Ranolazine
(XKLMZUWKNUAPSZ-UHFFFAOYSA-N)
Structure
- SMILES
- COc1ccccc1OCC(CN1CCN(CC1)CC(=O)Nc1c(C)cccc1C)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- C01EB18
- Molecular Formula:
- C24H33N3O4
- Molecular Weight:
- 427.537
- Log P:
- 2.2568
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 74.27
- CAS Number(s):
- 95635-55-5; 110445-25-5; 142387-99-3
Synonym(s)
1.
Ranolazine
2.
N-(2,6-dimethylphenyl)-4-(2-hydroxy-3-(2-methoxyphenoxy)propyl)-1-piperazineacetamide
3.
RS 43285
4.
RS 43285-193
5.
RS-43285
6.
Ranexa
7.
Ranolazine Dihydrochloride
8.
Ranolazine HCl
9.
Ranolazine Hydrochloride
10.
Renolazine
11.
43285, RS
12.
Dihydrochloride, Ranolazine
13.
HCl, Ranolazine
14.
Hydrochloride, Ranolazine
15.
RS 43285 193
16.
RS 43285193
17.
RS43285
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myocardial Infarction | FAERS: 562 | US FAERS | |
| 2 | Chest Pain | FAERS: 485 | OFFSIDES US FAERS | |
| 3 | Angina Pectoris | FAERS: 467 | 11975803 12439634 15378131 | CTD US FAERS |
| 4 | Dizziness | FAERS: 383 | OFFSIDES SIDER US FAERS | |
| 5 | Cerebrovascular accident | FAERS: 312 | US FAERS | |
| 6 | Constipation | FAERS: 238 | SIDER US FAERS | |
| 7 | Diabetes Mellitus | FAERS: 235 | US FAERS | |
| 8 | Intentional product use issue | FAERS: 227 | US FAERS | |
| 9 | Nausea | FAERS: 221 | OFFSIDES SIDER US FAERS | |
| 10 | Malaise | FAERS: 199 | US FAERS | |
| 11 | Headache | FAERS: 174 | SIDER US FAERS | |
| 12 | Product use issue | FAERS: 147 | US FAERS | |
| 13 | Pneumonia | FAERS: 140 | US FAERS | |
| 14 | Unevaluable event | FAERS: 135 | US FAERS | |
| 15 | Asthenia | FAERS: 124 | OFFSIDES SIDER US FAERS | |
| 16 | Memory impairment | FAERS: 121 | US FAERS | |
| 17 | Tremor | FAERS: 114 | SIDER US FAERS | |
| 18 | Drug dose omission | FAERS: 107 | US FAERS | |
| 19 | Dementia | FAERS: 105 | US FAERS | |
| 20 | Fatigue | FAERS: 104 | OFFSIDES SIDER US FAERS | |
| 21 | Wrong technique in product usage process | FAERS: 98 | US FAERS | |
| 22 | Coronary Artery Disease | FAERS: 96 | US FAERS | |
| 23 | Atrial Fibrillation | FAERS: 78 | 19698954 | CTD US FAERS |
| 24 | Chromaturia | FAERS: 75 | OFFSIDES SIDER US FAERS | |
| 25 | Vomiting | FAERS: 73 | SIDER US FAERS | |
| 26 | Deafness | FAERS: 71 | US FAERS | |
| 27 | Amnesia | FAERS: 69 | SIDER US FAERS | |
| 28 | Intentional dose omission | FAERS: 69 | US FAERS | |
| 29 | Implantable defibrillator insertion | FAERS: 68 | US FAERS | |
| 30 | Hypotension | FAERS: 63 | SIDER US FAERS | |
| 31 | Syncope | FAERS: 61 | SIDER US FAERS | |
| 32 | Drug ineffective | FAERS: 59 | US FAERS | |
| 33 | Feeling abnormal | FAERS: 57 | SIDER US FAERS | |
| 34 | Therapeutic response unexpected | FAERS: 56 | OFFSIDES US FAERS | |
| 35 | Pain | FAERS: 55 | US FAERS | |
| 36 | Weight decreased | FAERS: 55 | SIDER US FAERS | |
| 37 | Visual Impairment | FAERS: 51 | SIDER US FAERS | |
| 38 | Blindness | FAERS: 48 | US FAERS | |
| 39 | Palpitations | FAERS: 48 | SIDER US FAERS | |
| 40 | Disability | FAERS: 47 | US FAERS | |
| 41 | Intentional product misuse | FAERS: 47 | US FAERS | |
| 42 | Chest discomfort | FAERS: 46 | US FAERS | |
| 43 | Cataract | FAERS: 45 | US FAERS | |
| 44 | Back Pain | FAERS: 42 | US FAERS | |
| 45 | Thrombosis | FAERS: 42 | US FAERS | |
| 46 | Wrong technique in drug usage process | FAERS: 36 | OFFSIDES US FAERS | |
| 47 | Angioplasty | FAERS: 35 | OFFSIDES US FAERS | |
| 48 | Tinnitus | FAERS: 35 | SIDER US FAERS | |
| 49 | Blood creatinine increased | FAERS: 34 | OFFSIDES SIDER US FAERS | |
| 50 | Dehydration | FAERS: 34 | SIDER US FAERS | |
| 51 | Cardiac Arrest | FAERS: 33 | US FAERS | |
| 52 | Stress | FAERS: 33 | US FAERS | |
| 53 | Medication residue present | FAERS: 32 | US FAERS | |
| 54 | Anxiety | FAERS: 31 | SIDER US FAERS | |
| 55 | Arthritis | FAERS: 31 | US FAERS | |
| 56 | Urinary tract infection | FAERS: 30 | US FAERS | |
| 57 | Pruritus | FAERS: 28 | SIDER US FAERS | |
| 58 | Influenza | FAERS: 27 | US FAERS | |
| 59 | Alopecia | FAERS: 26 | US FAERS | |
| 60 | Bronchitis | FAERS: 26 | US FAERS | |
| 61 | Glaucoma | FAERS: 26 | US FAERS | |
| 62 | Abdominal discomfort | FAERS: 24 | SIDER US FAERS | |
| 63 | General physical health deterioration | FAERS: 24 | US FAERS | |
| 64 | Nasopharyngitis | FAERS: 24 | US FAERS | |
| 65 | Nephrolithiasis | FAERS: 24 | OFFSIDES US FAERS | |
| 66 | Peripheral swelling | FAERS: 24 | US FAERS | |
| 67 | Macular degeneration | FAERS: 23 | US FAERS | |
| 68 | Somnolence | FAERS: 23 | SIDER US FAERS | |
| 69 | Abdominal Pain | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 70 | Vertigo | FAERS: 22 | SIDER US FAERS | |
| 71 | Arthralgia | FAERS: 21 | US FAERS | |
| 72 | Blood glucose increased | FAERS: 21 | US FAERS | |
| 73 | Inability to afford medication | FAERS: 21 | US FAERS | |
| 74 | Product dose omission | FAERS: 21 | US FAERS | |
| 75 | Impaired work ability | FAERS: 20 | US FAERS | |
| 76 | Abasia | FAERS: 19 | US FAERS | |
| 77 | Blood glucose decreased | FAERS: 19 | OFFSIDES US FAERS | |
| 78 | Dyspepsia | FAERS: 19 | SIDER US FAERS | |
| 79 | Hypersensitivity | FAERS: 19 | US FAERS | |
| 80 | Mental impairment | FAERS: 19 | US FAERS | |
| 81 | Product use complaint | FAERS: 19 | US FAERS | |
| 82 | Multiple Sclerosis | FAERS: 18 | US FAERS | |
| 83 | Therapy cessation | FAERS: 18 | US FAERS | |
