Lapatinib
(BCFGMOOMADDAQU-UHFFFAOYSA-N)
Structure
- SMILES
- Fc1cccc(c1)COc1ccc(cc1Cl)Nc1ncnc2c1cc(cc2)c1ccc(o1)CNCCS(=O)(=O)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE07
- Molecular Formula:
- C29H26ClFN4O4S
- Molecular Weight:
- 581.058
- Log P:
- 7.6838
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 114.73
- CAS Number(s):
- 231277-92-2; 388082-78-8; 913989-15-8
Synonym(s)
1.
Lapatinib
2.
GW 282974X
3.
GW 572016
4.
GW-282974X
5.
GW-572016
6.
GW282974X
7.
GW572016
8.
Lapatinib Ditosylate
9.
N-(3-chloro-4-(((3-fluorobenzyl)oxy)phenyl)-6-(5-(((2-methylsulfonyl)ethyl)amino)methyl) -2-furyl)-4-quinazolinamine
10.
Tykerb
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 380 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 2 | Fatigue | FAERS: 293 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Vomiting | FAERS: 230 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 4 | Drug ineffective | FAERS: 171 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 5 | Disease Progression | FAERS: 159 Canada Vigilance: 12 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Malaise | FAERS: 96 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Dry skin | FAERS: 93 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Asthenia | FAERS: 83 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Weight decreased | FAERS: 81 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 10 | Pruritus | FAERS: 80 | SIDER US FAERS | |
| 11 | Dehydration | FAERS: 70 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Dizziness | FAERS: 70 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Malignant neoplasm progression | FAERS: 69 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 14 | Adverse event | FAERS: 63 | OFFSIDES US FAERS | |
| 15 | Stomatitis | FAERS: 60 | SIDER US FAERS | |
| 16 | Erythema | FAERS: 56 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Headache | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 18 | Abdominal discomfort | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Dyspepsia | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 20 | Constipation | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Abdominal Pain | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Acne | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Epistaxis | FAERS: 37 | OFFSIDES SIDER US FAERS | |
| 24 | Hospice Care | FAERS: 37 | OFFSIDES US FAERS | |
| 25 | Pain | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Chest Pain | FAERS: 30 | US FAERS | |
| 27 | jaundice | FAERS: 29 | US FAERS | |
| 28 | Hepatotoxicity | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 29 | Product use in unapproved indication | FAERS: 28 | US FAERS | |
| 30 | Alanine Aminotransferase Increased | FAERS: 26 | OFFSIDES SIDER US FAERS | |
| 31 | Myocardial Infarction | FAERS: 25 | US FAERS | |
| 32 | Drug dose omission | FAERS: 24 | US FAERS | |
| 33 | Dermatitis acneiform | FAERS: 23 | SIDER US FAERS | |
| 34 | Pneumonia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Alopecia | FAERS: 22 | SIDER US FAERS | |
| 36 | Dysgeusia | FAERS: 22 | OFFSIDES US FAERS | |
| 37 | Onychoclasis | FAERS: 22 | OFFSIDES US FAERS | |
| 38 | General physical health deterioration | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 39 | Incorrect dose administered | FAERS: 21 | US FAERS | |
| 40 | Chest discomfort | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Back Pain | FAERS: 19 | SIDER US FAERS | |
| 42 | Hypersensitivity | FAERS: 19 | SIDER US FAERS | |
| 43 | Nasopharyngitis | FAERS: 19 | US FAERS | |
| 44 | Somnolence | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Drug administration error | FAERS: 18 | US FAERS | |
| 46 | Blood potassium decreased | FAERS: 17 | US FAERS | |
| 47 | Infection | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 48 | Palpitations | FAERS: 17 | SIDER US FAERS | |
| 49 | Peripheral swelling | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Skin toxicity | FAERS: 17 | US FAERS | |
| 51 | Arthralgia | FAERS: 16 | SIDER US FAERS | |
