pazopanib
(CUIHSIWYWATEQL-UHFFFAOYSA-N)
Structure
- SMILES
- CN(c1ccc2c(c1)nn(c2C)C)c1ccnc(n1)Nc1ccc(c(c1)S(=O)(=O)N)C
- Type(s)
- Approved
- ATC code(s)
- L01XE11
- Molecular Formula:
- C21H23N7O2S
- Molecular Weight:
- 437.518
- Log P:
- 4.9931
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 127.41
- CAS Number(s):
- 444731-52-6; 790713-33-6
Synonym(s)
1.
pazopanib
2.
GW 780604
3.
GW 786034B
4.
GW-780604
5.
GW-786034B
6.
GW780604
7.
GW786034B
8.
Votrient
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Fatigue | FAERS: 67 | SIDER US FAERS | |
| 3 | Nausea | FAERS: 60 | SIDER US FAERS | |
| 4 | Alanine Aminotransferase Increased | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Disease Progression | FAERS: 40 | US FAERS | |
| 6 | Asthenia | FAERS: 38 | SIDER US FAERS | |
| 7 | Vomiting | FAERS: 37 | SIDER US FAERS | |
| 8 | Abdominal Pain | FAERS: 36 | SIDER US FAERS | |
| 9 | Malaise | FAERS: 35 | US FAERS | |
| 10 | Aspartate Aminotransferase Increased | FAERS: 34 | SIDER US FAERS | |
| 11 | Dehydration | FAERS: 32 | SIDER US FAERS | |
| 12 | Hepatotoxicity | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Thrombocytopenia | FAERS: 32 | SIDER US FAERS | |
| 14 | Pain | FAERS: 28 | SIDER US FAERS | |
| 15 | Pneumonia | FAERS: 28 | US FAERS | |
| 16 | Sepsis | FAERS: 23 | US FAERS | |
| 17 | General physical health deterioration | FAERS: 22 | US FAERS | |
| 18 | Pulmonary Embolism | FAERS: 21 | SIDER US FAERS | |
| 19 | Headache | FAERS: 20 | SIDER US FAERS | |
| 20 | Gamma-Glutamyltransferase Increased | FAERS: 19 | SIDER US FAERS | |
| 21 | Product use in unapproved indication | FAERS: 19 | US FAERS | |
| 22 | jaundice | FAERS: 19 | SIDER US FAERS | |
| 23 | Deep Vein Thrombosis | FAERS: 16 | SIDER US FAERS | |
| 24 | Pericardial effusion | FAERS: 15 | US FAERS | |
| 25 | Weight decreased | FAERS: 15 | SIDER US FAERS | |
| 26 | Blood creatinine increased | FAERS: 14 | SIDER US FAERS | |
| 27 | Hypersensitivity | FAERS: 14 | US FAERS | |
| 28 | Hypothyroidism | FAERS: 14 | SIDER US FAERS | |
| 29 | Pneumothorax | FAERS: 14 | SIDER US FAERS | |
| 30 | Infection | FAERS: 13 | SIDER US FAERS | |
| 31 | Proteinuria | FAERS: 13 | SIDER US FAERS | |
| 32 | Toxicity to various agents | FAERS: 13 | US FAERS | |
| 33 | Colitis | FAERS: 12 | US FAERS | |
| 34 | Hyperthyroidism | FAERS: 12 | US FAERS | |
| 35 | Ileus | FAERS: 12 | US FAERS | |
| 36 | Back Pain | FAERS: 11 | US FAERS | |
| 37 | Cerebral Infarction | FAERS: 11 | SIDER US FAERS | |
| 38 | Constipation | FAERS: 11 | US FAERS | |
| 39 | Intestinal Obstruction | FAERS: 11 | US FAERS | |
| 40 | Skin Ulcer | FAERS: 11 | SIDER US FAERS | |
| 41 | Urinary tract infection | FAERS: 11 | US FAERS | |
| 42 | Ascites | FAERS: 10 | US FAERS | |
| 43 | Duodenal Ulcer | FAERS: 10 | US FAERS | |
| 44 | Acute kidney injury | FAERS: 9 | US FAERS | |
| 45 | Blood alkaline phosphatase increased | FAERS: 9 | SIDER US FAERS | |
| 46 | Flank Pain | FAERS: 9 | US FAERS | |
| 47 | Hypertensive crisis | FAERS: 9 | SIDER US FAERS | |
| 48 | Hypotension | FAERS: 9 | US FAERS | |
| 49 | Pancreatitis | FAERS: 9 | SIDER US FAERS | |
| 50 | Respiratory Failure | FAERS: 9 | US FAERS | |
| 51 | Dysgeusia | FAERS: 8 | SIDER US FAERS | |
| 52 | Febrile Neutropenia | FAERS: 8 | US FAERS | |
| 53 | Gastritis | FAERS: 8 | US FAERS | |
| 54 | Lethargy | FAERS: 8 | SIDER US FAERS | |
| 55 | Neutropenia | FAERS: 8 | SIDER US FAERS | |
| 56 | Pruritus | FAERS: 8 | SIDER US FAERS | |
