Paliperidone Palmitate
(PMXMIIMHBWHSKN-UHFFFAOYSA-N)
Structure
- SMILES
- Fc1ccc2c(c1)onc2C1CCN(CC1)CCc1c(C)nc2n(c1=O)CCCC2O
- Type(s)
- Approved
- ATC code(s)
- N05AX13
- Molecular Formula:
- C23H27FN4O3
- Molecular Weight:
- 426.484
- Log P:
- 3.0192
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 84.39
- CAS Number(s):
- 130049-84-2; 144598-75-4
Synonym(s)
1.
Paliperidone Palmitate
2.
3-(2-(4-(6-fluoro-3-(1,2-benzisoxazolyl))-1-piperidinyl)ethyl)-6,7,8,9-tetrahydro-9-hydroxy-2-methyl-4H-pyrido(1,2-a)pyrimidin-4-one
3.
9-Hydroxy-risperidone
4.
9-Hydroxyrisperidone
5.
9-OH-risperidone
6.
Invega
7.
Invega Sustenna
8.
Paliperidone
9.
R 76477
10.
R-76477
11.
9 Hydroxy risperidone
12.
9 Hydroxyrisperidone
13.
9 OH risperidone
14.
Palmitate, Paliperidone
15.
R76477
16.
Sustenna, Invega
External Link(s)
| MeSH | D000068882 |
| PubChem Compound | 115237 |
| BindingDB | 50252513 |
| ChEBI | 83804 |
| CHEMBL | CHEMBL1621 |
| DrugBank | DB01267 |
| DrugCentral | 4137 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7258 |
| KEGG | cpd:C21516 dr:D05339 |
| Therapeutic Target Database | D0B3UJ |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 147 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 2 | Blood prolactin increased | FAERS: 115 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Drug dose omission | FAERS: 108 | US FAERS | |
| 4 | Dystonia | FAERS: 90 | OFFSIDES US FAERS | |
| 5 | Dizziness | FAERS: 81 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 6 | Emotional disorder | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Tremor | FAERS: 78 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Anxiety | FAERS: 72 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Akathisia | FAERS: 70 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 10 | Suicide attempt | FAERS: 70 | US FAERS | |
| 11 | Adverse event | FAERS: 64 | US FAERS | |
| 12 | Tachycardia | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Schizophrenia | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 14 | Somnolence | FAERS: 60 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 15 | Headache | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Tardive Dyskinesia | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Fatigue | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 18 | Nausea | FAERS: 49 | SIDER US FAERS | |
| 19 | Agitation | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Feeling abnormal | FAERS: 43 | SIDER US FAERS | |
| 21 | Inappropriate schedule of drug administration | FAERS: 43 | OFFSIDES US FAERS | |
| 22 | Wrong technique in drug usage process | FAERS: 42 | OFFSIDES US FAERS | |
| 23 | Vomiting | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Restlessness | FAERS: 39 | US FAERS | |
| 25 | Completed Suicide | FAERS: 37 | SIDER US FAERS | |
| 26 | Musculoskeletal stiffness | FAERS: 37 | OFFSIDES SIDER US FAERS | |
| 27 | Product use issue | FAERS: 37 | US FAERS | |
| 28 | Overdose | FAERS: 33 | US FAERS | |
| 29 | Malaise | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 30 | Palpitations | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 31 | Asthenia | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 32 | Neuroleptic Malignant Syndrome | FAERS: 31 | SIDER US FAERS | |
| 33 | Abnormal weight gain | FAERS: 30 | US FAERS | |
| 34 | Product use in unapproved indication | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 35 | Blood glucose increased | FAERS: 26 | US FAERS | |
| 36 | Chest Pain | FAERS: 26 | SIDER US FAERS | |
| 37 | Diabetes Mellitus | FAERS: 25 | SIDER US FAERS | |
| 38 | Constipation | FAERS: 24 | SIDER US FAERS | |
| 39 | Drooling | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 40 | Intentional self-injury | FAERS: 23 | US FAERS | |
| 41 | Paranoia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Syncope | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Cerebrovascular accident | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 44 | Hypotension | FAERS: 20 | SIDER US FAERS | |
| 45 | Pain | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 46 | Drug prescribing error | FAERS: 19 | OFFSIDES US FAERS | |
| 47 | Erectile dysfunction | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 48 | Blood creatine phosphokinase increased | FAERS: 18 | SIDER US FAERS | |
| 49 | Delirium | FAERS: 18 | US FAERS | |
| 50 | Hypersensitivity | FAERS: 18 | SIDER US FAERS | |
| 51 | Incorrect dose administered | FAERS: 18 | US FAERS | |
| 52 | Pulmonary Embolism | FAERS: 18 | SIDER US FAERS | |
| 53 | Rhabdomyolysis | FAERS: 18 | SIDER US FAERS | |
| 54 | Weight decreased | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Chest discomfort | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 56 | Drug dispensing error | FAERS: 17 | US FAERS | |
| 57 | Memory impairment | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 58 | Catatonia | FAERS: 16 | OFFSIDES US FAERS | |
