Travoprost
(MKPLKVHSHYCHOC-AHTXBMBWSA-N)
Structure
- SMILES
- CC(OC(=O)CCC/C=C\C[C@H]1[C@@H](O)C[C@H]([C@@H]1/C=C/[C@H](COc1cccc(c1)C(F)(F)F)O)O)C
- Type(s)
- Approved
- ATC code(s)
- S01EE04
- Molecular Formula:
- C26H35F3O6
- Molecular Weight:
- 500.548
- Log P:
- 4.4274
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 96.22
- CAS Number(s):
- 157283-68-6
Synonym(s)
1.
Travoprost
2.
(((1R)-(1alpha(Z),2beta(1E,3R*),3alpha,5alpha))-7-(3,5-dihydroxy-2-(3-hydroxy-4-(3-trifluoromethyl)phenoxy)-1-butenyl)cyclopentyl)-5-heptenoic acid, 1-methylethyl ester
3.
AL-6221
4.
AL6221
5.
Travatan
6.
Travatan Z
7.
AL 6221
8.
Z, Travatan
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 213 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 2 | Eye pain | FAERS: 129 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Drug ineffective | FAERS: 122 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 4 | Visual Impairment | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Glaucoma | FAERS: 59 | 18837686 | CTD OFFSIDES US FAERS |
| 6 | No adverse event | FAERS: 44 | US FAERS | |
| 7 | Product quality issue | FAERS: 34 | OFFSIDES US FAERS | |
| 8 | Headache | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Product dropper issue | FAERS: 30 | US FAERS | |
| 10 | Blindness | FAERS: 28 | US FAERS | |
| 11 | Cataract | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 12 | Growth of eyelashes | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Photophobia | FAERS: 26 | SIDER US FAERS | |
| 14 | Foreign body sensation in eyes | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 15 | Hypersensitivity | FAERS: 24 | SIDER US FAERS | |
| 16 | Malaise | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 17 | Dizziness | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Expired product administered | FAERS: 22 | US FAERS | |
| 19 | Ocular discomfort | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Erythema | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Diabetes Mellitus | FAERS: 16 | US FAERS | |
| 22 | Nasopharyngitis | FAERS: 16 | US FAERS | |
| 23 | Accidental exposure to product | FAERS: 15 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 25 | Pruritus | FAERS: 15 | SIDER US FAERS | |
| 26 | Fatigue | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 27 | Product use issue | FAERS: 14 | US FAERS | |
| 28 | Therapy partial responder | FAERS: 14 | US FAERS | |
| 29 | Dark circles under eyes | FAERS: 13 | SIDER US FAERS | |
| 30 | Incorrect dose administered | FAERS: 13 | US FAERS | |
| 31 | Cerebrovascular accident | FAERS: 12 | US FAERS | |
| 32 | Product packaging quantity issue | FAERS: 12 | US FAERS | |
| 33 | Anxiety | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Chest Pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 35 | Intraocular pressure fluctuation | FAERS: 11 | US FAERS | |
| 36 | Pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Palpitations | FAERS: 11 | SIDER US FAERS | |
| 38 | Uveitis | FAERS: 11 | 19403113 | CTD SIDER US FAERS |
| 39 | Deafness | FAERS: 10 | OFFSIDES US FAERS | |
| 40 | Diplopia | FAERS: 10 | OFFSIDES US FAERS | |
| 41 | Myocardial Infarction | FAERS: 10 | US FAERS | |
| 42 | Retinal Detachment | FAERS: 10 | SIDER US FAERS | |
| 43 | Asthma | FAERS: 9 | SIDER US FAERS | |
| 44 | Memory impairment | FAERS: 9 | US FAERS | |
| 45 | Throat irritation | FAERS: 9 | SIDER US FAERS | |
| 46 | Tinnitus | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 47 | Tremor | FAERS: 9 | US FAERS | |
| 48 | Arthralgia | FAERS: 8 | SIDER US FAERS | |
| 49 | Asthenia | FAERS: 8 | SIDER US FAERS | |
| 50 | Back Pain | FAERS: 8 | SIDER US FAERS | |
| 51 | Chest discomfort | FAERS: 8 | US FAERS | |
| 52 | Conjunctivitis | FAERS: 8 | SIDER US FAERS | |