| 57 | Renal Cell Carcinoma | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Tumour haemorrhage | FAERS: 8 | US FAERS | |
| 59 | Arthralgia | FAERS: 7 | SIDER US FAERS | |
| 60 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 61 | Epilepsy | FAERS: 7 | US FAERS | |
| 62 | Myalgia | FAERS: 7 | SIDER US FAERS | |
| 63 | Somnolence | FAERS: 7 | SIDER US FAERS | |
| 64 | Transaminases increased | FAERS: 7 | US FAERS | |
| 65 | Abdominal discomfort | FAERS: 6 | US FAERS | |
| 66 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 67 | Disorientation | FAERS: 6 | US FAERS | |
| 68 | Dizziness | FAERS: 6 | SIDER US FAERS | |
| 69 | Eosinophilia | FAERS: 6 | US FAERS | |
| 70 | Metastasis | FAERS: 6 | US FAERS | |
| 71 | Myocardial Infarction | FAERS: 6 | SIDER US FAERS | |
| 72 | Nephrotic Syndrome | FAERS: 6 | US FAERS | |
| 73 | Posterior reversible encephalopathy syndrome | FAERS: 6 | SIDER US FAERS | |
| 74 | Stomatitis | FAERS: 6 | SIDER US FAERS | |
| 75 | Tachycardia | FAERS: 6 | US FAERS | |
| 76 | Visual Impairment | FAERS: 6 | US FAERS | |
| 77 | Bradycardia | FAERS: 5 | SIDER US FAERS | |
| 78 | Cerebrovascular accident | FAERS: 5 | SIDER US FAERS | |
| 79 | Chills | FAERS: 5 | SIDER US FAERS | |
| 80 | Concomitant disease aggravated | FAERS: 5 | US FAERS | |
| 81 | Dyspepsia | FAERS: 5 | SIDER US FAERS | |
| 82 | Embolism | FAERS: 5 | SIDER US FAERS | |
| 83 | Emotional distress | FAERS: 5 | US FAERS | |
| 84 | Epistaxis | FAERS: 5 | SIDER US FAERS | |
| 85 | Hypoxia | FAERS: 5 | US FAERS | |
| 86 | Intestinal Perforation | FAERS: 5 | SIDER US FAERS | |
| 87 | Metastatic Renal Cell Carcinoma | FAERS: 5 | US FAERS | |
| 88 | Necrosis | FAERS: 5 | US FAERS | |
| 89 | Osteonecrosis of Jaw | FAERS: 5 | US FAERS | |
| 90 | Performance status decreased | FAERS: 5 | US FAERS | |
| 91 | Pneumonitis | FAERS: 5 | US FAERS | |
| 92 | Syncope | FAERS: 5 | SIDER US FAERS | |
| 93 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 94 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 95 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 96 | Cardiotoxicity | FAERS: 4 | US FAERS | |
| 97 | Cellulitis | FAERS: 4 | US FAERS | |
| 98 | Cholecystitis | FAERS: 4 | US FAERS | |
| 99 | Compulsive lip biting | FAERS: 4 | US FAERS | |
| 100 | Duodenitis | FAERS: 4 | US FAERS | |
| 101 | Enterocolitis | FAERS: 4 | US FAERS | |
| 102 | Enterocutaneous Fistula | FAERS: 4 | SIDER US FAERS | |
| 103 | Erythema | FAERS: 4 | SIDER US FAERS | |
| 104 | Hepatitis | FAERS: 4 | US FAERS | |
| 105 | Mental status changes | FAERS: 4 | US FAERS | |
| 106 | Night sweats | FAERS: 4 | US FAERS | |
| 107 | Palpitations | FAERS: 4 | US FAERS | |
| 108 | Pancytopenia | FAERS: 4 | US FAERS | |
| 109 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 110 | Respiratory distress | FAERS: 4 | US FAERS | |
| 111 | Skin lesion | FAERS: 4 | US FAERS | |
| 112 | Skin necrosis | FAERS: 4 | US FAERS | |
| 113 | Tongue biting | FAERS: 4 | US FAERS | |
| 114 | leiomyosarcoma | FAERS: 4 | US FAERS | |
| 115 | Abdominal sepsis | FAERS: 3 | US FAERS | |
| 116 | Amylase increased | FAERS: 3 | SIDER US FAERS | |
| 117 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 118 | Blood thyroid stimulating hormone increased | FAERS: 3 | SIDER US FAERS | |
| 119 | Bone pain | FAERS: 3 | US FAERS | |
| 120 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 121 | Chest discomfort | FAERS: 3 | US FAERS | |
| 122 | Cholangitis | FAERS: 3 | US FAERS | |
| 123 | Cytokine Release Syndrome | FAERS: 3 | US FAERS | |