| 84 | Disorientation | FAERS: 17 | SIDER US FAERS | |
| 85 | Infection | FAERS: 17 | US FAERS | |
| 86 | Overdose | FAERS: 17 | US FAERS | |
| 87 | Asthma | FAERS: 16 | US FAERS | |
| 88 | Urinary Retention | FAERS: 16 | SIDER US FAERS | |
| 89 | Choking | FAERS: 15 | US FAERS | |
| 90 | Dysuria | FAERS: 15 | SIDER US FAERS | |
| 91 | Flatulence | FAERS: 15 | SIDER US FAERS | |
| 92 | Myalgia | FAERS: 15 | US FAERS | |
| 93 | Swelling | FAERS: 15 | US FAERS | |
| 94 | Arthropathy | FAERS: 14 | US FAERS | |
| 95 | Blood cholesterol increased | FAERS: 14 | US FAERS | |
| 96 | Cardiac assistance device user | FAERS: 14 | US FAERS | |
| 97 | Hernia | FAERS: 14 | US FAERS | |
| 98 | Hip surgery | FAERS: 14 | US FAERS | |
| 99 | Inappropriate schedule of drug administration | FAERS: 14 | OFFSIDES US FAERS | |
| 100 | Musculoskeletal Pain | FAERS: 14 | US FAERS | |
| 101 | Angioedema | FAERS: 13 | SIDER US FAERS | |
| 102 | Blood urine present | FAERS: 13 | US FAERS | |
| 103 | Bradycardia | FAERS: 13 | SIDER US FAERS | |
| 104 | Diplopia | FAERS: 13 | SIDER US FAERS | |
| 105 | Joint swelling | FAERS: 13 | SIDER US FAERS | |
| 106 | Laceration | FAERS: 13 | US FAERS | |
| 107 | Dysarthria | FAERS: 12 | US FAERS | |
| 108 | Dysgraphia | FAERS: 12 | US FAERS | |
| 109 | Presyncope | FAERS: 12 | US FAERS | |
| 110 | Tachycardia | FAERS: 12 | 16777088 | CTD US FAERS |
| 111 | Urticaria | FAERS: 12 | SIDER US FAERS | |
| 112 | Acute myocardial infarction | FAERS: 11 | OFFSIDES US FAERS | |
| 113 | Carotid artery occlusion | FAERS: 11 | US FAERS | |
| 114 | Catheter placement | FAERS: 11 | US FAERS | |
| 115 | Lip swelling | FAERS: 11 | US FAERS | |
| 116 | Pancreatitis | FAERS: 11 | SIDER US FAERS | |
| 117 | Product difficult to swallow | FAERS: 11 | US FAERS | |
| 118 | Retching | FAERS: 11 | US FAERS | |
| 119 | Rheumatoid Arthritis | FAERS: 11 | US FAERS | |
| 120 | Walking aid user | FAERS: 11 | US FAERS | |
| 121 | Aneurysm | FAERS: 10 | US FAERS | |
| 122 | Ankle Fracture | FAERS: 10 | US FAERS | |
| 123 | Back disorder | FAERS: 10 | US FAERS | |
| 124 | Cellulitis | FAERS: 10 | US FAERS | |
| 125 | Diverticulitis | FAERS: 10 | US FAERS | |
| 126 | Dysgeusia | FAERS: 10 | US FAERS | |
| 127 | Epistaxis | FAERS: 10 | SIDER US FAERS | |
| 128 | Erectile dysfunction | FAERS: 10 | SIDER US FAERS | |
| 129 | Gout | FAERS: 10 | OFFSIDES US FAERS | |
| 130 | Intestinal Obstruction | FAERS: 10 | US FAERS | |
| 131 | Limb operation | FAERS: 10 | US FAERS | |
| 132 | Sinusitis | FAERS: 10 | US FAERS | |
| 133 | Aortic Aneurysm | FAERS: 9 | US FAERS | |
| 134 | Atrioventricular Block | FAERS: 9 | OFFSIDES US FAERS | |
| 135 | Chills | FAERS: 9 | US FAERS | |
| 136 | Delirium | FAERS: 9 | US FAERS | |
| 137 | Neck Pain | FAERS: 9 | US FAERS | |
| 138 | Pancreatic carcinoma | FAERS: 9 | US FAERS | |
| 139 | Pulmonary Fibrosis | FAERS: 9 | SIDER US FAERS | |
| 140 | Rotator cuff syndrome | FAERS: 9 | US FAERS | |
| 141 | Sudden death | FAERS: 9 | US FAERS | |
| 142 | Accidental overdose | FAERS: 8 | US FAERS | |
| 143 | Discomfort | FAERS: 8 | US FAERS | |
| 144 | Dysphonia | FAERS: 8 | US FAERS | |
| 145 | Fibromyalgia | FAERS: 8 | US FAERS | |
| 146 | Flushing | FAERS: 8 | US FAERS | |
| 147 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 148 | Mental status changes | FAERS: 8 | OFFSIDES US FAERS | |
| 149 | Microvascular coronary artery disease | FAERS: 8 | US FAERS | |
| 150 | Osteoporosis | FAERS: 8 | US FAERS | |
| 151 | Product size issue | FAERS: 8 | US FAERS | |
| 152 | Sepsis | FAERS: 8 | US FAERS | |
| 153 | Ventricular Fibrillation | FAERS: 8 | US FAERS | |
| 154 | Wheelchair user | FAERS: 8 | US FAERS | |
| 155 | angiogram | FAERS: 8 | US FAERS | |
| 156 | Activities of daily living impaired | FAERS: 7 | OFFSIDES US FAERS | |
| 157 | Agitation | FAERS: 7 | US FAERS | |
| 158 | Aphasia | FAERS: 7 | US FAERS | |
| 159 | Arteriosclerosis | FAERS: 7 | US FAERS | |
| 160 | Blood pressure fluctuation | FAERS: 7 | US FAERS | |
| 161 | Cardiac ablation | FAERS: 7 | US FAERS | |
| 162 | Chemotherapy | FAERS: 7 | US FAERS | |
| 163 | Drug ineffective for unapproved indication | FAERS: 7 | US FAERS | |
| 164 | Electrocardiogram abnormal | FAERS: 7 | US FAERS | |
| 165 | Emotional disorder | FAERS: 7 | US FAERS | |
| 166 | Erythema | FAERS: 7 | US FAERS | |
| 167 | Feeling jittery | FAERS: 7 | US FAERS | |
| 168 | General physical condition abnormal | FAERS: 7 | US FAERS | |
| 169 | Peripheral arterial occlusive disease | FAERS: 7 | US FAERS | |
| 170 | Post procedural complication | FAERS: 7 | US FAERS | |
| 171 | Terminal state | FAERS: 7 | US FAERS | |
| 172 | Urinary Incontinence | FAERS: 7 | US FAERS | |
| 173 | Vascular occlusion | FAERS: 7 | US FAERS | |
| 174 | Ageusia | FAERS: 6 | US FAERS | |
| 175 | Aphonia | FAERS: 6 | US FAERS | |
| 176 | Ataxia | FAERS: 6 | US FAERS | |
| 177 | Bedridden | FAERS: 6 | US FAERS | |
| 178 | Cold sweat | FAERS: 6 | SIDER US FAERS | |
| 179 | Coronary angioplasty | FAERS: 6 | US FAERS | |
| 180 | Cystitis | FAERS: 6 | US FAERS | |
| 181 | Device occlusion | FAERS: 6 | US FAERS | |
| 182 | Gait inability | FAERS: 6 | US FAERS | |
| 183 | Intentional drug misuse | FAERS: 6 | US FAERS | |
| 184 | Intracranial Aneurysm | FAERS: 6 | US FAERS | |
| 185 | Loss of personal independence in daily activities | FAERS: 6 | US FAERS | |
