Irbesartan
(YOSHYTLCDANDAN-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2
- Type(s)
- Approved; Investigational
- ATC code(s)
- C09CA04; C09DA04; C09DB05
- Molecular Formula:
- C25H28N6O
- Molecular Weight:
- 428.529
- Log P:
- 4.1509
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 87.13
- CAS Number(s):
- 138402-11-6
Synonym(s)
1.
Irbesartan
2.
2-N-Butyl-3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-1,3-diazaspiro(4,4)non-1-en-4-one
3.
Aprovel
4.
Avapro
5.
BMS 186295
6.
BMS-186295
7.
Karvea
8.
SR 47436
9.
SR-47436
10.
SR47436
External Link(s)
| MeSH | D000077405 |
| PubChem Compound | 3749 |
| BindingDB | 50042235 |
| ChEBI | 5959 |
| CHEMBL | CHEMBL1513 |
| DrugBank | DB01029 |
| DrugCentral | 1481 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 6908 589 |
| KEGG | cpd:C07469 dr:D00523 |
| Therapeutic Target Database | D00JAU D0F8KG |
| ZINC | 3872931 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 180 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 90 Canada Vigilance: 17 | Canada Vigilance SIDER US FAERS | |
| 3 | Dysgeusia | FAERS: 88 | SIDER US FAERS | |
| 4 | Headache | FAERS: 85 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 5 | Fatigue | FAERS: 66 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 6 | Nausea | FAERS: 61 Canada Vigilance: 13 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Malaise | FAERS: 53 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 8 | Product substitution issue | FAERS: 42 Canada Vigilance: 50 | Canada Vigilance US FAERS | |
| 9 | Adverse event | FAERS: 38 | US FAERS | |
| 10 | Hypotension | FAERS: 38 Canada Vigilance: 1 | 16164579 18182475 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Myalgia | FAERS: 37 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 12 | Alopecia | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Angioedema | FAERS: 31 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 14 | Asthenia | FAERS: 30 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 15 | Feeling abnormal | FAERS: 28 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 16 | Medication Error | FAERS: 27 | US FAERS | |
| 17 | Palpitations | FAERS: 27 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 18 | Weight decreased | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Chest Pain | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 20 | Abdominal Pain | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 21 | Hypersensitivity | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Anxiety | FAERS: 23 | SIDER US FAERS | |
| 23 | Urticaria | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Pruritus | FAERS: 21 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 25 | Product quality issue | FAERS: 20 | US FAERS | |
| 26 | Vomiting | FAERS: 20 Canada Vigilance: 6 | 18182475 | CTD SIDER Canada Vigilance US FAERS |
| 27 | Abdominal discomfort | FAERS: 19 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 28 | Nervousness | FAERS: 19 | SIDER US FAERS | |
| 29 | Arthralgia | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 30 | Blood pressure inadequately controlled | FAERS: 18 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 31 | Wrong technique in product usage process | FAERS: 18 | US FAERS | |
| 32 | Blood creatinine increased | FAERS: 16 | US FAERS | |
| 33 | Cerebrovascular accident | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Dyspepsia | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 35 | Pain | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Chest discomfort | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Tinnitus | FAERS: 14 | SIDER US FAERS | |
| 38 | Blood pressure fluctuation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 39 | Burning sensation | FAERS: 13 | US FAERS | |
| 40 | Wrong technique in drug usage process | FAERS: 13 | US FAERS | |
| 41 | Acute kidney injury | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Erectile dysfunction | FAERS: 12 | US FAERS | |
| 43 | Erythema | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 44 | Flushing | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 45 | Somnolence | FAERS: 12 | SIDER US FAERS | |
