Alendronate
(CAKRAHQRJGUPIG-UHFFFAOYSA-M)
Structure
- SMILES
- NCCCC(P(=O)(O)O)(P(=O)(O)[O-])O.[Na+]
- Molecular Formula:
- C4H12NNaO7P2
- Molecular Weight:
- 271.078
- Log P:
- -0.1347
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 5
- TPSA:
- 183.76
- CAS Number(s):
- 129318-43-0
Synonym(s)
1.
Alendronate
2.
4-Amino-1-Hydroxybutylidene 1,1-Biphosphonate
3.
Alendronate Monosodium Salt, Trihydrate
4.
Alendronate Sodium
5.
Aminohydroxybutane Bisphosphonate
6.
Fosamax
7.
MK-217
8.
MK 217
9.
MK217
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 363 | US FAERS | |
| 2 | Emotional distress | FAERS: 280 | US FAERS | |
| 3 | Low turnover osteopathy | FAERS: 252 | US FAERS | |
| 4 | Arthralgia | FAERS: 149 | US FAERS | |
| 5 | Osteonecrosis of Jaw | FAERS: 135 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Anxiety | FAERS: 124 | US FAERS | |
| 7 | Fracture | FAERS: 108 | US FAERS | |
| 8 | Quality of life decreased | FAERS: 103 | US FAERS | |
| 9 | Myalgia | FAERS: 86 | US FAERS | |
| 10 | Drug dose omission | FAERS: 79 | US FAERS | |
| 11 | Atypical femur fracture | FAERS: 74 | US FAERS | |
| 12 | Anhedonia | FAERS: 70 | US FAERS | |
| 13 | Bone pain | FAERS: 67 | US FAERS | |
| 14 | Nausea | FAERS: 63 | US FAERS | |
| 15 | Osteogenesis Imperfecta | FAERS: 61 | US FAERS | |
| 16 | Back Pain | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Bone density decreased | FAERS: 43 | US FAERS | |
| 18 | Pathological fracture | FAERS: 43 | US FAERS | |
| 19 | Chest Pain | FAERS: 42 | US FAERS | |
| 20 | Dyspepsia | FAERS: 42 | US FAERS | |
| 21 | Headache | FAERS: 41 | US FAERS | |
| 22 | Asthenia | FAERS: 33 | US FAERS | |
| 23 | Musculoskeletal Pain | FAERS: 32 | US FAERS | |
| 24 | Dizziness | FAERS: 31 | US FAERS | |
| 25 | Abdominal discomfort | FAERS: 29 | US FAERS | |
| 26 | Drug ineffective | FAERS: 28 | US FAERS | |
| 27 | Inappropriate schedule of drug administration | FAERS: 27 | US FAERS | |
| 28 | Unevaluable event | FAERS: 27 | US FAERS | |
| 29 | Oropharyngeal pain | FAERS: 24 | US FAERS | |
| 30 | Constipation | FAERS: 23 | US FAERS | |
| 31 | Feeling abnormal | FAERS: 22 | US FAERS | |
| 32 | Neck Pain | FAERS: 22 | US FAERS | |
| 33 | Tooth Extraction | FAERS: 22 | US FAERS | |
| 34 | Intramedullary rod insertion | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Malaise | FAERS: 21 | US FAERS | |
| 36 | Osteomyelitis | FAERS: 21 | US FAERS | |
| 37 | Product quality issue | FAERS: 21 | US FAERS | |
| 38 | Product substitution issue | FAERS: 21 | US FAERS | |
| 39 | Pruritus | FAERS: 21 | US FAERS | |
| 40 | Abdominal Pain | FAERS: 20 | US FAERS | |
| 41 | Vomiting | FAERS: 20 | US FAERS | |
| 42 | No adverse event | FAERS: 19 | US FAERS | |
| 43 | Activities of daily living impaired | FAERS: 18 | US FAERS | |
| 44 | Atrial Fibrillation | FAERS: 16 | US FAERS | |
| 45 | Joint swelling | FAERS: 16 | US FAERS | |
| 46 | Adverse event | FAERS: 15 | US FAERS | |
| 47 | Swelling | FAERS: 15 | US FAERS | |
| 48 | Toothache | FAERS: 15 | US FAERS | |
| 49 | Dehydration | FAERS: 14 | US FAERS | |
| 50 | Urticaria | FAERS: 14 | US FAERS | |
| 51 | Alopecia | FAERS: 13 | US FAERS | |
| 52 | Flatulence | FAERS: 13 | US FAERS | |
| 53 | Joint stiffness | FAERS: 13 | US FAERS | |
| 54 | Osteoporosis | FAERS: 13 | US FAERS | |
| 55 | Throat irritation | FAERS: 13 | US FAERS | |
| 56 | Abasia | FAERS: 12 | US FAERS | |
| 57 | Fatigue | FAERS: 12 | US FAERS | |
| 58 | Stomatitis | FAERS: 12 | US FAERS | |
| 59 | Gastric ulcer | FAERS: 11 | US FAERS | |
| 60 | Overdose | FAERS: 11 | US FAERS | |
| 61 | Weight decreased | FAERS: 11 | US FAERS | |
| 62 | Accidental overdose | FAERS: 10 | US FAERS | |
| 63 | Drug administration error | FAERS: 10 | US FAERS | |
| 64 | Dysphonia | FAERS: 10 | US FAERS | |
| 65 | Erythema | FAERS: 10 | US FAERS | |
| 66 | Eye pain | FAERS: 10 | US FAERS | |
| 67 | Medication Error | FAERS: 10 | US FAERS | |
