: 1 | US FAERS | |
| 262 | Bruxism | FAERS: 1 | US FAERS | |
| 263 | Cancer Pain | FAERS: 1 | US FAERS | |
| 264 | Candida pneumonia | FAERS: 1 | US FAERS | |
| 265 | Cardiac Death | FAERS: 1 | US FAERS | |
| 266 | Cataract | FAERS: 1 | US FAERS | |
| 267 | Cell Death | FAERS: 1 | US FAERS | |
| 268 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 269 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 270 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 271 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 272 | Cleft Palate | FAERS: 1 | US FAERS | |
| 273 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 274 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 275 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 276 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 277 | Crush syndrome | FAERS: 1 | US FAERS | |
| 278 | Delusional perception | FAERS: 1 | US FAERS | |
| 279 | Dermatitis | FAERS: 1 | US FAERS | |
| 280 | Diplopia | FAERS: 1 | US FAERS | |
| 281 | Discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 282 | Disease Progression | FAERS: 1 | US FAERS | |
| 283 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 284 | Drug administration error | FAERS: 1 | US FAERS | |
| 285 | Drug dose omission | FAERS: 1 | US FAERS | |
| 286 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 287 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 288 | Drug level decreased | FAERS: 1 | US FAERS | |
| 289 | Drug monitoring procedure incorrectly performed | FAERS: 1 | US FAERS | |
| 290 | Dysgraphia | FAERS: 1 | US FAERS | |
| 291 | Dysmorphism | FAERS: 1 | US FAERS | |
| 292 | Dysphonia | FAERS: 1 | US FAERS | |
| 293 | Dystonia | FAERS: 1 | US FAERS | |
| 294 | Ecchymosis | FAERS: 1 | US FAERS | |
| 295 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 296 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 297 | Electrocardiogram T wave peaked | FAERS: 1 | US FAERS | |
| 298 | Electrocardiogram U-wave abnormality | FAERS: 1 | US FAERS | |
| 299 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 300 | Emotional disorder | FAERS: 1 | US FAERS | |
| 301 | Emotional distress | FAERS: 1 | US FAERS | |
| 302 | Enteritis | FAERS: 1 | US FAERS | |
| 303 | Enuresis | FAERS: 1 | US FAERS | |
| 304 | Eosinophilia | FAERS: 1 | US FAERS | |
| 305 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 306 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 307 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 308 | Excoriation | FAERS: 1 | US FAERS | |
| 309 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 310 | Eye pain | FAERS: 1 | US FAERS | |
| 311 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 312 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 313 | Fibrosis | FAERS: 1 | US FAERS | |
| 314 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 315 | Food craving | FAERS: 1 | US FAERS | |
| 316 | Formication | FAERS: 1 | US FAERS | |
| 317 | Fragile X Syndrome | FAERS: 1 | US FAERS | |
| 318 | Gastrointestinal disorder congenital | FAERS: 1 | US FAERS | |
| 319 | Glasgow coma scale abnormal | FAERS: 1 | US FAERS | |
| 320 | Gout | FAERS: 1 | US FAERS | |
| 321 | Head circumference abnormal | FAERS: 1 | US FAERS | |
| 322 | Head discomfort | FAERS: 1 | US FAERS | |
| 323 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 324 | Hepatitis B | FAERS: 1 | US FAERS | |
| 325 | Hepatitis C | FAERS: 1 | US FAERS | |
| 326 | Hepatitis | FAERS: 1 | US FAERS | |
| 327 | Hypersomnia | FAERS: 1 | US FAERS | |
| 328 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 329 | Hypophagia | FAERS: 1 | US FAERS | |
| 330 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 331 | Illogical thinking | FAERS: 1 | US FAERS | |
| 332 | Impaired self-care | FAERS: 1 | US FAERS | |
| 333 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 334 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 335 | Injection site abscess | FAERS: 1 | US FAERS | |
| 336 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 337 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 338 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 339 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 340 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 341 | Joint injury | FAERS: 1 | US FAERS | |
| 342 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 343 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 344 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 345 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 346 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 347 | Lung Abscess | FAERS: 1 | US FAERS | |
| 348 | Mastication disorder | FAERS: 1 | US FAERS | |
| 349 | Maternal use of illicit drugs | FAERS: 1 | US FAERS | |
| 350 | Megacolon | FAERS: 1 | US FAERS | |
