Tamoxifen
(FQZYTYWMLGAPFJ-OQKDUQJOSA-N)
Structure
- SMILES
- OC(=O)C(CC(=O)O)(CC(=O)O)O.CC/C(=C(\c1ccccc1)/c1ccc(cc1)OCCN(C)C)/c1ccccc1
- Molecular Formula:
- C32H37NO8
- Molecular Weight:
- 563.638
- Log P:
- 4.7476
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 144.6
- CAS Number(s):
- 54965-24-1
Synonym(s)
1.
Tamoxifen
2.
ICI-46,474
3.
ICI-46474
4.
ICI-47699
5.
Nolvadex
6.
Novaldex
7.
Soltamox
8.
Tamoxifen Citrate
9.
Tomaxithen
10.
Zitazonium
11.
Citrate, Tamoxifen
12.
ICI 46,474
13.
ICI 46474
14.
ICI 47699
15.
ICI46,474
16.
ICI46474
17.
ICI47699
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Uterine Polyp | FAERS: 32 | US FAERS | |
| 2 | Arthralgia | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Thrombosis | FAERS: 26 | US FAERS | |
| 4 | Nausea | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 5 | Fatigue | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Breast cancer recurrent | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Alopecia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Cerebrovascular accident | FAERS: 17 | US FAERS | |
| 9 | Pulmonary Embolism | FAERS: 17 | US FAERS | |
| 10 | Deep Vein Thrombosis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Bone pain | FAERS: 15 | US FAERS | |
| 12 | Deafness | FAERS: 15 | US FAERS | |
| 13 | Uterine Cancer | FAERS: 15 | US FAERS | |
| 14 | Hysterectomy | FAERS: 14 | US FAERS | |
| 15 | Endometrial hypertrophy | FAERS: 13 | US FAERS | |
| 16 | Product substitution issue | FAERS: 13 | US FAERS | |
| 17 | Disease Progression | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Endometrial Hyperplasia | FAERS: 12 | US FAERS | |
| 19 | Malaise | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Pain | FAERS: 12 | US FAERS | |
| 21 | Dizziness | FAERS: 11 | US FAERS | |
| 22 | Headache | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Drug exposure during pregnancy | FAERS: 9 | US FAERS | |
| 24 | Malignant neoplasm progression | FAERS: 9 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 25 | Memory impairment | FAERS: 9 | US FAERS | |
| 26 | Vaginal Discharge | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Asthenia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Back Pain | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Disease recurrence | FAERS: 8 | US FAERS | |
| 30 | Drug ineffective | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Endometriosis | FAERS: 8 | US FAERS | |
| 32 | Ovarian Hyperstimulation Syndrome | FAERS: 8 | US FAERS | |
| 33 | Retinal Detachment | FAERS: 8 | US FAERS | |
| 34 | Scotoma | FAERS: 8 | US FAERS | |
| 35 | Amnesia | FAERS: 7 | US FAERS | |
| 36 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 37 | Cataract | FAERS: 7 | US FAERS | |
| 38 | Night sweats | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Optic Neuropathy | FAERS: 7 | US FAERS | |
| 40 | Pruritus | FAERS: 7 | US FAERS | |
| 41 | Urticaria | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Vitreous Detachment | FAERS: 7 | US FAERS | |
| 43 | Vomiting | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | Weight decreased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Anger | FAERS: 6 | US FAERS | |
| 46 | Anxiety | FAERS: 6 | US FAERS | |
| 47 | Cerebral Infarction | FAERS: 6 | US FAERS | |
| 48 | Dyspepsia | FAERS: 6 | US FAERS | |
| 49 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 50 | Hypersensitivity | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Hysteroscopy | FAERS: 6 | US FAERS | |
| 52 | Myalgia | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 53 | Rheumatoid Arthritis | FAERS: 6 | US FAERS | |
| 54 | Vasculitis | FAERS: 6 | US FAERS | |
| 55 | Vitreous floaters | FAERS: 6 | US FAERS | |
| 56 | Blindness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Contralateral breast cancer | FAERS: 5 | US FAERS | |
| 58 | Crying | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Erythema | FAERS: 5 | US FAERS | |
| 60 | Flushing | FAERS: 5 | US FAERS | |
| 61 | Ocular Toxicity | FAERS: 5 | US FAERS | |
| 62 | Optic Atrophy | FAERS: 5 | US FAERS | |
| 63 | Osteoporosis | FAERS: 5 | US FAERS | |
| 64 | Ovarian adenoma | FAERS: 5 | US FAERS | |