| 68 | Mental impairment | FAERS: 10 | US FAERS | |
| 69 | Musculoskeletal stiffness | FAERS: 10 | US FAERS | |
| 70 | Wrong technique in product usage process | FAERS: 10 | US FAERS | |
| 71 | Loose tooth | FAERS: 9 | US FAERS | |
| 72 | Peripheral swelling | FAERS: 9 | US FAERS | |
| 73 | Gingivitis | FAERS: 8 | US FAERS | |
| 74 | Lip swelling | FAERS: 8 | US FAERS | |
| 75 | Musculoskeletal chest pain | FAERS: 8 | US FAERS | |
| 76 | Osteitis | FAERS: 8 | US FAERS | |
| 77 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 78 | Product solubility abnormal | FAERS: 8 | US FAERS | |
| 79 | Terminal state | FAERS: 8 | US FAERS | |
| 80 | Arthropathy | FAERS: 7 | US FAERS | |
| 81 | Chest discomfort | FAERS: 7 | US FAERS | |
| 82 | Chills | FAERS: 7 | US FAERS | |
| 83 | Discomfort | FAERS: 7 | US FAERS | |
| 84 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 85 | Osteosclerosis | FAERS: 7 | US FAERS | |
| 86 | Palpitations | FAERS: 7 | US FAERS | |
| 87 | Pneumonia | FAERS: 7 | US FAERS | |
| 88 | Tooth Loss | FAERS: 7 | US FAERS | |
| 89 | Ankle Fracture | FAERS: 6 | US FAERS | |
| 90 | Arthritis | FAERS: 6 | US FAERS | |
| 91 | Atypical fracture | FAERS: 6 | US FAERS | |
| 92 | Burning sensation | FAERS: 6 | US FAERS | |
| 93 | Bursitis | FAERS: 6 | US FAERS | |
| 94 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 95 | Choking | FAERS: 6 | US FAERS | |
| 96 | Delirium | FAERS: 6 | US FAERS | |
| 97 | Dysgeusia | FAERS: 6 | US FAERS | |
| 98 | Economic problem | FAERS: 6 | US FAERS | |
| 99 | Emotional disorder | FAERS: 6 | US FAERS | |
| 100 | Hypertensive emergency | FAERS: 6 | US FAERS | |
| 101 | Osteopenia | FAERS: 6 | US FAERS | |
| 102 | Polyarthritis | FAERS: 6 | US FAERS | |
| 103 | Purulence | FAERS: 6 | US FAERS | |
| 104 | Vertigo | FAERS: 6 | US FAERS | |
| 105 | Walking aid user | FAERS: 6 | US FAERS | |
| 106 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 107 | Erythema Multiforme | FAERS: 5 | US FAERS | |
| 108 | Inflammation | FAERS: 5 | US FAERS | |
| 109 | Parophthalmia | FAERS: 5 | US FAERS | |
| 110 | Product use complaint | FAERS: 5 | US FAERS | |
| 111 | Sequestrectomy | FAERS: 5 | US FAERS | |
| 112 | Syncope | FAERS: 5 | US FAERS | |
| 113 | Abscess | FAERS: 4 | US FAERS | |
| 114 | Ageusia | FAERS: 4 | US FAERS | |
| 115 | Crying | FAERS: 4 | US FAERS | |
| 116 | Eczema | FAERS: 4 | US FAERS | |
| 117 | Gas Gangrene | FAERS: 4 | US FAERS | |
| 118 | Gastritis | FAERS: 4 | US FAERS | |
| 119 | Impaired work ability | FAERS: 4 | US FAERS | |
| 120 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 121 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 122 | Infection | FAERS: 4 | US FAERS | |
| 123 | Mastication disorder | FAERS: 4 | US FAERS | |
| 124 | Middle insomnia | FAERS: 4 | US FAERS | |
| 125 | Musculoskeletal discomfort | FAERS: 4 | US FAERS | |
| 126 | Nasal Polyps | FAERS: 4 | US FAERS | |
| 127 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 128 | Open reduction of fracture | FAERS: 4 | US FAERS | |
| 129 | Oroantral Fistula | FAERS: 4 | US FAERS | |
| 130 | Product dose omission | FAERS: 4 | US FAERS | |
| 131 | Restless Legs Syndrome | FAERS: 4 | US FAERS | |
| 132 | Sciatica | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Stress | FAERS: 4 | US FAERS | |
| 134 | Synovitis | FAERS: 4 | US FAERS | |
| 135 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 136 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 137 | Aphonia | FAERS: 3 | US FAERS | |
| 138 | Choking sensation | FAERS: 3 | US FAERS | |
| 139 | Compression fracture | FAERS: 3 | US FAERS | |
| 140 | Corneal lesion | FAERS: 3 | US FAERS | |
| 141 | Debridement | FAERS: 3 | US FAERS | |
| 142 | Dental caries | FAERS: 3 | US FAERS | |
| 143 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 144 | Drooling | FAERS: 3 | US FAERS | |
| 145 | Dysuria | FAERS: 3 | US FAERS | |