| 52 | Anorexia | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 53 | Dysphonia | FAERS: 15 | US FAERS | |
| 54 | Product use issue | FAERS: 15 | US FAERS | |
| 55 | Urticaria | FAERS: 15 | US FAERS | |
| 56 | Cerebrovascular accident | FAERS: 14 | US FAERS | |
| 57 | Myalgia | FAERS: 14 | SIDER US FAERS | |
| 58 | Oral pain | FAERS: 14 | US FAERS | |
| 59 | Burning sensation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Pericardial effusion | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 61 | Rash erythematous | FAERS: 13 | US FAERS | |
| 62 | Bone pain | FAERS: 12 | US FAERS | |
| 63 | Hypotension | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Nervousness | FAERS: 12 | US FAERS | |
| 65 | Onychalgia | FAERS: 12 | OFFSIDES US FAERS | |
| 66 | Tachycardia | FAERS: 12 | US FAERS | |
| 67 | Urinary tract infection | FAERS: 12 | US FAERS | |
| 68 | Cardiotoxicity | FAERS: 11 | SIDER US FAERS | |
| 69 | Laceration | FAERS: 11 | US FAERS | |
| 70 | Oropharyngeal pain | FAERS: 11 | OFFSIDES US FAERS | |
| 71 | Toxicity to various agents | FAERS: 11 | US FAERS | |
| 72 | Thrombosis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Visual Impairment | FAERS: 10 | US FAERS | |
| 74 | Chills | FAERS: 9 | US FAERS | |
| 75 | Feeling abnormal | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Neutropenia | FAERS: 9 | SIDER US FAERS | |
| 77 | Product quality issue | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Sinusitis | FAERS: 9 | US FAERS | |
| 79 | Skin Ulcer | FAERS: 9 | US FAERS | |
| 80 | Tremor | FAERS: 9 | US FAERS | |
| 81 | treatment failure | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 82 | Anxiety | FAERS: 8 | US FAERS | |
| 83 | Ascites | FAERS: 8 | US FAERS | |
| 84 | Cellulitis | FAERS: 8 | US FAERS | |
| 85 | Gastrointestinal toxicity | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 86 | Influenza | FAERS: 8 | US FAERS | |
| 87 | Memory impairment | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 88 | Metastasis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | No adverse event | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Retching | FAERS: 8 | US FAERS | |
| 91 | Skin irritation | FAERS: 8 | US FAERS | |
| 92 | Abasia | FAERS: 7 | US FAERS | |
| 93 | Aphagia | FAERS: 7 | OFFSIDES US FAERS | |
| 94 | Aphasia | FAERS: 7 | US FAERS | |
| 95 | Aspartate Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 96 | Dysuria | FAERS: 7 | OFFSIDES US FAERS | |
| 97 | Ejection Fraction Decreased | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 98 | Flatulence | FAERS: 7 | OFFSIDES US FAERS | |
| 99 | Inappropriate schedule of drug administration | FAERS: 7 | US FAERS | |
| 100 | Nail Infection | FAERS: 7 | OFFSIDES US FAERS | |
| 101 | Overdose | FAERS: 7 | US FAERS | |
| 102 | Pain of skin | FAERS: 7 | OFFSIDES US FAERS | |
| 103 | Syncope | FAERS: 7 | US FAERS | |
| 104 | Therapy cessation | FAERS: 7 | US FAERS | |
| 105 | Transaminases increased | FAERS: 7 | OFFSIDES US FAERS | |
| 106 | Vertigo | FAERS: 7 | US FAERS | |
| 107 | White blood cell count decreased | FAERS: 7 | US FAERS | |
| 108 | Cheilitis | FAERS: 6 | OFFSIDES US FAERS | |
| 109 | Drug toxicity | FAERS: 6 | US FAERS | |
| 110 | Hepatic Infection | FAERS: 6 | US FAERS | |
| 111 | Hypokinesia | FAERS: 6 | US FAERS | |
| 112 | Pancreatitis | FAERS: 6 | US FAERS | |
| 113 | Pulmonary thrombosis | FAERS: 6 | OFFSIDES US FAERS | |
| 114 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 115 | Angioedema | FAERS: 5 | US FAERS | |
| 116 | Blood magnesium decreased | FAERS: 5 | US FAERS | |
| 117 | Breast cancer recurrent | FAERS: 5 | US FAERS | |
| 118 | Depressed mood | FAERS: 5 | US FAERS | |
| 119 | Erysipelas | FAERS: 5 | OFFSIDES US FAERS | |
| 120 | Failure to Thrive | FAERS: 5 | US FAERS | |
| 121 | Febrile Neutropenia | FAERS: 5 | OFFSIDES US FAERS | |
| 122 | Gastritis | FAERS: 5 | US FAERS | |
| 123 | Limb injury | FAERS: 5 | US FAERS | |
| 124 | Lip swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Medication Error | FAERS: 5 | US FAERS | |