| 53 | Detachment of retinal pigment epithelium | FAERS: 8 | OFFSIDES US FAERS | |
| 54 | Eye allergy | FAERS: 8 | SIDER US FAERS | |
| 55 | Influenza | FAERS: 8 | SIDER US FAERS | |
| 56 | Iritis | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 57 | Nausea | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 58 | Product container issue | FAERS: 8 | US FAERS | |
| 59 | Arthritis | FAERS: 7 | SIDER US FAERS | |
| 60 | Blepharitis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 61 | Dysphonia | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 62 | Eye inflammation | FAERS: 7 | OFFSIDES US FAERS | |
| 63 | Product administration error | FAERS: 7 | US FAERS | |
| 64 | Abdominal discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 65 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 66 | Iris hyperpigmentation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 67 | Periorbital fat atrophy | FAERS: 6 | US FAERS | |
| 68 | Weight decreased | FAERS: 6 | US FAERS | |
| 69 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 70 | Choroidal Detachment | FAERS: 5 | US FAERS | |
| 71 | Drug administration error | FAERS: 5 | US FAERS | |
| 72 | Dysgeusia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 73 | Eyelids pruritus | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 74 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 75 | Intraocular pressure test abnormal | FAERS: 5 | US FAERS | |
| 76 | Liquid product physical issue | FAERS: 5 | US FAERS | |
| 77 | Macular degeneration | FAERS: 5 | SIDER US FAERS | |
| 78 | Nervousness | FAERS: 5 | US FAERS | |
| 79 | Ocular Hypertension | FAERS: 5 | 19403113 | CTD OFFSIDES US FAERS |
| 80 | Oropharyngeal pain | FAERS: 5 | SIDER US FAERS | |
| 81 | Product packaging issue | FAERS: 5 | US FAERS | |
| 82 | Product storage error | FAERS: 5 | US FAERS | |
| 83 | Sinusitis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 84 | Tachycardia | FAERS: 5 | SIDER US FAERS | |
| 85 | Ageusia | FAERS: 4 | OFFSIDES US FAERS | |
| 86 | Anosmia | FAERS: 4 | US FAERS | |
| 87 | Bradycardia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 88 | Dementia | FAERS: 4 | US FAERS | |
| 89 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 90 | Entropion | FAERS: 4 | OFFSIDES US FAERS | |
| 91 | Eyelash thickening | FAERS: 4 | SIDER US FAERS | |
| 92 | Eyelid margin crusting | FAERS: 4 | SIDER US FAERS | |
| 93 | Hypotension | FAERS: 4 | SIDER US FAERS | |
| 94 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 95 | Pneumonia | FAERS: 4 | US FAERS | |
| 96 | Product label issue | FAERS: 4 | US FAERS | |
| 97 | Sciatica | FAERS: 4 | US FAERS | |
| 98 | Skin irritation | FAERS: 4 | US FAERS | |
| 99 | Somnolence | FAERS: 4 | US FAERS | |
| 100 | Superficial injury of eye | FAERS: 4 | US FAERS | |
| 101 | Alopecia | FAERS: 3 | US FAERS | |
| 102 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 103 | Anterior chamber inflammation | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 104 | Asthenopia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 105 | Blepharospasm | FAERS: 3 | US FAERS | |
| 106 | Burning sensation | FAERS: 3 | US FAERS | |
| 107 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 108 | Choking | FAERS: 3 | US FAERS | |
| 109 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 110 | Dysgraphia | FAERS: 3 | OFFSIDES US FAERS | |
| 111 | Ear discomfort | FAERS: 3 | US FAERS | |
| 112 | Epistaxis | FAERS: 3 | OFFSIDES US FAERS | |
| 113 | Eye Infection | FAERS: 3 | OFFSIDES US FAERS | |
| 114 | Product use complaint | FAERS: 3 | US FAERS | |
| 115 | Punctate keratitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 116 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 117 | Tension Headache | FAERS: 3 | US FAERS | |
