Vardenafil Dihydrochloride
(SECKRCOLJRRGGV-UHFFFAOYSA-N)
Structure
- SMILES
- CCOc1ccc(cc1c1[nH]c(=O)c2n(n1)c(CCC)nc2C)S(=O)(=O)N1CCN(CC1)CC
- Type(s)
- Approved
- ATC code(s)
- G04BE09
- Molecular Formula:
- C23H32N6O4S
- Molecular Weight:
- 488.603
- Log P:
- 3.0270
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 1
- TPSA:
- 121.28
- CAS Number(s):
- 224785-90-4; 224789-15-5
Synonym(s)
1.
Vardenafil Dihydrochloride
2.
1-(((3-(3,4-dihydro-5-methyl)-4-oxo-7-propylimidazo(5,1-f)-as-triazin-2-yl)-4-ethoxyphenyl)sulfonyl)-4-ethylpiperazine
3.
Levitra
4.
Vardenafil
5.
Vardenafil Hydrochloride
6.
Vardenafil Hydrochloride Anhydrous
7.
Vardenafil Hydrochloride Trihydrate
8.
Anhydrous, Vardenafil Hydrochloride
9.
Dihydrochloride, Vardenafil
10.
Hydrochloride Anhydrous, Vardenafil
11.
Hydrochloride Trihydrate, Vardenafil
12.
Hydrochloride, Vardenafil
13.
Trihydrate, Vardenafil Hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 774 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Erectile dysfunction | FAERS: 641 | OFFSIDES US FAERS | |
| 3 | Headache | FAERS: 369 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 4 | Adverse event | FAERS: 217 | OFFSIDES US FAERS | |
| 5 | Erection increased | FAERS: 210 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 6 | Flushing | FAERS: 164 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Dizziness | FAERS: 90 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Drug use for unknown indication | FAERS: 60 | OFFSIDES US FAERS | |
| 9 | No adverse event | FAERS: 58 | US FAERS | |
| 10 | Visual disturbance | FAERS: 58 | OFFSIDES SIDER US FAERS | |
| 11 | Nausea | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Blindness | FAERS: 44 | SIDER US FAERS | |
| 13 | Erythema | FAERS: 42 | SIDER US FAERS | |
| 14 | Palpitations | FAERS: 40 | SIDER US FAERS | |
| 15 | Dyspepsia | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 16 | Priapism | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Tinnitus | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Chest Pain | FAERS: 33 | SIDER US FAERS | |
| 19 | Vomiting | FAERS: 31 | SIDER US FAERS | |
| 20 | Deafness | FAERS: 30 | OFFSIDES US FAERS | |
| 21 | Unevaluable event | FAERS: 29 | OFFSIDES US FAERS | |
| 22 | Back Pain | FAERS: 28 | SIDER US FAERS | |
| 23 | Feeling abnormal | FAERS: 27 | SIDER US FAERS | |
| 24 | Cerebrovascular accident | FAERS: 26 | US FAERS | |
| 25 | Visual Impairment | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 26 | Anorgasmia | FAERS: 24 | OFFSIDES US FAERS | |
| 27 | Cyanopsia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Spontaneous penile erection | FAERS: 22 | OFFSIDES US FAERS | |
| 29 | Therapeutic response delayed | FAERS: 22 | US FAERS | |
| 30 | Myalgia | FAERS: 21 | SIDER US FAERS | |
| 31 | Syncope | FAERS: 20 | SIDER US FAERS | |
| 32 | Malaise | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Hypotension | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Photophobia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Abdominal discomfort | FAERS: 16 | US FAERS | |
| 36 | Eye pain | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 37 | Myocardial Infarction | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Fatigue | FAERS: 15 | US FAERS | |
| 39 | Premature Ejaculation | FAERS: 15 | SIDER US FAERS | |
| 40 | Retinal Vein Occlusion | FAERS: 15 | SIDER US FAERS | |
| 41 | Pain | FAERS: 14 | SIDER US FAERS | |
| 42 | Vertigo | FAERS: 14 | SIDER US FAERS | |
| 43 | Flatulence | FAERS: 13 | OFFSIDES US FAERS | |
| 44 | Hypersensitivity | FAERS: 13 | SIDER US FAERS | |
| 45 | Chromatopsia | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 46 | Diplopia | FAERS: 12 | US FAERS | |