| 126 | Metastatic Neoplasm | FAERS: 5 | SIDER US FAERS | |
| 127 | Nasal discomfort | FAERS: 5 | OFFSIDES US FAERS | |
| 128 | Nephrolithiasis | FAERS: 5 | US FAERS | |
| 129 | Nonspecific reaction | FAERS: 5 | US FAERS | |
| 130 | Pulmonary arterial hypertension | FAERS: 5 | US FAERS | |
| 131 | Sepsis | FAERS: 5 | US FAERS | |
| 132 | Swelling | FAERS: 5 | US FAERS | |
| 133 | Tinnitus | FAERS: 5 | US FAERS | |
| 134 | Accidental overdose | FAERS: 4 | OFFSIDES US FAERS | |
| 135 | Amnesia | FAERS: 4 | US FAERS | |
| 136 | Blindness | FAERS: 4 | US FAERS | |
| 137 | Blood alkaline phosphatase increased | FAERS: 4 | OFFSIDES US FAERS | |
| 138 | Diplopia | FAERS: 4 | OFFSIDES US FAERS | |
| 139 | Electrolyte depletion | FAERS: 4 | OFFSIDES US FAERS | |
| 140 | Feeling Cold | FAERS: 4 | US FAERS | |
| 141 | Hepatitis | FAERS: 4 | US FAERS | |
| 142 | Hypersomnia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Incontinence | FAERS: 4 | US FAERS | |
| 144 | Laryngitis | FAERS: 4 | US FAERS | |
| 145 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 146 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 147 | Mastectomy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Mental impairment | FAERS: 4 | US FAERS | |
| 149 | Onycholysis | FAERS: 4 | US FAERS | |
| 150 | Poisoning | FAERS: 4 | US FAERS | |
| 151 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 152 | Shock | FAERS: 4 | US FAERS | |
| 153 | Skin laceration | FAERS: 4 | OFFSIDES US FAERS | |
| 154 | Skin reaction | FAERS: 4 | US FAERS | |
| 155 | Therapeutic response unexpected | FAERS: 4 | OFFSIDES US FAERS | |
| 156 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 157 | Anal Fissure | FAERS: 3 | OFFSIDES US FAERS | |
| 158 | Apparent death | FAERS: 3 | US FAERS | |
| 159 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 160 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 161 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 162 | Cataract | FAERS: 3 | US FAERS | |
| 163 | Chromaturia | FAERS: 3 | OFFSIDES US FAERS | |
| 164 | Clostridium difficile colitis | FAERS: 3 | US FAERS | |
| 165 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 166 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 167 | Corneal erosion | FAERS: 3 | US FAERS | |
| 168 | Crying | FAERS: 3 | US FAERS | |
| 169 | Cystitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 171 | Discomfort | FAERS: 3 | US FAERS | |
| 172 | Disorientation | FAERS: 3 | US FAERS | |
| 173 | Drug resistance | FAERS: 3 | US FAERS | |
| 174 | Dysarthria | FAERS: 3 | US FAERS | |
| 175 | Eye pain | FAERS: 3 | US FAERS | |
| 176 | Fingerprint loss | FAERS: 3 | US FAERS | |
| 177 | Gastric pH decreased | FAERS: 3 | US FAERS | |
| 178 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 179 | Hemiparesis | FAERS: 3 | OFFSIDES US FAERS | |
| 180 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 181 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 182 | Limb discomfort | FAERS: 3 | US FAERS | |
| 183 | Medical diet | FAERS: 3 | OFFSIDES US FAERS | |
| 184 | Musculoskeletal discomfort | FAERS: 3 | SIDER US FAERS | |
| 185 | Nail bed disorder | FAERS: 3 | US FAERS | |
| 186 | Neck Pain | FAERS: 3 | US FAERS | |
| 187 | Noninfective encephalitis | FAERS: 3 | US FAERS | |
| 188 | Onychomycosis | FAERS: 3 | US FAERS | |
| 189 | Palmar erythema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 190 | Pneumonitis | FAERS: 3 | US FAERS | |
| 191 | Productive Cough | FAERS: 3 | OFFSIDES US FAERS | |
| 192 | Psoriasis | FAERS: 3 | US FAERS | |
| 193 | Pulmonary Embolism | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Pulmonary Hypertension | FAERS: 3 | OFFSIDES US FAERS | |
| 195 | Skin Wrinkling | FAERS: 3 | OFFSIDES US FAERS | |
| 196 | Skin tightness | FAERS: 3 | US FAERS | |
| 197 | Sudden death | FAERS: 3 | US FAERS | |
| 198 | Suicide attempt | FAERS: 3 | US FAERS | |
| 199 | Terminal state | FAERS: 3 | US FAERS | |
| 200 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 201 | Throat irritation | FAERS: 3 | US FAERS | |
| 202 | Tumour haemorrhage | FAERS: 3 | US FAERS | |