| 124 | Cytolytic hepatitis | FAERS: 3 | US FAERS | |
| 125 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 126 | Drug ineffective | FAERS: 3 | US FAERS | |
| 127 | Dysarthria | FAERS: 3 | US FAERS | |
| 128 | Dysphonia | FAERS: 3 | SIDER US FAERS | |
| 129 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 130 | Enteritis | FAERS: 3 | US FAERS | |
| 131 | Hemiparesis | FAERS: 3 | US FAERS | |
| 132 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 133 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 134 | Metastases to pelvis | FAERS: 3 | US FAERS | |
| 135 | Metastatic Neoplasm | FAERS: 3 | US FAERS | |
| 136 | Neck Pain | FAERS: 3 | US FAERS | |
| 137 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 138 | Peritonitis | FAERS: 3 | SIDER US FAERS | |
| 139 | Pharyngotonsillitis | FAERS: 3 | US FAERS | |
| 140 | Pleurisy | FAERS: 3 | US FAERS | |
| 141 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 142 | Pyoderma Gangrenosum | FAERS: 3 | US FAERS | |
| 143 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 144 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 145 | Therapy cessation | FAERS: 3 | US FAERS | |
| 146 | Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 147 | Ulcer | FAERS: 3 | US FAERS | |
| 148 | Urinary Retention | FAERS: 3 | US FAERS | |
| 149 | Urticaria | FAERS: 3 | US FAERS | |
| 150 | Vertigo | FAERS: 3 | US FAERS | |
| 151 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 152 | Abdominal mass | FAERS: 2 | US FAERS | |
| 153 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 154 | Abscess | FAERS: 2 | US FAERS | |
| 155 | Acute Coronary Syndrome | FAERS: 2 | SIDER US FAERS | |
| 156 | Agitation | FAERS: 2 | US FAERS | |
| 157 | Alopecia | FAERS: 2 | SIDER US FAERS | |
| 158 | Aphagia | FAERS: 2 | US FAERS | |
| 159 | Aphasia | FAERS: 2 | US FAERS | |
| 160 | Arthritis | FAERS: 2 | US FAERS | |
| 161 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 162 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 163 | Brain natriuretic peptide abnormal | FAERS: 2 | US FAERS | |
| 164 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 165 | Cell Death | FAERS: 2 | US FAERS | |
| 166 | Cementoplasty | FAERS: 2 | US FAERS | |
| 167 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 168 | Chromaturia | FAERS: 2 | US FAERS | |
| 169 | Colonic fistula | FAERS: 2 | US FAERS | |
| 170 | Culture positive | FAERS: 2 | US FAERS | |
| 171 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 172 | Drug resistance | FAERS: 2 | US FAERS | |
| 173 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 174 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 175 | Gastrointestinal toxicity | FAERS: 2 | US FAERS | |
| 176 | Gastrointestinal wall thickening | FAERS: 2 | US FAERS | |
| 177 | Haematotoxicity | FAERS: 2 | US FAERS | |
| 178 | Hemiplegia | FAERS: 2 | US FAERS | |
| 179 | Hypertensive Encephalopathy | FAERS: 2 | US FAERS | |
| 180 | Hypophagia | FAERS: 2 | US FAERS | |
| 181 | Incisional hernia | FAERS: 2 | US FAERS | |
| 182 | Inflammation | FAERS: 2 | US FAERS | |
| 183 | Large intestine perforation | FAERS: 2 | SIDER US FAERS | |
| 184 | Liposarcoma recurrent | FAERS: 2 | US FAERS | |
| 185 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 186 | Lung Abscess | FAERS: 2 | US FAERS | |
| 187 | Monoplegia | FAERS: 2 | US FAERS | |
| 188 | Myocarditis | FAERS: 2 | US FAERS | |
| 189 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 190 | Neutrophil count decreased | FAERS: 2 | SIDER US FAERS | |