| 47 | Epistaxis | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 48 | Pharmaceutical product complaint | FAERS: 12 | US FAERS | |
| 49 | Product quality issue | FAERS: 12 | US FAERS | |
| 50 | Tremor | FAERS: 12 | US FAERS | |
| 51 | Wrong technique in drug usage process | FAERS: 12 | US FAERS | |
| 52 | Macular degeneration | FAERS: 11 | US FAERS | |
| 53 | Retinal Detachment | FAERS: 11 | US FAERS | |
| 54 | Anxiety | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 55 | Dysuria | FAERS: 10 | US FAERS | |
| 56 | Pruritus | FAERS: 10 | SIDER US FAERS | |
| 57 | Somnolence | FAERS: 10 | SIDER US FAERS | |
| 58 | Tachycardia | FAERS: 10 | SIDER US FAERS | |
| 59 | Abdominal Pain | FAERS: 9 | SIDER US FAERS | |
| 60 | Arthralgia | FAERS: 9 | SIDER US FAERS | |
| 61 | Asthenia | FAERS: 9 | SIDER US FAERS | |
| 62 | Cataract | FAERS: 9 | US FAERS | |
| 63 | Chills | FAERS: 9 | US FAERS | |
| 64 | Pulmonary Embolism | FAERS: 9 | US FAERS | |
| 65 | Retinal Artery Occlusion | FAERS: 9 | OFFSIDES US FAERS | |
| 66 | Sexual Dysfunction | FAERS: 9 | US FAERS | |
| 67 | Suspected counterfeit product | FAERS: 9 | US FAERS | |
| 68 | Chest discomfort | FAERS: 8 | US FAERS | |
| 69 | Rhinitis | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 70 | Blood urine present | FAERS: 7 | US FAERS | |
| 71 | Dysphonia | FAERS: 7 | US FAERS | |
| 72 | Euphoric mood | FAERS: 7 | OFFSIDES US FAERS | |
| 73 | Expired product administered | FAERS: 7 | US FAERS | |
| 74 | Restless Legs Syndrome | FAERS: 7 | US FAERS | |
| 75 | Therapeutic product ineffective | FAERS: 7 | US FAERS | |
| 76 | Thrombosis | FAERS: 7 | US FAERS | |
| 77 | Amnesia | FAERS: 6 | SIDER US FAERS | |
| 78 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 79 | Deafness Neurosensory | FAERS: 6 | OFFSIDES US FAERS | |
| 80 | Genital burning sensation | FAERS: 6 | OFFSIDES US FAERS | |
| 81 | Urinary Incontinence | FAERS: 6 | US FAERS | |
| 82 | Urticaria | FAERS: 6 | US FAERS | |
| 83 | Vitreous Detachment | FAERS: 6 | US FAERS | |
| 84 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 85 | Asthma | FAERS: 5 | US FAERS | |
| 86 | Bradycardia | FAERS: 5 | OFFSIDES US FAERS | |
| 87 | Burning sensation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 88 | Chloropsia | FAERS: 5 | OFFSIDES US FAERS | |
| 89 | Dehydration | FAERS: 5 | US FAERS | |
| 90 | Depressed mood | FAERS: 5 | US FAERS | |
| 91 | Disorientation | FAERS: 5 | US FAERS | |
| 92 | Dysgeusia | FAERS: 5 | US FAERS | |
| 93 | Feeling jittery | FAERS: 5 | US FAERS | |
| 94 | Genital erythema | FAERS: 5 | OFFSIDES US FAERS | |
| 95 | Hemiparesis | FAERS: 5 | US FAERS | |
| 96 | Medication Error | FAERS: 5 | US FAERS | |
| 97 | Vitreous floaters | FAERS: 5 | US FAERS | |
| 98 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 99 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 100 | Drug administration error | FAERS: 4 | US FAERS | |
| 101 | Genital pain | FAERS: 4 | OFFSIDES US FAERS | |
| 102 | Head discomfort | FAERS: 4 | US FAERS | |
| 103 | Joint swelling | FAERS: 4 | US FAERS | |
| 104 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 105 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 106 | Nervousness | FAERS: 4 | US FAERS | |
| 107 | Optic Neuritis | FAERS: 4 | US FAERS | |
| 108 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 109 | Pre-existing condition improved | FAERS: 4 | OFFSIDES US FAERS | |
| 110 | Presyncope | FAERS: 4 | US FAERS | |
| 111 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 112 | Semen volume increased | FAERS: 4 | OFFSIDES US FAERS | |
| 113 | Swelling | FAERS: 4 | US FAERS | |