| 65 | Pulmonary thrombosis | FAERS: 5 | US FAERS | |
| 66 | Salpingitis | FAERS: 5 | US FAERS | |
| 67 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 68 | Arthritis | FAERS: 4 | US FAERS | |
| 69 | Asthma | FAERS: 4 | US FAERS | |
| 70 | Blood follicle stimulating hormone decreased | FAERS: 4 | US FAERS | |
| 71 | Cachexia | FAERS: 4 | US FAERS | |
| 72 | Cataract operation | FAERS: 4 | US FAERS | |
| 73 | Cervical polyp | FAERS: 4 | US FAERS | |
| 74 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 75 | Constipation | FAERS: 4 | US FAERS | |
| 76 | Dry skin | FAERS: 4 | US FAERS | |
| 77 | Embolism | FAERS: 4 | US FAERS | |
| 78 | Metrorrhagia | FAERS: 4 | US FAERS | |
| 79 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 80 | Nerve Root Compression | FAERS: 4 | US FAERS | |
| 81 | Optic Neuritis | FAERS: 4 | US FAERS | |
| 82 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 83 | Porphyria non-acute | FAERS: 4 | US FAERS | |
| 84 | Radiculopathy | FAERS: 4 | US FAERS | |
| 85 | Rash erythematous | FAERS: 4 | US FAERS | |
| 86 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 87 | Seronegative arthritis | FAERS: 4 | US FAERS | |
| 88 | Somnolence | FAERS: 4 | US FAERS | |
| 89 | Spondylolisthesis | FAERS: 4 | US FAERS | |
| 90 | Unevaluable event | FAERS: 4 | US FAERS | |
| 91 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 92 | Adverse event | FAERS: 3 | US FAERS | |
| 93 | Arthroscopy | FAERS: 3 | US FAERS | |
| 94 | Biopsy endometrium abnormal | FAERS: 3 | US FAERS | |
| 95 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 96 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 97 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 98 | Chills | FAERS: 3 | US FAERS | |
| 99 | Deposit eye | FAERS: 3 | US FAERS | |
| 100 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 101 | Emotional disorder | FAERS: 3 | US FAERS | |
| 102 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 103 | Hemiplegia | FAERS: 3 | US FAERS | |
| 104 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 105 | Hirsutism | FAERS: 3 | US FAERS | |
| 106 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 107 | Hypoxia | FAERS: 3 | US FAERS | |
| 108 | Joint swelling | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 109 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 110 | Lip swelling | FAERS: 3 | US FAERS | |
| 111 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 112 | Meniscus operation | FAERS: 3 | US FAERS | |
| 113 | Menopause | FAERS: 3 | US FAERS | |
| 114 | Menorrhagia | FAERS: 3 | US FAERS | |
| 115 | Metastatic Neoplasm | FAERS: 3 | US FAERS | |
| 116 | Nephritis | FAERS: 3 | US FAERS | |
| 117 | No adverse event | FAERS: 3 | US FAERS | |
| 118 | Ovarian cyst torsion | FAERS: 3 | US FAERS | |
| 119 | Petechiae | FAERS: 3 | US FAERS | |
| 120 | Product quality issue | FAERS: 3 | US FAERS | |
| 121 | Rhabdomyosarcoma | FAERS: 3 | US FAERS | |
| 122 | Tinnitus | FAERS: 3 | US FAERS | |
| 123 | Tremor | FAERS: 3 | US FAERS | |
| 124 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 125 | Wound dehiscence | FAERS: 3 | US FAERS | |
| 126 | ovarian neoplasm | FAERS: 3 | US FAERS | |
| 127 | Antiphospholipid Syndrome | FAERS: 2 | US FAERS | |
| 128 | Aortic Valve Stenosis | FAERS: 2 | US FAERS | |
| 129 | Arteriopathic disease | FAERS: 2 | US FAERS | |
| 130 | Arteritis | FAERS: 2 | US FAERS | |
| 131 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 132 | Bradycardia | FAERS: 2 | US FAERS | |
| 133 | Chest discomfort | FAERS: 2 | US FAERS | |
| 134 | Cholecystitis | FAERS: 2 | US FAERS | |
| 135 | Cholestasis | FAERS: 2 | US FAERS | |
| 136 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 137 | Corneal Opacity | FAERS: 2 | US FAERS | |
| 138 | Coronary artery insufficiency | FAERS: 2 | US FAERS | |
| 139 | Dehydration | FAERS: 2 | US FAERS | |
| 140 | Diplopia | FAERS: 2 | US FAERS | |
| 141 | Dysgeusia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Dysuria | FAERS: 2 | US FAERS | |
| 143 | Endocervical curettage | FAERS: 2 | US FAERS | |
| 144 | Exeresis | FAERS: 2 | US FAERS | |
| 145 | Eye pain | FAERS: 2 | US FAERS | |
