Tramadol
(PPKXEPBICJTCRU-XMZRARIVSA-N)
Structure
- SMILES
- COc1cccc(c1)[C@@]1(O)CCCC[C@@H]1CN(C)C.Cl
- Molecular Formula:
- C16H26ClNO2
- Molecular Weight:
- 299.836
- Log P:
- 3.4366
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.7
- CAS Number(s):
- 22204-88-2; 36282-47-0; 53611-16-8; 148229-78-1; 194602-08-9
Synonym(s)
1.
Tramadol
2.
Adolonta
3.
Amadol
4.
Biodalgic
5.
Biokanol
6.
Contramal
7.
Jutadol
8.
K-315
9.
MTW-Tramadol
10.
Nobligan
11.
Prontofort
12.
Ranitidin 1A Pharma
13.
Takadol
14.
Theradol
15.
Tiral
16.
Topalgic
17.
Tradol
18.
Tradol-Puren
19.
Tradonal
20.
Tralgiol
21.
Trama 1A Pharma
22.
Trama AbZ
23.
Trama KD
24.
Trama-Dorsch
25.
Tramabeta
26.
Tramadin
27.
Tramadoc
28.
Tramadol 1A
29.
Tramadol AL
30.
Tramadol Asta Medica
31.
Tramadol Basics
32.
Tramadol Bayvit
33.
Tramadol Bexal
34.
Tramadol Cinfa
35.
Tramadol Edigen
36.
Tramadol Heumann
37.
Tramadol Hydrochloride
38.
Tramadol Kern
39.
Tramadol Lichtenstein
40.
Tramadol Lindo
41.
Tramadol Mabo
42.
Tramadol Normon
43.
Tramadol PB
44.
Tramadol Ratiopharm
45.
Tramadol Stada
46.
Tramadol acis
47.
Tramadol-Dolgit
48.
Tramadol-Hameln
49.
Tramadol-ratiopharm
50.
Tramadolor
51.
Tramadura
52.
Tramagetic
53.
Tramagit
54.
Tramake
55.
Tramal
56.
Tramex
57.
Tramundin
58.
Trasedal
59.
Ultram
60.
Xymel 50
61.
Zamudol
62.
Zumalgic
63.
Zydol
64.
Zytram
65.
K 315
66.
K315
67.
MTW Tramadol
68.
MTWTramadol
69.
Tradol Puren
70.
TradolPuren
71.
Trama Dorsch
72.
TramaDorsch
73.
Tramadol Dolgit
74.
Tramadol Hameln
75.
TramadolDolgit
76.
TramadolHameln
77.
Tramadolratiopharm
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 266 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 216 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 3 | Vomiting | FAERS: 214 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 4 | Dizziness | FAERS: 171 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 5 | Overdose | FAERS: 160 | US FAERS | |
| 6 | Hypersensitivity | FAERS: 116 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Toxicity to various agents | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Pruritus | FAERS: 93 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 9 | Drug Dependence | FAERS: 92 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 10 | Somnolence | FAERS: 91 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 11 | Headache | FAERS: 79 | US FAERS | |
| 12 | Drug abuse | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Tremor | FAERS: 73 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 14 | Malaise | FAERS: 68 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 15 | Drug withdrawal syndrome | FAERS: 64 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 16 | Feeling abnormal | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 17 | Pain | FAERS: 57 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Respiratory Depression | FAERS: 52 | US FAERS | |
| 19 | Completed Suicide | FAERS: 51 | US FAERS | |
| 20 | Asthenia | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Anxiety | FAERS: 45 | US FAERS | |
| 22 | Suicide attempt | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Agitation | FAERS: 42 | US FAERS | |
| 24 | Fatigue | FAERS: 41 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 25 | Constipation | FAERS: 38 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 26 | Tachycardia | FAERS: 38 | US FAERS | |
| 27 | Urticaria | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Intentional product misuse | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Drug dose omission | FAERS: 33 | US FAERS | |
| 30 | Adverse event | FAERS: 32 | US FAERS | |
| 31 | Palpitations | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Disorientation | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Medication Error | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Poisoning | FAERS: 29 | US FAERS | |
| 35 | Vertigo | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Incorrect dose administered | FAERS: 27 | US FAERS | |
| 37 | Mental status changes | FAERS: 27 | US FAERS | |
| 38 | Euphoric mood | FAERS: 26 | US FAERS | |
| 39 | Abdominal Pain | FAERS: 24 | US FAERS | |
| 40 | Dependence | FAERS: 24 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 41 | Product substitution issue | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Restlessness | FAERS: 24 | US FAERS | |