| 186 | Nervousness | FAERS: 6 | US FAERS | |
| 187 | Oliguria | FAERS: 6 | US FAERS | |
| 188 | Oropharyngeal pain | FAERS: 6 | OFFSIDES US FAERS | |
| 189 | Procedural complication | FAERS: 6 | US FAERS | |
| 190 | Product package associated injury | FAERS: 6 | US FAERS | |
| 191 | Product physical issue | FAERS: 6 | US FAERS | |
| 192 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 193 | Pulmonary Hypertension | FAERS: 6 | US FAERS | |
| 194 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 195 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 196 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 197 | Blood creatinine abnormal | FAERS: 5 | US FAERS | |
| 198 | Blood potassium increased | FAERS: 5 | US FAERS | |
| 199 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 200 | Carpal Tunnel Syndrome | FAERS: 5 | US FAERS | |
| 201 | Complication associated with device | FAERS: 5 | US FAERS | |
| 202 | Drug administration error | FAERS: 5 | US FAERS | |
| 203 | Expired product administered | FAERS: 5 | US FAERS | |
| 204 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 205 | Joint injury | FAERS: 5 | US FAERS | |
| 206 | Lethargy | FAERS: 5 | SIDER US FAERS | |
| 207 | Limb injury | FAERS: 5 | US FAERS | |
| 208 | Osteomyelitis | FAERS: 5 | US FAERS | |
| 209 | Pericardial effusion | FAERS: 5 | US FAERS | |
| 210 | Pneumothorax | FAERS: 5 | US FAERS | |
| 211 | Productive Cough | FAERS: 5 | US FAERS | |
| 212 | Pulmonary thrombosis | FAERS: 5 | US FAERS | |
| 213 | Rash erythematous | FAERS: 5 | US FAERS | |
| 214 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 215 | Restlessness | FAERS: 5 | US FAERS | |
| 216 | Spinal column stenosis | FAERS: 5 | US FAERS | |
| 217 | Stent malfunction | FAERS: 5 | US FAERS | |
| 218 | Throat cancer | FAERS: 5 | US FAERS | |
| 219 | Throat irritation | FAERS: 5 | US FAERS | |
| 220 | Thrombocytopenia | FAERS: 5 | SIDER US FAERS | |
| 221 | nervous system disorder | FAERS: 5 | SIDER US FAERS | |
| 222 | Blood cholesterol abnormal | FAERS: 4 | US FAERS | |
| 223 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 224 | Blood urea increased | FAERS: 4 | SIDER US FAERS | |
| 225 | Breast tenderness | FAERS: 4 | US FAERS | |
| 226 | Burning sensation | FAERS: 4 | US FAERS | |
| 227 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 228 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 229 | Clostridium difficile infection | FAERS: 4 | US FAERS | |
| 230 | Colectomy | FAERS: 4 | US FAERS | |
| 231 | Creatinine renal clearance decreased | FAERS: 4 | US FAERS | |
| 232 | Cyanosis | FAERS: 4 | US FAERS | |
| 233 | Diastolic dysfunction | FAERS: 4 | US FAERS | |
| 234 | Eye pain | FAERS: 4 | US FAERS | |
| 235 | Hypersomnia | FAERS: 4 | US FAERS | |
| 236 | Implantable cardiac monitor insertion | FAERS: 4 | US FAERS | |
| 237 | Incontinence | FAERS: 4 | US FAERS | |
| 238 | Laryngitis | FAERS: 4 | US FAERS | |
| 239 | Limb discomfort | FAERS: 4 | US FAERS | |
| 240 | Meniscus injury | FAERS: 4 | US FAERS | |
| 241 | Musculoskeletal discomfort | FAERS: 4 | OFFSIDES US FAERS | |
| 242 | Myasthenia Gravis | FAERS: 4 | US FAERS | |
| 243 | Peripheral artery bypass | FAERS: 4 | US FAERS | |
| 244 | Pneumonectomy | FAERS: 4 | US FAERS | |
| 245 | Product packaging issue | FAERS: 4 | US FAERS | |
| 246 | Product storage error | FAERS: 4 | US FAERS | |
| 247 | Renal artery stent placement | FAERS: 4 | US FAERS | |
| 248 | Therapeutic procedure | FAERS: 4 | US FAERS | |
| 249 | Tooth Extraction | FAERS: 4 | US FAERS | |
| 250 | Toothache | FAERS: 4 | US FAERS | |
| 251 | Unresponsive to stimuli | FAERS: 4 | OFFSIDES US FAERS | |
| 252 | Venous occlusion | FAERS: 4 | US FAERS | |
| 253 | cancer surgery | FAERS: 4 | US FAERS | |
| 254 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 255 | Amphetamines positive | FAERS: 3 | US FAERS | |
| 256 | Anorexia | FAERS: 3 | SIDER US FAERS | |
| 257 | Arterial thrombosis | FAERS: 3 | US FAERS | |
| 258 | Blood creatine increased | FAERS: 3 | OFFSIDES US FAERS | |
| 259 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 260 | Carotid Endarterectomy | FAERS: 3 | US FAERS | |
| 261 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 262 | Crying | FAERS: 3 | US FAERS | |
| 263 | Cyst | FAERS: 3 | OFFSIDES US FAERS | |
| 264 | Diabetic ulcer | FAERS: 3 | US FAERS | |
| 265 | Dystonia | FAERS: 3 | US FAERS | |
| 266 | Epilepsy | FAERS: 3 | US FAERS | |
| 267 | Eructation | FAERS: 3 | US FAERS | |
| 268 | Fluid overload | FAERS: 3 | US FAERS | |
| 269 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 270 | Gastrostomy | FAERS: 3 | US FAERS | |
| 271 | Hepatitis C | FAERS: 3 | US FAERS | |
| 272 | Initial insomnia | FAERS: 3 | US FAERS | |
| 273 | Intervertebral Disc Degeneration | FAERS: 3 | US FAERS | |
| 274 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 275 | Leukopenia | FAERS: 3 | SIDER US FAERS | |
| 276 | Ligament rupture | FAERS: 3 | US FAERS | |
| 277 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 278 | Mastectomy | FAERS: 3 | US FAERS | |
| 279 | Mechanical ventilation | FAERS: 3 | US FAERS | |
| 280 | Medication Error | FAERS: 3 | US FAERS | |
| 281 | Myoclonus | FAERS: 3 | US FAERS | |
| 282 | Night sweats | FAERS: 3 | US FAERS | |
| 283 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 284 | Oxygen supplementation | FAERS: 3 | US FAERS | |