| 146 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 147 | Eructation | FAERS: 3 | US FAERS | |
| 148 | Exposed bone in jaw | FAERS: 3 | US FAERS | |
| 149 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 150 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 151 | Muscle strain | FAERS: 3 | US FAERS | |
| 152 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 153 | Optic Neuritis | FAERS: 3 | US FAERS | |
| 154 | Osteomalacia | FAERS: 3 | US FAERS | |
| 155 | Physical disability | FAERS: 3 | US FAERS | |
| 156 | Product coating issue | FAERS: 3 | US FAERS | |
| 157 | Purulent discharge | FAERS: 3 | US FAERS | |
| 158 | Rash erythematous | FAERS: 3 | US FAERS | |
| 159 | Sepsis | FAERS: 3 | US FAERS | |
| 160 | Sinusitis | FAERS: 3 | US FAERS | |
| 161 | Skeletal injury | FAERS: 3 | US FAERS | |
| 162 | Somnolence | FAERS: 3 | US FAERS | |
| 163 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 164 | Tinnitus | FAERS: 3 | US FAERS | |
| 165 | Tooth Infection | FAERS: 3 | US FAERS | |
| 166 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 167 | Traumatic fracture | FAERS: 3 | US FAERS | |
| 168 | Visual Impairment | FAERS: 3 | US FAERS | |
| 169 | Alveolitis | FAERS: 2 | US FAERS | |
| 170 | Aphagia | FAERS: 2 | US FAERS | |
| 171 | Aphasia | FAERS: 2 | US FAERS | |
| 172 | Appendicitis | FAERS: 2 | US FAERS | |
| 173 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 174 | Blindness | FAERS: 2 | US FAERS | |
| 175 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 176 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 177 | Bone formation decreased | FAERS: 2 | US FAERS | |
| 178 | Bronchitis | FAERS: 2 | US FAERS | |
| 179 | Calcinosis | FAERS: 2 | US FAERS | |
| 180 | Cataract | FAERS: 2 | US FAERS | |
| 181 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 182 | Chemical injury | FAERS: 2 | US FAERS | |
| 183 | Device related infection | FAERS: 2 | US FAERS | |
| 184 | Disorientation | FAERS: 2 | US FAERS | |
| 185 | Duodenal ulcer perforation | FAERS: 2 | US FAERS | |
| 186 | Exophthalmos | FAERS: 2 | US FAERS | |
| 187 | Facial Pain | FAERS: 2 | US FAERS | |
| 188 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 189 | Foreign body trauma | FAERS: 2 | US FAERS | |
| 190 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 191 | Hypotension | FAERS: 2 | US FAERS | |
| 192 | Hypoxia | FAERS: 2 | US FAERS | |
| 193 | Hysterectomy | FAERS: 2 | US FAERS | |
| 194 | Implant site reaction | FAERS: 2 | US FAERS | |
| 195 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 196 | Influenza | FAERS: 2 | US FAERS | |
| 197 | Laryngitis | FAERS: 2 | US FAERS | |
| 198 | Limb asymmetry | FAERS: 2 | US FAERS | |
| 199 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 200 | Nerve injury | FAERS: 2 | US FAERS | |
| 201 | Onychoclasis | FAERS: 2 | US FAERS | |
| 202 | Oral Cavity Fistula | FAERS: 2 | US FAERS | |
| 203 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 204 | Pancreatitis | FAERS: 2 | US FAERS | |
| 205 | Periodontitis | FAERS: 2 | US FAERS | |
| 206 | Polyuria | FAERS: 2 | US FAERS | |
| 207 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 208 | Productive Cough | FAERS: 2 | US FAERS | |
| 209 | Pupillary light reflex tests abnormal | FAERS: 2 | US FAERS | |
| 210 | Renal pain | FAERS: 2 | US FAERS | |
| 211 | Sclerotherapy | FAERS: 2 | US FAERS | |
| 212 | Tracheobronchitis | FAERS: 2 | US FAERS | |
| 213 | Tremor | FAERS: 2 | US FAERS | |
| 214 | Trismus | FAERS: 2 | US FAERS | |
| 215 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 216 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 217 | Wrong dose | FAERS: 2 | US FAERS | |
| 218 | X-ray of pelvis and hip abnormal | FAERS: 2 | US FAERS | |
| 219 | treatment failure | FAERS: 2 | US FAERS | |
| 220 | Acne | FAERS: 1 | US FAERS | |
| 221 | Actinomycosis | FAERS: 1 | US FAERS | |