| 43 | Rhabdomyolysis | FAERS: 24 | US FAERS | |
| 44 | Abdominal discomfort | FAERS: 23 | US FAERS | |
| 45 | Depressed Level of Consciousness | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Accidental overdose | FAERS: 22 | US FAERS | |
| 47 | Unresponsive to stimuli | FAERS: 22 | US FAERS | |
| 48 | Chills | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 49 | Intentional drug misuse | FAERS: 21 | US FAERS | |
| 50 | Pharmaceutical product complaint | FAERS: 20 | US FAERS | |
| 51 | Unevaluable event | FAERS: 20 | US FAERS | |
| 52 | Cardiac Arrest | FAERS: 19 | US FAERS | |
| 53 | Cerebrovascular accident | FAERS: 19 | US FAERS | |
| 54 | Chest Pain | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Dehydration | FAERS: 19 | US FAERS | |
| 56 | Hypotension | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Weight decreased | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 58 | Blood creatine phosphokinase increased | FAERS: 18 | US FAERS | |
| 59 | Urinary Retention | FAERS: 18 | US FAERS | |
| 60 | Accidental drug intake by child | FAERS: 17 | US FAERS | |
| 61 | Drug toxicity | FAERS: 17 | US FAERS | |
| 62 | Erythema | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Serotonin Syndrome | FAERS: 17 | US FAERS | |
| 64 | Syncope | FAERS: 17 | US FAERS | |
| 65 | Chest discomfort | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Cyanosis | FAERS: 16 | US FAERS | |
| 67 | Lethargy | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Myoclonus | FAERS: 16 | US FAERS | |
| 69 | Respiratory arrest | FAERS: 16 | US FAERS | |
| 70 | Amnesia | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 71 | Delirium | FAERS: 15 | US FAERS | |
| 72 | Musculoskeletal stiffness | FAERS: 15 | US FAERS | |
| 73 | Prescription drug used without a prescription | FAERS: 15 | US FAERS | |
| 74 | Back Pain | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Cold sweat | FAERS: 14 | US FAERS | |
| 76 | Drug screen positive | FAERS: 14 | US FAERS | |
| 77 | Dysarthria | FAERS: 14 | US FAERS | |
| 78 | Electrocardiogram abnormal | FAERS: 14 | US FAERS | |
| 79 | Mydriasis | FAERS: 14 | US FAERS | |
| 80 | Pneumonia | FAERS: 14 | US FAERS | |
| 81 | Formication | FAERS: 13 | US FAERS | |
| 82 | Pallor | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 83 | Product quality issue | FAERS: 13 | US FAERS | |
| 84 | Sinus Tachycardia | FAERS: 13 | US FAERS | |
| 85 | Wrong technique in drug usage process | FAERS: 13 | US FAERS | |
| 86 | Acidosis | FAERS: 12 | US FAERS | |
| 87 | Dysgeusia | FAERS: 12 | US FAERS | |
| 88 | Erectile dysfunction | FAERS: 12 | US FAERS | |
| 89 | Hemiplegia | FAERS: 12 | US FAERS | |
| 90 | Hypersomnia | FAERS: 12 | US FAERS | |
| 91 | Impaired work ability | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 92 | Inadequate analgesia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Metabolic acidosis | FAERS: 12 | US FAERS | |
| 94 | Shock | FAERS: 12 | US FAERS | |
| 95 | Swelling | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Therapeutic response unexpected with drug substitution | FAERS: 12 | US FAERS | |
| 97 | Bradycardia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Drug dispensing error | FAERS: 11 | US FAERS | |
| 99 | Drug exposure during pregnancy | FAERS: 11 | US FAERS | |
| 100 | Dysphonia | FAERS: 11 | US FAERS | |
| 101 | Inappropriate schedule of drug administration | FAERS: 11 | US FAERS | |
| 102 | Tinnitus | FAERS: 11 | US FAERS | |
| 103 | Visual Impairment | FAERS: 11 | US FAERS | |
| 104 | Abasia | FAERS: 10 | US FAERS | |
| 105 | Burning sensation | FAERS: 10 | US FAERS | |
| 106 | Drug administration error | FAERS: 10 | US FAERS | |
| 107 | Dysuria | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Impaired driving ability | FAERS: 10 | US FAERS | |
| 109 | Memory impairment | FAERS: 10 | US FAERS | |
| 110 | Nervousness | FAERS: 10 | US FAERS | |
| 111 | Restless Legs Syndrome | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Sopor | FAERS: 10 | US FAERS | |
| 113 | Wheezing | FAERS: 10 | US FAERS | |
| 114 | Angioedema | FAERS: 9 | US FAERS | |
| 115 | Anorexia | FAERS: 9 | US FAERS | |
| 116 | Drug Tolerance | FAERS: 9 | US FAERS | |
| 117 | Flushing | FAERS: 9 | US FAERS | |
| 118 | Immobile | FAERS: 9 | US FAERS | |
| 119 | Lip swelling | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 120 | Maternal exposure during pregnancy | FAERS: 9 | US FAERS | |