| 118 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 119 | Trichiasis | FAERS: 3 | OFFSIDES US FAERS | |
| 120 | Urticaria | FAERS: 3 | US FAERS | |
| 121 | Vertigo | FAERS: 3 | SIDER US FAERS | |
| 122 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 123 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 124 | Aphasia | FAERS: 2 | US FAERS | |
| 125 | Arthropathy | FAERS: 2 | US FAERS | |
| 126 | Bladder prolapse | FAERS: 2 | US FAERS | |
| 127 | Blood urine present | FAERS: 2 | US FAERS | |
| 128 | Cataract operation | FAERS: 2 | OFFSIDES US FAERS | |
| 129 | Chemical eye injury | FAERS: 2 | US FAERS | |
| 130 | Chills | FAERS: 2 | US FAERS | |
| 131 | Chromatopsia | FAERS: 2 | US FAERS | |
| 132 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 133 | Device damage | FAERS: 2 | US FAERS | |
| 134 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 135 | Disease Progression | FAERS: 2 | US FAERS | |
| 136 | Diverticulitis | FAERS: 2 | US FAERS | |
| 137 | Exophthalmos | FAERS: 2 | US FAERS | |
| 138 | Incorrect dose administered by product | FAERS: 2 | US FAERS | |
| 139 | Instillation site irritation | FAERS: 2 | US FAERS | |
| 140 | Instillation site reaction | FAERS: 2 | OFFSIDES US FAERS | |
| 141 | Keratitis | FAERS: 2 | SIDER US FAERS | |
| 142 | Lip swelling | FAERS: 2 | US FAERS | |
| 143 | Lipodystrophy acquired | FAERS: 2 | US FAERS | |
| 144 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 145 | Melanoma recurrent | FAERS: 2 | OFFSIDES US FAERS | |
| 146 | Myalgia | FAERS: 2 | SIDER US FAERS | |
| 147 | Ocular surface disease | FAERS: 2 | US FAERS | |
| 148 | Oral pain | FAERS: 2 | US FAERS | |
| 149 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 150 | Post procedural complication | FAERS: 2 | US FAERS | |
| 151 | Product container seal issue | FAERS: 2 | US FAERS | |
| 152 | Sepsis | FAERS: 2 | US FAERS | |
| 153 | Stress | FAERS: 2 | US FAERS | |
| 154 | Struck by lightning | FAERS: 2 | US FAERS | |
| 155 | Thrombosis | FAERS: 2 | US FAERS | |
| 156 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 157 | Urinary Incontinence | FAERS: 2 | SIDER US FAERS | |
| 158 | Urinary tract infection | FAERS: 2 | SIDER US FAERS | |
| 159 | Vital dye staining cornea present | FAERS: 2 | SIDER US FAERS | |
| 160 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 161 | Abasia | FAERS: 1 | US FAERS | |
| 162 | Abdominal Pain | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 163 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 164 | Acne | FAERS: 1 | US FAERS | |
| 165 | Acquired corneal dystrophy | FAERS: 1 | US FAERS | |
| 166 | Adverse event | FAERS: 1 | US FAERS | |
| 167 | Amnesia | FAERS: 1 | US FAERS | |
| 168 | Aneurysm | FAERS: 1 | US FAERS | |
| 169 | Anger | FAERS: 1 | US FAERS | |
| 170 | Angle Closure Glaucoma | FAERS: 1 | OFFSIDES US FAERS | |
| 171 | Anophthalmos | FAERS: 1 | US FAERS | |
| 172 | Aphonia | FAERS: 1 | US FAERS | |
| 173 | Application site irritation | FAERS: 1 | OFFSIDES US FAERS | |
| 174 | Atrial Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 175 | Back disorder | FAERS: 1 | US FAERS | |
| 176 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 177 | Bedridden | FAERS: 1 | US FAERS | |
| 178 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 179 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 180 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 181 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 182 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 183 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 184 | Bone pain | FAERS: 1 | US FAERS | |
| 185 | Borderline glaucoma | FAERS: 1 | US FAERS | |
| 186 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 187 | Bronchitis | FAERS: 1 | SIDER US FAERS | |
