Modafinil
(YFGHCGITMMYXAQ-LJQANCHMSA-N)
Structure
- SMILES
- NC(=O)C[S@@](=O)C(c1ccccc1)c1ccccc1
- Type(s)
- Approved; Investigational
- ATC code(s)
- N06BA13
- Molecular Formula:
- C15H15NO2S
- Molecular Weight:
- 273.350
- Log P:
- 3.5760
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 79.37
- CAS Number(s):
- 112111-43-0
Synonym(s)
1.
Modafinil
2.
2-((Diphenylmethyl)sulfinyl)acetamide
3.
2-((R)-(Diphenylmethyl)sulfinyl)acetamide
4.
Alertec
5.
Armodafinil
6.
Benzhydrylsulfinylacetamide
7.
CRL 40476
8.
CRL-40476
9.
Modiodal
10.
Nuvigil
11.
Provigil
12.
R-Modafinil
13.
Sparlon
14.
Vigil
15.
R Modafinil
External Link(s)
| MeSH | D000077408 |
| PubChem Compound | 9690109 |
| BindingDB | 50336892 |
| ChEBI | 77590 |
| CHEMBL | CHEMBL1201192 |
| DrugBank | DB06413 |
| DrugCentral | 4501 |
| KEGG | dr:D03215 |
| Therapeutic Target Database | D0J5RN |
| ZINC | 6156 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 378 | US FAERS | |
| 2 | Headache | FAERS: 239 | US FAERS | |
| 3 | Nausea | FAERS: 133 | US FAERS | |
| 4 | Somnolence | FAERS: 130 | US FAERS | |
| 5 | Anxiety | FAERS: 104 | US FAERS | |
| 6 | Fatigue | FAERS: 98 | US FAERS | |
| 7 | Feeling abnormal | FAERS: 81 | US FAERS | |
| 8 | Dizziness | FAERS: 64 | US FAERS | |
| 9 | Palpitations | FAERS: 62 | US FAERS | |
| 10 | Feeling jittery | FAERS: 52 | US FAERS | |
| 11 | Drug ineffective for unapproved indication | FAERS: 51 | US FAERS | |
| 12 | Malaise | FAERS: 45 | US FAERS | |
| 13 | Chest Pain | FAERS: 43 | US FAERS | |
| 14 | Stevens-Johnson Syndrome | FAERS: 42 | US FAERS | |
| 15 | Stomatitis | FAERS: 42 | US FAERS | |
| 16 | Pruritus | FAERS: 41 | US FAERS | |
| 17 | Drug prescribing error | FAERS: 40 | US FAERS | |
| 18 | Therapeutic response unexpected | FAERS: 40 | US FAERS | |
| 19 | Tremor | FAERS: 39 | US FAERS | |
| 20 | Product substitution issue | FAERS: 37 | US FAERS | |
| 21 | Urticaria | FAERS: 34 | US FAERS | |
| 22 | Agitation | FAERS: 33 | US FAERS | |
| 23 | Nervousness | FAERS: 33 | US FAERS | |
| 24 | Adverse event | FAERS: 32 | US FAERS | |
| 25 | Drug Tolerance | FAERS: 32 | US FAERS | |
| 26 | Vomiting | FAERS: 31 | US FAERS | |
| 27 | Abdominal discomfort | FAERS: 27 | US FAERS | |
| 28 | Asthenia | FAERS: 27 | US FAERS | |
| 29 | Hypersensitivity | FAERS: 26 | US FAERS | |
| 30 | Product use issue | FAERS: 25 | US FAERS | |
| 31 | Drug dose omission | FAERS: 24 | US FAERS | |
| 32 | Intentional drug misuse | FAERS: 24 | US FAERS | |
| 33 | Alopecia | FAERS: 23 | US FAERS | |
| 34 | Lip swelling | FAERS: 22 | US FAERS | |
| 35 | Arthralgia | FAERS: 20 | US FAERS | |
| 36 | Inappropriate schedule of drug administration | FAERS: 20 | US FAERS | |
| 37 | Tachycardia | FAERS: 19 | US FAERS | |
| 38 | Incorrect dose administered | FAERS: 18 | US FAERS | |
| 39 | Hypersomnia | FAERS: 16 | US FAERS | |
| 40 | Pain | FAERS: 16 | US FAERS | |
| 41 | Weight decreased | FAERS: 16 | US FAERS | |
| 42 | Rash erythematous | FAERS: 15 | US FAERS | |
| 43 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 44 | Bruxism | FAERS: 14 | US FAERS | |
| 45 | Dysgeusia | FAERS: 14 | US FAERS | |
| 46 | Oropharyngeal blistering | FAERS: 14 | US FAERS | |
| 47 | Oropharyngeal pain | FAERS: 14 | US FAERS | |
| 48 | Anger | FAERS: 13 | US FAERS | |
| 49 | Oral pain | FAERS: 13 | US FAERS | |
| 50 | Angioedema | FAERS: 12 | US FAERS | |
| 51 | Lethargy | FAERS: 12 | US FAERS | |
| 52 | Mood swings | FAERS: 12 | US FAERS | |
| 53 | Unevaluable event | FAERS: 12 | US FAERS | |
| 54 | Visual Impairment | FAERS: 12 | US FAERS | |
| 55 | Chest discomfort | FAERS: 11 | US FAERS | |
| 56 | Dysphonia | FAERS: 11 | US FAERS | |
| 57 | Erythema | FAERS: 11 | US FAERS | |
| 58 | Memory impairment | FAERS: 11 | US FAERS | |
| 59 | Muscle tightness | FAERS: 11 | US FAERS | |
| 60 | Product use in unapproved indication | FAERS: 11 | US FAERS | |
| 61 | Atrial Fibrillation | FAERS: 10 | US FAERS | |
| 62 | Drug effect incomplete | FAERS: 10 | US FAERS | |
| 63 | Dyspepsia | FAERS: 10 | US FAERS | |
| 64 | Product quality issue | FAERS: 10 | US FAERS | |
| 65 | Amphetamines positive | FAERS: 9 | US FAERS | |
| 66 | Disorientation | FAERS: 9 | US FAERS | |