| 59 | Hypersomnia | FAERS: 16 | US FAERS | |
| 60 | Muscle Rigidity | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 61 | Pneumonia | FAERS: 16 | SIDER US FAERS | |
| 62 | Urinary Incontinence | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Drug administration error | FAERS: 15 | OFFSIDES US FAERS | |
| 64 | Lethargy | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 65 | Leukopenia | FAERS: 15 | SIDER US FAERS | |
| 66 | Myocardial Infarction | FAERS: 15 | US FAERS | |
| 67 | Urticaria | FAERS: 15 | SIDER US FAERS | |
| 68 | Dysarthria | FAERS: 14 | SIDER US FAERS | |
| 69 | Product quality issue | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Trismus | FAERS: 14 | SIDER US FAERS | |
| 71 | Visual Impairment | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | White blood cell count decreased | FAERS: 14 | SIDER US FAERS | |
| 73 | Mental impairment | FAERS: 13 | US FAERS | |
| 74 | Myalgia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 75 | Poor quality sleep | FAERS: 13 | OFFSIDES US FAERS | |
| 76 | Pruritus | FAERS: 13 | SIDER US FAERS | |
| 77 | Anger | FAERS: 12 | US FAERS | |
| 78 | Neutropenia | FAERS: 12 | SIDER US FAERS | |
| 79 | Alanine Aminotransferase Increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 80 | Therapeutic response unexpected | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 81 | Therapy cessation | FAERS: 11 | US FAERS | |
| 82 | Breast tenderness | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 83 | Cardiac Arrest | FAERS: 10 | SIDER US FAERS | |
| 84 | Chills | FAERS: 10 | SIDER US FAERS | |
| 85 | Intentional drug misuse | FAERS: 10 | US FAERS | |
| 86 | Medication residue present | FAERS: 10 | US FAERS | |
| 87 | Pancreatitis | FAERS: 10 | SIDER US FAERS | |
| 88 | Priapism | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 89 | Psychiatric symptom | FAERS: 10 | US FAERS | |
| 90 | Sexual Dysfunction | FAERS: 10 | SIDER US FAERS | |
| 91 | Sluggishness | FAERS: 10 | US FAERS | |
| 92 | Thrombosis | FAERS: 10 | US FAERS | |
| 93 | Accidental drug intake by child | FAERS: 9 | OFFSIDES US FAERS | |
| 94 | Apathy | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Arthralgia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 96 | Depressed mood | FAERS: 9 | US FAERS | |
| 97 | Nervousness | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 98 | Back Pain | FAERS: 8 | SIDER US FAERS | |
| 99 | Blood cholesterol increased | FAERS: 8 | SIDER US FAERS | |
| 100 | Blood triglycerides increased | FAERS: 8 | SIDER US FAERS | |
| 101 | Choking | FAERS: 8 | US FAERS | |
| 102 | Crying | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 103 | Drug abuse | FAERS: 8 | US FAERS | |
| 104 | Eye pain | FAERS: 8 | US FAERS | |
| 105 | Hunger | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 106 | Mental status changes | FAERS: 8 | US FAERS | |
| 107 | Oculogyric crisis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 108 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 109 | Abdominal discomfort | FAERS: 7 | SIDER US FAERS | |
| 110 | Amnesia | FAERS: 7 | US FAERS | |
| 111 | Bradycardia | FAERS: 7 | SIDER US FAERS | |
| 112 | Bradyphrenia | FAERS: 7 | US FAERS | |
| 113 | Drug Dependence | FAERS: 7 | US FAERS | |
| 114 | Erythema | FAERS: 7 | SIDER US FAERS | |
| 115 | Expired drug administered | FAERS: 7 | OFFSIDES US FAERS | |
| 116 | Medication residue | FAERS: 7 | US FAERS | |
| 117 | Product availability issue | FAERS: 7 | US FAERS | |
| 118 | Sepsis | FAERS: 7 | US FAERS | |
| 119 | Thirst | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 120 | Thrombocytopenia | FAERS: 7 | SIDER US FAERS | |
| 121 | Unevaluable event | FAERS: 7 | US FAERS | |
| 122 | Activities of daily living impaired | FAERS: 6 | US FAERS | |
| 123 | Anorexia | FAERS: 6 | SIDER US FAERS | |
| 124 | Drug screen positive | FAERS: 6 | OFFSIDES US FAERS | |
| 125 | Emotional distress | FAERS: 6 | US FAERS | |
| 126 | Fracture | FAERS: 6 | US FAERS | |
| 127 | General physical health deterioration | FAERS: 6 | US FAERS | |
| 128 | Inappropriate schedule of product administration | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Injection site pain | FAERS: 6 | SIDER US FAERS | |
| 130 | Intestinal Obstruction | FAERS: 6 | SIDER US FAERS | |
| 131 | Joint stiffness | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 132 | Joint swelling | FAERS: 6 | SIDER US FAERS | |
| 133 | Nonspecific reaction | FAERS: 6 | US FAERS | |
| 134 | Pancytopenia | FAERS: 6 | US FAERS | |
| 135 | Photophobia | FAERS: 6 | SIDER US FAERS | |
| 136 | Polydipsia | FAERS: 6 | SIDER US FAERS | |
| 137 | Schizoaffective Disorder | FAERS: 6 | OFFSIDES US FAERS | |
| 138 | Stress | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 139 | Urinary Retention | FAERS: 6 | SIDER US FAERS | |