| 46 | Blood potassium increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 47 | Drug abuse | FAERS: 11 | US FAERS | |
| 48 | Joint swelling | FAERS: 11 | US FAERS | |
| 49 | Blood creatine phosphokinase increased | FAERS: 10 | SIDER US FAERS | |
| 50 | Constipation | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 51 | Presyncope | FAERS: 10 | US FAERS | |
| 52 | Toxicity to various agents | FAERS: 10 | US FAERS | |
| 53 | Tremor | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 54 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 55 | Deafness | FAERS: 9 | US FAERS | |
| 56 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 57 | Epistaxis | FAERS: 9 | SIDER US FAERS | |
| 58 | Pregnancy | FAERS: 9 | US FAERS | |
| 59 | jaundice | FAERS: 9 | SIDER US FAERS | |
| 60 | Back Pain | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 61 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 62 | Urinary tract infection | FAERS: 8 | SIDER US FAERS | |
| 63 | Vasculitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 64 | Accidental exposure to product by child | FAERS: 7 | US FAERS | |
| 65 | Cataract | FAERS: 7 | US FAERS | |
| 66 | Dysphonia | FAERS: 7 | OFFSIDES US FAERS | |
| 67 | Flatulence | FAERS: 7 | SIDER US FAERS | |
| 68 | Hepatitis | FAERS: 7 | SIDER US FAERS | |
| 69 | Musculoskeletal Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 70 | Musculoskeletal stiffness | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 71 | Myocardial Infarction | FAERS: 7 Canada Vigilance: 2 | 21229253 | CTD SIDER Canada Vigilance US FAERS |
| 72 | No adverse event | FAERS: 7 | US FAERS | |
| 73 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 74 | Throat irritation | FAERS: 7 | US FAERS | |
| 75 | Unevaluable event | FAERS: 7 | US FAERS | |
| 76 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 77 | Ageusia | FAERS: 6 | US FAERS | |
| 78 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 79 | Depressed mood | FAERS: 6 | US FAERS | |
| 80 | Drug dose omission | FAERS: 6 | US FAERS | |
| 81 | Enteritis | FAERS: 6 | US FAERS | |
| 82 | Eye pain | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 83 | Gastritis | FAERS: 6 | 29523851 | CTD US FAERS |
| 84 | Neutropenia | FAERS: 6 | SIDER US FAERS | |
| 85 | Overdose | FAERS: 6 | OFFSIDES US FAERS | |
| 86 | Rhabdomyolysis | FAERS: 6 | SIDER US FAERS | |
| 87 | Sprue-like enteropathy | FAERS: 6 | US FAERS | |
| 88 | Syncope | FAERS: 6 | 18182475 | CTD SIDER US FAERS |
| 89 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 90 | Vertigo | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 91 | Agitation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 92 | Anosmia | FAERS: 5 | OFFSIDES US FAERS | |
| 93 | Apparent life threatening event | FAERS: 5 | US FAERS | |
| 94 | Asthma | FAERS: 5 | SIDER US FAERS | |
| 95 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 96 | Bradycardia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 97 | Chills | FAERS: 5 | SIDER US FAERS | |
| 98 | Dysuria | FAERS: 5 | OFFSIDES US FAERS | |
| 99 | Glaucoma | FAERS: 5 | US FAERS | |
| 100 | Lethargy | FAERS: 5 | US FAERS | |
| 101 | Leukocytoclastic vasculitis | FAERS: 5 | SIDER US FAERS | |
| 102 | Limb discomfort | FAERS: 5 | US FAERS | |
| 103 | Lip swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Malabsorption | FAERS: 5 | US FAERS | |
| 105 | Swelling | FAERS: 5 | SIDER US FAERS | |
| 106 | Visual Impairment | FAERS: 5 | SIDER US FAERS | |
| 107 | Atrial Fibrillation | FAERS: 4 | 21545815 | CTD US FAERS |
| 108 | Bronchitis | FAERS: 4 | US FAERS | |
| 109 | Choking | FAERS: 4 | OFFSIDES US FAERS | |
| 110 | Chromaturia | FAERS: 4 | SIDER US FAERS | |
| 111 | Cold sweat | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Colitis | FAERS: 4 | US FAERS | |
| 113 | Diabetes Mellitus | FAERS: 4 | SIDER US FAERS | |
| 114 | Diplopia | FAERS: 4 | US FAERS | |
| 115 | Discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 116 | Ear discomfort | FAERS: 4 | US FAERS | |
| 117 | Erythema Multiforme | FAERS: 4 | US FAERS | |