| 121 | Myalgia | FAERS: 9 | US FAERS | |
| 122 | Pancreatitis | FAERS: 9 | US FAERS | |
| 123 | Presyncope | FAERS: 9 | US FAERS | |
| 124 | Product use issue | FAERS: 9 | US FAERS | |
| 125 | Urinary Incontinence | FAERS: 9 | US FAERS | |
| 126 | Accidental exposure | FAERS: 8 | US FAERS | |
| 127 | Altered state of consciousness | FAERS: 8 | US FAERS | |
| 128 | Arthralgia | FAERS: 8 | US FAERS | |
| 129 | Aspartate Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 130 | Ataxia | FAERS: 8 | US FAERS | |
| 131 | Blood glucose increased | FAERS: 8 | US FAERS | |
| 132 | Depressed mood | FAERS: 8 | US FAERS | |
| 133 | Hypoventilation | FAERS: 8 | US FAERS | |
| 134 | Hypoxia | FAERS: 8 | US FAERS | |
| 135 | Multiple drug overdose | FAERS: 8 | US FAERS | |
| 136 | Opisthotonus | FAERS: 8 | US FAERS | |
| 137 | Paranoia | FAERS: 8 | US FAERS | |
| 138 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 139 | Respiratory distress | FAERS: 8 | US FAERS | |
| 140 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 141 | Bone pain | FAERS: 7 | US FAERS | |
| 142 | Clonus | FAERS: 7 | US FAERS | |
| 143 | Crying | FAERS: 7 | US FAERS | |
| 144 | Dementia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Drug level increased | FAERS: 7 | US FAERS | |
| 146 | Dystonia | FAERS: 7 | US FAERS | |
| 147 | Epilepsy | FAERS: 7 | US FAERS | |
| 148 | Feeling Cold | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Middle insomnia | FAERS: 7 | US FAERS | |
| 150 | Muscle tightness | FAERS: 7 | US FAERS | |
| 151 | Prescription form tampering | FAERS: 7 | US FAERS | |
| 152 | Rash erythematous | FAERS: 7 | US FAERS | |
| 153 | Retching | FAERS: 7 | US FAERS | |
| 154 | Sepsis | FAERS: 7 | US FAERS | |
| 155 | Alanine Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 156 | Alopecia | FAERS: 6 | US FAERS | |
| 157 | Analgesic drug level above therapeutic | FAERS: 6 | US FAERS | |
| 158 | Analgesic drug level increased | FAERS: 6 | US FAERS | |
| 159 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 160 | Blood potassium increased | FAERS: 6 | US FAERS | |
| 161 | Discomfort | FAERS: 6 | US FAERS | |
| 162 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 163 | Feeling jittery | FAERS: 6 | US FAERS | |
| 164 | Flatulence | FAERS: 6 | US FAERS | |
| 165 | Hypokinesia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Neuralgia | FAERS: 6 | US FAERS | |
| 167 | Screaming | FAERS: 6 | US FAERS | |
| 168 | Starvation | FAERS: 6 | US FAERS | |
| 169 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 170 | Accidental death | FAERS: 5 | US FAERS | |
| 171 | Accidental exposure to product by child | FAERS: 5 | US FAERS | |
| 172 | Anger | FAERS: 5 | US FAERS | |
| 173 | Apathy | FAERS: 5 | US FAERS | |
| 174 | Blood creatinine increased | FAERS: 5 | US FAERS | |
| 175 | Drug abuser | FAERS: 5 | US FAERS | |
| 176 | Drug diversion | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Electrocardiogram change | FAERS: 5 | US FAERS | |
| 178 | Hypophagia | FAERS: 5 | US FAERS | |
| 179 | Ileus | FAERS: 5 | US FAERS | |
| 180 | Influenza | FAERS: 5 | US FAERS | |
| 181 | Intestinal Obstruction | FAERS: 5 | US FAERS | |
| 182 | Loss of personal independence in daily activities | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Neck Pain | FAERS: 5 | US FAERS | |
| 184 | Photophobia | FAERS: 5 | US FAERS | |
| 185 | Product taste abnormal | FAERS: 5 | US FAERS | |
| 186 | Thirst | FAERS: 5 | US FAERS | |
| 187 | Visceral congestion | FAERS: 5 | US FAERS | |
| 188 | nervous system disorder | FAERS: 5 | US FAERS | |
| 189 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 190 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 191 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 192 | Aphasia | FAERS: 4 | US FAERS | |
| 193 | Asterixis | FAERS: 4 | US FAERS | |
| 194 | Asthma | FAERS: 4 | US FAERS | |
| 195 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 196 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 197 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 198 | Drug level above therapeutic | FAERS: 4 | US FAERS | |
| 199 | Drug screen false positive | FAERS: 4 | US FAERS | |
| 200 | Drug withdrawal convulsions | FAERS: 4 | US FAERS | |
| 201 | Economic problem | FAERS: 4 | US FAERS | |