| 285 | Peripheral artery occlusion | FAERS: 3 | US FAERS | |
| 286 | Prescription drug used without a prescription | FAERS: 3 | US FAERS | |
| 287 | Product closure removal difficult | FAERS: 3 | US FAERS | |
| 288 | Product dispensing error | FAERS: 3 | US FAERS | |
| 289 | Product quality issue | FAERS: 3 | US FAERS | |
| 290 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 291 | Rehabilitation therapy | FAERS: 3 | US FAERS | |
| 292 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 293 | Septic Shock | FAERS: 3 | US FAERS | |
| 294 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 295 | Spinal fusion surgery | FAERS: 3 | US FAERS | |
| 296 | Sudden Cardiac Death | FAERS: 3 | US FAERS | |
| 297 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 298 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 299 | Thirst | FAERS: 3 | US FAERS | |
| 300 | Ulcer | FAERS: 3 | US FAERS | |
| 301 | Vasospasm | FAERS: 3 | US FAERS | |
| 302 | colonoscopy | FAERS: 3 | US FAERS | |
| 303 | Amputation | FAERS: 2 | US FAERS | |
| 304 | Anosmia | FAERS: 2 | US FAERS | |
| 305 | Anuria | FAERS: 2 | US FAERS | |
| 306 | Arterial Injury | FAERS: 2 | US FAERS | |
| 307 | Ascites | FAERS: 2 | US FAERS | |
| 308 | Atrial Flutter | FAERS: 2 | OFFSIDES US FAERS | |
| 309 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 310 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 311 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 312 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 313 | Brain Hypoxia | FAERS: 2 | US FAERS | |
| 314 | Cardiac dysfunction | FAERS: 2 | US FAERS | |
| 315 | Cardiac procedure complication | FAERS: 2 | US FAERS | |
| 316 | Carotid bruit | FAERS: 2 | US FAERS | |
| 317 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 318 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 319 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 320 | Colitis | FAERS: 2 | US FAERS | |
| 321 | Collateral Circulation | FAERS: 2 | US FAERS | |
| 322 | Coronary vascular graft occlusion | FAERS: 2 | US FAERS | |
| 323 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 324 | Device malfunction | FAERS: 2 | US FAERS | |
| 325 | Device related infection | FAERS: 2 | US FAERS | |
| 326 | Diabetic Foot | FAERS: 2 | US FAERS | |
| 327 | Drooling | FAERS: 2 | US FAERS | |
| 328 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 329 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 330 | Dysphemia | FAERS: 2 | US FAERS | |
| 331 | Ear discomfort | FAERS: 2 | US FAERS | |
| 332 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 333 | Eosinophilia | FAERS: 2 | SIDER US FAERS | |
| 334 | Escherichia infection | FAERS: 2 | US FAERS | |
| 335 | Eye Infection | FAERS: 2 | US FAERS | |
| 336 | Feeling Cold | FAERS: 2 | US FAERS | |
| 337 | Food Poisoning | FAERS: 2 | US FAERS | |
| 338 | Formication | FAERS: 2 | OFFSIDES US FAERS | |
| 339 | Gastrectomy | FAERS: 2 | US FAERS | |
| 340 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 341 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 342 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 343 | Gastrointestinal infection | FAERS: 2 | OFFSIDES US FAERS | |
| 344 | Hemiplegia | FAERS: 2 | US FAERS | |
| 345 | Hepatitis | FAERS: 2 | US FAERS | |
| 346 | Hospice Care | FAERS: 2 | US FAERS | |
| 347 | Hunger | FAERS: 2 | US FAERS | |
| 348 | Hypertrophic Cardiomyopathy | FAERS: 2 | US FAERS | |
| 349 | Hypokinesia | FAERS: 2 | OFFSIDES US FAERS | |
| 350 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 351 | Immobile | FAERS: 2 | US FAERS | |
| 352 | Implantable defibrillator replacement | FAERS: 2 | US FAERS | |
| 353 | Incoherent | FAERS: 2 | US FAERS | |
| 354 | Insulin-requiring type 2 diabetes mellitus | FAERS: 2 | US FAERS | |
| 355 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 356 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 357 | Limb girth increased | FAERS: 2 | US FAERS | |
| 358 | Lipids abnormal | FAERS: 2 | US FAERS | |
| 359 | Lower respiratory tract congestion | FAERS: 2 | US FAERS | |
| 360 | Lung Injury | FAERS: 2 | OFFSIDES US FAERS | |
| 361 | Lymphoma | FAERS: 2 | US FAERS | |
| 362 | Medical device implantation | FAERS: 2 | US FAERS | |
| 363 | Medication residue | FAERS: 2 | US FAERS | |
| 364 | Menorrhagia | FAERS: 2 | US FAERS | |
| 365 | Middle insomnia | FAERS: 2 | US FAERS | |
| 366 | Mood swings | FAERS: 2 | US FAERS | |
| 367 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 368 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 369 | Myocardial fibrosis | FAERS: 2 | US FAERS | |
| 370 | Narcolepsy | FAERS: 2 | US FAERS | |
| 371 | Nerve injury | FAERS: 2 | US FAERS | |
| 372 | Nitrate compound therapy | FAERS: 2 | US FAERS | |
| 373 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 374 | Oxygen saturation increased | FAERS: 2 | US FAERS | |
| 375 | Pallor | FAERS: 2 | US FAERS | |
| 376 | Pancytopenia | FAERS: 2 | SIDER US FAERS | |
| 377 | Peripheral artery stent insertion | FAERS: 2 | US FAERS | |
| 378 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 379 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 380 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 381 | Product blister packaging issue | FAERS: 2 | US FAERS | |