| 203 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 204 | Vasculitis | FAERS: 3 | US FAERS | |
| 205 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 206 | Actinomycosis | FAERS: 2 | US FAERS | |
| 207 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 208 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 209 | Anorectal discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Asthma | FAERS: 2 | US FAERS | |
| 211 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 212 | Bedridden | FAERS: 2 | US FAERS | |
| 213 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 214 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 215 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 216 | Bronchitis | FAERS: 2 | US FAERS | |
| 217 | Cell marker increased | FAERS: 2 | US FAERS | |
| 218 | Cold sweat | FAERS: 2 | US FAERS | |
| 219 | Colitis | FAERS: 2 | US FAERS | |
| 220 | Deafness | FAERS: 2 | US FAERS | |
| 221 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 222 | Delusional perception | FAERS: 2 | US FAERS | |
| 223 | Device related infection | FAERS: 2 | US FAERS | |
| 224 | Disease complication | FAERS: 2 | US FAERS | |
| 225 | Drooling | FAERS: 2 | US FAERS | |
| 226 | Ear discomfort | FAERS: 2 | US FAERS | |
| 227 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 228 | Embolism | FAERS: 2 | US FAERS | |
| 229 | Emergency care examination | FAERS: 2 | US FAERS | |
| 230 | Emotional distress | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 231 | Encephalitis | FAERS: 2 | US FAERS | |
| 232 | Enteritis | FAERS: 2 | US FAERS | |
| 233 | Enterocolitis | FAERS: 2 | US FAERS | |
| 234 | Eye irritation | FAERS: 2 | US FAERS | |
| 235 | Feeling jittery | FAERS: 2 | US FAERS | |
| 236 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 237 | Fracture | FAERS: 2 | US FAERS | |
| 238 | Gastroenteritis | FAERS: 2 | OFFSIDES US FAERS | |
| 239 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 240 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 241 | Genital erosion | FAERS: 2 | US FAERS | |
| 242 | Glioblastoma | FAERS: 2 | OFFSIDES US FAERS | |
| 243 | Hypophagia | FAERS: 2 | US FAERS | |
| 244 | Incoherent | FAERS: 2 | US FAERS | |
| 245 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 246 | Inflammation | FAERS: 2 | US FAERS | |
| 247 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 248 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 249 | Intracranial mass | FAERS: 2 | US FAERS | |
| 250 | Joint swelling | FAERS: 2 | US FAERS | |
| 251 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 252 | Lethargy | FAERS: 2 | OFFSIDES US FAERS | |
| 253 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 254 | Limb operation | FAERS: 2 | US FAERS | |
| 255 | Lung Abscess | FAERS: 2 | US FAERS | |
| 256 | Macular degeneration | FAERS: 2 | US FAERS | |
| 257 | Multiple allergies | FAERS: 2 | US FAERS | |
| 258 | Myelitis | FAERS: 2 | US FAERS | |
| 259 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 260 | Necrosis | FAERS: 2 | US FAERS | |
| 261 | Ocular icterus | FAERS: 2 | OFFSIDES US FAERS | |
| 262 | Oncologic complication | FAERS: 2 | US FAERS | |
| 263 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 264 | Osteitis | FAERS: 2 | US FAERS | |
| 265 | Oxygen supplementation | FAERS: 2 | US FAERS | |
| 266 | Palliative Care | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 267 | Pallor | FAERS: 2 | US FAERS | |
| 268 | Pancytopenia | FAERS: 2 | US FAERS | |
| 269 | Papule | FAERS: 2 | US FAERS | |
| 270 | Perirectal abscess | FAERS: 2 | US FAERS | |
| 271 | Pharmaceutical product complaint | FAERS: 2 | OFFSIDES US FAERS | |
| 272 | Polydipsia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 273 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 274 | Portal Vein Thrombosis | FAERS: 2 | US FAERS | |
| 275 | Positron emission tomogram abnormal | FAERS: 2 | US FAERS | |
| 276 | Product size issue | FAERS: 2 | US FAERS | |
| 277 | Product use complaint | FAERS: 2 | US FAERS | |