| 118 | Gamma-Glutamyltransferase Increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Gastric ulcer | FAERS: 4 | OFFSIDES US FAERS | |
| 120 | Head discomfort | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 121 | Hypertensive crisis | FAERS: 4 | SIDER US FAERS | |
| 122 | Leukopenia | FAERS: 4 | SIDER US FAERS | |
| 123 | Nephrolithiasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Oropharyngeal blistering | FAERS: 4 | US FAERS | |
| 125 | Oropharyngeal pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Peripheral swelling | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 127 | Recalled product administered | FAERS: 4 | US FAERS | |
| 128 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 129 | Suicide attempt | FAERS: 4 | US FAERS | |
| 130 | Suspected counterfeit product | FAERS: 4 | US FAERS | |
| 131 | Urinary Retention | FAERS: 4 | US FAERS | |
| 132 | Vascular purpura | FAERS: 4 | US FAERS | |
| 133 | Visual disturbance | FAERS: 4 | SIDER US FAERS | |
| 134 | Accidental overdose | FAERS: 3 | US FAERS | |
| 135 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 136 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 137 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 138 | Blood glucose decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 139 | Blood potassium abnormal | FAERS: 3 | US FAERS | |
| 140 | Blood product transfusion dependent | FAERS: 3 | US FAERS | |
| 141 | Bronchiolitis | FAERS: 3 | US FAERS | |
| 142 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 143 | Cyanosis | FAERS: 3 | US FAERS | |
| 144 | Dehydration | FAERS: 3 | OFFSIDES US FAERS | |
| 145 | Dementia | FAERS: 3 | US FAERS | |
| 146 | Drug administration error | FAERS: 3 | OFFSIDES US FAERS | |
| 147 | Ear congestion | FAERS: 3 | US FAERS | |
| 148 | Fracture | FAERS: 3 | US FAERS | |
| 149 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 150 | Joint injury | FAERS: 3 | US FAERS | |
| 151 | Joint stiffness | FAERS: 3 | SIDER US FAERS | |
| 152 | Leukocytosis | FAERS: 3 | US FAERS | |
| 153 | Medication residue | FAERS: 3 | US FAERS | |
| 154 | Memory impairment | FAERS: 3 | US FAERS | |
| 155 | Nasopharyngitis | FAERS: 3 | SIDER US FAERS | |
| 156 | Pneumonia | FAERS: 3 | SIDER US FAERS | |
| 157 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 158 | Product use issue | FAERS: 3 | US FAERS | |
| 159 | Pulmonary congestion | FAERS: 3 | SIDER US FAERS | |
| 160 | Rash erythematous | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Renal cyst | FAERS: 3 | OFFSIDES US FAERS | |
| 162 | Shock | FAERS: 3 | 16164579 | CTD SIDER US FAERS |
| 163 | Stomatitis | FAERS: 3 | US FAERS | |
| 164 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 165 | Thrombocytopenia | FAERS: 3 | SIDER US FAERS | |
| 166 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 167 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 168 | Abasia | FAERS: 2 | US FAERS | |
| 169 | Acute Coronary Syndrome | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 170 | Air Embolism | FAERS: 2 | OFFSIDES US FAERS | |
| 171 | Anorexia | FAERS: 2 | SIDER US FAERS | |
| 172 | Arthropathy | FAERS: 2 | US FAERS | |
| 173 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 174 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 175 | Blood creatine increased | FAERS: 2 | OFFSIDES US FAERS | |
| 176 | Blood creatine phosphokinase MB increased | FAERS: 2 | US FAERS | |
| 177 | Blood urea increased | FAERS: 2 | SIDER US FAERS | |
| 178 | Burning Mouth Syndrome | FAERS: 2 | US FAERS | |
| 179 | Cardiac Arrest | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 181 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 182 | Decompression Sickness | FAERS: 2 | US FAERS | |
| 183 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 184 | Disability | FAERS: 2 | US FAERS | |
| 185 | Diverticulitis | FAERS: 2 | US FAERS | |
| 186 | Dry skin | FAERS: 2 | US FAERS | |
| 187 | Extra dose administered | FAERS: 2 | US FAERS | |
| 188 | Eye irritation | FAERS: 2 | US FAERS | |
| 189 | Facial paralysis | FAERS: 2 | US FAERS | |