| 191 | Oral pain | FAERS: 2 | US FAERS | |
| 192 | Pallor | FAERS: 2 | US FAERS | |
| 193 | Palpable purpura | FAERS: 2 | US FAERS | |
| 194 | Pelvic venous thrombosis | FAERS: 2 | US FAERS | |
| 195 | Peritonsillar Abscess | FAERS: 2 | US FAERS | |
| 196 | Pneumatosis intestinalis | FAERS: 2 | US FAERS | |
| 197 | Pneumocystis jiroveci pneumonia | FAERS: 2 | US FAERS | |
| 198 | Presyncope | FAERS: 2 | US FAERS | |
| 199 | Purpura | FAERS: 2 | US FAERS | |
| 200 | Renal cancer metastatic | FAERS: 2 | US FAERS | |
| 201 | Renal mass | FAERS: 2 | US FAERS | |
| 202 | Septic Shock | FAERS: 2 | US FAERS | |
| 203 | Serratia test positive | FAERS: 2 | US FAERS | |
| 204 | Sinus bradycardia | FAERS: 2 | SIDER US FAERS | |
| 205 | Sinusitis | FAERS: 2 | US FAERS | |
| 206 | Skin toxicity | FAERS: 2 | US FAERS | |
| 207 | Soft tissue mass | FAERS: 2 | US FAERS | |
| 208 | Superinfection | FAERS: 2 | US FAERS | |
| 209 | Synovial sarcoma metastatic | FAERS: 2 | US FAERS | |
| 210 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 211 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 212 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 213 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 214 | White blood cell count decreased | FAERS: 2 | SIDER US FAERS | |
| 215 | Wound Infection | FAERS: 2 | US FAERS | |
| 216 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 217 | Wound sepsis | FAERS: 2 | US FAERS | |
| 218 | treatment failure | FAERS: 2 | US FAERS | |
| 219 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 220 | Abscess soft tissue | FAERS: 1 | US FAERS | |
| 221 | Accessory spleen | FAERS: 1 | US FAERS | |
| 222 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 223 | Adnexa uteri mass | FAERS: 1 | US FAERS | |
| 224 | Adrenal mass | FAERS: 1 | US FAERS | |
| 225 | Akinesia | FAERS: 1 | US FAERS | |
| 226 | Alveolar Soft Part Sarcoma | FAERS: 1 | US FAERS | |
| 227 | Amnesia | FAERS: 1 | US FAERS | |
| 228 | Anal Fistula | FAERS: 1 | US FAERS | |
| 229 | Anal abscess | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 231 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 232 | Appendicitis | FAERS: 1 | US FAERS | |
| 233 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 234 | Ataxia | FAERS: 1 | US FAERS | |
| 235 | Atelectasis | FAERS: 1 | US FAERS | |
| 236 | Atrial natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 237 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 238 | Bacillus infection | FAERS: 1 | US FAERS | |
| 239 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 240 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 241 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 242 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 243 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 244 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 245 | Blood potassium increased | FAERS: 1 | SIDER US FAERS | |
| 246 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 247 | Blood urea increased | FAERS: 1 | SIDER US FAERS | |
| 248 | Bone erosion | FAERS: 1 | US FAERS | |
| 249 | Bone lesion | FAERS: 1 | US FAERS | |
| 250 | Bone marrow infiltration | FAERS: 1 | US FAERS | |
| 251 | Bronchial Fistula | FAERS: 1 | US FAERS | |
| 252 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 253 | Bronchial dysplasia | FAERS: 1 | US FAERS | |
| 254 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 255 | Cancer Pain | FAERS: 1 | US FAERS | |
| 256 | Candidiasis | FAERS: 1 | US FAERS | |