| 382 | Product residue present | FAERS: 2 | US FAERS | |
| 383 | Product substitution issue | FAERS: 2 | US FAERS | |
| 384 | Prurigo | FAERS: 2 | US FAERS | |
| 385 | Pulmonary toxicity | FAERS: 2 | OFFSIDES US FAERS | |
| 386 | Renal pain | FAERS: 2 | US FAERS | |
| 387 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 388 | Sciatica | FAERS: 2 | US FAERS | |
| 389 | Secretion discharge | FAERS: 2 | US FAERS | |
| 390 | Shock | FAERS: 2 | SIDER US FAERS | |
| 391 | Sneezing | FAERS: 2 | US FAERS | |
| 392 | Splenomegaly | FAERS: 2 | US FAERS | |
| 393 | Spontaneous penile erection | FAERS: 2 | US FAERS | |
| 394 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 395 | Transplant | FAERS: 2 | US FAERS | |
| 396 | Troponin increased | FAERS: 2 | US FAERS | |
| 397 | Urine output increased | FAERS: 2 | US FAERS | |
| 398 | Vascular stent insertion | FAERS: 2 | US FAERS | |
| 399 | Vascular stent occlusion | FAERS: 2 | US FAERS | |
| 400 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 401 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 402 | Abdominal hernia obstructive | FAERS: 1 | US FAERS | |
| 403 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 404 | Accidental underdose | FAERS: 1 | US FAERS | |
| 405 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 406 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 407 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 408 | Airway burns | FAERS: 1 | US FAERS | |
| 409 | Ammonia increased | FAERS: 1 | US FAERS | |
| 410 | Anticoagulation drug level decreased | FAERS: 1 | US FAERS | |
| 411 | Anticonvulsant drug level below therapeutic | FAERS: 1 | US FAERS | |
| 412 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 413 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 414 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 415 | Apparent death | FAERS: 1 | US FAERS | |
| 416 | Appendicitis | FAERS: 1 | US FAERS | |
| 417 | Arterial bypass operation | FAERS: 1 | US FAERS | |
| 418 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 419 | Arteritis | FAERS: 1 | US FAERS | |
| 420 | Arthropod bite | FAERS: 1 | US FAERS | |
| 421 | Arthropod sting | FAERS: 1 | US FAERS | |
| 422 | Asthenopia | FAERS: 1 | US FAERS | |
| 423 | Atrial appendage closure | FAERS: 1 | US FAERS | |
| 424 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 425 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 426 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 427 | B-cell lymphoma stage IV | FAERS: 1 | US FAERS | |
| 428 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 429 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 430 | Biliary Colic | FAERS: 1 | US FAERS | |
| 431 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 432 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 433 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 434 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 435 | Blood insulin decreased | FAERS: 1 | US FAERS | |
| 436 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 437 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 438 | Blood viscosity decreased | FAERS: 1 | US FAERS | |
| 439 | Bone density decreased | FAERS: 1 | US FAERS | |
| 440 | Brachytherapy | FAERS: 1 | US FAERS | |
| 441 | Breast Cyst | FAERS: 1 | US FAERS | |
| 442 | Breast cancer stage II | FAERS: 1 | US FAERS | |
| 443 | Bronchoscopy | FAERS: 1 | US FAERS | |
| 444 | Calcinosis | FAERS: 1 | US FAERS | |
| 445 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 446 | Cardiac complication associated with device | FAERS: 1 | US FAERS | |
| 447 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 448 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 449 | Cardiac infection | FAERS: 1 | US FAERS | |
| 450 | Cardiac monitoring | FAERS: 1 | US FAERS | |
| 451 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 452 | Cardiac ventricular thrombosis | FAERS: 1 | US FAERS | |
| 453 | Cardiopulmonary Bypass | FAERS: 1 | US FAERS | |
| 454 | Cartilage injury | FAERS: 1 | US FAERS | |
| 455 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 456 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 457 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 458 | Compression fracture | FAERS: 1 | US FAERS | |
| 459 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 460 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 461 | Critical Illness | FAERS: 1 | US FAERS | |
| 462 | Deafness Permanent | FAERS: 1 | US FAERS | |
| 463 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 464 | Dependence | FAERS: 1 | US FAERS | |
| 465 | Depressed Level of Consciousness | FAERS: 1 | SIDER US FAERS | |
| 466 | Depressed mood | FAERS: 1 | US FAERS | |
| 467 | Device Failure | FAERS: 1 | US FAERS | |
| 468 | Device dislocation | FAERS: 1 | US FAERS | |
| 469 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 470 | Diabetic Amyotrophy | FAERS: 1 | US FAERS | |
| 471 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 472 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 473 | Diabetic blindness | FAERS: 1 | US FAERS | |
| 474 | Diplegia | FAERS: 1 | US FAERS | |
| 475 | Disease Progression | FAERS: 1 | US FAERS | |
| 476 | Dissociation | FAERS: 1 | US FAERS | |
| 477 | Diverticulum | FAERS: 1 | US FAERS | |
| 478 | Dropped head syndrome | FAERS: 1 | US FAERS | |