| 190 | Food Allergy | FAERS: 2 | US FAERS | |
| 191 | Gastroenteritis | FAERS: 2 | SIDER US FAERS | |
| 192 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 193 | Gingivitis | FAERS: 2 | US FAERS | |
| 194 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 195 | Hernia | FAERS: 2 | OFFSIDES US FAERS | |
| 196 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 197 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 198 | Impaired work ability | FAERS: 2 | US FAERS | |
| 199 | Incontinence | FAERS: 2 | US FAERS | |
| 200 | Infarction | FAERS: 2 | US FAERS | |
| 201 | Inflammation | FAERS: 2 | US FAERS | |
| 202 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 203 | Macular degeneration | FAERS: 2 | US FAERS | |
| 204 | Mastitis | FAERS: 2 | US FAERS | |
| 205 | Microalbuminuria | FAERS: 2 | US FAERS | |
| 206 | Muscle tightness | FAERS: 2 | US FAERS | |
| 207 | Musculoskeletal chest pain | FAERS: 2 | SIDER US FAERS | |
| 208 | Myopia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Neck Pain | FAERS: 2 | US FAERS | |
| 210 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 211 | Occupational exposure to drug | FAERS: 2 | US FAERS | |
| 212 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 213 | Pancytopenia | FAERS: 2 | US FAERS | |
| 214 | Petechiae | FAERS: 2 | US FAERS | |
| 215 | Polymyalgia Rheumatica | FAERS: 2 | US FAERS | |
| 216 | Product physical issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Product size issue | FAERS: 2 | US FAERS | |
| 218 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 219 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 220 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 221 | Restlessness | FAERS: 2 | US FAERS | |
| 222 | Rhinitis | FAERS: 2 | SIDER US FAERS | |
| 223 | Septic Shock | FAERS: 2 | US FAERS | |
| 224 | Sexual Dysfunction | FAERS: 2 | SIDER US FAERS | |
| 225 | Sinusitis | FAERS: 2 | US FAERS | |
| 226 | Skin lesion | FAERS: 2 | US FAERS | |
| 227 | Sneezing | FAERS: 2 | US FAERS | |
| 228 | Spermatozoa morphology abnormal | FAERS: 2 | US FAERS | |
| 229 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 230 | Stress | FAERS: 2 | SIDER US FAERS | |
| 231 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 232 | Tachycardia | FAERS: 2 | SIDER US FAERS | |
| 233 | Thirst | FAERS: 2 | US FAERS | |
| 234 | Urine output increased | FAERS: 2 | US FAERS | |
| 235 | Wheezing | FAERS: 2 | SIDER US FAERS | |
| 236 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 237 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 238 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 239 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 240 | Amnesia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 242 | Aneurysm | FAERS: 1 | US FAERS | |
| 243 | Anger | FAERS: 1 | US FAERS | |
| 244 | Angiotensin converting enzyme increased | FAERS: 1 | US FAERS | |
| 245 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 246 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 247 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 248 | Aortic Aneurysm | FAERS: 1 | OFFSIDES US FAERS | |
| 249 | Aphagia | FAERS: 1 | US FAERS | |
| 250 | Aphasia | FAERS: 1 | US FAERS | |
| 251 | Aphonia | FAERS: 1 | US FAERS | |
| 252 | Arteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 253 | Arthritis | FAERS: 1 | SIDER US FAERS | |
| 254 | Asphyxia | FAERS: 1 | US FAERS | |
| 255 | Back disorder | FAERS: 1 | US FAERS | |
| 256 | Bedridden | FAERS: 1 | US FAERS | |
| 257 | Bladder cyst | FAERS: 1 | US FAERS | |
| 258 | Bladder spasm | FAERS: 1 | US FAERS | |
| 259 | Blepharospasm | FAERS: 1 | US FAERS | |
| 260 | Blindness | FAERS: 1 | SIDER US FAERS | |
| 261 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 262 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 263 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 264 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 265 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 266 | Blood urine present | FAERS: 1 | US FAERS | |