| 257 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 258 | Cardiac ventricular thrombosis | FAERS: 1 | US FAERS | |
| 259 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 260 | Cataract operation | FAERS: 1 | US FAERS | |
| 261 | Cataract | FAERS: 1 | US FAERS | |
| 262 | Chest Pain | FAERS: 1 | SIDER US FAERS | |
| 263 | Cholestasis | FAERS: 1 | US FAERS | |
| 264 | Chondrosarcoma | FAERS: 1 | US FAERS | |
| 265 | Chordoma | FAERS: 1 | US FAERS | |
| 266 | Clear Cell Sarcoma of Soft Tissue | FAERS: 1 | US FAERS | |
| 267 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 268 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 269 | Compression fracture | FAERS: 1 | US FAERS | |
| 270 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 271 | Cyanosis | FAERS: 1 | US FAERS | |
| 272 | Cystitis | FAERS: 1 | US FAERS | |
| 273 | Cytopenia | FAERS: 1 | US FAERS | |
| 274 | Depressed mood | FAERS: 1 | US FAERS | |
| 275 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 276 | Device dislocation | FAERS: 1 | US FAERS | |
| 277 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 278 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 279 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 280 | Diplopia | FAERS: 1 | US FAERS | |
| 281 | Discomfort | FAERS: 1 | US FAERS | |
| 282 | Disease recurrence | FAERS: 1 | US FAERS | |
| 283 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 284 | Diverticulitis | FAERS: 1 | US FAERS | |
| 285 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 286 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 287 | Drug level increased | FAERS: 1 | US FAERS | |
| 288 | Dry skin | FAERS: 1 | SIDER US FAERS | |
| 289 | Duodenal Obstruction | FAERS: 1 | US FAERS | |
| 290 | Dysuria | FAERS: 1 | US FAERS | |
| 291 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 292 | Endothelial dysfunction | FAERS: 1 | US FAERS | |
| 293 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 294 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 295 | Escherichia infection | FAERS: 1 | US FAERS | |
| 296 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 297 | Eye pain | FAERS: 1 | US FAERS | |
| 298 | Factor XII Deficiency | FAERS: 1 | US FAERS | |
| 299 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 300 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 301 | Fistula discharge | FAERS: 1 | US FAERS | |
| 302 | Fistula of small intestine | FAERS: 1 | US FAERS | |
| 303 | Flatulence | FAERS: 1 | SIDER US FAERS | |
| 304 | Flushing | FAERS: 1 | SIDER US FAERS | |
| 305 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 306 | Gastrointestinal perforation | FAERS: 1 | SIDER US FAERS | |
| 307 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 308 | Glioblastoma | FAERS: 1 | US FAERS | |
| 309 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 310 | Hepatic Encephalopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 311 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 312 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 313 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 314 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 315 | Internal injury | FAERS: 1 | US FAERS | |
| 316 | Intestinal metastasis | FAERS: 1 | US FAERS | |
| 317 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 318 | Laryngitis | FAERS: 1 | US FAERS | |
| 319 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 320 | Leukocytosis | FAERS: 1 | US FAERS | |