| 67 | Drug abuse | FAERS: 9 | US FAERS | |
| 68 | Drug administration error | FAERS: 9 | US FAERS | |
| 69 | Pregnancy | FAERS: 9 | US FAERS | |
| 70 | Restlessness | FAERS: 9 | US FAERS | |
| 71 | Apathy | FAERS: 8 | US FAERS | |
| 72 | Aphasia | FAERS: 8 | US FAERS | |
| 73 | Completed Suicide | FAERS: 8 | US FAERS | |
| 74 | Drug screen positive | FAERS: 8 | US FAERS | |
| 75 | Drug withdrawal syndrome | FAERS: 8 | US FAERS | |
| 76 | Epistaxis | FAERS: 8 | US FAERS | |
| 77 | Euphoric mood | FAERS: 8 | US FAERS | |
| 78 | Maternal exposure during pregnancy | FAERS: 8 | US FAERS | |
| 79 | Mental status changes | FAERS: 8 | US FAERS | |
| 80 | Myalgia | FAERS: 8 | US FAERS | |
| 81 | Nasopharyngitis | FAERS: 8 | US FAERS | |
| 82 | Pneumonia | FAERS: 8 | US FAERS | |
| 83 | Poor quality sleep | FAERS: 8 | US FAERS | |
| 84 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 85 | Back Pain | FAERS: 7 | US FAERS | |
| 86 | Chromaturia | FAERS: 7 | US FAERS | |
| 87 | Depressed mood | FAERS: 7 | US FAERS | |
| 88 | Flushing | FAERS: 7 | US FAERS | |
| 89 | Impaired driving ability | FAERS: 7 | US FAERS | |
| 90 | Tongue blistering | FAERS: 7 | US FAERS | |
| 91 | Dehydration | FAERS: 6 | US FAERS | |
| 92 | Initial insomnia | FAERS: 6 | US FAERS | |
| 93 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 94 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 95 | Neck Pain | FAERS: 6 | US FAERS | |
| 96 | Paranoia | FAERS: 6 | US FAERS | |
| 97 | Pharyngitis | FAERS: 6 | US FAERS | |
| 98 | Swelling | FAERS: 6 | US FAERS | |
| 99 | Tinnitus | FAERS: 6 | US FAERS | |
| 100 | Vasculitis | FAERS: 6 | US FAERS | |
| 101 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 102 | Aphthous Stomatitis | FAERS: 5 | US FAERS | |
| 103 | Chills | FAERS: 5 | US FAERS | |
| 104 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 105 | Dry skin | FAERS: 5 | US FAERS | |
| 106 | Dysarthria | FAERS: 5 | US FAERS | |
| 107 | Hypophagia | FAERS: 5 | US FAERS | |
| 108 | Medication Error | FAERS: 5 | US FAERS | |
| 109 | Personality Change | FAERS: 5 | US FAERS | |
| 110 | Product physical issue | FAERS: 5 | US FAERS | |
| 111 | Product taste abnormal | FAERS: 5 | US FAERS | |
| 112 | Somnambulism | FAERS: 5 | US FAERS | |
| 113 | Abasia | FAERS: 4 | US FAERS | |
| 114 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 115 | Ageusia | FAERS: 4 | US FAERS | |
| 116 | Amnesia | FAERS: 4 | US FAERS | |
| 117 | Burning sensation | FAERS: 4 | US FAERS | |
| 118 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 119 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 120 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 121 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 122 | Dysuria | FAERS: 4 | US FAERS | |
| 123 | Fibromyalgia | FAERS: 4 | US FAERS | |
| 124 | Hypotension | FAERS: 4 | US FAERS | |
| 125 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 126 | Joint swelling | FAERS: 4 | US FAERS | |
| 127 | Mental impairment | FAERS: 4 | US FAERS | |
| 128 | Multiple Sclerosis | FAERS: 4 | US FAERS | |
| 129 | Overdose | FAERS: 4 | US FAERS | |
| 130 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 131 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 132 | Sluggishness | FAERS: 4 | US FAERS | |
| 133 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 134 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 135 | Arthritis | FAERS: 3 | US FAERS | |
| 136 | Arthropod sting | FAERS: 3 | US FAERS | |
| 137 | Asthma | FAERS: 3 | US FAERS | |
| 138 | Bedridden | FAERS: 3 | US FAERS | |
| 139 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 140 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 141 | Cerebral calcification | FAERS: 3 | US FAERS | |
| 142 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 143 | Chemotherapy | FAERS: 3 | US FAERS | |
| 144 | Cholestasis | FAERS: 3 | US FAERS | |
| 145 | Crying | FAERS: 3 | US FAERS | |
| 146 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 147 | Diplopia | FAERS: 3 | US FAERS | |
| 148 | Discomfort | FAERS: 3 | US FAERS | |
| 149 | Dissociation | FAERS: 3 | US FAERS | |
| 150 | Drug Dependence | FAERS: 3 | US FAERS | |
| 151 | Drug diversion | FAERS: 3 | US FAERS | |