| 267 | Bone pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 268 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 269 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 270 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 271 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 272 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 273 | Caustic injury | FAERS: 1 | US FAERS | |
| 274 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 275 | Cholestasis | FAERS: 1 | US FAERS | |
| 276 | Clinodactyly | FAERS: 1 | US FAERS | |
| 277 | Completed Suicide | FAERS: 1 | US FAERS | |
| 278 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 279 | Crying | FAERS: 1 | US FAERS | |
| 280 | Cystitis | FAERS: 1 | US FAERS | |
| 281 | Cytopenia | FAERS: 1 | US FAERS | |
| 282 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 283 | Dental caries | FAERS: 1 | US FAERS | |
| 284 | Device interaction | FAERS: 1 | US FAERS | |
| 285 | Device malfunction | FAERS: 1 | US FAERS | |
| 286 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 287 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 288 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 289 | Drug resistance | FAERS: 1 | US FAERS | |
| 290 | Dysarthria | FAERS: 1 | US FAERS | |
| 291 | Dysphemia | FAERS: 1 | US FAERS | |
| 292 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 293 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 294 | Emotional disorder | FAERS: 1 | SIDER US FAERS | |
| 295 | Enuresis | FAERS: 1 | US FAERS | |
| 296 | Erythrosis | FAERS: 1 | US FAERS | |
| 297 | Excoriation | FAERS: 1 | US FAERS | |
| 298 | Expired drug administered | FAERS: 1 | US FAERS | |
| 299 | Eye Redness | FAERS: 1 | US FAERS | |
| 300 | Facial Pain | FAERS: 1 | US FAERS | |
| 301 | Feeling Cold | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 302 | Feeling jittery | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Formication | FAERS: 1 | US FAERS | |
| 304 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 305 | Gastric hypertonia | FAERS: 1 | US FAERS | |
| 306 | Gastroduodenitis | FAERS: 1 | US FAERS | |
| 307 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 308 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 309 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 310 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 311 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 312 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 313 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 314 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 315 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 316 | Hypogonadism | FAERS: 1 | US FAERS | |
| 317 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 318 | Idiopathic angioedema | FAERS: 1 | US FAERS | |
| 319 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 320 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 321 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 322 | Infertility | FAERS: 1 | US FAERS | |
| 323 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 324 | Influenza | FAERS: 1 | SIDER US FAERS | |
| 325 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 326 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 327 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 328 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 329 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 330 | Laziness | FAERS: 1 | US FAERS | |
| 331 | Ligament rupture | FAERS: 1 | US FAERS | |
| 332 | Live Birth | FAERS: 1 | US FAERS | |
| 333 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 334 | Lumbar hernia | FAERS: 1 | US FAERS | |
| 335 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 336 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 337 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 338 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 339 | Metastasis | FAERS: 1 | US FAERS | |
| 340 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 341 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 342 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 343 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 344 | Myopathy | FAERS: 1 | US FAERS | |