| 278 | Pulmonary congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 279 | Regurgitation | FAERS: 2 | US FAERS | |
| 280 | Renal pain | FAERS: 2 | US FAERS | |
| 281 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 282 | Respiratory distress | FAERS: 2 | US FAERS | |
| 283 | Restlessness | FAERS: 2 | US FAERS | |
| 284 | Scab | FAERS: 2 | US FAERS | |
| 285 | Scan abnormal | FAERS: 2 | US FAERS | |
| 286 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 287 | Skin lesion | FAERS: 2 | US FAERS | |
| 288 | Stress | FAERS: 2 | US FAERS | |
| 289 | Sunburn | FAERS: 2 | US FAERS | |
| 290 | Ulcer | FAERS: 2 | US FAERS | |
| 291 | Urinary Retention | FAERS: 2 | US FAERS | |
| 292 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 293 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 294 | intensive care | FAERS: 2 | US FAERS | |
| 295 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 296 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 297 | Acoustic neuritis | FAERS: 1 | OFFSIDES US FAERS | |
| 298 | Acrodermatitis | FAERS: 1 | US FAERS | |
| 299 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 300 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 301 | Ageusia | FAERS: 1 | US FAERS | |
| 302 | Agitation | FAERS: 1 | US FAERS | |
| 303 | Anal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 304 | Anger | FAERS: 1 | US FAERS | |
| 305 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 306 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 307 | Apathy | FAERS: 1 | OFFSIDES US FAERS | |
| 308 | Arthropathy | FAERS: 1 | US FAERS | |
| 309 | Asthenopia | FAERS: 1 | US FAERS | |
| 310 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 311 | Bladder spasm | FAERS: 1 | US FAERS | |
| 312 | Blood bilirubin decreased | FAERS: 1 | US FAERS | |
| 313 | Blood bilirubin unconjugated increased | FAERS: 1 | OFFSIDES US FAERS | |
| 314 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 315 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 316 | Blood pH abnormal | FAERS: 1 | US FAERS | |
| 317 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 318 | Blood urine present | FAERS: 1 | US FAERS | |
| 319 | Bradycardia | FAERS: 1 | US FAERS | |
| 320 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 321 | Brain Contusion | FAERS: 1 | US FAERS | |
| 322 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 323 | Breast prosthesis user | FAERS: 1 | US FAERS | |
| 324 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 325 | Cachexia | FAERS: 1 | US FAERS | |
| 326 | Cancer Pain | FAERS: 1 | US FAERS | |
| 327 | Candidiasis | FAERS: 1 | US FAERS | |
| 328 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 329 | Central nervous system lesion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 330 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 331 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 332 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 333 | Colloid brain cyst | FAERS: 1 | US FAERS | |
| 334 | Completed Suicide | FAERS: 1 | US FAERS | |
| 335 | Conjunctival ulcer | FAERS: 1 | US FAERS | |
| 336 | Craniotomy | FAERS: 1 | US FAERS | |
| 337 | Cyanosis | FAERS: 1 | US FAERS | |
| 338 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 339 | Diverticulitis | FAERS: 1 | US FAERS | |
| 340 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 341 | Duodenal ulcer perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 342 | Dysentery | FAERS: 1 | US FAERS | |
| 343 | Dysgraphia | FAERS: 1 | US FAERS | |
| 344 | Early satiety | FAERS: 1 | US FAERS | |
| 345 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 346 | Electrocardiogram change | FAERS: 1 | OFFSIDES US FAERS | |
| 347 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 348 | Epilepsy | FAERS: 1 | US FAERS | |
| 349 | Eructation | FAERS: 1 | US FAERS | |
| 350 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 351 | Eye Infection | FAERS: 1 | US FAERS | |
| 352 | Facial Pain | FAERS: 1 | US FAERS | |
| 353 | Facial paralysis | FAERS: 1 | US FAERS | |
| 354 | Fear of falling | FAERS: 1 | US FAERS | |