| 351 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 352 | Mesothelioma | FAERS: 1 | US FAERS | |
| 353 | Micropenis | FAERS: 1 | US FAERS | |
| 354 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 355 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 356 | Murder | FAERS: 1 | US FAERS | |
| 357 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 358 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 359 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 360 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 361 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 362 | Myalgia | FAERS: 1 | US FAERS | |
| 363 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 364 | Necrosis | FAERS: 1 | US FAERS | |
| 365 | Neonatal aspiration | FAERS: 1 | US FAERS | |
| 366 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 367 | Neuralgia | FAERS: 1 | US FAERS | |
| 368 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 369 | No adverse event | FAERS: 1 | US FAERS | |
| 370 | No adverse reaction | FAERS: 1 | US FAERS | |
| 371 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 372 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 373 | Oculocephalogyric reflex absent | FAERS: 1 | US FAERS | |
| 374 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 375 | Overweight | FAERS: 1 | US FAERS | |
| 376 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 377 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 378 | PCO2 increased | FAERS: 1 | US FAERS | |
| 379 | PO2 decreased | FAERS: 1 | US FAERS | |
| 380 | Personality Change | FAERS: 1 | US FAERS | |
| 381 | Petechiae | FAERS: 1 | US FAERS | |
| 382 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 383 | Pierre Robin Syndrome | FAERS: 1 | US FAERS | |
| 384 | Placenta Accreta | FAERS: 1 | US FAERS | |
| 385 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 386 | Pneumothorax | FAERS: 1 | US FAERS | |
| 387 | Polysubstance abuse | FAERS: 1 | US FAERS | |
| 388 | Post-anoxic myoclonus | FAERS: 1 | US FAERS | |
| 389 | Postoperative fever | FAERS: 1 | US FAERS | |
| 390 | Pregnancy | FAERS: 1 | US FAERS | |
| 391 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 392 | Product administration error | FAERS: 1 | US FAERS | |
| 393 | Product dispensing error | FAERS: 1 | US FAERS | |
| 394 | Product formulation issue | FAERS: 1 | US FAERS | |
| 395 | Product label issue | FAERS: 1 | US FAERS | |
| 396 | Product storage error | FAERS: 1 | US FAERS | |
| 397 | Progressive supranuclear palsy | FAERS: 1 | US FAERS | |
| 398 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 399 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 400 | Purpura | FAERS: 1 | US FAERS | |
| 401 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 402 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 403 | Rectal discharge | FAERS: 1 | US FAERS | |
| 404 | Regurgitation | FAERS: 1 | US FAERS | |
| 405 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 406 | Retching | FAERS: 1 | US FAERS | |
| 407 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 408 | Shock | FAERS: 1 | US FAERS | |
| 409 | Silicon granuloma | FAERS: 1 | US FAERS | |
| 410 | Skin Erosion | FAERS: 1 | US FAERS | |
| 411 | Skin laceration | FAERS: 1 | US FAERS | |
| 412 | Skin lesion | FAERS: 1 | US FAERS | |
| 413 | Sluggishness | FAERS: 1 | US FAERS | |
| 414 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 415 | Somnambulism | FAERS: 1 | US FAERS | |
| 416 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 417 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 418 | Swelling | FAERS: 1 | US FAERS | |
| 419 | Syndactyly | FAERS: 1 | US FAERS | |
| 420 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 421 | Tachycardia | FAERS: 1 | US FAERS | |
| 422 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 423 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 424 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 425 | Tinnitus | FAERS: 1 | US FAERS | |
| 426 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 427 | Tooth Infection | FAERS: 1 | US FAERS | |
| 428 | Troponin T increased | FAERS: 1 | US FAERS | |
| 429 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 430 | Uveitis | FAERS: 1 | US FAERS | |
| 431 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 432 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 433 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 434 | Victim of child abuse | FAERS: 1 | US FAERS | |
| 435 | Visceral congestion | FAERS: 1 | US FAERS | |
| 436 | Vision abnormal neonatal | FAERS: 1 | US FAERS | |
| 437 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 438 | muscle injury | FAERS: 1 | US FAERS | |
| 439 | Throat irritation | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.