| 345 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 346 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 347 | Nerve injury | FAERS: 1 | US FAERS | |
| 348 | Neuralgia | FAERS: 1 | US FAERS | |
| 349 | Night sweats | FAERS: 1 | US FAERS | |
| 350 | Nodule | FAERS: 1 | US FAERS | |
| 351 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 352 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 353 | Ocular icterus | FAERS: 1 | US FAERS | |
| 354 | Opiates positive | FAERS: 1 | US FAERS | |
| 355 | Pallor | FAERS: 1 | US FAERS | |
| 356 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 357 | Pancreatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 358 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 359 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 360 | Personality Change | FAERS: 1 | US FAERS | |
| 361 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 362 | Photophobia | FAERS: 1 | US FAERS | |
| 363 | Pneumonitis | FAERS: 1 | US FAERS | |
| 364 | Poisoning | FAERS: 1 | US FAERS | |
| 365 | Polymyositis | FAERS: 1 | US FAERS | |
| 366 | Polyuria | FAERS: 1 | US FAERS | |
| 367 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 368 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 369 | Procedural complication | FAERS: 1 | US FAERS | |
| 370 | Product availability issue | FAERS: 1 | US FAERS | |
| 371 | Product coating issue | FAERS: 1 | US FAERS | |
| 372 | Product counterfeit | FAERS: 1 | US FAERS | |
| 373 | Product dose omission | FAERS: 1 | US FAERS | |
| 374 | Product formulation issue | FAERS: 1 | US FAERS | |
| 375 | Product friable | FAERS: 1 | US FAERS | |
| 376 | Product package associated injury | FAERS: 1 | US FAERS | |
| 377 | Product use complaint | FAERS: 1 | US FAERS | |
| 378 | Productive Cough | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Protein total increased | FAERS: 1 | US FAERS | |
| 380 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 381 | Psoriasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 382 | Pterygium | FAERS: 1 | US FAERS | |
| 383 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 384 | Quadriplegia | FAERS: 1 | US FAERS | |
| 385 | Rash scaly | FAERS: 1 | US FAERS | |
| 386 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 387 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 388 | Renal pain | FAERS: 1 | US FAERS | |
| 389 | Renin abnormal | FAERS: 1 | US FAERS | |
| 390 | Renin increased | FAERS: 1 | US FAERS | |
| 391 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 392 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 393 | Respiratory distress | FAERS: 1 | SIDER US FAERS | |
| 394 | Retching | FAERS: 1 | US FAERS | |
| 395 | Retrognathia | FAERS: 1 | US FAERS | |
| 396 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 397 | Rosacea | FAERS: 1 | US FAERS | |
| 398 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 399 | Secretion discharge | FAERS: 1 | US FAERS | |
| 400 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 401 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 402 | Skin laceration | FAERS: 1 | US FAERS | |
| 403 | Sluggishness | FAERS: 1 | US FAERS | |
| 404 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 405 | Spinal cord herniation | FAERS: 1 | US FAERS | |
| 406 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 407 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 408 | Therapy change | FAERS: 1 | US FAERS | |
| 409 | Thermal burn | FAERS: 1 | US FAERS | |
| 410 | Thirst decreased | FAERS: 1 | US FAERS | |
| 411 | Thrombosis | FAERS: 1 | US FAERS | |
| 412 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 413 | Tongue blistering | FAERS: 1 | US FAERS | |
| 414 | Tongue discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 415 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 416 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 417 | Toxic Epidermal Necrolysis | FAERS: 1 | SIDER US FAERS | |
| 418 | Transaminases increased | FAERS: 1 | US FAERS | |
| 419 | Ulcer | FAERS: 1 | US FAERS | |