| 140 | Ventricular Fibrillation | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 141 | Abasia | FAERS: 5 | OFFSIDES US FAERS | |
| 142 | Accidental exposure to product by child | FAERS: 5 | US FAERS | |
| 143 | Accidental overdose | FAERS: 5 | US FAERS | |
| 144 | Alopecia | FAERS: 5 | SIDER US FAERS | |
| 145 | Aphasia | FAERS: 5 | US FAERS | |
| 146 | Aspartate Aminotransferase Increased | FAERS: 5 | SIDER US FAERS | |
| 147 | Atrioventricular Block | FAERS: 5 | SIDER US FAERS | |
| 148 | Blood creatinine increased | FAERS: 5 | US FAERS | |
| 149 | Cogwheel Rigidity | FAERS: 5 | SIDER US FAERS | |
| 150 | Deep Vein Thrombosis | FAERS: 5 | SIDER US FAERS | |
| 151 | Depressed Level of Consciousness | FAERS: 5 | SIDER US FAERS | |
| 152 | Discomfort | FAERS: 5 | SIDER US FAERS | |
| 153 | Disorientation | FAERS: 5 | US FAERS | |
| 154 | Drug ineffective for unapproved indication | FAERS: 5 | US FAERS | |
| 155 | Dysgeusia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 156 | Dyspepsia | FAERS: 5 | SIDER US FAERS | |
| 157 | Dysphemia | FAERS: 5 | US FAERS | |
| 158 | Hypokinesia | FAERS: 5 | SIDER US FAERS | |
| 159 | Infection | FAERS: 5 | SIDER US FAERS | |
| 160 | Mood swings | FAERS: 5 | US FAERS | |
| 161 | Obesity | FAERS: 5 | US FAERS | |
| 162 | Obsessive-Compulsive Disorder | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Product dose omission | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 165 | Sudden death | FAERS: 5 | SIDER US FAERS | |
| 166 | Swelling | FAERS: 5 | SIDER US FAERS | |
| 167 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 168 | Urinary tract infection | FAERS: 5 | SIDER US FAERS | |
| 169 | Vertigo | FAERS: 5 | SIDER US FAERS | |
| 170 | Wrong technique in product usage process | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Abdominal Pain | FAERS: 4 | SIDER US FAERS | |
| 172 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 173 | Atrial Fibrillation | FAERS: 4 | SIDER US FAERS | |
| 174 | Autonomic nervous system imbalance | FAERS: 4 | US FAERS | |
| 175 | Blindness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 177 | Body temperature fluctuation | FAERS: 4 | US FAERS | |
| 178 | Device leakage | FAERS: 4 | US FAERS | |
| 179 | Diabetic Ketoacidosis | FAERS: 4 | SIDER US FAERS | |
| 180 | Drug level decreased | FAERS: 4 | US FAERS | |
| 181 | Drug withdrawal syndrome | FAERS: 4 | SIDER US FAERS | |
| 182 | Dysphonia | FAERS: 4 | SIDER US FAERS | |
| 183 | Dysuria | FAERS: 4 | SIDER US FAERS | |
| 184 | Epistaxis | FAERS: 4 | SIDER US FAERS | |
| 185 | Erythema Multiforme | FAERS: 4 | US FAERS | |
| 186 | Extra dose administered | FAERS: 4 | US FAERS | |
| 187 | Gamma-Glutamyltransferase Increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 188 | Hostility | FAERS: 4 | US FAERS | |
| 189 | Ileus | FAERS: 4 | SIDER US FAERS | |
| 190 | Impaired work ability | FAERS: 4 | US FAERS | |
| 191 | Lactation Disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 192 | Muscle tightness | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 193 | Nasopharyngitis | FAERS: 4 | SIDER US FAERS | |
| 194 | Neck Pain | FAERS: 4 | SIDER US FAERS | |
| 195 | Nephrolithiasis | FAERS: 4 | OFFSIDES US FAERS | |
| 196 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 197 | Restless Legs Syndrome | FAERS: 4 | SIDER US FAERS | |
| 198 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 199 | Skin laceration | FAERS: 4 | US FAERS | |
| 200 | Staring | FAERS: 4 | OFFSIDES US FAERS | |
| 201 | Tension | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 202 | Torticollis | FAERS: 4 | SIDER US FAERS | |
| 203 | treatment failure | FAERS: 4 | US FAERS | |
| 204 | Akinesia | FAERS: 3 | SIDER US FAERS | |
| 205 | Anaphylactoid Reaction | FAERS: 3 | US FAERS | |
| 206 | Angioedema | FAERS: 3 | SIDER US FAERS | |
| 207 | Anorgasmia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 208 | Aphonia | FAERS: 3 | OFFSIDES US FAERS | |
| 209 | Ataxia | FAERS: 3 | US FAERS | |
| 210 | Blepharospasm | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 211 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 212 | Bruxism | FAERS: 3 | US FAERS | |
| 213 | Burning sensation | FAERS: 3 | US FAERS | |
| 214 | Cardiac Death | FAERS: 3 | OFFSIDES US FAERS | |
| 215 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 216 | Consciousness fluctuating | FAERS: 3 | US FAERS | |
| 217 | Creatinine renal clearance decreased | FAERS: 3 | US FAERS | |
| 218 | Dehydration | FAERS: 3 | US FAERS | |
| 219 | Dementia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Dependence | FAERS: 3 | US FAERS | |
| 221 | Diplopia | FAERS: 3 | US FAERS | |
| 222 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 223 | Drug level increased | FAERS: 3 | US FAERS | |
| 224 | Epilepsy | FAERS: 3 | US FAERS | |
| 225 | Expired product administered | FAERS: 3 | US FAERS | |