| 152 | Expired product administered | FAERS: 3 | US FAERS | |
| 153 | Eye pain | FAERS: 3 | US FAERS | |
| 154 | Food Poisoning | FAERS: 3 | US FAERS | |
| 155 | Frustration | FAERS: 3 | US FAERS | |
| 156 | Infection | FAERS: 3 | US FAERS | |
| 157 | Influenza | FAERS: 3 | US FAERS | |
| 158 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 159 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 160 | Menorrhagia | FAERS: 3 | US FAERS | |
| 161 | Middle insomnia | FAERS: 3 | US FAERS | |
| 162 | Milk Allergy | FAERS: 3 | US FAERS | |
| 163 | Myopathy | FAERS: 3 | US FAERS | |
| 164 | No adverse event | FAERS: 3 | US FAERS | |
| 165 | Obsessive-Compulsive Disorder | FAERS: 3 | US FAERS | |
| 166 | Osteoporosis | FAERS: 3 | US FAERS | |
| 167 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 168 | Premature Ejaculation | FAERS: 3 | US FAERS | |
| 169 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 170 | Skin lesion | FAERS: 3 | US FAERS | |
| 171 | Therapy cessation | FAERS: 3 | US FAERS | |
| 172 | Thirst | FAERS: 3 | US FAERS | |
| 173 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 174 | Trismus | FAERS: 3 | US FAERS | |
| 175 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 176 | Urine amphetamine positive | FAERS: 3 | US FAERS | |
| 177 | treatment failure | FAERS: 3 | US FAERS | |
| 178 | Acne | FAERS: 2 | US FAERS | |
| 179 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 180 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 181 | Anosmia | FAERS: 2 | US FAERS | |
| 182 | Aphagia | FAERS: 2 | US FAERS | |
| 183 | Aspergillosis | FAERS: 2 | US FAERS | |
| 184 | Asthenopia | FAERS: 2 | US FAERS | |
| 185 | Atelectasis | FAERS: 2 | US FAERS | |
| 186 | Blepharospasm | FAERS: 2 | US FAERS | |
| 187 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 188 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 189 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 190 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 191 | Breech Presentation | FAERS: 2 | US FAERS | |
| 192 | Bronchitis | FAERS: 2 | US FAERS | |
| 193 | Cataplexy | FAERS: 2 | US FAERS | |
| 194 | Cheilitis | FAERS: 2 | US FAERS | |
| 195 | Chronic Fatigue Syndrome | FAERS: 2 | US FAERS | |
| 196 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 197 | Claustrophobia | FAERS: 2 | US FAERS | |
| 198 | Congenital torticollis | FAERS: 2 | US FAERS | |
| 199 | Constipation | FAERS: 2 | US FAERS | |
| 200 | Dependence | FAERS: 2 | US FAERS | |
| 201 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 202 | Disease Progression | FAERS: 2 | US FAERS | |
| 203 | Disease recurrence | FAERS: 2 | US FAERS | |
| 204 | Drug level decreased | FAERS: 2 | US FAERS | |
| 205 | Dystonia | FAERS: 2 | US FAERS | |
| 206 | Emotional disorder | FAERS: 2 | US FAERS | |
| 207 | Eructation | FAERS: 2 | US FAERS | |
| 208 | Extra dose administered | FAERS: 2 | US FAERS | |
| 209 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 210 | Feeling Cold | FAERS: 2 | US FAERS | |
| 211 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 212 | Formication | FAERS: 2 | US FAERS | |
| 213 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 214 | Gaze palsy | FAERS: 2 | US FAERS | |
| 215 | Hemiparesis | FAERS: 2 | US FAERS | |
| 216 | Impaired work ability | FAERS: 2 | US FAERS | |
| 217 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 218 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 219 | Intercepted drug prescribing error | FAERS: 2 | US FAERS | |
| 220 | Intracranial mass | FAERS: 2 | US FAERS | |
| 221 | Laryngitis | FAERS: 2 | US FAERS | |
| 222 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 223 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 224 | Mouth swelling | FAERS: 2 | US FAERS | |
| 225 | Multiple sclerosis relapse | FAERS: 2 | US FAERS | |
| 226 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 227 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 228 | Oral infection | FAERS: 2 | US FAERS | |
| 229 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 230 | Pancreatitis | FAERS: 2 | US FAERS | |
| 231 | Product contamination physical | FAERS: 2 | US FAERS | |
| 232 | Product dose omission | FAERS: 2 | US FAERS | |