| 420 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 421 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 422 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 423 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 424 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 425 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 426 | Venous occlusion | FAERS: 1 | US FAERS | |
| 427 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 428 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 429 | Walking aid user | FAERS: 1 | US FAERS | |
| 430 | Wheelchair user | FAERS: 1 | US FAERS | |
| 431 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 432 | muscle injury | FAERS: 1 | US FAERS | |
| 433 | prostatitis | FAERS: 1 | US FAERS | |
| 434 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 435 | Abdominal Infection | OFFSIDES | ||
| 436 | Acid reflux | OFFSIDES | ||
| 437 | Acidosis | OFFSIDES | ||
| 438 | Agitation postoperative | OFFSIDES | ||
| 439 | Agranulocytosis | SIDER | ||
| 440 | Albuminuria | 11508272 | CTD | |
| 441 | Amylase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 442 | Anemia | 17216246 | CTD | |
| 443 | Angioplasty | OFFSIDES | ||
| 444 | Anhedonia | OFFSIDES | ||
| 445 | Anhidrosis | OFFSIDES | ||
| 446 | Animal bite | OFFSIDES | ||
| 447 | Anoxia | OFFSIDES | ||
| 448 | Antidepressant drug level above therapeutic | OFFSIDES | ||
| 449 | Antipsychotic drug level increased | OFFSIDES | ||
| 450 | Aortic valve calcification | OFFSIDES | ||
| 451 | Application site discomfort | OFFSIDES | ||
| 452 | Application site urticaria | OFFSIDES | ||
| 453 | Arterial bruit | OFFSIDES | ||
| 454 | Atherosclerosis | 19028402 | CTD | |
| 455 | Atrial hypertrophy | OFFSIDES | ||
| 456 | Atrial rhythm | SIDER | ||
| 457 | Atrial tachycardia | OFFSIDES | ||
| 458 | Atrioventricular Block | OFFSIDES | ||
| 459 | Azotemia | 14728886 | CTD | |
| 460 | Blepharitis | OFFSIDES | ||
| 461 | Blood pH decreased | OFFSIDES | ||
| 462 | Blood pressure immeasurable | OFFSIDES | ||
| 463 | Blood sodium | OFFSIDES | ||
| 464 | Body Temperature | OFFSIDES | ||
| 465 | Bone density decreased | OFFSIDES | ||
| 466 | Breast Feeding | SIDER | ||
| 467 | Bronchial irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 468 | Brown urine | SIDER | ||
| 469 | Bursitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 470 | Cardiomegaly | 9118530 | CTD | |
| 471 | Carotid bruit | OFFSIDES | ||
| 472 | Cellulitis | OFFSIDES | ||
| 473 | Cerebral artery occlusion | OFFSIDES | ||
| 474 | Cerebral atrophy | OFFSIDES | ||
| 475 | Cervicobrachial syndrome | OFFSIDES | ||
| 476 | Chemical and Drug Induced Liver Injury | 14733885 | CTD | |
| 477 | Choking sensation | OFFSIDES | ||
| 478 | Chronic respiratory failure | OFFSIDES | ||
| 479 | Common Cold | SIDER | ||
| 480 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 481 | Conjunctivitis | SIDER | ||
| 482 | Coordination disturbance | SIDER | ||
| 483 | Creatine Phosphokinase Increased | SIDER | ||
| 484 | Deafness Neurosensory | OFFSIDES | ||
| 485 | Delirium | 18182475 | CTD | |
| 486 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 487 | Diabetic Foot | OFFSIDES | ||
| 488 | Diabetic Neuropathies | 14586737 | CTD | |
| 489 | Diabetic Retinopathy | OFFSIDES | ||
| 490 | Diabetic | SIDER | ||
| 491 | Diarrhea | 18182475 | CTD OFFSIDES | |
| 492 | Distention | SIDER | ||
| 493 | Diverticulum | OFFSIDES | ||
| 494 | Dysgraphia | OFFSIDES | ||
| 495 | Ear and labyrinth disorders | SIDER | ||
| 496 | Ecchymosis | SIDER | ||
| 497 | Electrolyte imbalance | SIDER | ||
| 498 | Emotional distress | OFFSIDES | ||
| 499 | Endomyocardial Fibrosis | 21545815 | CTD | |
| 500 | Eosinophilia | 16943303 | CTD | |
| 501 | Epigastric discomfort | SIDER | ||
| 502 | Epigastric pain | SIDER | ||
| 503 | Erysipelas | OFFSIDES | ||
| 504 | Essential Hypertension | OFFSIDES SIDER | ||
| 505 | Febrile Neutropenia | OFFSIDES | ||
| 506 | Fibrosis | 15149348 | CTD | |
| 507 | Flank Pain | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 508 | Foaming at mouth | OFFSIDES | ||
| 509 | Gastric irritation | SIDER | ||
| 510 | General disorders and administration site conditions | SIDER | ||