| 188 | Bronchospasm | FAERS: 1 | US FAERS | |
| 189 | Cardiac Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 190 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 191 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 192 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 193 | Coagulation factor VIII level decreased | FAERS: 1 | US FAERS | |
| 194 | Constipation | FAERS: 1 | SIDER US FAERS | |
| 195 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 196 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 197 | Corneal epithelium defect | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 198 | Corneal graft rejection | FAERS: 1 | US FAERS | |
| 199 | Corneal lesion | FAERS: 1 | US FAERS | |
| 200 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 201 | Crying | FAERS: 1 | US FAERS | |
| 202 | Cyst | FAERS: 1 | US FAERS | |
| 203 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 204 | Dehydration | FAERS: 1 | OFFSIDES US FAERS | |
| 205 | Depressed mood | FAERS: 1 | US FAERS | |
| 206 | Device breakage | FAERS: 1 | US FAERS | |
| 207 | Device malfunction | FAERS: 1 | US FAERS | |
| 208 | Device related infection | FAERS: 1 | OFFSIDES US FAERS | |
| 209 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 210 | Dry age-related macular degeneration | FAERS: 1 | US FAERS | |
| 211 | Dry skin | FAERS: 1 | OFFSIDES US FAERS | |
| 212 | Dysmorphism | FAERS: 1 | US FAERS | |
| 213 | Dysuria | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 214 | Eczema | FAERS: 1 | US FAERS | |
| 215 | Embolism | FAERS: 1 | US FAERS | |
| 216 | Emotional distress | FAERS: 1 | US FAERS | |
| 217 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 218 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 219 | Expired drug administered | FAERS: 1 | US FAERS | |
| 220 | Eye Redness | FAERS: 1 | US FAERS | |
| 221 | Eyelash hyperpigmentation | FAERS: 1 | US FAERS | |
| 222 | Eyelid exfoliation | FAERS: 1 | OFFSIDES US FAERS | |
| 223 | Eyelid rash | FAERS: 1 | US FAERS | |
| 224 | Feeling jittery | FAERS: 1 | US FAERS | |
| 225 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 226 | Forceps delivery | FAERS: 1 | US FAERS | |
| 227 | Gait inability | FAERS: 1 | US FAERS | |
| 228 | Gastric ulcer helicobacter | FAERS: 1 | US FAERS | |
| 229 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 230 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 231 | Gliosis | FAERS: 1 | US FAERS | |
| 232 | Head discomfort | FAERS: 1 | US FAERS | |
| 233 | Hypokinesia | FAERS: 1 | US FAERS | |
| 234 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 235 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 236 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 237 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 238 | Infarction | FAERS: 1 | US FAERS | |
| 239 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 240 | Instillation site pain | FAERS: 1 | US FAERS | |
| 241 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 242 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 243 | Iridocyclitis | FAERS: 1 | SIDER US FAERS | |
| 244 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 245 | Keratoconjunctivitis Sicca | FAERS: 1 | SIDER US FAERS | |
| 246 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 247 | Larynx irritation | FAERS: 1 | US FAERS | |
| 248 | Lid sulcus deepened | FAERS: 1 | SIDER US FAERS | |
| 249 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 250 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 251 | Meibomianitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 252 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 253 | Mood swings | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Mydriasis | FAERS: 1 | SIDER US FAERS | |