| 233 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 234 | Productive Cough | FAERS: 2 | US FAERS | |
| 235 | Purpura | FAERS: 2 | US FAERS | |
| 236 | Retching | FAERS: 2 | US FAERS | |
| 237 | Skin reaction | FAERS: 2 | US FAERS | |
| 238 | Sleep Paralysis | FAERS: 2 | US FAERS | |
| 239 | Stress | FAERS: 2 | US FAERS | |
| 240 | Suicide attempt | FAERS: 2 | US FAERS | |
| 241 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 242 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 243 | Tension | FAERS: 2 | US FAERS | |
| 244 | Throat irritation | FAERS: 2 | US FAERS | |
| 245 | Toothache | FAERS: 2 | US FAERS | |
| 246 | Ulcer | FAERS: 2 | US FAERS | |
| 247 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 248 | Uterine Cancer | FAERS: 2 | US FAERS | |
| 249 | Vertigo | FAERS: 2 | US FAERS | |
| 250 | Violence-related symptom | FAERS: 2 | US FAERS | |
| 251 | Yawning | FAERS: 2 | US FAERS | |
| 252 | Abscess | FAERS: 1 | US FAERS | |
| 253 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 254 | Accidental overdose | FAERS: 1 | US FAERS | |
| 255 | Acidosis | FAERS: 1 | US FAERS | |
| 256 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 257 | Allergy to arthropod sting | FAERS: 1 | US FAERS | |
| 258 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 259 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 260 | Amblyopia | FAERS: 1 | US FAERS | |
| 261 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 262 | Anaplastic astrocytoma | FAERS: 1 | US FAERS | |
| 263 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 264 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 265 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 266 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 267 | Aphonia | FAERS: 1 | US FAERS | |
| 268 | Apparent death | FAERS: 1 | US FAERS | |
| 269 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 270 | Balanoposthitis | FAERS: 1 | US FAERS | |
| 271 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 272 | Bladder pain | FAERS: 1 | US FAERS | |
| 273 | Blindness | FAERS: 1 | US FAERS | |
| 274 | Blood alcohol decreased | FAERS: 1 | US FAERS | |
| 275 | Blood blister | FAERS: 1 | US FAERS | |
| 276 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 277 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 278 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 279 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 280 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 281 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 282 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 283 | Blunted affect | FAERS: 1 | US FAERS | |
| 284 | Bradycardia | FAERS: 1 | US FAERS | |
| 285 | Bunion operation | FAERS: 1 | US FAERS | |
| 286 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 287 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 288 | Cardiac imaging procedure abnormal | FAERS: 1 | US FAERS | |
| 289 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 290 | Cataract | FAERS: 1 | US FAERS | |
| 291 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 292 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 293 | Choking sensation | FAERS: 1 | US FAERS | |
| 294 | Choking | FAERS: 1 | US FAERS | |
| 295 | Cholestasis of pregnancy | FAERS: 1 | US FAERS | |
| 296 | Chorea | FAERS: 1 | US FAERS | |
| 297 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 298 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 299 | Cystitis | FAERS: 1 | US FAERS | |
| 300 | Deafness | FAERS: 1 | US FAERS | |
| 301 | Dependence on enabling machine or device | FAERS: 1 | US FAERS | |
| 302 | Depression suicidal | FAERS: 1 | US FAERS | |
| 303 | Dermatitis | FAERS: 1 | US FAERS | |
| 304 | Device occlusion | FAERS: 1 | US FAERS | |
| 305 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 306 | Disability | FAERS: 1 | US FAERS | |
| 307 | Drug therapeutic incompatibility | FAERS: 1 | US FAERS | |
| 308 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 309 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 310 | Dysphemia | FAERS: 1 | US FAERS | |
| 311 | Dysthymic Disorder | FAERS: 1 | US FAERS | |