| 226 | Flushing | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 227 | Hepatitis | FAERS: 3 | US FAERS | |
| 228 | Hernia | FAERS: 3 | US FAERS | |
| 229 | Hypometabolism | FAERS: 3 | US FAERS | |
| 230 | Hypophagia | FAERS: 3 | US FAERS | |
| 231 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 232 | Impatience | FAERS: 3 | OFFSIDES US FAERS | |
| 233 | Injection site nodule | FAERS: 3 | US FAERS | |
| 234 | Leukocytosis | FAERS: 3 | US FAERS | |
| 235 | Lip swelling | FAERS: 3 | US FAERS | |
| 236 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 237 | Low density lipoprotein abnormal | FAERS: 3 | US FAERS | |
| 238 | Negative thoughts | FAERS: 3 | US FAERS | |
| 239 | Night sweats | FAERS: 3 | US FAERS | |
| 240 | Oropharyngeal spasm | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 241 | Physical assault | FAERS: 3 | US FAERS | |
| 242 | Product dispensing error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Product packaging issue | FAERS: 3 | US FAERS | |
| 244 | Psychotic symptom | FAERS: 3 | US FAERS | |
| 245 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 246 | Serotonin Syndrome | FAERS: 3 | US FAERS | |
| 247 | Sinus Tachycardia | FAERS: 3 | SIDER US FAERS | |
| 248 | Soliloquy | FAERS: 3 | US FAERS | |
| 249 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 250 | Stomatitis | FAERS: 3 | US FAERS | |
| 251 | Temperature intolerance | FAERS: 3 | OFFSIDES US FAERS | |
| 252 | Therapy change | FAERS: 3 | US FAERS | |
| 253 | Thrombophlebitis | FAERS: 3 | US FAERS | |
| 254 | Transaminases increased | FAERS: 3 | SIDER US FAERS | |
| 255 | Unresponsive to stimuli | FAERS: 3 | SIDER US FAERS | |
| 256 | Visual disturbance | FAERS: 3 | US FAERS | |
| 257 | Accidental exposure | FAERS: 2 | US FAERS | |
| 258 | Acne Conglobata | FAERS: 2 | OFFSIDES US FAERS | |
| 259 | Acne | FAERS: 2 | SIDER US FAERS | |
| 260 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 261 | Acute psychosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 262 | Ageusia | FAERS: 2 | OFFSIDES US FAERS | |
| 263 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 264 | Altered state of consciousness | FAERS: 2 | SIDER US FAERS | |
| 265 | Anticholinergic Syndrome | FAERS: 2 | US FAERS | |
| 266 | Asphyxia | FAERS: 2 | US FAERS | |
| 267 | Asthma | FAERS: 2 | US FAERS | |
| 268 | Bipolar Disorder | FAERS: 2 | SIDER US FAERS | |
| 269 | Bipolar I disorder | FAERS: 2 | SIDER US FAERS | |
| 270 | Blepharitis | FAERS: 2 | OFFSIDES US FAERS | |
| 271 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 272 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 273 | Blood testosterone decreased | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 274 | Blood urea increased | FAERS: 2 | US FAERS | |
| 275 | Blood urine present | FAERS: 2 | US FAERS | |
| 276 | Blunted affect | FAERS: 2 | SIDER US FAERS | |
| 277 | Breast cancer stage II | FAERS: 2 | OFFSIDES US FAERS | |
| 278 | Breast engorgement | FAERS: 2 | SIDER US FAERS | |
| 279 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 280 | Bulimia Nervosa | FAERS: 2 | US FAERS | |
| 281 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 282 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 283 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 284 | Dissociative Identity Disorder | FAERS: 2 | US FAERS | |
| 285 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 286 | Dyspareunia | FAERS: 2 | OFFSIDES US FAERS | |
| 287 | Ear discomfort | FAERS: 2 | US FAERS | |
| 288 | Electrocardiogram ST-T change | FAERS: 2 | US FAERS | |
| 289 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 290 | Enuresis | FAERS: 2 | US FAERS | |
| 291 | Euphoric mood | FAERS: 2 | US FAERS | |
| 292 | Excessive masturbation | FAERS: 2 | US FAERS | |
| 293 | Eye irritation | FAERS: 2 | US FAERS | |
| 294 | Facial paralysis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 295 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 2 | OFFSIDES US FAERS | |
| 296 | Feeling jittery | FAERS: 2 | US FAERS | |
| 297 | Gastritis | FAERS: 2 | US FAERS | |
| 298 | Gastrointestinal stoma complication | FAERS: 2 | US FAERS | |
| 299 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 300 | Head discomfort | FAERS: 2 | US FAERS | |
| 301 | Heat illness | FAERS: 2 | US FAERS | |
| 302 | Hemiparesis | FAERS: 2 | US FAERS | |
| 303 | Hepatitis C | FAERS: 2 | US FAERS | |
| 304 | Homicide | FAERS: 2 | US FAERS | |
| 305 | Hyperphagia | FAERS: 2 | US FAERS | |
| 306 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 307 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 308 | Hypomania | FAERS: 2 | US FAERS | |
| 309 | Hypothalamo-pituitary disorder | FAERS: 2 | US FAERS | |
| 310 | Immobile | FAERS: 2 | US FAERS | |
| 311 | Incontinence | FAERS: 2 | OFFSIDES US FAERS | |
| 312 | Influenza | FAERS: 2 | SIDER US FAERS | |
| 313 | Injection site mass | FAERS: 2 | US FAERS | |