| 114 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 115 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 116 | Accidental exposure | FAERS: 3 | US FAERS | |
| 117 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 118 | Aspermia | FAERS: 3 | OFFSIDES US FAERS | |
| 119 | Blood creatine phosphokinase increased | FAERS: 3 | SIDER US FAERS | |
| 120 | Blood follicle stimulating hormone increased | FAERS: 3 | OFFSIDES US FAERS | |
| 121 | Blood testosterone increased | FAERS: 3 | US FAERS | |
| 122 | Choking sensation | FAERS: 3 | US FAERS | |
| 123 | Conjunctivitis | FAERS: 3 | SIDER US FAERS | |
| 124 | Constipation | FAERS: 3 | US FAERS | |
| 125 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 126 | Disease recurrence | FAERS: 3 | US FAERS | |
| 127 | Drug effect delayed | FAERS: 3 | US FAERS | |
| 128 | Drug therapy changed | FAERS: 3 | OFFSIDES US FAERS | |
| 129 | Ear discomfort | FAERS: 3 | US FAERS | |
| 130 | Emotional distress | FAERS: 3 | OFFSIDES US FAERS | |
| 131 | Enuresis | FAERS: 3 | OFFSIDES US FAERS | |
| 132 | Eructation | FAERS: 3 | US FAERS | |
| 133 | Essential Tremor | FAERS: 3 | US FAERS | |
| 134 | Extra dose administered | FAERS: 3 | US FAERS | |
| 135 | Eye Redness | FAERS: 3 | SIDER US FAERS | |
| 136 | Genital discomfort | FAERS: 3 | US FAERS | |
| 137 | Global Amnesia | FAERS: 3 | OFFSIDES US FAERS | |
| 138 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 139 | Hypertrichosis | FAERS: 3 | OFFSIDES US FAERS | |
| 140 | Impaired work ability | FAERS: 3 | US FAERS | |
| 141 | Lipoprotein (a) increased | FAERS: 3 | US FAERS | |
| 142 | Middle insomnia | FAERS: 3 | US FAERS | |
| 143 | Musculoskeletal discomfort | FAERS: 3 | SIDER US FAERS | |
| 144 | Neck Pain | FAERS: 3 | SIDER US FAERS | |
| 145 | Overdose | FAERS: 3 | US FAERS | |
| 146 | Pain of skin | FAERS: 3 | US FAERS | |
| 147 | Paraesthesia of genital male | FAERS: 3 | US FAERS | |
| 148 | Pregnancy of partner | FAERS: 3 | US FAERS | |
| 149 | Product use issue | FAERS: 3 | US FAERS | |
| 150 | Scotoma | FAERS: 3 | SIDER US FAERS | |
| 151 | Skin irritation | FAERS: 3 | US FAERS | |
| 152 | Skin nodule | FAERS: 3 | US FAERS | |
| 153 | Sudden death | FAERS: 3 | US FAERS | |
| 154 | Tachyphylaxis | FAERS: 3 | OFFSIDES US FAERS | |
| 155 | Trismus | FAERS: 3 | US FAERS | |
| 156 | Unexpected therapeutic drug effect | FAERS: 3 | OFFSIDES US FAERS | |
| 157 | Urinary hesitation | FAERS: 3 | US FAERS | |
| 158 | Urine flow decreased | FAERS: 3 | US FAERS | |
| 159 | Weight decreased | FAERS: 3 | US FAERS | |
| 160 | Xanthopsia | FAERS: 3 | US FAERS | |
| 161 | prostatitis | FAERS: 3 | OFFSIDES US FAERS | |
| 162 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 163 | Activities of daily living impaired | FAERS: 2 | OFFSIDES US FAERS | |
| 164 | Amaurosis Fugax | FAERS: 2 | OFFSIDES US FAERS | |
| 165 | Amaurosis | FAERS: 2 | US FAERS | |
| 166 | Anhedonia | FAERS: 2 | US FAERS | |
| 167 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 168 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 169 | Balanoposthitis | FAERS: 2 | US FAERS | |
| 170 | Blood creatine phosphokinase MM increased | FAERS: 2 | OFFSIDES US FAERS | |
| 171 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 172 | Bone pain | FAERS: 2 | US FAERS | |
| 173 | Bronchospasm | FAERS: 2 | US FAERS | |
| 174 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 175 | Dehydroepiandrosterone increased | FAERS: 2 | OFFSIDES US FAERS | |
| 176 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 177 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 178 | Drug diversion | FAERS: 2 | US FAERS | |
| 179 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 180 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 181 | Drug screen positive | FAERS: 2 | US FAERS | |