| 146 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 147 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 148 | Hepatitis A | FAERS: 2 | US FAERS | |
| 149 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 150 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 151 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 152 | Hypokinesia | FAERS: 2 | US FAERS | |
| 153 | Impaired work ability | FAERS: 2 | US FAERS | |
| 154 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 155 | Jejunectomy | FAERS: 2 | US FAERS | |
| 156 | Keratopathy | FAERS: 2 | US FAERS | |
| 157 | Laparotomy | FAERS: 2 | US FAERS | |
| 158 | Macular degeneration | FAERS: 2 | US FAERS | |
| 159 | Malignant transformation | FAERS: 2 | US FAERS | |
| 160 | Medication Error | FAERS: 2 | US FAERS | |
| 161 | Mood swings | FAERS: 2 | US FAERS | |
| 162 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 163 | Ocular vascular disorder | FAERS: 2 | US FAERS | |
| 164 | Oliguria | FAERS: 2 | US FAERS | |
| 165 | Onychoclasis | FAERS: 2 | US FAERS | |
| 166 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 167 | Palpitations | FAERS: 2 | US FAERS | |
| 168 | Pancreatic operation | FAERS: 2 | US FAERS | |
| 169 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 170 | Peritonitis | FAERS: 2 | US FAERS | |
| 171 | Protein C decreased | FAERS: 2 | US FAERS | |
| 172 | Protein S decreased | FAERS: 2 | US FAERS | |
| 173 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 174 | Retinal Degeneration | FAERS: 2 | US FAERS | |
| 175 | Retinal deposits | FAERS: 2 | US FAERS | |
| 176 | Retinal pigmentation | FAERS: 2 | US FAERS | |
| 177 | Septic Shock | FAERS: 2 | US FAERS | |
| 178 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 179 | Swelling | FAERS: 2 | US FAERS | |
| 180 | Tachycardia | FAERS: 2 | US FAERS | |
| 181 | Thoracic cavity drainage | FAERS: 2 | US FAERS | |
| 182 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 183 | Uterine Prolapse | FAERS: 2 | US FAERS | |
| 184 | Vertigo | FAERS: 2 | US FAERS | |
| 185 | Visual Impairment | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 186 | Abdominal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Abdominal mass | FAERS: 1 | US FAERS | |
| 188 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 189 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 190 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 191 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 192 | Adenoid Cystic Carcinoma | FAERS: 1 | US FAERS | |
| 193 | Ageusia | FAERS: 1 | US FAERS | |
| 194 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 195 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 196 | Amputation | FAERS: 1 | US FAERS | |
| 197 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 198 | Anorexia | FAERS: 1 | US FAERS | |
| 199 | Anosmia | FAERS: 1 | US FAERS | |
| 200 | Anti-SS-A antibody positive | FAERS: 1 | US FAERS | |
| 201 | Aphonia | FAERS: 1 | US FAERS | |
| 202 | Arthropathy | FAERS: 1 | US FAERS | |
| 203 | Ascites | FAERS: 1 | US FAERS | |
| 204 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 205 | Asthenopia | FAERS: 1 | US FAERS | |
| 206 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 207 | Aversion | FAERS: 1 | US FAERS | |
| 208 | Bedridden | FAERS: 1 | US FAERS | |
| 209 | Bilirubinuria | FAERS: 1 | US FAERS | |
| 210 | Biopsy chorionic villous abnormal | FAERS: 1 | US FAERS | |
| 211 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 212 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 213 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 214 | Bone density decreased | FAERS: 1 | US FAERS | |
| 215 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 216 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 217 | Breast Microcalcification | FAERS: 1 | US FAERS | |
| 218 | Burning sensation | FAERS: 1 | US FAERS | |
| 219 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 220 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 221 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 222 | Cervicitis human papilloma virus | FAERS: 1 | US FAERS | |