| 255 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 256 | Nasal discomfort | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 257 | Nasal mucosal ulcer | FAERS: 1 | US FAERS | |
| 258 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 259 | Neck Pain | FAERS: 1 | US FAERS | |
| 260 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 261 | Neuralgia | FAERS: 1 | US FAERS | |
| 262 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 263 | Optic nerve cupping | FAERS: 1 | US FAERS | |
| 264 | Osteoporosis | FAERS: 1 | OFFSIDES US FAERS | |
| 265 | Overdose | FAERS: 1 | US FAERS | |
| 266 | Pallor | FAERS: 1 | US FAERS | |
| 267 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 268 | Papule | FAERS: 1 | US FAERS | |
| 269 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 270 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 271 | Periorbital disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 272 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 273 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 274 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 275 | Posterior capsule opacification | FAERS: 1 | US FAERS | |
| 276 | Posterior capsule rupture | FAERS: 1 | US FAERS | |
| 277 | Pregnancy | FAERS: 1 | US FAERS | |
| 278 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 279 | Presyncope | FAERS: 1 | US FAERS | |
| 280 | Product design issue | FAERS: 1 | US FAERS | |
| 281 | Product dispensing error | FAERS: 1 | US FAERS | |
| 282 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 283 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 284 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 285 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 286 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 287 | Product prescribing error | FAERS: 1 | US FAERS | |
| 288 | Product substitution issue | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 289 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 290 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 291 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 292 | Rash erythematous | FAERS: 1 | US FAERS | |
| 293 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 294 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 295 | Renal cyst | FAERS: 1 | US FAERS | |
| 296 | Renal pain | FAERS: 1 | US FAERS | |
| 297 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 298 | Restlessness | FAERS: 1 | US FAERS | |
| 299 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 300 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 301 | Retinal scar | FAERS: 1 | US FAERS | |
| 302 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 303 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 304 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 305 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 306 | Sneezing | FAERS: 1 | US FAERS | |
| 307 | Starvation | FAERS: 1 | US FAERS | |
| 308 | Stenosis | FAERS: 1 | US FAERS | |
| 309 | Swelling | FAERS: 1 | US FAERS | |
| 310 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 311 | Tendon discomfort | FAERS: 1 | US FAERS | |
| 312 | Tension | FAERS: 1 | US FAERS | |
| 313 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 314 | Tracheitis | FAERS: 1 | US FAERS | |
| 315 | Unevaluable event | FAERS: 1 | US FAERS | |
| 316 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 317 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 318 | Urinary Retention | FAERS: 1 | US FAERS | |
| 319 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 320 | VIIth nerve paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 321 | Vascular stent restenosis | FAERS: 1 | US FAERS | |
| 322 | Vein collapse | FAERS: 1 | US FAERS | |