| 202 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 203 | Emotional disorder | FAERS: 4 | US FAERS | |
| 204 | Expired drug administered | FAERS: 4 | US FAERS | |
| 205 | Freezing phenomenon | FAERS: 4 | US FAERS | |
| 206 | Hyperreflexia | FAERS: 4 | US FAERS | |
| 207 | Hyporeflexia | FAERS: 4 | US FAERS | |
| 208 | Incoherent | FAERS: 4 | US FAERS | |
| 209 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 210 | Infection | FAERS: 4 | US FAERS | |
| 211 | Joint stiffness | FAERS: 4 | US FAERS | |
| 212 | Joint swelling | FAERS: 4 | US FAERS | |
| 213 | Medication tampering | FAERS: 4 | US FAERS | |
| 214 | Multi-organ disorder | FAERS: 4 | US FAERS | |
| 215 | Multiple allergies | FAERS: 4 | US FAERS | |
| 216 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 217 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 218 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 219 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 220 | Regurgitation | FAERS: 4 | US FAERS | |
| 221 | Status Epilepticus | FAERS: 4 | US FAERS | |
| 222 | Supraventricular tachycardia | FAERS: 4 | US FAERS | |
| 223 | Troponin I increased | FAERS: 4 | US FAERS | |
| 224 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 225 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 226 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 227 | Anticholinergic Syndrome | FAERS: 3 | US FAERS | |
| 228 | Apparent life threatening event | FAERS: 3 | US FAERS | |
| 229 | Ascites | FAERS: 3 | US FAERS | |
| 230 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 231 | Blood urine present | FAERS: 3 | US FAERS | |
| 232 | Breakthrough Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Bruxism | FAERS: 3 | US FAERS | |
| 234 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 235 | Electrocardiogram repolarisation abnormality | FAERS: 3 | US FAERS | |
| 236 | Extra dose administered | FAERS: 3 | US FAERS | |
| 237 | Feeding disorder neonatal | FAERS: 3 | US FAERS | |
| 238 | Feeling of body temperature change | FAERS: 3 | US FAERS | |
| 239 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 240 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 241 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 242 | Hypomania | FAERS: 3 | US FAERS | |
| 243 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 244 | Joint injury | FAERS: 3 | US FAERS | |
| 245 | Monoparesis | FAERS: 3 | US FAERS | |
| 246 | Mood swings | FAERS: 3 | US FAERS | |
| 247 | Morbid thoughts | FAERS: 3 | US FAERS | |
| 248 | Nephrosclerosis | FAERS: 3 | US FAERS | |
| 249 | Panic Disorder | FAERS: 3 | US FAERS | |
| 250 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 251 | Rectal tenesmus | FAERS: 3 | US FAERS | |
| 252 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 253 | Sneezing | FAERS: 3 | US FAERS | |
| 254 | Stomatitis | FAERS: 3 | US FAERS | |
| 255 | Tardive Dyskinesia | FAERS: 3 | US FAERS | |
| 256 | Therapy cessation | FAERS: 3 | US FAERS | |
| 257 | Throat irritation | FAERS: 3 | US FAERS | |
| 258 | Thrombosis | FAERS: 3 | US FAERS | |
| 259 | Traumatic Brain Injury | FAERS: 3 | US FAERS | |
| 260 | Trismus | FAERS: 3 | US FAERS | |
| 261 | Ulcer | FAERS: 3 | US FAERS | |
| 262 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 263 | jaundice | FAERS: 3 | US FAERS | |
| 264 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 265 | Aphagia | FAERS: 2 | US FAERS | |
| 266 | Arthritis | FAERS: 2 | US FAERS | |
| 267 | Blindness | FAERS: 2 | US FAERS | |
| 268 | Blood creatine phosphokinase MB increased | FAERS: 2 | US FAERS | |
| 269 | Blood glucose decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 270 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 271 | Blood sodium abnormal | FAERS: 2 | US FAERS | |
| 272 | Blood urea increased | FAERS: 2 | US FAERS | |
| 273 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 274 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 275 | Chromaturia | FAERS: 2 | US FAERS | |
| 276 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 277 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 278 | Consciousness fluctuating | FAERS: 2 | US FAERS | |
| 279 | Deafness | FAERS: 2 | US FAERS | |
| 280 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 281 | Dental caries | FAERS: 2 | US FAERS | |