| 182 | Dysarthria | FAERS: 2 | US FAERS | |
| 183 | Dyspareunia | FAERS: 2 | US FAERS | |
| 184 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 185 | Epilepsy | FAERS: 2 | US FAERS | |
| 186 | Excessive masturbation | FAERS: 2 | OFFSIDES US FAERS | |
| 187 | Frustration | FAERS: 2 | US FAERS | |
| 188 | Gastric pH decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 189 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 190 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 191 | Genital rash | FAERS: 2 | US FAERS | |
| 192 | Glaucoma | FAERS: 2 | SIDER US FAERS | |
| 193 | Glossitis | FAERS: 2 | US FAERS | |
| 194 | Hemiplegia | FAERS: 2 | US FAERS | |
| 195 | Hypertrophy | FAERS: 2 | US FAERS | |
| 196 | Hypoventilation | FAERS: 2 | US FAERS | |
| 197 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 198 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 199 | Incontinence | FAERS: 2 | US FAERS | |
| 200 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 201 | Influenza | FAERS: 2 | SIDER US FAERS | |
| 202 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 203 | Male Orgasmic Disorder | FAERS: 2 | US FAERS | |
| 204 | Monoplegia | FAERS: 2 | OFFSIDES US FAERS | |
| 205 | Muscle tightness | FAERS: 2 | US FAERS | |
| 206 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 207 | Nasal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 208 | Neuropathy | FAERS: 2 | US FAERS | |
| 209 | No adverse effect | FAERS: 2 | US FAERS | |
| 210 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 211 | Ocular discomfort | FAERS: 2 | SIDER US FAERS | |
| 212 | Ocular vascular disorder | FAERS: 2 | US FAERS | |
| 213 | Orgasmic sensation decreased | FAERS: 2 | US FAERS | |
| 214 | Otitis Externa | FAERS: 2 | US FAERS | |
| 215 | Penile size reduced | FAERS: 2 | US FAERS | |
| 216 | Perineal pain | FAERS: 2 | US FAERS | |
| 217 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 218 | Pneumonia | FAERS: 2 | US FAERS | |
| 219 | Portal Vein Thrombosis | FAERS: 2 | US FAERS | |
| 220 | Product packaging issue | FAERS: 2 | US FAERS | |
| 221 | Rash erythematous | FAERS: 2 | US FAERS | |
| 222 | Retrograde amnesia | FAERS: 2 | US FAERS | |
| 223 | Scrotal irritation | FAERS: 2 | OFFSIDES US FAERS | |
| 224 | Semen viscosity increased | FAERS: 2 | US FAERS | |
| 225 | Semen volume decreased | FAERS: 2 | US FAERS | |
| 226 | Sinusitis | FAERS: 2 | SIDER US FAERS | |
| 227 | Transmission of drug via semen | FAERS: 2 | US FAERS | |
| 228 | Varicophlebitis | FAERS: 2 | OFFSIDES US FAERS | |
| 229 | Visual acuity reduced transiently | FAERS: 2 | US FAERS | |
| 230 | jaundice | FAERS: 2 | US FAERS | |
| 231 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 232 | Abasia | FAERS: 1 | US FAERS | |
| 233 | Accidental overdose | FAERS: 1 | US FAERS | |
| 234 | Acute Coronary Syndrome | FAERS: 1 | SIDER US FAERS | |
| 235 | Alopecia | FAERS: 1 | US FAERS | |
| 236 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 237 | Anencephaly | FAERS: 1 | US FAERS | |
| 238 | Anger | FAERS: 1 | US FAERS | |
| 239 | Angioedema | FAERS: 1 | SIDER US FAERS | |
| 240 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 241 | Aphagia | FAERS: 1 | US FAERS | |
| 242 | Aphasia | FAERS: 1 | US FAERS | |
| 243 | Arthritis | FAERS: 1 | US FAERS | |
| 244 | Asthenopia | FAERS: 1 | US FAERS | |
| 245 | Astigmatism | FAERS: 1 | US FAERS | |
| 246 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 247 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 248 | Blepharitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 249 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 250 | Blood creatinine increased | FAERS: 1 | SIDER US FAERS | |