| 511 | General symptom | OFFSIDES | ||
| 512 | Glomerulonephritis | 9848785 | CTD | |
| 513 | Glycosuria | SIDER | ||
| 514 | Gout | SIDER | ||
| 515 | Granulocytosis | OFFSIDES | ||
| 516 | Haemoconcentration | OFFSIDES | ||
| 517 | Heart failure | 10750252 | CTD | |
| 518 | Heartburn | SIDER | ||
| 519 | Hemiparesis | OFFSIDES | ||
| 520 | Hydrocephalus | OFFSIDES | ||
| 521 | Infection | OFFSIDES SIDER | ||
| 522 | Infectious Mononucleosis | OFFSIDES | ||
| 523 | Intention tremor | OFFSIDES | ||
| 524 | Internal injury | OFFSIDES | ||
| 525 | Intestinal Diseases | 19077729 | CTD | |
| 526 | Jaundice, Obstructive | 23956101 | CTD | |
| 527 | Joint abscess | OFFSIDES | ||
| 528 | Kidney Diseases | 9407464 15101793 | CTD | |
| 529 | Kidney Failure, Chronic | 11104169 11765585 | CTD | |
| 530 | Kidney Failure | OFFSIDES | ||
| 531 | Labyrinthine disorder | SIDER | ||
| 532 | Leukoplakia | OFFSIDES | ||
| 533 | Lightheadedness | SIDER | ||
| 534 | Livedo Reticularis | OFFSIDES | ||
| 535 | Long QT Syndrome | 18182475 | CTD | |
| 536 | Lymphopenia | SIDER | ||
| 537 | Malnutrition | SIDER | ||
| 538 | Mastication disorder | OFFSIDES | ||
| 539 | Meningioma | OFFSIDES | ||
| 540 | Monoparesis | SIDER | ||
| 541 | Monoplegia | OFFSIDES | ||
| 542 | Mood swings | SIDER | ||
| 543 | Multiple Myeloma | OFFSIDES | ||
| 544 | Musculoskeletal discomfort | SIDER | ||
| 545 | Myositis | SIDER | ||
| 546 | Nephrectomy | OFFSIDES | ||
| 547 | Nephritis, Interstitial | 16943303 | CTD | |
| 548 | Neutropenic colitis | OFFSIDES | ||
| 549 | Numbness | SIDER | ||
| 550 | Occult blood positive | OFFSIDES | ||
| 551 | Ocular discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 552 | Oliguria | OFFSIDES | ||
| 553 | Onychoclasis | Canada Vigilance: 1 | Canada Vigilance | |
| 554 | Oral lesion | SIDER | ||
| 555 | Panniculitis | OFFSIDES | ||
| 556 | Papule | Canada Vigilance: 1 | Canada Vigilance | |
| 557 | Performance status decreased | OFFSIDES | ||
| 558 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 559 | Pharyngitis | SIDER | ||
| 560 | Phlebitis | OFFSIDES | ||
| 561 | Pinguecula | OFFSIDES | ||
| 562 | Pneumococcal sepsis | OFFSIDES | ||
| 563 | Product lot number issue | Canada Vigilance: 1 | Canada Vigilance | |
| 564 | Progesterone receptor assay | OFFSIDES | ||
| 565 | Protein urine present | SIDER | ||
| 566 | Proteinuria | 12969165 15149348 15685505 | CTD SIDER | |
| 567 | Purpura | Canada Vigilance: 1 | Canada Vigilance | |
| 568 | Relapsing Fever | OFFSIDES | ||
| 569 | Renal Artery Stenosis | OFFSIDES | ||
| 570 | Renal Insufficiency | 15685505 | CTD | |
| 571 | Respiratory tract congestion | SIDER | ||
| 572 | Restrictive cardiomyopathy | OFFSIDES | ||
| 573 | Scotoma | 16362652 | CTD | |
| 574 | Sensation of warmth | SIDER | ||
| 575 | Sick Sinus Syndrome | OFFSIDES | ||
| 576 | Sinus bradycardia | OFFSIDES | ||
| 577 | Sinus headache | Canada Vigilance: 1 | Canada Vigilance | |
| 578 | Skin discomfort | SIDER | ||
| 579 | Sopor | OFFSIDES | ||
| 580 | Spinal column stenosis | OFFSIDES | ||
| 581 | Stiffness | SIDER | ||
| 582 | Subcutaneous Abscess | OFFSIDES | ||
| 583 | Substance Withdrawal Syndrome | 20428619 | CTD | |
| 584 | Swelling of limb | SIDER | ||
| 585 | Systolic hypertension | OFFSIDES | ||
| 586 | Tension Headache | OFFSIDES | ||
| 587 | Tension | SIDER | ||
| 588 | Therapeutic response changed | Canada Vigilance: 1 | Canada Vigilance | |
| 589 | Thromboembolic stroke | OFFSIDES | ||
| 590 | Tooth Loss | OFFSIDES | ||
| 591 | Tooth repair | OFFSIDES | ||
| 592 | Toxoplasmosis | OFFSIDES | ||
| 593 | Tracheobronchitis | SIDER | ||
| 594 | Trauma | SIDER | ||
| 595 | Upper airway obstruction | OFFSIDES | ||
| 596 | Urethral Stenosis | OFFSIDES | ||
| 597 | Ventricular Remodeling | 16635409 | CTD | |
| 598 | Ventricular arrhythmia | SIDER | ||
| 599 | Vertebroplasty | OFFSIDES | ||
| 600 | Vestibular Neuronitis | OFFSIDES | ||
| 601 | Weight Gain | OFFSIDES | ||
| 602 | Xanthopsia | SIDER | ||
| 603 | bad taste | SIDER | ||
| 604 | skin abrasion | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.