| 355 | Fluid replacement | FAERS: 1 | US FAERS | |
| 356 | Folliculitis | FAERS: 1 | US FAERS | |
| 357 | Food Allergy | FAERS: 1 | US FAERS | |
| 358 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 359 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 360 | Full blood count increased | FAERS: 1 | US FAERS | |
| 361 | Fungating wound | FAERS: 1 | US FAERS | |
| 362 | Gait inability | FAERS: 1 | US FAERS | |
| 363 | Gamma-Glutamyltransferase Increased | FAERS: 1 | OFFSIDES US FAERS | |
| 364 | Gastric infection | FAERS: 1 | US FAERS | |
| 365 | Gastroenteritis norovirus | FAERS: 1 | OFFSIDES US FAERS | |
| 366 | Gastrointestinal infection | FAERS: 1 | OFFSIDES US FAERS | |
| 367 | Gastrointestinal motility disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 368 | Genital discomfort | FAERS: 1 | US FAERS | |
| 369 | Genital rash | FAERS: 1 | US FAERS | |
| 370 | Gingival Recession | FAERS: 1 | US FAERS | |
| 371 | Glossitis | FAERS: 1 | US FAERS | |
| 372 | Granuloma | FAERS: 1 | US FAERS | |
| 373 | Hair growth rate abnormal | FAERS: 1 | US FAERS | |
| 374 | Head discomfort | FAERS: 1 | US FAERS | |
| 375 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 376 | Hepatitis B antigen positive | FAERS: 1 | US FAERS | |
| 377 | Hepatitis B | FAERS: 1 | OFFSIDES US FAERS | |
| 378 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 379 | Hip surgery | FAERS: 1 | US FAERS | |
| 380 | Hunger | FAERS: 1 | US FAERS | |
| 381 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 382 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 383 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 384 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 385 | Hypoxia | FAERS: 1 | US FAERS | |
| 386 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 387 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 388 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 389 | Infarction | FAERS: 1 | US FAERS | |
| 390 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 391 | Initial insomnia | FAERS: 1 | US FAERS | |
| 392 | Injection | FAERS: 1 | US FAERS | |
| 393 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 394 | Intestinal resection | FAERS: 1 | US FAERS | |
| 395 | Iron deficiency | FAERS: 1 | US FAERS | |
| 396 | Keratopathy | FAERS: 1 | US FAERS | |
| 397 | Laziness | FAERS: 1 | US FAERS | |
| 398 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 399 | Living in residential institution | FAERS: 1 | US FAERS | |
| 400 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 401 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 402 | Medical device implantation | FAERS: 1 | US FAERS | |
| 403 | Meningitis | FAERS: 1 | US FAERS | |
| 404 | Mental status changes | FAERS: 1 | US FAERS | |
| 405 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 406 | Miliaria | FAERS: 1 | US FAERS | |
| 407 | Monoparesis | FAERS: 1 | US FAERS | |
| 408 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 409 | Mouth swelling | FAERS: 1 | US FAERS | |
| 410 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 411 | Muscle tightness | FAERS: 1 | US FAERS | |
| 412 | Nail bed tenderness | FAERS: 1 | US FAERS | |
| 413 | Nerve injury | FAERS: 1 | US FAERS | |
| 414 | Neuralgia | FAERS: 1 | US FAERS | |
| 415 | Neurological decompensation | FAERS: 1 | OFFSIDES US FAERS | |
| 416 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 417 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 418 | Oliguria | FAERS: 1 | US FAERS | |
| 419 | Oral fungal infection | FAERS: 1 | OFFSIDES US FAERS | |
| 420 | Oral infection | FAERS: 1 | US FAERS | |
| 421 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 422 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 423 | Oral toxicity | FAERS: 1 | US FAERS | |
| 424 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 425 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 426 | PO2 decreased | FAERS: 1 | US FAERS | |
| 427 | Pancreatic carcinoma recurrent | FAERS: 1 | US FAERS | |