| 314 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 315 | Laceration | FAERS: 2 | US FAERS | |
| 316 | Laryngospasm | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 317 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 318 | Mastication disorder | FAERS: 2 | US FAERS | |
| 319 | Medication Error | FAERS: 2 | US FAERS | |
| 320 | Meningitis | FAERS: 2 | US FAERS | |
| 321 | Monoplegia | FAERS: 2 | US FAERS | |
| 322 | Muscle tone disorder | FAERS: 2 | US FAERS | |
| 323 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 324 | Mydriasis | FAERS: 2 | US FAERS | |
| 325 | Myocarditis | FAERS: 2 | US FAERS | |
| 326 | Nipple pain | FAERS: 2 | OFFSIDES US FAERS | |
| 327 | Obsessive thoughts | FAERS: 2 | US FAERS | |
| 328 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 329 | Physical product label issue | FAERS: 2 | US FAERS | |
| 330 | Pleurothotonus | FAERS: 2 | SIDER US FAERS | |
| 331 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 332 | Presyncope | FAERS: 2 | US FAERS | |
| 333 | Product counterfeit | FAERS: 2 | US FAERS | |
| 334 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 335 | Product substitution issue | FAERS: 2 | US FAERS | |
| 336 | Prurigo | FAERS: 2 | US FAERS | |
| 337 | Psoriasis | FAERS: 2 | US FAERS | |
| 338 | Respiratory distress | FAERS: 2 | SIDER US FAERS | |
| 339 | Resting Tremor | FAERS: 2 | US FAERS | |
| 340 | Retching | FAERS: 2 | US FAERS | |
| 341 | Scab | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 342 | Secondary tic | FAERS: 2 | US FAERS | |
| 343 | Septic Shock | FAERS: 2 | US FAERS | |
| 344 | Sinusitis | FAERS: 2 | SIDER US FAERS | |
| 345 | Snoring | FAERS: 2 | US FAERS | |
| 346 | Sopor | FAERS: 2 | OFFSIDES US FAERS | |
| 347 | Starvation | FAERS: 2 | OFFSIDES US FAERS | |
| 348 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 349 | Sunburn | FAERS: 2 | US FAERS | |
| 350 | Syringe issue | FAERS: 2 | US FAERS | |
| 351 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 352 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 353 | Throat irritation | FAERS: 2 | US FAERS | |
| 354 | Tinnitus | FAERS: 2 | SIDER US FAERS | |
| 355 | Water Intoxication | FAERS: 2 | SIDER US FAERS | |
| 356 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 357 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 358 | Abnormal withdrawal bleeding | FAERS: 1 | US FAERS | |
| 359 | Abscess | FAERS: 1 | US FAERS | |
| 360 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 361 | Agranulocytosis | FAERS: 1 | SIDER US FAERS | |
| 362 | Alcohol abuse | FAERS: 1 | OFFSIDES US FAERS | |
| 363 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 364 | Ammonia increased | FAERS: 1 | US FAERS | |
| 365 | Anal Fissure | FAERS: 1 | US FAERS | |
| 366 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 367 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 368 | Anhedonia | FAERS: 1 | US FAERS | |
| 369 | Anosognosia | FAERS: 1 | US FAERS | |
| 370 | Antipsychotic drug level increased | FAERS: 1 | US FAERS | |
| 371 | Aphagia | FAERS: 1 | US FAERS | |
| 372 | Apparent death | FAERS: 1 | US FAERS | |
| 373 | Arthropathy | FAERS: 1 | US FAERS | |
| 374 | Arthropod bite | FAERS: 1 | US FAERS | |
| 375 | Ascites | FAERS: 1 | US FAERS | |
| 376 | Asterixis | FAERS: 1 | US FAERS | |
| 377 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 378 | Azoospermia | FAERS: 1 | US FAERS | |
| 379 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 380 | Biliary Colic | FAERS: 1 | US FAERS | |
| 381 | Blood arsenic increased | FAERS: 1 | US FAERS | |
| 382 | Blood growth hormone increased | FAERS: 1 | US FAERS | |
| 383 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 384 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 385 | Bone pain | FAERS: 1 | US FAERS | |
| 386 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 387 | Bradykinesia | FAERS: 1 | SIDER US FAERS | |
| 388 | Brain Contusion | FAERS: 1 | US FAERS | |
| 389 | Brain Death | FAERS: 1 | US FAERS | |
| 390 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 391 | Bronchitis | FAERS: 1 | SIDER US FAERS | |
| 392 | Bronchospasm | FAERS: 1 | US FAERS | |
| 393 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 394 | Cardiovascular insufficiency | FAERS: 1 | OFFSIDES US FAERS | |
| 395 | Cataract | FAERS: 1 | US FAERS | |
| 396 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 397 | Cerebral hygroma | FAERS: 1 | US FAERS | |
| 398 | Choking sensation | FAERS: 1 | US FAERS | |
| 399 | Cholestasis | FAERS: 1 | US FAERS | |
| 400 | Chromatopsia | FAERS: 1 | US FAERS | |
| 401 | Chromaturia | FAERS: 1 | US FAERS | |
| 402 | Compulsive sexual behaviour | FAERS: 1 | US FAERS | |
| 403 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 404 | Conjunctivitis | FAERS: 1 | SIDER US FAERS | |