| 282 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 283 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 284 | Diverticulitis | FAERS: 2 | US FAERS | |
| 285 | Drooling | FAERS: 2 | US FAERS | |
| 286 | Drowning | FAERS: 2 | US FAERS | |
| 287 | Drug exposure via breast milk | FAERS: 2 | US FAERS | |
| 288 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 289 | Dysphemia | FAERS: 2 | US FAERS | |
| 290 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 291 | Excoriation | FAERS: 2 | US FAERS | |
| 292 | Eye irritation | FAERS: 2 | US FAERS | |
| 293 | Eye pain | FAERS: 2 | US FAERS | |
| 294 | Facial paralysis | FAERS: 2 | US FAERS | |
| 295 | False negative investigation result | FAERS: 2 | US FAERS | |
| 296 | Fracture | FAERS: 2 | US FAERS | |
| 297 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 298 | Gaze palsy | FAERS: 2 | US FAERS | |
| 299 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 300 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 301 | Homicide | FAERS: 2 | US FAERS | |
| 302 | Hyperacusis | FAERS: 2 | US FAERS | |
| 303 | Hypercapnia | FAERS: 2 | US FAERS | |
| 304 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 305 | Hyperventilation | FAERS: 2 | US FAERS | |
| 306 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 307 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 308 | Initial insomnia | FAERS: 2 | US FAERS | |
| 309 | Injection site abscess | FAERS: 2 | US FAERS | |
| 310 | Intentional misuse | FAERS: 2 | US FAERS | |
| 311 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 312 | Limb discomfort | FAERS: 2 | US FAERS | |
| 313 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 314 | Mental impairment | FAERS: 2 | US FAERS | |
| 315 | Near Drowning | FAERS: 2 | US FAERS | |
| 316 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 317 | Neonatal tachycardia | FAERS: 2 | US FAERS | |
| 318 | Nerve injury | FAERS: 2 | US FAERS | |
| 319 | Neutrophil percentage increased | FAERS: 2 | US FAERS | |
| 320 | Night sweats | FAERS: 2 | US FAERS | |
| 321 | No reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 322 | Nystagmus | FAERS: 2 | US FAERS | |
| 323 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 324 | Obstruction | FAERS: 2 | US FAERS | |
| 325 | Peripheral swelling | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 326 | Pharyngitis | FAERS: 2 | US FAERS | |
| 327 | Pneumatosis intestinalis | FAERS: 2 | US FAERS | |
| 328 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 329 | Product dispensing error | FAERS: 2 | US FAERS | |
| 330 | Product formulation issue | FAERS: 2 | US FAERS | |
| 331 | Product packaging issue | FAERS: 2 | US FAERS | |
| 332 | Productive Cough | FAERS: 2 | US FAERS | |
| 333 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 334 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 335 | Renal cyst | FAERS: 2 | US FAERS | |
| 336 | Schizophrenia | FAERS: 2 | US FAERS | |
| 337 | Septic Shock | FAERS: 2 | US FAERS | |
| 338 | Sluggishness | FAERS: 2 | US FAERS | |
| 339 | Somnambulism | FAERS: 2 | US FAERS | |
| 340 | Spermatozoa progressive motility decreased | FAERS: 2 | US FAERS | |
| 341 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 342 | Tablet physical issue | FAERS: 2 | US FAERS | |
| 343 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 344 | Tongue biting | FAERS: 2 | US FAERS | |
| 345 | Torticollis | FAERS: 2 | US FAERS | |
| 346 | Transaminases increased | FAERS: 2 | US FAERS | |
| 347 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 348 | Victim of sexual abuse | FAERS: 2 | US FAERS | |
| 349 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 350 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 351 | treatment failure | FAERS: 2 | US FAERS | |
| 352 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 353 | Acne | FAERS: 1 | US FAERS | |
| 354 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 355 | Acute psychosis | FAERS: 1 | US FAERS | |
| 356 | Agoraphobia | FAERS: 1 | US FAERS | |
| 357 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 358 | Ammonia increased | FAERS: 1 | US FAERS | |
| 359 | Anal Fistula | FAERS: 1 | US FAERS | |
| 360 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 361 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 362 | Antisocial Personality Disorder | FAERS: 1 | US FAERS | |