| 223 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 224 | Chest Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 226 | Chromatopsia | FAERS: 1 | US FAERS | |
| 227 | Cleft Palate | FAERS: 1 | US FAERS | |
| 228 | Colitis | FAERS: 1 | US FAERS | |
| 229 | Coronary artery perforation | FAERS: 1 | US FAERS | |
| 230 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 231 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 232 | Dental caries | FAERS: 1 | US FAERS | |
| 233 | Depression suicidal | FAERS: 1 | US FAERS | |
| 234 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 235 | Discomfort | FAERS: 1 | US FAERS | |
| 236 | Dissociation | FAERS: 1 | US FAERS | |
| 237 | Diverticulitis | FAERS: 1 | US FAERS | |
| 238 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 239 | Drug toxicity | FAERS: 1 | US FAERS | |
| 240 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 241 | Dysarthria | FAERS: 1 | US FAERS | |
| 242 | Dyspareunia | FAERS: 1 | US FAERS | |
| 243 | Ear discomfort | FAERS: 1 | US FAERS | |
| 244 | Embolic stroke | FAERS: 1 | US FAERS | |
| 245 | Emotional distress | FAERS: 1 | US FAERS | |
| 246 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 247 | Endometrial sarcoma | FAERS: 1 | US FAERS | |
| 248 | Endometrial thickening | FAERS: 1 | US FAERS | |
| 249 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 250 | Eye irritation | FAERS: 1 | US FAERS | |
| 251 | Failure of implant | FAERS: 1 | US FAERS | |
| 252 | Fat necrosis | FAERS: 1 | US FAERS | |
| 253 | Fluid replacement | FAERS: 1 | US FAERS | |
| 254 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 255 | Frustration | FAERS: 1 | US FAERS | |
| 256 | Gangrene | FAERS: 1 | US FAERS | |
| 257 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 258 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 259 | Gingival Recession | FAERS: 1 | US FAERS | |
| 260 | Global Amnesia | FAERS: 1 | US FAERS | |
| 261 | Glossoptosis | FAERS: 1 | US FAERS | |
| 262 | Graft loss | FAERS: 1 | US FAERS | |
| 263 | Graft thrombosis | FAERS: 1 | US FAERS | |
| 264 | Hair injury | FAERS: 1 | US FAERS | |
| 265 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 266 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 267 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 268 | Hypersomnia | FAERS: 1 | US FAERS | |
| 269 | Hypomania | FAERS: 1 | US FAERS | |
| 270 | Hypotension | FAERS: 1 | US FAERS | |
| 271 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 272 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 273 | Infection | FAERS: 1 | US FAERS | |
| 274 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 275 | Joint stiffness | FAERS: 1 | US FAERS | |
| 276 | Leukopenia | FAERS: 1 | US FAERS | |
| 277 | Limb operation | FAERS: 1 | US FAERS | |
| 278 | Lipase increased | FAERS: 1 | US FAERS | |
| 279 | Lymph node cancer metastatic | FAERS: 1 | US FAERS | |
| 280 | Lymphangioleiomyomatosis | FAERS: 1 | US FAERS | |
| 281 | Lymphangioma | FAERS: 1 | US FAERS | |
| 282 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 283 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 284 | Medical device complication | FAERS: 1 | US FAERS | |
| 285 | Mental impairment | FAERS: 1 | US FAERS | |
| 286 | Metaplasia | FAERS: 1 | US FAERS | |
| 287 | Monoparesis | FAERS: 1 | US FAERS | |
| 288 | Monoplegia | FAERS: 1 | US FAERS | |
| 289 | Muscle strain | FAERS: 1 | US FAERS | |
| 290 | Mutagenic effect | FAERS: 1 | US FAERS | |
| 291 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 292 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 293 | Myomectomy | FAERS: 1 | US FAERS | |
| 294 | Myopathy | FAERS: 1 | US FAERS | |
| 295 | Myositis | FAERS: 1 | US FAERS | |
| 296 | Nasopharyngeal surgery | FAERS: 1 | US FAERS | |
| 297 | Nerve injury | FAERS: 1 | US FAERS | |
| 298 | Neuralgia | FAERS: 1 | US FAERS | |
| 299 | Neurotransmitter level altered | FAERS: 1 | US FAERS | |
| 300 | Neutropenia | FAERS: 1 | US FAERS | |
| 301 | Onychalgia | FAERS: 1 | US FAERS | |
| 302 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 303 | Oral pain | FAERS: 1 | US FAERS | |
| 304 | Osteopenia | FAERS: 1 | US FAERS | |