| 405 | Coronary Artery Disease | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 406 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 407 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 408 | Deafness | FAERS: 1 | US FAERS | |
| 409 | Dental caries | FAERS: 1 | US FAERS | |
| 410 | Disability | FAERS: 1 | US FAERS | |
| 411 | Disease recurrence | FAERS: 1 | US FAERS | |
| 412 | Diverticulitis | FAERS: 1 | US FAERS | |
| 413 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 414 | Drug resistance | FAERS: 1 | US FAERS | |
| 415 | Dry skin | FAERS: 1 | SIDER US FAERS | |
| 416 | Dysgraphia | FAERS: 1 | US FAERS | |
| 417 | Dysthymic Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Eczema | FAERS: 1 | SIDER US FAERS | |
| 419 | Educational problem | FAERS: 1 | US FAERS | |
| 420 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 421 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 422 | Emergency Care | FAERS: 1 | US FAERS | |
| 423 | Encephalitis | FAERS: 1 | US FAERS | |
| 424 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 425 | Erection increased | FAERS: 1 | US FAERS | |
| 426 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 427 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 428 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 429 | Extremity necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 430 | Eyelid Function Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 431 | Facial Pain | FAERS: 1 | US FAERS | |
| 432 | Feeling Cold | FAERS: 1 | US FAERS | |
| 433 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 434 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 435 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 436 | Flatulence | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 437 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 438 | Food craving | FAERS: 1 | US FAERS | |
| 439 | Freezing phenomenon | FAERS: 1 | US FAERS | |
| 440 | Frustration | FAERS: 1 | US FAERS | |
| 441 | Gangrene | FAERS: 1 | US FAERS | |
| 442 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 443 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 444 | Gaze palsy | FAERS: 1 | US FAERS | |
| 445 | General symptom | FAERS: 1 | US FAERS | |
| 446 | Glaucoma | FAERS: 1 | SIDER US FAERS | |
| 447 | Glossitis | FAERS: 1 | OFFSIDES US FAERS | |
| 448 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 449 | Hair injury | FAERS: 1 | US FAERS | |
| 450 | Hemiplegia | FAERS: 1 | US FAERS | |
| 451 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 452 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 453 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 454 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 455 | Hyperacusis | FAERS: 1 | US FAERS | |
| 456 | Hypercatabolism | FAERS: 1 | US FAERS | |
| 457 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 458 | Hypervigilance | FAERS: 1 | US FAERS | |
| 459 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 460 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 461 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 462 | Illiteracy | FAERS: 1 | US FAERS | |
| 463 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 464 | Incoherent | FAERS: 1 | US FAERS | |
| 465 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 466 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 467 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 468 | Infarction | FAERS: 1 | US FAERS | |
| 469 | Initial insomnia | FAERS: 1 | SIDER US FAERS | |
| 470 | Injection site cellulitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 471 | Injection site erythema | FAERS: 1 | US FAERS | |
| 472 | Injection site infection | FAERS: 1 | US FAERS | |
| 473 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 474 | Injection site warmth | FAERS: 1 | US FAERS | |
| 475 | Insulin-requiring type 2 diabetes mellitus | FAERS: 1 | US FAERS | |
| 476 | Intention tremor | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 477 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 478 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 479 | Laziness | FAERS: 1 | US FAERS | |
| 480 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 481 | Limb discomfort | FAERS: 1 | US FAERS | |
| 482 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 483 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 484 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 485 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 486 | Malabsorption | FAERS: 1 | US FAERS | |
| 487 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 488 | Mastitis | FAERS: 1 | US FAERS | |
| 489 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 490 | Menopause | FAERS: 1 | US FAERS | |
| 491 | Menorrhagia | FAERS: 1 | SIDER US FAERS | |
| 492 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 493 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 494 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 495 | Multiple allergies | FAERS: 1 | US FAERS | |