| 222 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 223 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 224 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 225 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 226 | Angioedema | FAERS: 1 | US FAERS | |
| 227 | Anorexia | FAERS: 1 | US FAERS | |
| 228 | Anosmia | FAERS: 1 | US FAERS | |
| 229 | Anti-thyroid antibody positive | FAERS: 1 | US FAERS | |
| 230 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 231 | Ascites | FAERS: 1 | US FAERS | |
| 232 | Asthma | FAERS: 1 | US FAERS | |
| 233 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 234 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 235 | Back disorder | FAERS: 1 | US FAERS | |
| 236 | Bacterial allergy | FAERS: 1 | US FAERS | |
| 237 | Bacterial culture positive | FAERS: 1 | US FAERS | |
| 238 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 239 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 240 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 241 | Blood phosphorus | FAERS: 1 | US FAERS | |
| 242 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 243 | Bone callus excessive | FAERS: 1 | US FAERS | |
| 244 | Bone erosion | FAERS: 1 | US FAERS | |
| 245 | Bone fistula | FAERS: 1 | US FAERS | |
| 246 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 247 | Bone lesion | FAERS: 1 | US FAERS | |
| 248 | Bone scan abnormal | FAERS: 1 | US FAERS | |
| 249 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 250 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 251 | Bruxism | FAERS: 1 | US FAERS | |
| 252 | C-telopeptide increased | FAERS: 1 | US FAERS | |
| 253 | Callus formation delayed | FAERS: 1 | US FAERS | |
| 254 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 255 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 256 | Caustic injury | FAERS: 1 | US FAERS | |
| 257 | Cellulitis | FAERS: 1 | US FAERS | |
| 258 | Chemical burn of gastrointestinal tract | FAERS: 1 | US FAERS | |
| 259 | Chemical burn of respiratory tract | FAERS: 1 | US FAERS | |
| 260 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 261 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 262 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 263 | Choroiditis | FAERS: 1 | US FAERS | |
| 264 | Chromaturia | FAERS: 1 | US FAERS | |
| 265 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 266 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 267 | Coating in mouth | FAERS: 1 | US FAERS | |
| 268 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 269 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 270 | Deafness | FAERS: 1 | US FAERS | |
| 271 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 272 | Dementia | FAERS: 1 | US FAERS | |
| 273 | Dental Restoration Failure | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 274 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 275 | Dermatitis | FAERS: 1 | US FAERS | |
| 276 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 277 | Device Failure | FAERS: 1 | US FAERS | |
| 278 | Device breakage | FAERS: 1 | US FAERS | |
| 279 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 280 | Dissociation | FAERS: 1 | US FAERS | |
| 281 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 282 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 283 | Drug dispensing issue | FAERS: 1 | US FAERS | |
| 284 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 285 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 286 | Drug level changed | FAERS: 1 | US FAERS | |
| 287 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 288 | Dry skin | FAERS: 1 | US FAERS | |
| 289 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 290 | Dysarthria | FAERS: 1 | US FAERS | |
| 291 | Ear discomfort | FAERS: 1 | US FAERS | |
| 292 | Empyema | FAERS: 1 | US FAERS | |
| 293 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 294 | Epicondylitis | FAERS: 1 | US FAERS | |
| 295 | Epiglottitis | FAERS: 1 | US FAERS | |