| 363 | Anuria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 364 | Aphonia | FAERS: 1 | US FAERS | |
| 365 | Apparent death | FAERS: 1 | US FAERS | |
| 366 | Arcus lipoides | FAERS: 1 | US FAERS | |
| 367 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 368 | Arthropathy | FAERS: 1 | US FAERS | |
| 369 | Arthropod bite | FAERS: 1 | US FAERS | |
| 370 | Asphyxia | FAERS: 1 | US FAERS | |
| 371 | Back disorder | FAERS: 1 | US FAERS | |
| 372 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 373 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 374 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 375 | Blood antidiuretic hormone increased | FAERS: 1 | US FAERS | |
| 376 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 377 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 378 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 379 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 380 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 381 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 382 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 383 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 384 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 385 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 386 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 387 | Blood pressure orthostatic decreased | FAERS: 1 | US FAERS | |
| 388 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 389 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 390 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 391 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 392 | Bowel movement irregularity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 393 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 394 | Bronchospasm | FAERS: 1 | US FAERS | |
| 395 | Bursitis | FAERS: 1 | US FAERS | |
| 396 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 397 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 398 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 399 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 400 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 401 | Choking | FAERS: 1 | US FAERS | |
| 402 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 403 | Circumstantiality | FAERS: 1 | US FAERS | |
| 404 | Cleft Palate | FAERS: 1 | US FAERS | |
| 405 | Cleft uvula | FAERS: 1 | US FAERS | |
| 406 | Clumsiness | FAERS: 1 | US FAERS | |
| 407 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 408 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 409 | Compression fracture | FAERS: 1 | US FAERS | |
| 410 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 411 | Conversion disorder | FAERS: 1 | US FAERS | |
| 412 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 413 | Cystitis | FAERS: 1 | US FAERS | |
| 414 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 415 | Decompression Sickness | FAERS: 1 | US FAERS | |
| 416 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 417 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 418 | Diplegia | FAERS: 1 | US FAERS | |
| 419 | Disability | FAERS: 1 | US FAERS | |
| 420 | Disease recurrence | FAERS: 1 | US FAERS | |
| 421 | Diverticulum | FAERS: 1 | US FAERS | |
| 422 | Dry skin | FAERS: 1 | US FAERS | |
| 423 | Dyschezia | FAERS: 1 | US FAERS | |
| 424 | Dysmorphism | FAERS: 1 | US FAERS | |
| 425 | Dyspepsia | FAERS: 1 | US FAERS | |
| 426 | Ear discomfort | FAERS: 1 | US FAERS | |
| 427 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 428 | Emergency Care | FAERS: 1 | US FAERS | |
| 429 | Emotional distress | FAERS: 1 | US FAERS | |
| 430 | Enuresis | FAERS: 1 | US FAERS | |
| 431 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 432 | Epiglottitis | FAERS: 1 | US FAERS | |
| 433 | Epistaxis | FAERS: 1 | US FAERS | |
| 434 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 435 | Exophthalmos | FAERS: 1 | US FAERS | |
| 436 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 437 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 438 | Eye inflammation | FAERS: 1 | US FAERS | |
| 439 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 1 | US FAERS | |
| 440 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 441 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 442 | Flank Pain | FAERS: 1 | US FAERS | |
| 443 | Flat affect | FAERS: 1 | US FAERS | |