| 321 | Lichenification | FAERS: 1 | US FAERS | |
| 322 | Lipase increased | FAERS: 1 | SIDER US FAERS | |
| 323 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 324 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 325 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 326 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 327 | Lymphopenia | FAERS: 1 | SIDER US FAERS | |
| 328 | Malabsorption | FAERS: 1 | US FAERS | |
| 329 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 330 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 331 | Meningitis | FAERS: 1 | US FAERS | |
| 332 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 333 | Mesenteric neoplasm | FAERS: 1 | US FAERS | |
| 334 | Mesothelioma | FAERS: 1 | US FAERS | |
| 335 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 336 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 337 | Metrorrhagia | FAERS: 1 | SIDER US FAERS | |
| 338 | Monoparesis | FAERS: 1 | US FAERS | |
| 339 | Musculoskeletal Pain | FAERS: 1 | SIDER US FAERS | |
| 340 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 341 | Neuroblastoma | FAERS: 1 | US FAERS | |
| 342 | Nodule | FAERS: 1 | US FAERS | |
| 343 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 344 | Ocular cancer metastatic | FAERS: 1 | US FAERS | |
| 345 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 346 | Oropharyngeal pain | FAERS: 1 | SIDER US FAERS | |
| 347 | Osteolysis | FAERS: 1 | US FAERS | |
| 348 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 349 | Overdose | FAERS: 1 | US FAERS | |
| 350 | Palmar erythema | FAERS: 1 | US FAERS | |
| 351 | Pancreatic Fistula | FAERS: 1 | US FAERS | |
| 352 | Pancreatic leak | FAERS: 1 | US FAERS | |
| 353 | Pancreatic toxicity | FAERS: 1 | US FAERS | |
| 354 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 355 | Paranoia | FAERS: 1 | US FAERS | |
| 356 | Paraplegia | FAERS: 1 | US FAERS | |
| 357 | Paresis | FAERS: 1 | US FAERS | |
| 358 | Parotitis | FAERS: 1 | US FAERS | |
| 359 | Pathological fracture | FAERS: 1 | US FAERS | |
| 360 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 361 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 362 | Pelvic mass | FAERS: 1 | US FAERS | |
| 363 | Pemphigus | FAERS: 1 | US FAERS | |
| 364 | Peripancreatic fluid collection | FAERS: 1 | US FAERS | |
| 365 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 366 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 367 | Pharyngitis | FAERS: 1 | US FAERS | |
| 368 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 369 | Pleurocutaneous fistula | FAERS: 1 | US FAERS | |
| 370 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 371 | Portal venous gas | FAERS: 1 | US FAERS | |
| 372 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 373 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 374 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 375 | Product quality issue | FAERS: 1 | US FAERS | |
| 376 | Product use issue | FAERS: 1 | US FAERS | |
| 377 | Proteus test positive | FAERS: 1 | US FAERS | |
| 378 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 379 | Pulmonary artery aneurysm | FAERS: 1 | US FAERS | |
| 380 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 381 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 382 | Pulmonary hilar enlargement | FAERS: 1 | US FAERS | |
| 383 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 384 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 385 | Purulent discharge | FAERS: 1 | US FAERS | |