| 296 | Extra dose administered | FAERS: 1 | US FAERS | |
| 297 | Eye inflammation | FAERS: 1 | US FAERS | |
| 298 | Eye irritation | FAERS: 1 | US FAERS | |
| 299 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 300 | Eyelid pain | FAERS: 1 | US FAERS | |
| 301 | Facial Paresis | FAERS: 1 | US FAERS | |
| 302 | Fanconi Syndrome | FAERS: 1 | US FAERS | |
| 303 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 304 | Flank Pain | FAERS: 1 | US FAERS | |
| 305 | Flushing | FAERS: 1 | US FAERS | |
| 306 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 307 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 308 | Formication | FAERS: 1 | US FAERS | |
| 309 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 310 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 311 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 312 | Gastrointestinal endoscopic therapy | FAERS: 1 | US FAERS | |
| 313 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 314 | Gingival Recession | FAERS: 1 | US FAERS | |
| 315 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 316 | Gingival erythema | FAERS: 1 | US FAERS | |
| 317 | Glossitis | FAERS: 1 | US FAERS | |
| 318 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 319 | Head discomfort | FAERS: 1 | US FAERS | |
| 320 | Hip surgery | FAERS: 1 | US FAERS | |
| 321 | Hirsutism | FAERS: 1 | US FAERS | |
| 322 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 323 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 324 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 325 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 326 | Iliotibial Band Syndrome | FAERS: 1 | US FAERS | |
| 327 | Immobile | FAERS: 1 | US FAERS | |
| 328 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 329 | Incontinence | FAERS: 1 | US FAERS | |
| 330 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 331 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 332 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 333 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 334 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 335 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 336 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 337 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 338 | Joint injury | FAERS: 1 | US FAERS | |
| 339 | Laceration | FAERS: 1 | US FAERS | |
| 340 | Lethargy | FAERS: 1 | US FAERS | |
| 341 | Leukopenia | FAERS: 1 | US FAERS | |
| 342 | Ligament pain | FAERS: 1 | US FAERS | |
| 343 | Limb discomfort | FAERS: 1 | US FAERS | |
| 344 | Limb injury | FAERS: 1 | US FAERS | |
| 345 | Limb mass | FAERS: 1 | US FAERS | |
| 346 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 347 | Malocclusion | FAERS: 1 | US FAERS | |
| 348 | Maxillofacial operation | FAERS: 1 | US FAERS | |
| 349 | Memory impairment | FAERS: 1 | US FAERS | |
| 350 | Mental status changes | FAERS: 1 | US FAERS | |
| 351 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 352 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 353 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 354 | Muscle tightness | FAERS: 1 | US FAERS | |
| 355 | Nail bed tenderness | FAERS: 1 | US FAERS | |
| 356 | Necrosis | FAERS: 1 | US FAERS | |
| 357 | Nephritis | FAERS: 1 | US FAERS | |
| 358 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 359 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 360 | Nervousness | FAERS: 1 | US FAERS | |
| 361 | Occult blood positive | FAERS: 1 | US FAERS | |
| 362 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 363 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 364 | Oral infection | FAERS: 1 | US FAERS | |
| 365 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 366 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 367 | Oral pain | FAERS: 1 | US FAERS | |
| 368 | Oral pruritus | FAERS: 1 | US FAERS | |
