Dronedarone
(ZQTNQVWKHCQYLQ-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCc1oc2c(c1C(=O)c1ccc(cc1)OCCCN(CCCC)CCCC)cc(cc2)NS(=O)(=O)C
- Type(s)
- Approved
- ATC code(s)
- C01BD07
- Molecular Formula:
- C31H44N2O5S
- Molecular Weight:
- 556.756
- Log P:
- 8.2028
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 97.23
- CAS Number(s):
- 141626-36-0
Synonym(s)
1.
Dronedarone
2.
Multaq
3.
SR 33589
4.
SR 33589B
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Atrial Fibrillation | FAERS: 335 | 17804843 19213680 20628043 | CTD US FAERS |
| 2 | Blood creatinine increased | FAERS: 108 | SIDER US FAERS | |
| 3 | Fatigue | FAERS: 85 | SIDER US FAERS | |
| 4 | Nausea | FAERS: 85 | 19213680 | CTD SIDER US FAERS |
| 5 | Asthenia | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Dizziness | FAERS: 53 | US FAERS | |
| 7 | Drug ineffective | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Malaise | FAERS: 45 | US FAERS | |
| 9 | Headache | FAERS: 37 | US FAERS | |
| 10 | Alanine Aminotransferase Increased | FAERS: 30 | US FAERS | |
| 11 | Palpitations | FAERS: 29 | US FAERS | |
| 12 | Feeling abnormal | FAERS: 27 | US FAERS | |
| 13 | Pneumonia | FAERS: 25 | SIDER US FAERS | |
| 14 | Aspartate Aminotransferase Increased | FAERS: 24 | US FAERS | |
| 15 | Pruritus | FAERS: 23 | SIDER US FAERS | |
| 16 | Pulmonary Fibrosis | FAERS: 23 | SIDER US FAERS | |
| 17 | Vomiting | FAERS: 23 | SIDER US FAERS | |
| 18 | Weight decreased | FAERS: 23 | US FAERS | |
| 19 | Cardiac Arrest | FAERS: 22 | US FAERS | |
| 20 | Atrial Flutter | FAERS: 20 | SIDER US FAERS | |
| 21 | Abdominal discomfort | FAERS: 19 | US FAERS | |
| 22 | Hyperthyroidism | FAERS: 19 | US FAERS | |
| 23 | Syncope | FAERS: 18 | US FAERS | |
| 24 | Bradycardia | FAERS: 17 | 19213680 | CTD SIDER US FAERS |
| 25 | Cerebrovascular accident | FAERS: 17 | US FAERS | |
| 26 | Drug dose omission | FAERS: 17 | US FAERS | |
| 27 | Pain | FAERS: 16 | US FAERS | |
| 28 | Pulmonary toxicity | FAERS: 16 | SIDER US FAERS | |
| 29 | Urinary tract infection | FAERS: 16 | US FAERS | |
| 30 | Wheezing | FAERS: 16 | US FAERS | |
| 31 | Myocardial Infarction | FAERS: 15 | US FAERS | |
| 32 | Abdominal Pain | FAERS: 14 | SIDER US FAERS | |
| 33 | Alopecia | FAERS: 14 | US FAERS | |
| 34 | Ejection Fraction Decreased | FAERS: 14 | US FAERS | |
| 35 | Erythema | FAERS: 13 | SIDER US FAERS | |
| 36 | Hypersensitivity | FAERS: 13 | US FAERS | |
| 37 | Incorrect dose administered | FAERS: 13 | US FAERS | |
| 38 | Transaminases increased | FAERS: 13 | US FAERS | |
| 39 | Tremor | FAERS: 13 | US FAERS | |
| 40 | Wrong technique in product usage process | FAERS: 13 | US FAERS | |
| 41 | Arthralgia | FAERS: 12 | US FAERS | |
| 42 | Chest discomfort | FAERS: 12 | US FAERS | |
| 43 | Hypotension | FAERS: 12 | US FAERS | |
| 44 | Infection | FAERS: 12 | US FAERS | |
| 45 | Sepsis | FAERS: 12 | US FAERS | |
| 46 | Tachycardia | FAERS: 12 | 10975596 | CTD US FAERS |
| 47 | Unevaluable event | FAERS: 12 | US FAERS | |
| 48 | Bronchitis | FAERS: 11 | US FAERS | |
| 49 | Gamma-Glutamyltransferase Increased | FAERS: 11 | US FAERS | |
| 50 | Pancreatitis | FAERS: 11 | US FAERS | |
| 51 | Flatulence | FAERS: 10 | US FAERS | |
| 52 | Product quality issue | FAERS: 10 | US FAERS | |
| 53 | Adverse event | FAERS: 9 | US FAERS | |
| 54 | Pulmonary Hypertension | FAERS: 9 | US FAERS | |
| 55 | Ventricular Fibrillation | FAERS: 9 | US FAERS | |
| 56 | Visual Impairment | FAERS: 9 | US FAERS | |
| 57 | Ageusia | FAERS: 8 | SIDER US FAERS | |
| 58 | Anxiety | FAERS: 8 | US FAERS | |
| 59 | Blood urea increased | FAERS: 8 | US FAERS | |
| 60 | Cardiac ablation | FAERS: 8 | US FAERS | |
| 61 | Deafness | FAERS: 8 | US FAERS | |
| 62 | Hepatitis | FAERS: 8 | US FAERS | |
| 63 | Lethargy | FAERS: 8 | US FAERS | |
| 64 | Myalgia | FAERS: 8 | US FAERS | |
| 65 | Peripheral swelling | FAERS: 8 | US FAERS | |
| 66 | Productive Cough | FAERS: 8 | US FAERS | |
| 67 | Urticaria | FAERS: 8 | US FAERS | |