| 305 | Overdose | FAERS: 1 | US FAERS | |
| 306 | Pain of skin | FAERS: 1 | US FAERS | |
| 307 | Pancreatitis | FAERS: 1 | US FAERS | |
| 308 | Pancytopenia | FAERS: 1 | US FAERS | |
| 309 | Parovarian Cyst | FAERS: 1 | US FAERS | |
| 310 | Pelvic mass | FAERS: 1 | US FAERS | |
| 311 | Pemphigus | FAERS: 1 | US FAERS | |
| 312 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 313 | Personality Change | FAERS: 1 | US FAERS | |
| 314 | Photophobia | FAERS: 1 | US FAERS | |
| 315 | Pneumonia | FAERS: 1 | US FAERS | |
| 316 | Pneumonitis | FAERS: 1 | US FAERS | |
| 317 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 318 | Post procedural complication | FAERS: 1 | US FAERS | |
| 319 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 320 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 321 | Presyncope | FAERS: 1 | US FAERS | |
| 322 | Procedural complication | FAERS: 1 | US FAERS | |
| 323 | Product prescribing error | FAERS: 1 | US FAERS | |
| 324 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 325 | Product use issue | FAERS: 1 | US FAERS | |
| 326 | Progesterone decreased | FAERS: 1 | US FAERS | |
| 327 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 328 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 329 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 330 | Radiation injury | FAERS: 1 | US FAERS | |
| 331 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 332 | Rectal discharge | FAERS: 1 | US FAERS | |
| 333 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 334 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 335 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 336 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 337 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 338 | Retinal exudates | FAERS: 1 | US FAERS | |
| 339 | Retinitis | FAERS: 1 | US FAERS | |
| 340 | Salpingo-oophorectomy | FAERS: 1 | US FAERS | |
| 341 | Secretion discharge | FAERS: 1 | US FAERS | |
| 342 | Sepsis | FAERS: 1 | US FAERS | |
| 343 | Shock | FAERS: 1 | US FAERS | |
| 344 | Skeletal injury | FAERS: 1 | US FAERS | |
| 345 | Skin flap necrosis | FAERS: 1 | US FAERS | |
| 346 | Skin necrosis | FAERS: 1 | US FAERS | |
| 347 | Smooth muscle cell neoplasm | FAERS: 1 | US FAERS | |
| 348 | Splenomegaly | FAERS: 1 | US FAERS | |
| 349 | Stress | FAERS: 1 | US FAERS | |
| 350 | Syndactyly | FAERS: 1 | US FAERS | |
| 351 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 352 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 353 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 354 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 355 | Tooth Loss | FAERS: 1 | US FAERS | |
| 356 | Toothache | FAERS: 1 | US FAERS | |
| 357 | Toxic Optic Neuropathy | FAERS: 1 | US FAERS | |
| 358 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 359 | Transaminases increased | FAERS: 1 | US FAERS | |
| 360 | Triple vessel bypass graft | FAERS: 1 | US FAERS | |
| 361 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 362 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 363 | Uterovaginal prolapse | FAERS: 1 | US FAERS | |
| 364 | Uveitis | FAERS: 1 | US FAERS | |
| 365 | Vaginal cancer recurrent | FAERS: 1 | US FAERS | |
| 366 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 367 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 368 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 369 | Vestibular Neuronitis | FAERS: 1 | US FAERS | |
| 370 | Visual disturbance | FAERS: 1 | US FAERS | |
| 371 | Von Willebrand's factor antigen increased | FAERS: 1 | US FAERS | |
| 372 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 373 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 374 | Wheelchair user | FAERS: 1 | US FAERS | |
| 375 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 376 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 377 | liposarcoma | FAERS: 1 | US FAERS | |
| 378 | Bronchiolitis | Canada Vigilance: 1 | Canada Vigilance | |
| 379 | Carpal Tunnel Syndrome | Canada Vigilance: 2 | Canada Vigilance | |
| 380 | Neutrophil count abnormal | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.