| 323 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 324 | Visual disturbance | FAERS: 1 | US FAERS | |
| 325 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 326 | Vitritis | FAERS: 1 | US FAERS | |
| 327 | Walking aid user | FAERS: 1 | US FAERS | |
| 328 | Wheezing | FAERS: 1 | US FAERS | |
| 329 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 330 | treatment failure | FAERS: 1 | US FAERS | |
| 331 | Abdominal rigidity | OFFSIDES | ||
| 332 | Abnormal vision | OFFSIDES SIDER | ||
| 333 | Accidental overdose | OFFSIDES | ||
| 334 | Acquired diaphragmatic eventration | OFFSIDES | ||
| 335 | Acute prerenal failure | OFFSIDES | ||
| 336 | Acute respiratory failure | OFFSIDES | ||
| 337 | Adenocarcinoma | OFFSIDES | ||
| 338 | Amputation | OFFSIDES | ||
| 339 | Anisocoria | OFFSIDES | ||
| 340 | Anterior chamber flare | SIDER | ||
| 341 | Anterior chamber pigmentation | SIDER | ||
| 342 | Appendectomy | OFFSIDES | ||
| 343 | Application site exfoliation | OFFSIDES | ||
| 344 | Application site scab | OFFSIDES | ||
| 345 | Arteriosclerosis Obliterans | OFFSIDES | ||
| 346 | Aspiration Pneumonia | OFFSIDES | ||
| 347 | Asthma aggravated | SIDER | ||
| 348 | Astigmatism | OFFSIDES | ||
| 349 | Asymptomatic bacteriuria | OFFSIDES | ||
| 350 | Atelectasis | OFFSIDES | ||
| 351 | Atrial tachycardia | OFFSIDES | ||
| 352 | Aura | OFFSIDES | ||
| 353 | Belligerence | OFFSIDES | ||
| 354 | Bifascicular block | OFFSIDES | ||
| 355 | Blepharoptosis | OFFSIDES | ||
| 356 | Blood Glucose | OFFSIDES | ||
| 357 | Blood creatine increased | OFFSIDES | ||
| 358 | Blood creatinine increased | OFFSIDES | ||
| 359 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 360 | Blood immunoglobulin G decreased | OFFSIDES | ||
| 361 | Blood sodium | OFFSIDES | ||
| 362 | Blood triglycerides increased | OFFSIDES | ||
| 363 | Blood urea increased | OFFSIDES | ||
| 364 | Blurred vision | OFFSIDES | ||
| 365 | Brain Concussion | OFFSIDES | ||
| 366 | Brain natriuretic peptide increased | OFFSIDES | ||
| 367 | Bronchial Obstruction | OFFSIDES | ||
| 368 | Bronchiectasis | OFFSIDES | ||
| 369 | Bulimia | OFFSIDES | ||
| 370 | Cardioactive drug level increased | OFFSIDES | ||
| 371 | Carotid artery occlusion | OFFSIDES | ||
| 372 | Cellulitis | OFFSIDES | ||
| 373 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 374 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 375 | Chronic sinusitis | OFFSIDES | ||
| 376 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 377 | Conjunctival deposit | OFFSIDES | ||
| 378 | Conjunctival irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 379 | Corneal Ulcer | OFFSIDES | ||
| 380 | Corneal abscess | OFFSIDES | ||
| 381 | Corneal erosion | OFFSIDES SIDER | ||
| 382 | Corneal pigmentation | SIDER | ||
| 383 | Cutis Laxa | OFFSIDES | ||
| 384 | Debridement | OFFSIDES | ||
| 385 | Dermatitis | SIDER | ||
| 386 | Diabetic Retinopathy | OFFSIDES | ||
| 387 | Diarrhea | OFFSIDES | ||
| 388 | Disease complication | OFFSIDES | ||
| 389 | Disorientation | Canada Vigilance: 1 | Canada Vigilance | |
| 390 | Drug toxicity | OFFSIDES | ||
| 391 | Dyspepsia | SIDER | ||
| 392 | Ear and labyrinth disorders | SIDER | ||
| 393 | Economic problem | OFFSIDES | ||
| 394 | Ectropion | SIDER | ||
| 395 | Electromechanical dissociation | OFFSIDES | ||
| 396 | Endodontic procedure | OFFSIDES | ||
| 397 | Endophthalmitis | SIDER | ||
| 398 | Epiduritis | OFFSIDES | ||
| 399 | Eyelid Diseases | OFFSIDES | ||
| 400 | Eyelid irritation | OFFSIDES SIDER | ||
| 401 | Eyelid pain | SIDER | ||
| 402 | Feeling Cold | OFFSIDES | ||
| 403 | Feeling of body temperature change | OFFSIDES | ||
| 404 | Folliculitis | OFFSIDES | ||
| 405 | Gastrectomy | OFFSIDES | ||
| 406 | Gastrointestinal Pain | SIDER | ||
| 407 | Gastrointestinal stoma complication | OFFSIDES | ||