| 251 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 252 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 253 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 254 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 255 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 256 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 257 | Cheilitis | FAERS: 1 | US FAERS | |
| 258 | Chemical burn of respiratory tract | FAERS: 1 | US FAERS | |
| 259 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 260 | Clumsiness | FAERS: 1 | US FAERS | |
| 261 | Coital bleeding | FAERS: 1 | US FAERS | |
| 262 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 263 | Crying | FAERS: 1 | US FAERS | |
| 264 | Deafness Permanent | FAERS: 1 | US FAERS | |
| 265 | Delirium | FAERS: 1 | US FAERS | |
| 266 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 267 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 268 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 269 | Dysphasia | FAERS: 1 | OFFSIDES US FAERS | |
| 270 | Electrocardiogram J wave abnormal | FAERS: 1 | US FAERS | |
| 271 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 272 | Expired drug administered | FAERS: 1 | US FAERS | |
| 273 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 274 | Exposure via partner | FAERS: 1 | US FAERS | |
| 275 | Eye irritation | FAERS: 1 | SIDER US FAERS | |
| 276 | Food Poisoning | FAERS: 1 | US FAERS | |
| 277 | Foreign body sensation in eyes | FAERS: 1 | OFFSIDES US FAERS | |
| 278 | Gangrene | FAERS: 1 | OFFSIDES US FAERS | |
| 279 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 280 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 281 | Genital contusion | FAERS: 1 | US FAERS | |
| 282 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 283 | Gout | FAERS: 1 | US FAERS | |
| 284 | Growth retardation | FAERS: 1 | US FAERS | |
| 285 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 286 | Hirsutism | FAERS: 1 | US FAERS | |
| 287 | Homicide | FAERS: 1 | US FAERS | |
| 288 | Hyperacusis | FAERS: 1 | US FAERS | |
| 289 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 290 | Hypervigilance | FAERS: 1 | US FAERS | |
| 291 | Implantable defibrillator malfunction | FAERS: 1 | US FAERS | |
| 292 | In-stent coronary artery restenosis | FAERS: 1 | US FAERS | |
| 293 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 294 | Inflammation | FAERS: 1 | US FAERS | |
| 295 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 296 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 297 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 298 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 299 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 300 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 301 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 302 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 303 | Lethargy | FAERS: 1 | US FAERS | |
| 304 | Libido disorder | FAERS: 1 | US FAERS | |
| 305 | Ligament rupture | FAERS: 1 | US FAERS | |
| 306 | Limb discomfort | FAERS: 1 | US FAERS | |
| 307 | Liver Abscess | FAERS: 1 | US FAERS | |
| 308 | Lymphocele | FAERS: 1 | OFFSIDES US FAERS | |
| 309 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 310 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 311 | Memory impairment | FAERS: 1 | US FAERS | |
| 312 | Mental impairment | FAERS: 1 | US FAERS | |
| 313 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 314 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 315 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 316 | Muscle Rigidity | FAERS: 1 | SIDER US FAERS | |