| 386 | Rash erythematous | FAERS: 1 | SIDER US FAERS | |
| 387 | Renal cell carcinoma recurrent | FAERS: 1 | US FAERS | |
| 388 | Renal cyst | FAERS: 1 | US FAERS | |
| 389 | Respiratory syncytial virus test positive | FAERS: 1 | US FAERS | |
| 390 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 391 | Restlessness | FAERS: 1 | US FAERS | |
| 392 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 393 | Retinal exudates | FAERS: 1 | US FAERS | |
| 394 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 395 | Rhinitis | FAERS: 1 | US FAERS | |
| 396 | Scleral pigmentation | FAERS: 1 | US FAERS | |
| 397 | Seroma | FAERS: 1 | US FAERS | |
| 398 | Sinus headache | FAERS: 1 | US FAERS | |
| 399 | Skin Erosion | FAERS: 1 | US FAERS | |
| 400 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 401 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 402 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 403 | Staphylococcal osteomyelitis | FAERS: 1 | US FAERS | |
| 404 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 405 | Sudden death | FAERS: 1 | US FAERS | |
| 406 | Swelling | FAERS: 1 | US FAERS | |
| 407 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 408 | Thyroxine therapy | FAERS: 1 | US FAERS | |
| 409 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 410 | Tremor | FAERS: 1 | US FAERS | |
| 411 | Trismus | FAERS: 1 | US FAERS | |
| 412 | Troponin increased | FAERS: 1 | US FAERS | |
| 413 | Umbilical erythema | FAERS: 1 | US FAERS | |
| 414 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 415 | Uterine abscess | FAERS: 1 | US FAERS | |
| 416 | Vaginal Fistula | FAERS: 1 | US FAERS | |
| 417 | Vascular calcification | FAERS: 1 | US FAERS | |
| 418 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 419 | Wheezing | FAERS: 1 | US FAERS | |
| 420 | abdominal wall wound | FAERS: 1 | US FAERS | |
| 421 | effusion | FAERS: 1 | US FAERS | |
| 422 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 423 | skin abrasion | FAERS: 1 | US FAERS | |
| 424 | Ageusia | SIDER | ||
| 425 | Anorexia | SIDER | ||
| 426 | Blood albumin decreased | SIDER | ||
| 427 | Blood albumin increased | SIDER | ||
| 428 | Blood and lymphatic system disorders | SIDER | ||
| 429 | Blood cholesterol abnormal | SIDER | ||
| 430 | Blood glucose decreased | SIDER | ||
| 431 | Blood glucose increased | SIDER | ||
| 432 | Blood magnesium decreased | SIDER | ||
| 433 | Blood phosphorus decreased | SIDER | ||
| 434 | Calcium low | SIDER | ||
| 435 | Chemical and Drug Induced Liver Injury | 28437613 | CTD | |
| 436 | Creatinine increased | SIDER | ||
| 437 | Cyst | SIDER | ||
| 438 | Exfoliative rash | SIDER | ||
| 439 | Gastrointestinal Pain | SIDER | ||
| 440 | Glucose decreased | SIDER | ||
| 441 | Glucose increased | SIDER | ||
| 442 | Hypogeusia | SIDER | ||
| 443 | Infectious peritonitis | SIDER | ||
| 444 | Infestation | SIDER | ||
| 445 | Leukoderma | SIDER | ||
| 446 | Leukopenia | SIDER | ||
| 447 | Long QT Syndrome | 20832415 | CTD | |
| 448 | Menorrhagia | SIDER | ||
| 449 | Mg reduced | SIDER | ||
| 450 | Musculoskeletal discomfort | SIDER | ||
| 451 | Phosphorus low | SIDER | ||
| 452 | Plantar erythema | SIDER | ||
| 453 | Potassium increased | SIDER | ||
| 454 | Protein urine present | SIDER | ||
| 455 | Prurigo | SIDER | ||
| 456 | Restrictive cardiomyopathy | SIDER | ||
| 457 | Shock | SIDER | ||
| 458 | Sodium decreased | SIDER | ||
| 459 | Torsades de Pointes | 20832415 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.