| 444 | Flight of ideas | FAERS: 1 | US FAERS | |
| 445 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 446 | Food Allergy | FAERS: 1 | US FAERS | |
| 447 | Food aversion | FAERS: 1 | US FAERS | |
| 448 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 449 | Gastritis | FAERS: 1 | US FAERS | |
| 450 | Gastrointestinal Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 451 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 452 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 453 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 454 | Gout | FAERS: 1 | US FAERS | |
| 455 | Granuloma | FAERS: 1 | US FAERS | |
| 456 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 457 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 458 | Heat Stroke | FAERS: 1 | US FAERS | |
| 459 | Hemiparesis | FAERS: 1 | US FAERS | |
| 460 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 461 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 462 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 463 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 464 | Hypervigilance | FAERS: 1 | US FAERS | |
| 465 | Illogical thinking | FAERS: 1 | US FAERS | |
| 466 | Impatience | FAERS: 1 | US FAERS | |
| 467 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 468 | Incontinence | FAERS: 1 | US FAERS | |
| 469 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 470 | Infarction | FAERS: 1 | US FAERS | |
| 471 | Inflammation | FAERS: 1 | US FAERS | |
| 472 | Infusion site abscess | FAERS: 1 | US FAERS | |
| 473 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 474 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 475 | Intercepted wrong patient selected | FAERS: 1 | US FAERS | |
| 476 | Internal injury | FAERS: 1 | US FAERS | |
| 477 | Intubation | FAERS: 1 | US FAERS | |
| 478 | Laceration | FAERS: 1 | US FAERS | |
| 479 | Leukocytosis | FAERS: 1 | US FAERS | |
| 480 | Lid lag | FAERS: 1 | US FAERS | |
| 481 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 482 | Lyme Disease | FAERS: 1 | US FAERS | |
| 483 | Macular degeneration | FAERS: 1 | US FAERS | |
| 484 | Malacoplakia | FAERS: 1 | US FAERS | |
| 485 | Mastication disorder | FAERS: 1 | US FAERS | |
| 486 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 487 | Medication residue present | FAERS: 1 | US FAERS | |
| 488 | Meningitis | FAERS: 1 | US FAERS | |
| 489 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 490 | Metaplasia | FAERS: 1 | US FAERS | |
| 491 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 492 | Myopathy | FAERS: 1 | US FAERS | |
| 493 | Narcotic intoxication | FAERS: 1 | US FAERS | |
| 494 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 495 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 496 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 497 | Neutropenia | FAERS: 1 | US FAERS | |
| 498 | No adverse event | FAERS: 1 | US FAERS | |
| 499 | Nonspecific reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 500 | Obesity | FAERS: 1 | US FAERS | |
| 501 | Occult blood positive | FAERS: 1 | US FAERS | |
| 502 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 503 | Onychoclasis | FAERS: 1 | US FAERS | |
| 504 | Opiates positive | FAERS: 1 | US FAERS | |
| 505 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 506 | Oral pruritus | FAERS: 1 | US FAERS | |
| 507 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 508 | Ototoxicity | FAERS: 1 | US FAERS | |
| 509 | PO2 decreased | FAERS: 1 | US FAERS | |
| 510 | Pain of skin | FAERS: 1 | US FAERS | |
| 511 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 512 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 513 | Peroneal nerve injury | FAERS: 1 | US FAERS | |
| 514 | Persistent depressive disorder | FAERS: 1 | US FAERS | |
| 515 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 516 | Physical assault | FAERS: 1 | US FAERS | |
| 517 | Piloerection | FAERS: 1 | US FAERS | |
| 518 | Polydipsia | FAERS: 1 | US FAERS | |
| 519 | Post procedural complication | FAERS: 1 | US FAERS | |
| 520 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 521 | Predisposition to disease | FAERS: 1 | US FAERS | |
| 522 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 523 | Pressure of speech | FAERS: 1 | US FAERS | |
| 524 | Priapism | FAERS: 1 | US FAERS | |
| 525 | Product administration error | FAERS: 1 | US FAERS | |