| 428 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 429 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 430 | Parophthalmia | FAERS: 1 | US FAERS | |
| 431 | Performance status decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 432 | Pericarditis | FAERS: 1 | OFFSIDES US FAERS | |
| 433 | Phlebitis deep | FAERS: 1 | US FAERS | |
| 434 | Pneumothorax | FAERS: 1 | US FAERS | |
| 435 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 436 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 437 | Post procedural complication | FAERS: 1 | US FAERS | |
| 438 | Post procedural infection | FAERS: 1 | US FAERS | |
| 439 | Proctitis | FAERS: 1 | US FAERS | |
| 440 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 441 | Product dose omission | FAERS: 1 | US FAERS | |
| 442 | Product physical issue | FAERS: 1 | US FAERS | |
| 443 | Product storage error | FAERS: 1 | US FAERS | |
| 444 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 445 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 446 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 447 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 448 | Purulent discharge | FAERS: 1 | US FAERS | |
| 449 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 450 | Radiotherapy to brain | FAERS: 1 | OFFSIDES US FAERS | |
| 451 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 452 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 453 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 454 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 455 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 456 | Sciatica | FAERS: 1 | US FAERS | |
| 457 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 458 | Septic Shock | FAERS: 1 | US FAERS | |
| 459 | Seroma | FAERS: 1 | US FAERS | |
| 460 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 461 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 462 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 463 | Therapy change | FAERS: 1 | US FAERS | |
| 464 | Thirst | FAERS: 1 | US FAERS | |
| 465 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 466 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 467 | Tongue biting | FAERS: 1 | US FAERS | |
| 468 | Tongue eruption | FAERS: 1 | US FAERS | |
| 469 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 470 | Tooth Loss | FAERS: 1 | US FAERS | |
| 471 | Toothache | FAERS: 1 | US FAERS | |
| 472 | Underweight | FAERS: 1 | US FAERS | |
| 473 | Unevaluable event | FAERS: 1 | US FAERS | |
| 474 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 475 | Urine output increased | FAERS: 1 | US FAERS | |
| 476 | Visual disturbance | FAERS: 1 | US FAERS | |
| 477 | Vital functions abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 478 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 479 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 480 | Wound Infection | FAERS: 1 | US FAERS | |
| 481 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 482 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 483 | Alanine aminotransferase abnormal | OFFSIDES | ||
| 484 | Alcohol withdrawal syndrome | OFFSIDES | ||
| 485 | Altered bowel function | OFFSIDES | ||
| 486 | Alveolitis | OFFSIDES | ||
| 487 | Ammonia increased | OFFSIDES | ||
| 488 | Anal inflammation | OFFSIDES | ||
| 489 | Anaphylactic shock | SIDER | ||
| 490 | Anhedonia | OFFSIDES | ||
| 491 | Anticonvulsant drug level increased | OFFSIDES | ||
| 492 | Arterial thrombosis | OFFSIDES | ||
| 493 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 494 | Asphyxia | OFFSIDES | ||
| 495 | Astigmatism | OFFSIDES | ||
| 496 | Atrial Flutter | OFFSIDES | ||
| 497 | Atrophic vulvovaginitis | OFFSIDES | ||
| 498 | Autoimmune hepatitis | OFFSIDES | ||
| 499 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 500 | Bile duct stent insertion | Canada Vigilance: 1 | Canada Vigilance | |
| 501 | Bile output | OFFSIDES | ||
| 502 | Bladder neck obstruction | OFFSIDES | ||
| 503 | Blood alkaline phosphatase | OFFSIDES | ||
| 504 | Blood and lymphatic system disorders | SIDER | ||
| 505 | Blood bilirubin abnormal | OFFSIDES | ||