| 68 | Acute kidney injury | FAERS: 7 | 20628043 | CTD US FAERS |
| 69 | Asthma | FAERS: 7 | US FAERS | |
| 70 | Back Pain | FAERS: 7 | US FAERS | |
| 71 | Blood alkaline phosphatase increased | FAERS: 7 | US FAERS | |
| 72 | Burning sensation | FAERS: 7 | US FAERS | |
| 73 | Chest Pain | FAERS: 7 | US FAERS | |
| 74 | Creatinine renal clearance decreased | FAERS: 7 | US FAERS | |
| 75 | Drug administration error | FAERS: 7 | US FAERS | |
| 76 | Hypoxia | FAERS: 7 | US FAERS | |
| 77 | Joint swelling | FAERS: 7 | US FAERS | |
| 78 | Respiratory Failure | FAERS: 7 | US FAERS | |
| 79 | Swelling | FAERS: 7 | US FAERS | |
| 80 | Tinnitus | FAERS: 7 | US FAERS | |
| 81 | Angioedema | FAERS: 6 | SIDER US FAERS | |
| 82 | Cardiac Flutter | FAERS: 6 | US FAERS | |
| 83 | Medication residue present | FAERS: 6 | US FAERS | |
| 84 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 85 | Pericardial effusion | FAERS: 6 | US FAERS | |
| 86 | Product dose omission | FAERS: 6 | US FAERS | |
| 87 | Rash erythematous | FAERS: 6 | SIDER US FAERS | |
| 88 | Sinusitis | FAERS: 6 | US FAERS | |
| 89 | Tachyarrhythmia | FAERS: 6 | US FAERS | |
| 90 | Vitreous floaters | FAERS: 6 | US FAERS | |
| 91 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 92 | jaundice | FAERS: 6 | US FAERS | |
| 93 | Angina Pectoris | FAERS: 5 | US FAERS | |
| 94 | Arthritis | FAERS: 5 | US FAERS | |
| 95 | Dehydration | FAERS: 5 | US FAERS | |
| 96 | Diverticulitis | FAERS: 5 | US FAERS | |
| 97 | Dry skin | FAERS: 5 | US FAERS | |
| 98 | Dyspepsia | FAERS: 5 | SIDER US FAERS | |
| 99 | Electrocardiogram abnormal | FAERS: 5 | US FAERS | |
| 100 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 101 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 102 | Joint injury | FAERS: 5 | US FAERS | |
| 103 | Polyneuropathy | FAERS: 5 | US FAERS | |
| 104 | Renal pain | FAERS: 5 | US FAERS | |
| 105 | Respiratory distress | FAERS: 5 | US FAERS | |
| 106 | Somnolence | FAERS: 5 | US FAERS | |
| 107 | Sudden death | FAERS: 5 | US FAERS | |
| 108 | Anorectal discomfort | FAERS: 4 | US FAERS | |
| 109 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 110 | Blindness | FAERS: 4 | US FAERS | |
| 111 | Brain natriuretic peptide increased | FAERS: 4 | US FAERS | |
| 112 | Chromaturia | FAERS: 4 | US FAERS | |
| 113 | Dysphonia | FAERS: 4 | US FAERS | |
| 114 | Electrocardiogram QT interval abnormal | FAERS: 4 | US FAERS | |
| 115 | Eye pain | FAERS: 4 | US FAERS | |
| 116 | Fluid overload | FAERS: 4 | US FAERS | |
| 117 | Gastritis | FAERS: 4 | US FAERS | |
| 118 | Hemicephalalgia | FAERS: 4 | US FAERS | |
| 119 | Impaired gastric emptying | FAERS: 4 | US FAERS | |
| 120 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 121 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 122 | Limb discomfort | FAERS: 4 | US FAERS | |
| 123 | Lipase increased | FAERS: 4 | US FAERS | |
| 124 | No adverse event | FAERS: 4 | US FAERS | |
| 125 | Pulmonary congestion | FAERS: 4 | US FAERS | |
| 126 | Pulse waveform abnormal | FAERS: 4 | US FAERS | |
| 127 | Scotoma | FAERS: 4 | US FAERS | |
| 128 | Tooth Infection | FAERS: 4 | US FAERS | |
| 129 | Vasculitis | FAERS: 4 | SIDER US FAERS | |
| 130 | Abasia | FAERS: 3 | US FAERS | |
| 131 | Agitation | FAERS: 3 | US FAERS | |
| 132 | Atrial tachycardia | FAERS: 3 | US FAERS | |
| 133 | Blood amylase increased | FAERS: 3 | US FAERS | |
| 134 | Blood iron decreased | FAERS: 3 | US FAERS | |
| 135 | Blood thyroid stimulating hormone increased | FAERS: 3 | US FAERS | |
| 136 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 137 | Cataract | FAERS: 3 | US FAERS | |
| 138 | Chills | FAERS: 3 | US FAERS | |
| 139 | Constipation | FAERS: 3 | US FAERS | |
| 140 | Cystitis | FAERS: 3 | US FAERS | |
| 141 | Cyst | FAERS: 3 | US FAERS | |
| 142 | Ear discomfort | FAERS: 3 | US FAERS | |
| 143 | Eructation | FAERS: 3 | US FAERS | |
| 144 | Inability to afford medication | FAERS: 3 | US FAERS | |