| 312 | Elbow operation | FAERS: 1 | US FAERS | |
| 313 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 314 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 315 | Empyema | FAERS: 1 | US FAERS | |
| 316 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 317 | Epilepsy | FAERS: 1 | US FAERS | |
| 318 | Epileptic aura | FAERS: 1 | US FAERS | |
| 319 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 320 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 321 | Excoriation | FAERS: 1 | US FAERS | |
| 322 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 323 | Expired drug administered | FAERS: 1 | US FAERS | |
| 324 | Eye irritation | FAERS: 1 | US FAERS | |
| 325 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 326 | Facial Pain | FAERS: 1 | US FAERS | |
| 327 | False positive investigation result | FAERS: 1 | US FAERS | |
| 328 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 329 | Flatulence | FAERS: 1 | US FAERS | |
| 330 | Gait inability | FAERS: 1 | US FAERS | |
| 331 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 332 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 333 | Gastritis | FAERS: 1 | US FAERS | |
| 334 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 335 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 336 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 337 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 338 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 339 | Gingivitis | FAERS: 1 | US FAERS | |
| 340 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 341 | Glossitis | FAERS: 1 | US FAERS | |
| 342 | Granuloma | FAERS: 1 | US FAERS | |
| 343 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 344 | Head discomfort | FAERS: 1 | US FAERS | |
| 345 | Head titubation | FAERS: 1 | US FAERS | |
| 346 | Heat Stroke | FAERS: 1 | US FAERS | |
| 347 | Hunger | FAERS: 1 | US FAERS | |
| 348 | Hyperacusis | FAERS: 1 | US FAERS | |
| 349 | Hyperemesis Gravidarum | FAERS: 1 | US FAERS | |
| 350 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 351 | Hyperventilation | FAERS: 1 | US FAERS | |
| 352 | Hypervigilance | FAERS: 1 | US FAERS | |
| 353 | Hypomania | FAERS: 1 | US FAERS | |
| 354 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 355 | Hypoxia | FAERS: 1 | US FAERS | |
| 356 | Hysterectomy | FAERS: 1 | US FAERS | |
| 357 | Inadequate lubrication | FAERS: 1 | US FAERS | |
| 358 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 359 | Infertility | FAERS: 1 | US FAERS | |
| 360 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 361 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 362 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 363 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 364 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 365 | Joint stiffness | FAERS: 1 | US FAERS | |
| 366 | Laceration | FAERS: 1 | US FAERS | |
| 367 | Laziness | FAERS: 1 | US FAERS | |
| 368 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 369 | Leukocytosis | FAERS: 1 | US FAERS | |
| 370 | Limb operation | FAERS: 1 | US FAERS | |
| 371 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 372 | Lip pruritus | FAERS: 1 | US FAERS | |
| 373 | Live Birth | FAERS: 1 | US FAERS | |
| 374 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 375 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 376 | Malabsorption | FAERS: 1 | US FAERS | |
| 377 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 378 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 379 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 380 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 381 | Motion Sickness | FAERS: 1 | US FAERS | |
| 382 | Mucosal exfoliation | FAERS: 1 | US FAERS | |
| 383 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 384 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 385 | Myoclonus | FAERS: 1 | US FAERS | |
| 386 | Nail picking | FAERS: 1 | US FAERS | |
| 387 | Narcolepsy | FAERS: 1 | US FAERS | |
| 388 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 389 | Neuroblastoma | FAERS: 1 | US FAERS | |
| 390 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 391 | Noonan Syndrome | FAERS: 1 | US FAERS | |