| 496 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 497 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 498 | Mutism | FAERS: 1 | US FAERS | |
| 499 | Myopia | FAERS: 1 | US FAERS | |
| 500 | Myotonia | FAERS: 1 | SIDER US FAERS | |
| 501 | Neuralgia | FAERS: 1 | US FAERS | |
| 502 | Neurotransmitter level altered | FAERS: 1 | US FAERS | |
| 503 | Nodule | FAERS: 1 | US FAERS | |
| 504 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 505 | Ocular icterus | FAERS: 1 | US FAERS | |
| 506 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 507 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 508 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 509 | Osteoporosis | FAERS: 1 | US FAERS | |
| 510 | Pancreatic Enzymes Decreased | FAERS: 1 | US FAERS | |
| 511 | Panic Disorder | FAERS: 1 | US FAERS | |
| 512 | Paramnesia | FAERS: 1 | US FAERS | |
| 513 | Paroxysmal perceptual alteration | FAERS: 1 | US FAERS | |
| 514 | Performance status decreased | FAERS: 1 | US FAERS | |
| 515 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 516 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 517 | Petechiae | FAERS: 1 | US FAERS | |
| 518 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 519 | Physical abuse | FAERS: 1 | US FAERS | |
| 520 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 521 | Pituitary gonadotropin hyperfunction | FAERS: 1 | US FAERS | |
| 522 | Pleuropericarditis | FAERS: 1 | US FAERS | |
| 523 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 524 | Poisoning | FAERS: 1 | US FAERS | |
| 525 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 526 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 527 | Portal venous gas | FAERS: 1 | US FAERS | |
| 528 | Post-injection delirium sedation syndrome | FAERS: 1 | US FAERS | |
| 529 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | SIDER US FAERS | |
| 530 | Poverty of speech | FAERS: 1 | US FAERS | |
| 531 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 532 | Pressure of speech | FAERS: 1 | US FAERS | |
| 533 | Product coating issue | FAERS: 1 | US FAERS | |
| 534 | Product label issue | FAERS: 1 | US FAERS | |
| 535 | Product prescribing error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 536 | Product residue present | FAERS: 1 | US FAERS | |
| 537 | Product use complaint | FAERS: 1 | US FAERS | |
| 538 | Productive Cough | FAERS: 1 | US FAERS | |
| 539 | Prolactinoma | FAERS: 1 | US FAERS | |
| 540 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 541 | Psychomotor skills impaired | FAERS: 1 | OFFSIDES US FAERS | |
| 542 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 543 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 544 | Rash erythematous | FAERS: 1 | US FAERS | |
| 545 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 546 | Retrograde ejaculation | FAERS: 1 | SIDER US FAERS | |
| 547 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 548 | Screaming | FAERS: 1 | US FAERS | |
| 549 | Seminoma | FAERS: 1 | US FAERS | |
| 550 | Shock | FAERS: 1 | SIDER US FAERS | |
| 551 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 552 | Skin lesion | FAERS: 1 | US FAERS | |
| 553 | Skin reaction | FAERS: 1 | US FAERS | |
| 554 | Sleep disorder therapy | FAERS: 1 | US FAERS | |
| 555 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 556 | Smoker | FAERS: 1 | OFFSIDES US FAERS | |
| 557 | Sneezing | FAERS: 1 | US FAERS | |
| 558 | Somnambulism | FAERS: 1 | US FAERS | |
| 559 | Sperm concentration zero | FAERS: 1 | US FAERS | |
| 560 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 561 | Strabismus | FAERS: 1 | US FAERS | |
| 562 | Stupor | FAERS: 1 | SIDER US FAERS | |
| 563 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 564 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 565 | Suspected product tampering | FAERS: 1 | US FAERS | |
| 566 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 567 | Tension Headache | FAERS: 1 | US FAERS | |
| 568 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 569 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 570 | Tobacco user | FAERS: 1 | US FAERS | |
| 571 | Tongue spasm | FAERS: 1 | SIDER US FAERS | |
| 572 | Tooth Loss | FAERS: 1 | US FAERS | |
| 573 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 574 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 575 | Uveitis | FAERS: 1 | US FAERS | |
| 576 | Vein pain | FAERS: 1 | US FAERS | |
| 577 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 578 | Waist circumference increased | FAERS: 1 | SIDER US FAERS | |
| 579 | Wheelchair user | FAERS: 1 | US FAERS | |
| 580 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 581 | Yawning | FAERS: 1 | US FAERS | |
| 582 | jaundice | FAERS: 1 | SIDER US FAERS | |