| 145 | Medication Error | FAERS: 3 | US FAERS | |
| 146 | Memory impairment | FAERS: 3 | US FAERS | |
| 147 | Myasthenia Gravis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 148 | Nervousness | FAERS: 3 | US FAERS | |
| 149 | Optic Neuritis | FAERS: 3 | US FAERS | |
| 150 | Optic Neuropathy | FAERS: 3 | US FAERS | |
| 151 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 152 | PO2 decreased | FAERS: 3 | US FAERS | |
| 153 | Pleurisy | FAERS: 3 | US FAERS | |
| 154 | Product counterfeit | FAERS: 3 | US FAERS | |
| 155 | Product label issue | FAERS: 3 | US FAERS | |
| 156 | Sick Sinus Syndrome | FAERS: 3 | US FAERS | |
| 157 | Sinus Arrhythmia | FAERS: 3 | US FAERS | |
| 158 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 159 | Throat cancer | FAERS: 3 | US FAERS | |
| 160 | Throat irritation | FAERS: 3 | US FAERS | |
| 161 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 162 | Vertigo | FAERS: 3 | US FAERS | |
| 163 | Acne | FAERS: 2 | US FAERS | |
| 164 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 165 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 166 | Amnesia | FAERS: 2 | US FAERS | |
| 167 | Aphasia | FAERS: 2 | US FAERS | |
| 168 | Arthropathy | FAERS: 2 | US FAERS | |
| 169 | Axonal neuropathy | FAERS: 2 | US FAERS | |
| 170 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 171 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 172 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 173 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 174 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 175 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 176 | Blood thyroid stimulating hormone decreased | FAERS: 2 | US FAERS | |
| 177 | Bronchial irritation | FAERS: 2 | US FAERS | |
| 178 | Bursitis | FAERS: 2 | US FAERS | |
| 179 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 180 | Cellulitis | FAERS: 2 | US FAERS | |
| 181 | Choking sensation | FAERS: 2 | US FAERS | |
| 182 | Cholangitis | FAERS: 2 | US FAERS | |
| 183 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 184 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 185 | Delirium | FAERS: 2 | US FAERS | |
| 186 | Device pacing issue | FAERS: 2 | US FAERS | |
| 187 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 188 | Disability | FAERS: 2 | US FAERS | |
| 189 | Disease Progression | FAERS: 2 | US FAERS | |
| 190 | Drug chemical incompatibility | FAERS: 2 | US FAERS | |
| 191 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 192 | Dysarthria | FAERS: 2 | US FAERS | |
| 193 | Dysgeusia | FAERS: 2 | SIDER US FAERS | |
| 194 | Endocarditis | FAERS: 2 | US FAERS | |
| 195 | Epistaxis | FAERS: 2 | US FAERS | |
| 196 | Expired product administered | FAERS: 2 | US FAERS | |
| 197 | Extra dose administered | FAERS: 2 | US FAERS | |
| 198 | Hepatic congestion | FAERS: 2 | US FAERS | |
| 199 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 200 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 201 | Hypoperfusion | FAERS: 2 | US FAERS | |
| 202 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 203 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 204 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 205 | Influenza | FAERS: 2 | US FAERS | |
| 206 | Leukopenia | FAERS: 2 | US FAERS | |
| 207 | Lip swelling | FAERS: 2 | US FAERS | |
| 208 | Lung consolidation | FAERS: 2 | US FAERS | |
| 209 | Macular degeneration | FAERS: 2 | US FAERS | |
| 210 | Mental status changes | FAERS: 2 | US FAERS | |
| 211 | Oliguria | FAERS: 2 | US FAERS | |
| 212 | Onychoclasis | FAERS: 2 | US FAERS | |
| 213 | Overdose | FAERS: 2 | US FAERS | |
| 214 | Photophobia | FAERS: 2 | US FAERS | |
| 215 | Pneumonitis | FAERS: 2 | US FAERS | |
| 216 | Poor dental condition | FAERS: 2 | US FAERS | |
| 217 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 218 | Presyncope | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Product use complaint | FAERS: 2 | US FAERS | |