| 392 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 393 | Ocular icterus | FAERS: 1 | US FAERS | |
| 394 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 395 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 396 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 397 | Oral pruritus | FAERS: 1 | US FAERS | |
| 398 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 399 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 400 | Pain of skin | FAERS: 1 | US FAERS | |
| 401 | Pancytopenia | FAERS: 1 | US FAERS | |
| 402 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 403 | Phlebitis | FAERS: 1 | US FAERS | |
| 404 | Physical product label issue | FAERS: 1 | US FAERS | |
| 405 | Pneumonitis | FAERS: 1 | US FAERS | |
| 406 | Polyuria | FAERS: 1 | US FAERS | |
| 407 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 408 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 409 | Pregnancy on oral contraceptive | FAERS: 1 | US FAERS | |
| 410 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 411 | Presyncope | FAERS: 1 | US FAERS | |
| 412 | Product container issue | FAERS: 1 | US FAERS | |
| 413 | Product formulation issue | FAERS: 1 | US FAERS | |
| 414 | Product label issue | FAERS: 1 | US FAERS | |
| 415 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 416 | Product preparation error | FAERS: 1 | US FAERS | |
| 417 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 418 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 419 | Psoriasis | FAERS: 1 | US FAERS | |
| 420 | Psychotic disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 421 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 422 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 423 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 424 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 425 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 426 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 427 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 428 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 429 | Rosacea | FAERS: 1 | US FAERS | |
| 430 | Saliva altered | FAERS: 1 | US FAERS | |
| 431 | Sciatica | FAERS: 1 | US FAERS | |
| 432 | Sclerotherapy | FAERS: 1 | US FAERS | |
| 433 | Screaming | FAERS: 1 | US FAERS | |
| 434 | Sepsis | FAERS: 1 | US FAERS | |
| 435 | Septic Shock | FAERS: 1 | US FAERS | |
| 436 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 437 | Sexual abuse | FAERS: 1 | US FAERS | |
| 438 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 439 | Sinus headache | FAERS: 1 | US FAERS | |
| 440 | Sinusitis | FAERS: 1 | US FAERS | |
| 441 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 442 | Skin irritation | FAERS: 1 | US FAERS | |
| 443 | Sneezing | FAERS: 1 | US FAERS | |
| 444 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 445 | Staring | FAERS: 1 | US FAERS | |
| 446 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 447 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 448 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 449 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 450 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 451 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 452 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 453 | Thrombosis | FAERS: 1 | US FAERS | |
| 454 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 455 | Tracheitis | FAERS: 1 | US FAERS | |
| 456 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 457 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 458 | Urine ketone body absent | FAERS: 1 | US FAERS | |
| 459 | Vascular pain | FAERS: 1 | US FAERS | |
| 460 | Vessel puncture site bruise | FAERS: 1 | US FAERS | |
| 461 | Vessel puncture site reaction | FAERS: 1 | US FAERS | |
| 462 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 463 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 464 | Wheelchair user | FAERS: 1 | US FAERS | |
| 465 | Wheezing | FAERS: 1 | US FAERS | |
| 466 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 467 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 468 | furuncle | FAERS: 1 | US FAERS | |
| 469 | prostatitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.