| 506 | Blood chloride decreased | OFFSIDES | ||
| 507 | Blood phosphorus increased | OFFSIDES | ||
| 508 | Blood test normal | OFFSIDES | ||
| 509 | Blood uric acid | OFFSIDES | ||
| 510 | Brain Death | OFFSIDES | ||
| 511 | Bronchiolitis | OFFSIDES | ||
| 512 | Catheter site infection | OFFSIDES | ||
| 513 | Cell Death | OFFSIDES | ||
| 514 | Cerebellar Ataxia | OFFSIDES | ||
| 515 | Cervical dysplasia | OFFSIDES | ||
| 516 | Cervicitis human papilloma virus | OFFSIDES | ||
| 517 | Cervicobrachial syndrome | OFFSIDES | ||
| 518 | Chemical and Drug Induced Liver Injury | 26958860 28437613 | CTD | |
| 519 | Choking sensation | OFFSIDES | ||
| 520 | Cholangiolitis | OFFSIDES | ||
| 521 | Clostridium difficile sepsis | OFFSIDES | ||
| 522 | Creatinine renal clearance increased | OFFSIDES | ||
| 523 | Dental prosthesis user | OFFSIDES | ||
| 524 | Diarrhea | OFFSIDES | ||
| 525 | Diastolic dysfunction | OFFSIDES | ||
| 526 | Diverticulum | OFFSIDES | ||
| 527 | Drowsiness | OFFSIDES | ||
| 528 | Ear congestion | OFFSIDES | ||
| 529 | Eczema | OFFSIDES | ||
| 530 | Ejection fraction abnormal | OFFSIDES | ||
| 531 | Enzyme abnormality | OFFSIDES | ||
| 532 | Escherichia sepsis | OFFSIDES | ||
| 533 | Escherichia urinary tract infection | OFFSIDES | ||
| 534 | Exfoliative rash | OFFSIDES | ||
| 535 | Granulocyte count decreased | OFFSIDES | ||
| 536 | Granulocytosis | OFFSIDES | ||
| 537 | Haptoglobin Decreased | OFFSIDES | ||
| 538 | Hemicephalalgia | OFFSIDES | ||
| 539 | Hiccough | OFFSIDES | ||
| 540 | Hydrothorax | OFFSIDES | ||
| 541 | Hypercapnia | OFFSIDES | ||
| 542 | Hypercreatinaemia | OFFSIDES | ||
| 543 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 544 | Infestation | SIDER | ||
| 545 | Intermittent Claudication | OFFSIDES | ||
| 546 | Intestinal Fistula | OFFSIDES | ||
| 547 | Left ventricular ejection fraction decreased | SIDER | ||
| 548 | Leukopenia neonatal | OFFSIDES | ||
| 549 | Lung hyperinflation | OFFSIDES | ||
| 550 | Malignant tumour excision | OFFSIDES | ||
| 551 | Mechanical urticaria | OFFSIDES | ||
| 552 | Mediastinal mass | OFFSIDES | ||
| 553 | Mediastinoscopy | OFFSIDES | ||
| 554 | Monoplegia | OFFSIDES | ||
| 555 | Myocardial fibrosis | OFFSIDES | ||
| 556 | Neoplasms, Experimental | 18829547 | CTD | |
| 557 | Oligodipsia | OFFSIDES | ||
| 558 | Oral polypectomy | OFFSIDES | ||
| 559 | Oropharyngeal plaque | OFFSIDES | ||
| 560 | Orthopnea | OFFSIDES | ||
| 561 | Ototoxicity | OFFSIDES | ||
| 562 | Paranoia | Canada Vigilance: 1 | Canada Vigilance | |
| 563 | Pelvic venous thrombosis | OFFSIDES | ||
| 564 | Perihepatic discomfort | OFFSIDES | ||
| 565 | Peripheral nerve palsy | OFFSIDES | ||
| 566 | Physical disability | OFFSIDES | ||
| 567 | Plantar erythema | OFFSIDES | ||
| 568 | Platelet adhesiveness increased | OFFSIDES | ||
| 569 | Pleural Infection | OFFSIDES | ||
| 570 | Pleurodesis | OFFSIDES | ||
| 571 | Portal hypertensive gastropathy | OFFSIDES | ||
| 572 | Post procedural swelling | OFFSIDES | ||
| 573 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 574 | Pseudomonal sepsis | OFFSIDES | ||
| 575 | Pulmonary Infarction | OFFSIDES | ||
| 576 | Pulmonary microemboli | OFFSIDES | ||
| 577 | Radiation necrosis | OFFSIDES | ||
| 578 | Radiation skin injury | OFFSIDES | ||
| 579 | Rales | OFFSIDES | ||
| 580 | Reflux gastritis | OFFSIDES | ||
| 581 | Retrocollis | OFFSIDES | ||
| 582 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 583 | Rhonchi | OFFSIDES | ||
| 584 | Sinoatrial Block | OFFSIDES | ||
| 585 | Skin Erosion | OFFSIDES | ||
| 586 | Snoring | OFFSIDES | ||
| 587 | Soft Tissue Injuries | OFFSIDES | ||
| 588 | Status Epilepticus | OFFSIDES | ||
| 589 | Stent occlusion | OFFSIDES | ||
| 590 | Stent related infection | OFFSIDES | ||
| 591 | Stomach Neoplasms | 21335337 | CTD | |
| 592 | Subileus | OFFSIDES | ||
| 593 | Thoracotomy | OFFSIDES | ||
| 594 | Tooth repair | OFFSIDES | ||
| 595 | Tracheitis | OFFSIDES | ||
| 596 | Ventricular Dysfunction, Left | 20832415 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.