| 220 | Pulmonary function test decreased | FAERS: 2 | US FAERS | |
| 221 | Purpura | FAERS: 2 | US FAERS | |
| 222 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 223 | Rales | FAERS: 2 | US FAERS | |
| 224 | Rosacea | FAERS: 2 | US FAERS | |
| 225 | Sarcoma | FAERS: 2 | US FAERS | |
| 226 | Scab | FAERS: 2 | US FAERS | |
| 227 | Sinoatrial Block | FAERS: 2 | US FAERS | |
| 228 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 229 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 230 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 231 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 232 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 233 | prostatitis | FAERS: 2 | US FAERS | |
| 234 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 235 | Accidental overdose | FAERS: 1 | US FAERS | |
| 236 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 237 | Acute endocarditis | FAERS: 1 | US FAERS | |
| 238 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 239 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 240 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 241 | Ammonia increased | FAERS: 1 | US FAERS | |
| 242 | Anosmia | FAERS: 1 | US FAERS | |
| 243 | Anoxia | FAERS: 1 | US FAERS | |
| 244 | Aortitis | FAERS: 1 | US FAERS | |
| 245 | Aphagia | FAERS: 1 | US FAERS | |
| 246 | Aphonia | FAERS: 1 | US FAERS | |
| 247 | Apparent death | FAERS: 1 | US FAERS | |
| 248 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 249 | Atelectasis | FAERS: 1 | US FAERS | |
| 250 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 251 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 252 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 253 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 254 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 255 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 256 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 257 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 258 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 259 | Bone density decreased | FAERS: 1 | US FAERS | |
| 260 | Bone swelling | FAERS: 1 | US FAERS | |
| 261 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 262 | Bronchospasm | FAERS: 1 | US FAERS | |
| 263 | C-reactive protein | FAERS: 1 | US FAERS | |
| 264 | Candida pneumonia | FAERS: 1 | US FAERS | |
| 265 | Choking | FAERS: 1 | US FAERS | |
| 266 | Cholecystitis | FAERS: 1 | US FAERS | |
| 267 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 268 | Cholestasis | FAERS: 1 | US FAERS | |
| 269 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 270 | Chromatopsia | FAERS: 1 | US FAERS | |
| 271 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 272 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 273 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 274 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 275 | Critical Illness | FAERS: 1 | US FAERS | |
| 276 | Cyanosis | FAERS: 1 | US FAERS | |
| 277 | Dementia | FAERS: 1 | US FAERS | |
| 278 | Dental Plaque | FAERS: 1 | US FAERS | |
| 279 | Dental caries | FAERS: 1 | US FAERS | |
| 280 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 281 | Depressed mood | FAERS: 1 | US FAERS | |
| 282 | Device battery issue | FAERS: 1 | US FAERS | |
| 283 | Device capturing issue | FAERS: 1 | US FAERS | |
| 284 | Device ineffective | FAERS: 1 | US FAERS | |
| 285 | Device malfunction | FAERS: 1 | US FAERS | |
| 286 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 287 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 288 | Diplopia | FAERS: 1 | US FAERS | |
| 289 | Discomfort | FAERS: 1 | US FAERS | |
| 290 | Disease recurrence | FAERS: 1 | US FAERS | |
| 291 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 292 | Drug level decreased | FAERS: 1 | US FAERS | |
| 293 | Dysgraphia | FAERS: 1 | US FAERS | |
| 294 | Ear congestion | FAERS: 1 | US FAERS | |
| 295 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 296 | Eczema | FAERS: 1 | SIDER US FAERS | |