| 479 | Drug abuse | FAERS: 1 | US FAERS | |
| 480 | Drug clearance decreased | FAERS: 1 | US FAERS | |
| 481 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 482 | Dry age-related macular degeneration | FAERS: 1 | US FAERS | |
| 483 | Dry skin | FAERS: 1 | US FAERS | |
| 484 | Dyscalculia | FAERS: 1 | US FAERS | |
| 485 | Early retirement | FAERS: 1 | US FAERS | |
| 486 | Eczema | FAERS: 1 | US FAERS | |
| 487 | Ejection fraction abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 488 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 489 | Embolism | FAERS: 1 | OFFSIDES US FAERS | |
| 490 | Endothelial dysfunction | FAERS: 1 | US FAERS | |
| 491 | Enteritis | FAERS: 1 | US FAERS | |
| 492 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 493 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 494 | Essential Tremor | FAERS: 1 | US FAERS | |
| 495 | Euphoric mood | FAERS: 1 | US FAERS | |
| 496 | Extra dose administered | FAERS: 1 | US FAERS | |
| 497 | Eye inflammation | FAERS: 1 | US FAERS | |
| 498 | Facial paralysis | FAERS: 1 | US FAERS | |
| 499 | Factor V deficiency | FAERS: 1 | US FAERS | |
| 500 | Factor VIII Deficiency | FAERS: 1 | US FAERS | |
| 501 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 502 | Food aversion | FAERS: 1 | US FAERS | |
| 503 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 504 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 505 | Fracture | FAERS: 1 | US FAERS | |
| 506 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 507 | Frustration | FAERS: 1 | US FAERS | |
| 508 | Gangrene | FAERS: 1 | US FAERS | |
| 509 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 1 | US FAERS | |
| 510 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 511 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 512 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 513 | Graft infection | FAERS: 1 | US FAERS | |
| 514 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 515 | Head discomfort | FAERS: 1 | US FAERS | |
| 516 | Hearing aid user | FAERS: 1 | US FAERS | |
| 517 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 518 | Heat Stroke | FAERS: 1 | US FAERS | |
| 519 | Hemiparesis | FAERS: 1 | US FAERS | |
| 520 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 521 | Hepatitis B | FAERS: 1 | US FAERS | |
| 522 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 523 | Hypertensive cardiomyopathy | FAERS: 1 | US FAERS | |
| 524 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 525 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 526 | Hypertensive heart disease | FAERS: 1 | OFFSIDES US FAERS | |
| 527 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 528 | Hypophagia | FAERS: 1 | US FAERS | |
| 529 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 530 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 531 | Hysterectomy | FAERS: 1 | US FAERS | |
| 532 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 533 | Ileus | FAERS: 1 | US FAERS | |
| 534 | Illiteracy | FAERS: 1 | US FAERS | |
| 535 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 536 | In-stent arterial stenosis | FAERS: 1 | US FAERS | |
| 537 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 538 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 539 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 540 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 541 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 542 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 543 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 544 | Intestinal cyst | FAERS: 1 | US FAERS | |
| 545 | Intestinal resection | FAERS: 1 | US FAERS | |
| 546 | Intracranial mass | FAERS: 1 | US FAERS | |
| 547 | Iris injury | FAERS: 1 | US FAERS | |
| 548 | Iron deficiency | FAERS: 1 | US FAERS | |
| 549 | Joint destruction | FAERS: 1 | US FAERS | |
| 550 | Joint stiffness | FAERS: 1 | US FAERS | |
| 551 | Keratomileusis | FAERS: 1 | US FAERS | |
| 552 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 553 | Laryngeal Squamous Cell Carcinoma | FAERS: 1 | US FAERS | |
| 554 | Laryngectomy | FAERS: 1 | US FAERS | |
| 555 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 556 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 557 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 558 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 559 | Lipoma | FAERS: 1 | US FAERS | |
| 560 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 561 | Living in residential institution | FAERS: 1 | US FAERS | |
| 562 | Long QT Syndrome | FAERS: 1 | 24052561 | CTD US FAERS |
| 563 | Loose tooth | FAERS: 1 | US FAERS | |
| 564 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 565 | Lung carcinoma cell type unspecified stage II | FAERS: 1 | US FAERS | |
| 566 | Lymphatic system neoplasm | FAERS: 1 | US FAERS | |
| 567 | Malabsorption | FAERS: 1 | US FAERS | |
| 568 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 569 | Meningioma | FAERS: 1 | US FAERS | |
| 570 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 571 | Mesenteric arterial occlusion | FAERS: 1 | US FAERS | |
| 572 | Mesothelioma | FAERS: 1 | US FAERS | |
| 573 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 574 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 575 | Motion Sickness | FAERS: 1 | US FAERS | |