| 526 | Product coating issue | FAERS: 1 | US FAERS | |
| 527 | Product commingling | FAERS: 1 | US FAERS | |
| 528 | Product contamination chemical | FAERS: 1 | US FAERS | |
| 529 | Product dropper issue | FAERS: 1 | US FAERS | |
| 530 | Product label issue | FAERS: 1 | US FAERS | |
| 531 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 532 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 533 | Product tampering | FAERS: 1 | US FAERS | |
| 534 | Product use complaint | FAERS: 1 | US FAERS | |
| 535 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 536 | Proteinuria | FAERS: 1 | US FAERS | |
| 537 | Psychotic symptom | FAERS: 1 | US FAERS | |
| 538 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 539 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 540 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 541 | Rebound effect | FAERS: 1 | US FAERS | |
| 542 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 543 | Reversed hot-cold sensation | FAERS: 1 | US FAERS | |
| 544 | Reversible cerebral vasoconstriction syndrome | FAERS: 1 | US FAERS | |
| 545 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 546 | Selective eating disorder | FAERS: 1 | US FAERS | |
| 547 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 548 | Sinusitis | FAERS: 1 | US FAERS | |
| 549 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 550 | Skin irritation | FAERS: 1 | US FAERS | |
| 551 | Skin laceration | FAERS: 1 | US FAERS | |
| 552 | Skin reaction | FAERS: 1 | US FAERS | |
| 553 | Slow speech | FAERS: 1 | US FAERS | |
| 554 | Snoring | FAERS: 1 | US FAERS | |
| 555 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 556 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 557 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 558 | Stress | FAERS: 1 | US FAERS | |
| 559 | Substance-induced mood disorder | FAERS: 1 | US FAERS | |
| 560 | Sudden death | FAERS: 1 | US FAERS | |
| 561 | Sunburn | FAERS: 1 | US FAERS | |
| 562 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 563 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 564 | Tension | FAERS: 1 | US FAERS | |
| 565 | Theft | FAERS: 1 | US FAERS | |
| 566 | Therapeutic agent urine negative | FAERS: 1 | US FAERS | |
| 567 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 568 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 569 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 570 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 571 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 572 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 573 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 574 | Tongue spasm | FAERS: 1 | US FAERS | |
| 575 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 576 | Tooth Loss | FAERS: 1 | US FAERS | |
| 577 | Toothache | FAERS: 1 | US FAERS | |
| 578 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 579 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 580 | Troponin increased | FAERS: 1 | US FAERS | |
| 581 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 582 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 583 | Vasculitis | FAERS: 1 | US FAERS | |
| 584 | Venous occlusion | FAERS: 1 | US FAERS | |
| 585 | Visual disturbance | FAERS: 1 | US FAERS | |
| 586 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 587 | Vitreous Detachment | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 588 | Vitreous floaters | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 589 | Vocal Cord Dysfunction | FAERS: 1 | US FAERS | |
| 590 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 591 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 592 | Weight decrease neonatal | FAERS: 1 | US FAERS | |
| 593 | Wrong dose | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 594 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 595 | Yawning | FAERS: 1 | US FAERS | |
| 596 | muscle injury | FAERS: 1 | US FAERS | |
| 597 | Anaphylactoid Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 598 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 599 | Ocular icterus | Canada Vigilance: 1 | Canada Vigilance | |
| 600 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 601 | Product residue present | Canada Vigilance: 2 | Canada Vigilance | |
| 602 | Transient psychosis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.