| 297 | Electrocardiogram U-wave abnormality | FAERS: 1 | US FAERS | |
| 298 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 299 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 300 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 301 | Eye inflammation | FAERS: 1 | US FAERS | |
| 302 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 303 | Facial Pain | FAERS: 1 | US FAERS | |
| 304 | Feeling Cold | FAERS: 1 | US FAERS | |
| 305 | Feeling jittery | FAERS: 1 | US FAERS | |
| 306 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 307 | Flank Pain | FAERS: 1 | US FAERS | |
| 308 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 309 | Flushing | FAERS: 1 | US FAERS | |
| 310 | Fracture | FAERS: 1 | US FAERS | |
| 311 | Gait inability | FAERS: 1 | US FAERS | |
| 312 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 313 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 314 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 315 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 316 | Gout | FAERS: 1 | US FAERS | |
| 317 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 318 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 319 | Hepatitis B | FAERS: 1 | US FAERS | |
| 320 | Hernia | FAERS: 1 | US FAERS | |
| 321 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 322 | Hip surgery | FAERS: 1 | US FAERS | |
| 323 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 324 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 325 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 326 | Ileus | FAERS: 1 | US FAERS | |
| 327 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 328 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 329 | Inflammation | FAERS: 1 | US FAERS | |
| 330 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 331 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 332 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 333 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 334 | Iridocorneal endothelial syndrome | FAERS: 1 | US FAERS | |
| 335 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 336 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 337 | Laryngitis | FAERS: 1 | US FAERS | |
| 338 | Leukocytosis | FAERS: 1 | US FAERS | |
| 339 | Limb operation | FAERS: 1 | US FAERS | |
| 340 | Long QT Syndrome | FAERS: 1 | 11723026 | CTD US FAERS |
| 341 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 342 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 343 | Lung cyst | FAERS: 1 | US FAERS | |
| 344 | Lymphoma | FAERS: 1 | US FAERS | |
| 345 | Mastication disorder | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 346 | Medication residue | FAERS: 1 | US FAERS | |
| 347 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 348 | Middle insomnia | FAERS: 1 | US FAERS | |
| 349 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 350 | Muscle tightness | FAERS: 1 | US FAERS | |
| 351 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 352 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 353 | Myoclonus | FAERS: 1 | US FAERS | |
| 354 | Neck Pain | FAERS: 1 | US FAERS | |
| 355 | Negative cardiac inotropic effect | FAERS: 1 | US FAERS | |
| 356 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 357 | Onycholysis | FAERS: 1 | US FAERS | |
| 358 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 359 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 360 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 361 | Overweight | FAERS: 1 | US FAERS | |
| 362 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 363 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 364 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 365 | Panophthalmitis | FAERS: 1 | US FAERS | |
| 366 | Paranoia | FAERS: 1 | US FAERS | |
| 367 | Pathological fracture | FAERS: 1 | US FAERS | |
| 368 | Performance status decreased | FAERS: 1 | US FAERS | |