| 576 | Mouth swelling | FAERS: 1 | US FAERS | |
| 577 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 578 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 579 | Muscle strain | FAERS: 1 | US FAERS | |
| 580 | Muscle tightness | FAERS: 1 | US FAERS | |
| 581 | Myocardial calcification | FAERS: 1 | US FAERS | |
| 582 | Myopathy | FAERS: 1 | US FAERS | |
| 583 | Myopia | FAERS: 1 | US FAERS | |
| 584 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 585 | Nephrectomy | FAERS: 1 | US FAERS | |
| 586 | Neuralgia | FAERS: 1 | US FAERS | |
| 587 | Neuroprosthesis implantation | FAERS: 1 | US FAERS | |
| 588 | Neutropenia | FAERS: 1 | US FAERS | |
| 589 | No adverse event | FAERS: 1 | US FAERS | |
| 590 | Obesity | FAERS: 1 | US FAERS | |
| 591 | Obstruction | FAERS: 1 | US FAERS | |
| 592 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 593 | Oral pain | FAERS: 1 | US FAERS | |
| 594 | Oral pruritus | FAERS: 1 | US FAERS | |
| 595 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 596 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 597 | Orthosis user | FAERS: 1 | US FAERS | |
| 598 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 599 | Overweight | FAERS: 1 | US FAERS | |
| 600 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 601 | Oxygen saturation abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 602 | Palpable purpura | FAERS: 1 | US FAERS | |
| 603 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 604 | Pancreatic operation | FAERS: 1 | US FAERS | |
| 605 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 606 | Paranoia | FAERS: 1 | US FAERS | |
| 607 | Paraparesis | FAERS: 1 | US FAERS | |
| 608 | Paraplegia | FAERS: 1 | US FAERS | |
| 609 | Parasomnia | FAERS: 1 | US FAERS | |
| 610 | Parkinsonian rest tremor | FAERS: 1 | US FAERS | |
| 611 | Pelvic operation | FAERS: 1 | US FAERS | |
| 612 | Percutaneous Coronary Intervention | FAERS: 1 | US FAERS | |
| 613 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 614 | Peripheral artery angioplasty | FAERS: 1 | US FAERS | |
| 615 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 616 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 617 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 618 | Peritonitis | FAERS: 1 | US FAERS | |
| 619 | Personality Change | FAERS: 1 | US FAERS | |
| 620 | Petechiae | FAERS: 1 | US FAERS | |
| 621 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 622 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 623 | Phlebitis | FAERS: 1 | US FAERS | |
| 624 | Physical disability | FAERS: 1 | US FAERS | |
| 625 | Physical product label issue | FAERS: 1 | US FAERS | |
| 626 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 627 | Pneumonitis | FAERS: 1 | US FAERS | |
| 628 | Polymyositis | FAERS: 1 | US FAERS | |
| 629 | Post procedural stroke | FAERS: 1 | US FAERS | |
| 630 | Post procedural urine leak | FAERS: 1 | US FAERS | |
| 631 | Postinfarction angina | FAERS: 1 | US FAERS | |
| 632 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 633 | Probiotic therapy | FAERS: 1 | US FAERS | |
| 634 | Procedural intestinal perforation | FAERS: 1 | US FAERS | |
| 635 | Procedural nausea | FAERS: 1 | US FAERS | |
| 636 | Product container issue | FAERS: 1 | US FAERS | |
| 637 | Product distribution issue | FAERS: 1 | US FAERS | |
| 638 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 639 | Product lot number issue | FAERS: 1 | US FAERS | |
| 640 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 641 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 642 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 643 | Progressive multiple sclerosis | FAERS: 1 | US FAERS | |
| 644 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 645 | Pulmonary arteriopathy | FAERS: 1 | US FAERS | |
| 646 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 647 | Quadriplegia | FAERS: 1 | US FAERS | |
| 648 | Radiation injury | FAERS: 1 | US FAERS | |
| 649 | Radiotherapy to prostate | FAERS: 1 | US FAERS | |
| 650 | Rales | FAERS: 1 | US FAERS | |
| 651 | Rebound effect | FAERS: 1 | US FAERS | |
| 652 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 653 | Renal cyst | FAERS: 1 | US FAERS | |
| 654 | Renal mass | FAERS: 1 | US FAERS | |
| 655 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 656 | Rhabdomyolysis | FAERS: 1 | OFFSIDES US FAERS | |
| 657 | Rhinitis | FAERS: 1 | US FAERS | |
| 658 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 659 | Saliva altered | FAERS: 1 | US FAERS | |
| 660 | Salt craving | FAERS: 1 | US FAERS | |
| 661 | Schizophrenia | FAERS: 1 | US FAERS | |
| 662 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 663 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 664 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 665 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 666 | Sinus operation | FAERS: 1 | US FAERS | |
| 667 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 668 | Skeletal injury | FAERS: 1 | US FAERS | |
| 669 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 670 | Skin discomfort | FAERS: 1 | US FAERS | |
| 671 | Skin graft infection | FAERS: 1 | US FAERS | |
| 672 | Skin laceration | FAERS: 1 | US FAERS | |
| 673 | Skin reaction | FAERS: 1 | US FAERS | |
| 674 | Skin tightness | FAERS: 1 | US FAERS | |