| 583 | Abdominal Compartment Syndrome | OFFSIDES | ||
| 584 | Abnormal vision | OFFSIDES | ||
| 585 | Acarodermatitis | SIDER | ||
| 586 | Adenocarcinoma | SIDER | ||
| 587 | Albinism | SIDER | ||
| 588 | Amenorrhea | OFFSIDES | ||
| 589 | Amphetamines | OFFSIDES | ||
| 590 | Anosmia | OFFSIDES | ||
| 591 | Arterial thrombosis | OFFSIDES | ||
| 592 | Athetosis | SIDER | ||
| 593 | Aura | OFFSIDES | ||
| 594 | Bladder pain | SIDER | ||
| 595 | Blood and lymphatic system disorders | SIDER | ||
| 596 | Blood creatine phosphokinase decreased | OFFSIDES | ||
| 597 | Blood lactate dehydrogenase decreased | OFFSIDES | ||
| 598 | Boredom | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 599 | Breast Feeding | SIDER | ||
| 600 | Breast discomfort | SIDER | ||
| 601 | Cellulitis | SIDER | ||
| 602 | Cheilitis | SIDER | ||
| 603 | Chorea | SIDER | ||
| 604 | Choreoathetosis | SIDER | ||
| 605 | Colonic Pseudo-Obstruction | OFFSIDES | ||
| 606 | Contracture | OFFSIDES | ||
| 607 | Cystitis | SIDER | ||
| 608 | Cyst | Canada Vigilance: 1 | Canada Vigilance | |
| 609 | Decreased Libido | OFFSIDES | ||
| 610 | Delusional disorder, persecutory type | Canada Vigilance: 1 | Canada Vigilance | |
| 611 | Depression suicidal | OFFSIDES | ||
| 612 | Disturbance in sexual arousal | SIDER | ||
| 613 | Drug withdrawal headache | OFFSIDES | ||
| 614 | Ear and labyrinth disorders | SIDER | ||
| 615 | Ejaculation inhibited | SIDER | ||
| 616 | Electrocardiogram abnormal | SIDER | ||
| 617 | Emprosthotonus | SIDER | ||
| 618 | Endophthalmitis | SIDER | ||
| 619 | Essential Hypertension | OFFSIDES | ||
| 620 | Eye Infection | SIDER | ||
| 621 | Flight of ideas | OFFSIDES | ||
| 622 | Floppy iris syndrome | SIDER | ||
| 623 | Galactorrhea | OFFSIDES | ||
| 624 | Gastroenteritis | SIDER | ||
| 625 | Gastrointestinal Pain | SIDER | ||
| 626 | Gastrointestinal obstruction | SIDER | ||
| 627 | Glabellar reflex abnormal | SIDER | ||
| 628 | Glycosuria | SIDER | ||
| 629 | Head Banging | OFFSIDES | ||
| 630 | Head titubation | OFFSIDES SIDER | ||
| 631 | Hyperinsulinism | SIDER | ||
| 632 | Hyperkeratosis | SIDER | ||
| 633 | Hyperkinesia | SIDER | ||
| 634 | Hyperventilation | SIDER | ||
| 635 | Increased prolactin level | SIDER | ||
| 636 | Induration | SIDER | ||
| 637 | Infestation | SIDER | ||
| 638 | Injection Site Reaction | SIDER | ||
| 639 | Injection site abscess | Canada Vigilance: 1 | Canada Vigilance | |
| 640 | Insulin C-peptide increased | SIDER | ||
| 641 | Jealous delusion | OFFSIDES | ||
| 642 | Libido disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 643 | Male sexual dysfunction | Canada Vigilance: 1 | Canada Vigilance | |
| 644 | Middle insomnia | SIDER | ||
| 645 | Multiple drug overdose intentional | OFFSIDES | ||
| 646 | Muscle Weakness | OFFSIDES | ||
| 647 | Muscle relaxant therapy | SIDER | ||
| 648 | Musculoskeletal Pain | SIDER | ||
| 649 | Musculoskeletal discomfort | SIDER | ||
| 650 | Myoclonus | SIDER | ||
| 651 | Myopericarditis | OFFSIDES | ||
| 652 | Nicotine Dependence | Canada Vigilance: 1 | Canada Vigilance | |
| 653 | Nuchal Rigidity | SIDER | ||
| 654 | Oculogyration | SIDER | ||
| 655 | Onychomycosis | SIDER | ||
| 656 | Opisthotonus | SIDER | ||
| 657 | Oromandibular dystonia | SIDER | ||
| 658 | Pain during injection | SIDER | ||
| 659 | Pancreatic Neoplasm | SIDER | ||
| 660 | Parkinsonian rest tremor | SIDER | ||
| 661 | Perivascular dermatitis | OFFSIDES | ||
| 662 | Pharyngolaryngeal Pain | SIDER | ||
| 663 | Pitting edema | SIDER | ||
| 664 | Pregnancy | SIDER | ||
| 665 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 666 | Pulmonary congestion | SIDER | ||
| 667 | Rales | SIDER | ||
| 668 | Redness | SIDER | ||
| 669 | Respiratory Therapy | OFFSIDES | ||
| 670 | Respiratory tract congestion | SIDER | ||
| 671 | Rhinitis | SIDER | ||
| 672 | Risus sardonicus | OFFSIDES SIDER | ||
| 673 | Senile dementia | OFFSIDES | ||
| 674 | Serum prolactin increased | SIDER | ||
| 675 | Serum testosterone decreased | SIDER | ||
| 676 | Shoulder Pain | SIDER | ||
| 677 | Sinus Arrhythmia | SIDER | ||
| 678 | Stillbirth | SIDER | ||
| 679 | Suicide | SIDER | ||
| 680 | Tetany | OFFSIDES SIDER | ||
| 681 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 682 | Therapy non-responder | Canada Vigilance: 1 | Canada Vigilance | |
| 683 | Tongue blistering | OFFSIDES | ||
| 684 | Tonsillitis | SIDER | ||
| 685 | Toothache | SIDER | ||
| 686 | Umbilical hernia | OFFSIDES | ||
| 687 | Upset stomach | SIDER | ||
| 688 | Vaginal Discharge | SIDER | ||
| 689 | Venous Thromboembolism | SIDER | ||
| 690 | Venous Thrombosis | SIDER | ||
| 691 | Ventricular arrhythmia | SIDER | ||
| 692 | Vitreous opacities | OFFSIDES | ||
| 693 | Vulvovaginal pruritus | OFFSIDES | ||
| 694 | Walking aid user | OFFSIDES | ||
| 695 | Weight Gain | OFFSIDES | ||
| 696 | Wheezing | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.