| 369 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 370 | Osteolysis | FAERS: 1 | US FAERS | |
| 371 | Osteoma cutis | FAERS: 1 | US FAERS | |
| 372 | Osteorrhagia | FAERS: 1 | US FAERS | |
| 373 | Osteosarcoma | FAERS: 1 | US FAERS | |
| 374 | Pain of skin | FAERS: 1 | US FAERS | |
| 375 | Pancytopenia | FAERS: 1 | US FAERS | |
| 376 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 377 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 378 | Periostitis | FAERS: 1 | US FAERS | |
| 379 | Peritonitis | FAERS: 1 | US FAERS | |
| 380 | Pharyngeal erosion | FAERS: 1 | US FAERS | |
| 381 | Phlebitis | FAERS: 1 | US FAERS | |
| 382 | Photophobia | FAERS: 1 | US FAERS | |
| 383 | Pneumonitis | FAERS: 1 | US FAERS | |
| 384 | Poisoning | FAERS: 1 | US FAERS | |
| 385 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 386 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 387 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 388 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 389 | Product formulation issue | FAERS: 1 | US FAERS | |
| 390 | Product packaging issue | FAERS: 1 | US FAERS | |
| 391 | Product shape issue | FAERS: 1 | US FAERS | |
| 392 | Product size issue | FAERS: 1 | US FAERS | |
| 393 | Product use issue | FAERS: 1 | US FAERS | |
| 394 | Proteinuria | FAERS: 1 | US FAERS | |
| 395 | Psoriasis | FAERS: 1 | US FAERS | |
| 396 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 397 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 398 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 399 | Regurgitation | FAERS: 1 | US FAERS | |
| 400 | Renal mass | FAERS: 1 | US FAERS | |
| 401 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 402 | Respiratory distress | FAERS: 1 | US FAERS | |
| 403 | Retinitis | FAERS: 1 | US FAERS | |
| 404 | Scab | FAERS: 1 | US FAERS | |
| 405 | Scleritis | FAERS: 1 | US FAERS | |
| 406 | Screaming | FAERS: 1 | US FAERS | |
| 407 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 408 | Septic arthritis staphylococcal | FAERS: 1 | US FAERS | |
| 409 | Septic embolus | FAERS: 1 | US FAERS | |
| 410 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 411 | Skin reaction | FAERS: 1 | US FAERS | |
| 412 | Sluggishness | FAERS: 1 | US FAERS | |
| 413 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 414 | Somnambulism | FAERS: 1 | US FAERS | |
| 415 | Sunburn | FAERS: 1 | US FAERS | |
| 416 | Superinfection | FAERS: 1 | US FAERS | |
| 417 | Tachycardia | FAERS: 1 | US FAERS | |
| 418 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 419 | Tension Headache | FAERS: 1 | US FAERS | |
| 420 | Therapy cessation | FAERS: 1 | US FAERS | |
| 421 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 422 | Thirst | FAERS: 1 | US FAERS | |
| 423 | Thrombosis | FAERS: 1 | US FAERS | |
| 424 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 425 | Tongue eruption | FAERS: 1 | US FAERS | |
| 426 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 427 | Transcription medication error | FAERS: 1 | US FAERS | |
| 428 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 429 | Ulcer | FAERS: 1 | US FAERS | |
| 430 | Unemployment | FAERS: 1 | US FAERS | |
| 431 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 432 | Upper airway necrosis | FAERS: 1 | US FAERS | |
| 433 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 434 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 435 | Vitamin B6 increased | FAERS: 1 | US FAERS | |
| 436 | Wheelchair user | FAERS: 1 | US FAERS | |
| 437 | Wheezing | FAERS: 1 | US FAERS | |
| 438 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 439 | Wound sepsis | FAERS: 1 | US FAERS | |
| 440 | Yawning | FAERS: 1 | US FAERS | |
| 441 | Dental prosthesis placement | Canada Vigilance: 1 | Canada Vigilance | |
| 442 | Fracture treatment | Canada Vigilance: 1 | Canada Vigilance | |
| 443 | Medical device removal | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.