| 675 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 676 | Sluggishness | FAERS: 1 | US FAERS | |
| 677 | Snoring | FAERS: 1 | US FAERS | |
| 678 | Spinal column injury | FAERS: 1 | US FAERS | |
| 679 | Spleen procedural complication | FAERS: 1 | US FAERS | |
| 680 | Splenectomy | FAERS: 1 | US FAERS | |
| 681 | Stent patency maintenance | FAERS: 1 | US FAERS | |
| 682 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 683 | Suture insertion | FAERS: 1 | US FAERS | |
| 684 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 685 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 686 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 687 | Therapy change | FAERS: 1 | US FAERS | |
| 688 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 689 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 690 | Tissue injury | FAERS: 1 | US FAERS | |
| 691 | Tonsillitis | FAERS: 1 | US FAERS | |
| 692 | Tooth Infection | FAERS: 1 | US FAERS | |
| 693 | Tooth Loss | FAERS: 1 | US FAERS | |
| 694 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 695 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 696 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 697 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 698 | Unevaluable therapy | FAERS: 1 | US FAERS | |
| 699 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 700 | Urethral perforation | FAERS: 1 | US FAERS | |
| 701 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 702 | Vascular bypass dysfunction | FAERS: 1 | OFFSIDES US FAERS | |
| 703 | Vascular calcification | FAERS: 1 | US FAERS | |
| 704 | Vascular device user | FAERS: 1 | US FAERS | |
| 705 | Vascular graft complication | FAERS: 1 | US FAERS | |
| 706 | Vascular procedure complication | FAERS: 1 | US FAERS | |
| 707 | Vascular stent stenosis | FAERS: 1 | US FAERS | |
| 708 | Vascular stent thrombosis | FAERS: 1 | US FAERS | |
| 709 | Venous Injury | FAERS: 1 | US FAERS | |
| 710 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 711 | Ventricular Flutter | FAERS: 1 | US FAERS | |
| 712 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 713 | Viral sinusitis | FAERS: 1 | US FAERS | |
| 714 | Visual acuity reduced transiently | FAERS: 1 | US FAERS | |
| 715 | Visual brightness | FAERS: 1 | US FAERS | |
| 716 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 717 | Vocal Cord Dysfunction | FAERS: 1 | US FAERS | |
| 718 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 719 | Wrong dose | FAERS: 1 | US FAERS | |
| 720 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 721 | diagnostic procedure | FAERS: 1 | US FAERS | |
| 722 | furuncle | FAERS: 1 | US FAERS | |
| 723 | Abnormal vision | OFFSIDES | ||
| 724 | Agonal death struggle | OFFSIDES | ||
| 725 | Altered state of consciousness | SIDER | ||
| 726 | Antidepressant drug clearance decreased | OFFSIDES | ||
| 727 | Application site burn | OFFSIDES | ||
| 728 | Aura | OFFSIDES | ||
| 729 | Autoimmune thyroiditis | OFFSIDES | ||
| 730 | Bilirubinuria | OFFSIDES | ||
| 731 | Bladder discomfort | OFFSIDES | ||
| 732 | Blepharospasm | OFFSIDES | ||
| 733 | Blood blister | OFFSIDES | ||
| 734 | Blurred vision | OFFSIDES | ||
| 735 | Bronchiectasis | OFFSIDES | ||
| 736 | Bronchopleural Fistula | OFFSIDES | ||
| 737 | Bursitis | OFFSIDES | ||
| 738 | Cardiac Death | OFFSIDES | ||
| 739 | Clostridium difficile colitis | OFFSIDES | ||
| 740 | Clumsiness | OFFSIDES | ||
| 741 | Completed Suicide | OFFSIDES | ||
| 742 | Confabulation | OFFSIDES | ||
| 743 | Creatinine increased | SIDER | ||
| 744 | Ear and labyrinth disorders | SIDER | ||
| 745 | Electrocardiogram repolarisation abnormality | OFFSIDES | ||
| 746 | Endomyocardial Fibrosis | 18820026 | CTD | |
| 747 | Enterococcal sepsis | OFFSIDES | ||
| 748 | Eye laser surgery | OFFSIDES | ||
| 749 | Fatty Liver | OFFSIDES | ||
| 750 | Flat affect | OFFSIDES | ||
| 751 | Hepatic cancer metastatic | OFFSIDES | ||
| 752 | Hiccough | OFFSIDES | ||
| 753 | Hydropneumothorax | OFFSIDES | ||
| 754 | Hypoaesthesia facial | OFFSIDES | ||
| 755 | Hypoxia | OFFSIDES | ||
| 756 | Immunosuppressant drug level | OFFSIDES | ||
| 757 | Increased insulin requirement | OFFSIDES | ||
| 758 | Intention tremor | OFFSIDES | ||
| 759 | Leukoencephalopathy | OFFSIDES | ||
| 760 | Malnutrition | SIDER | ||
| 761 | Myocardial Ischemia | 18462746 20925013 | CTD | |
| 762 | Nephritis allergic | OFFSIDES | ||
| 763 | Non-cardiac chest pain | OFFSIDES | ||
| 764 | Nonspecific reaction | OFFSIDES | ||
| 765 | Orthopnea | OFFSIDES | ||
| 766 | Pleural fistula | OFFSIDES | ||
| 767 | Proarrhythmic effect | SIDER | ||
| 768 | Renal Artery Stenosis | OFFSIDES | ||
| 769 | Salivary gland operation | OFFSIDES | ||
| 770 | Sick Sinus Syndrome | OFFSIDES | ||
| 771 | Superficial Thrombophlebitis | OFFSIDES | ||
| 772 | Thrombocytosis | SIDER | ||
| 773 | Tongue amyloidosis | OFFSIDES | ||
| 774 | Torsades de Pointes | 20170820 | CTD | |
| 775 | Transaminases increased | OFFSIDES | ||
| 776 | Underweight | SIDER | ||
| 777 | Upset stomach | SIDER | ||
| 778 | Urinary tract infection enterococcal | OFFSIDES | ||
| 779 | Urine arsenic increased | OFFSIDES | ||
| 780 | Vasculitic rash | OFFSIDES | ||
| 781 | Ventricular Dysfunction, Left | 18820026 | CTD | |
| 782 | Visual disturbance | SIDER | ||
| 783 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.