| 408 | Gout | OFFSIDES | ||
| 409 | Granulocytosis | OFFSIDES | ||
| 410 | Hemiparesis | OFFSIDES | ||
| 411 | Hemiplegia | OFFSIDES | ||
| 412 | Hemisensory Neglect | OFFSIDES | ||
| 413 | Hepatitis B antibody positive | OFFSIDES | ||
| 414 | Hostility | OFFSIDES | ||
| 415 | Hyperemia | 15321024 | CTD | |
| 416 | Hyperpigmentation | OFFSIDES | ||
| 417 | Hypertrichosis | SIDER | ||
| 418 | Hypophagia | OFFSIDES | ||
| 419 | Hysterectomy | OFFSIDES | ||
| 420 | Implantable defibrillator insertion | OFFSIDES | ||
| 421 | Infection | SIDER | ||
| 422 | Infestation | SIDER | ||
| 423 | Inflammation | SIDER | ||
| 424 | Instillation site complication | Canada Vigilance: 1 | Canada Vigilance | |
| 425 | Intraocular inflammation | OFFSIDES | ||
| 426 | Intraocular pressure test | OFFSIDES | ||
| 427 | Kidney Neoplasm | OFFSIDES | ||
| 428 | Lacrimation | SIDER | ||
| 429 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 430 | Left atrial dilatation | OFFSIDES | ||
| 431 | Lethargy | OFFSIDES | ||
| 432 | Life expectancy shortened | OFFSIDES | ||
| 433 | Medical device complication | OFFSIDES | ||
| 434 | Meningitis | Canada Vigilance: 1 | Canada Vigilance | |
| 435 | Mental status changes | OFFSIDES | ||
| 436 | Metastases to the respiratory system | OFFSIDES | ||
| 437 | Metrorrhagia | SIDER | ||
| 438 | Monocytosis | OFFSIDES | ||
| 439 | Muscle Weakness | OFFSIDES | ||
| 440 | Musculoskeletal Pain | OFFSIDES SIDER | ||
| 441 | Musculoskeletal discomfort | SIDER | ||
| 442 | Mycotic corneal ulcer | OFFSIDES | ||
| 443 | Myeloid Metaplasia | OFFSIDES | ||
| 444 | Myopia | OFFSIDES | ||
| 445 | Nystagmus | OFFSIDES | ||
| 446 | Ocular Hypotension | 15321024 | CTD | |
| 447 | Oroantral Fistula | OFFSIDES | ||
| 448 | Panophthalmitis | SIDER | ||
| 449 | Peptic Ulcer | SIDER | ||
| 450 | Peptic ulcer reactivated | SIDER | ||
| 451 | Physical disability | OFFSIDES | ||
| 452 | Pinguecula | OFFSIDES | ||
| 453 | Polyneuropathy | OFFSIDES | ||
| 454 | Presbyopia | OFFSIDES | ||
| 455 | Productive Cough | OFFSIDES | ||
| 456 | Pulmonary Hypertension | OFFSIDES | ||
| 457 | Reaction to preservatives | OFFSIDES | ||
| 458 | Renal mass | OFFSIDES | ||
| 459 | Renal vein occlusion | OFFSIDES | ||
| 460 | Retinal Vein Occlusion | OFFSIDES | ||
| 461 | Retinal pigment epitheliopathy | OFFSIDES | ||
| 462 | Retinal pigmentation | SIDER | ||
| 463 | Retinitis | OFFSIDES | ||
| 464 | Rhinalgia | OFFSIDES | ||
| 465 | Rhinitis | SIDER | ||
| 466 | Scab | SIDER | ||
| 467 | Scotoma | OFFSIDES SIDER | ||
| 468 | Secretion discharge | OFFSIDES | ||
| 469 | Shoulder Pain | SIDER | ||
| 470 | Sick Sinus Syndrome | OFFSIDES | ||
| 471 | Sinus bradycardia | OFFSIDES | ||
| 472 | Splenic abscess | OFFSIDES | ||
| 473 | Spondylitis | OFFSIDES | ||
| 474 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 475 | Stem cell transplant | OFFSIDES | ||
| 476 | Stevens-Johnson Syndrome | OFFSIDES | ||
| 477 | Subconjunctival hemorrhage | SIDER | ||
| 478 | Sunken eyes | SIDER | ||
| 479 | Supraventricular tachycardia | OFFSIDES | ||
| 480 | Tenosynovitis | OFFSIDES | ||
| 481 | Thoracic cavity drainage | OFFSIDES | ||
| 482 | Tooth Extraction | OFFSIDES | ||
| 483 | Tooth Infection | OFFSIDES | ||
| 484 | Tooth Loss | OFFSIDES | ||
| 485 | Trabeculectomy | OFFSIDES | ||
| 486 | Transfusion Reaction | OFFSIDES | ||
| 487 | Troponin increased | OFFSIDES | ||
| 488 | Ultrasound pelvis | OFFSIDES | ||
| 489 | Unresponsive to stimuli | OFFSIDES | ||
| 490 | Urine cytology abnormal | OFFSIDES | ||
| 491 | Vascular rupture | OFFSIDES | ||
| 492 | Ventricular Fibrillation | OFFSIDES | ||
| 493 | Vitreous Detachment | SIDER | ||
| 494 | Wound infection staphylococcal | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.