| 369 | Pericarditis | FAERS: 1 | US FAERS | |
| 370 | Perirectal abscess | FAERS: 1 | US FAERS | |
| 371 | Photodermatosis | FAERS: 1 | US FAERS | |
| 372 | Polyarthritis | FAERS: 1 | US FAERS | |
| 373 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 374 | Post procedural complication | FAERS: 1 | US FAERS | |
| 375 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 376 | Primary Biliary Cholangitis | FAERS: 1 | US FAERS | |
| 377 | Product administration error | FAERS: 1 | US FAERS | |
| 378 | Product contamination | FAERS: 1 | US FAERS | |
| 379 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 380 | Product physical issue | FAERS: 1 | US FAERS | |
| 381 | Product prescribing error | FAERS: 1 | US FAERS | |
| 382 | Product storage error | FAERS: 1 | US FAERS | |
| 383 | Product substitution issue | FAERS: 1 | US FAERS | |
| 384 | Product tampering | FAERS: 1 | US FAERS | |
| 385 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 386 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 387 | Product use issue | FAERS: 1 | US FAERS | |
| 388 | Proteinuria | FAERS: 1 | US FAERS | |
| 389 | Psoriasis | FAERS: 1 | US FAERS | |
| 390 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 391 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 392 | Renal cyst | FAERS: 1 | US FAERS | |
| 393 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 394 | Restlessness | FAERS: 1 | US FAERS | |
| 395 | Restrictive cardiomyopathy | FAERS: 1 | US FAERS | |
| 396 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 397 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 398 | Saliva altered | FAERS: 1 | US FAERS | |
| 399 | Sciatica | FAERS: 1 | US FAERS | |
| 400 | Serositis | FAERS: 1 | US FAERS | |
| 401 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 402 | Skin irritation | FAERS: 1 | US FAERS | |
| 403 | Sneezing | FAERS: 1 | US FAERS | |
| 404 | Splenic cyst | FAERS: 1 | US FAERS | |
| 405 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 406 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 407 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 408 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 409 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 410 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 411 | Therapy change | FAERS: 1 | US FAERS | |
| 412 | Throat clearing | FAERS: 1 | US FAERS | |
| 413 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 414 | Tonsillitis | FAERS: 1 | US FAERS | |
| 415 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 416 | Troponin increased | FAERS: 1 | US FAERS | |
| 417 | Ulcer | FAERS: 1 | US FAERS | |
| 418 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 419 | Urinary Retention | FAERS: 1 | US FAERS | |
| 420 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 421 | Urine output increased | FAERS: 1 | US FAERS | |
| 422 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 423 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 424 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 425 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 426 | Wound infection pseudomonas | FAERS: 1 | US FAERS | |
| 427 | intensive care | FAERS: 1 | US FAERS | |
| 428 | muscle injury | FAERS: 1 | US FAERS | |
| 429 | treatment failure | FAERS: 1 | US FAERS | |
| 430 | Anaphylactic shock | SIDER | ||
| 431 | Asthenic conditions | SIDER | ||
| 432 | Chemical and Drug Induced Liver Injury | 23135547 24881592 | CTD | |
| 433 | Dermatitis | SIDER | ||
| 434 | Diarrhea | 19213680 | CTD | |
| 435 | Dyspeptic signs and symptoms | SIDER | ||
| 436 | Exanthema | 19213680 | CTD | |
| 437 | Heart failure | 20628043 | CTD | |
| 438 | Leukocytoclastic vasculitis | SIDER | ||
| 439 | Liver Failure, Acute | 20628043 | CTD | |
| 440 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 441 | Torsades de Pointes | 11723026 | CTD | |
| 442 | Traumatic liver injury | SIDER | ||
| 443 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.