| 317 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 318 | Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 319 | Night sweats | FAERS: 1 | US FAERS | |
| 320 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 321 | Nocturia | FAERS: 1 | US FAERS | |
| 322 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 323 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 324 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 325 | Orchitis noninfective | FAERS: 1 | US FAERS | |
| 326 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 327 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 328 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 329 | Penile contusion | FAERS: 1 | US FAERS | |
| 330 | Penile swelling | FAERS: 1 | US FAERS | |
| 331 | Performance status decreased | FAERS: 1 | US FAERS | |
| 332 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 333 | Pleurisy | FAERS: 1 | US FAERS | |
| 334 | Polyuria | FAERS: 1 | US FAERS | |
| 335 | Pregnancy | FAERS: 1 | US FAERS | |
| 336 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 337 | Procedural complication | FAERS: 1 | US FAERS | |
| 338 | Proctitis | FAERS: 1 | US FAERS | |
| 339 | Product counterfeit | FAERS: 1 | US FAERS | |
| 340 | Product shape issue | FAERS: 1 | US FAERS | |
| 341 | Product supply issue | FAERS: 1 | US FAERS | |
| 342 | Prostatectomy | FAERS: 1 | US FAERS | |
| 343 | Radical prostatectomy | FAERS: 1 | US FAERS | |
| 344 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 345 | Restlessness | FAERS: 1 | US FAERS | |
| 346 | Retinal migraine | FAERS: 1 | OFFSIDES US FAERS | |
| 347 | Retrograde ejaculation | FAERS: 1 | US FAERS | |
| 348 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 349 | Semen viscosity abnormal | FAERS: 1 | US FAERS | |
| 350 | Sinus headache | FAERS: 1 | SIDER US FAERS | |
| 351 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 352 | Skin discomfort | FAERS: 1 | US FAERS | |
| 353 | Skin lesion | FAERS: 1 | US FAERS | |
| 354 | Sneezing | FAERS: 1 | US FAERS | |
| 355 | Snoring | FAERS: 1 | US FAERS | |
| 356 | Tachyarrhythmia | FAERS: 1 | SIDER US FAERS | |
| 357 | Tension | FAERS: 1 | US FAERS | |
| 358 | Testicular hypertrophy | FAERS: 1 | US FAERS | |
| 359 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 360 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 361 | Thermal burn | FAERS: 1 | US FAERS | |
| 362 | Thirst | FAERS: 1 | US FAERS | |
| 363 | Throat irritation | FAERS: 1 | US FAERS | |
| 364 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 365 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 366 | Urethritis | FAERS: 1 | US FAERS | |
| 367 | Urinary Retention | FAERS: 1 | US FAERS | |
| 368 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 369 | Vascular rupture | FAERS: 1 | OFFSIDES US FAERS | |
| 370 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 371 | Ventricular arrhythmia | FAERS: 1 | SIDER US FAERS | |
| 372 | Visual brightness | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 373 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 374 | Wheelchair user | FAERS: 1 | US FAERS | |
| 375 | Wheezing | FAERS: 1 | US FAERS | |
| 376 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 377 | Abnormal ejaculation | SIDER | ||
| 378 | Abnormal vision | SIDER | ||
| 379 | Acquired diaphragmatic eventration | OFFSIDES | ||
| 380 | Acromegaly | OFFSIDES | ||
| 381 | Agnosia | OFFSIDES | ||
| 382 | Alanine Aminotransferase Increased | SIDER | ||
| 383 | Alanine aminotransferase abnormal | OFFSIDES | ||
| 384 | Alcohol poisoning | OFFSIDES | ||
| 385 | Amblyopia | OFFSIDES | ||
| 386 | Amimia | OFFSIDES | ||
| 387 | Anaphylactic shock | SIDER | ||
| 388 | Anastomotic complication | OFFSIDES | ||
| 389 | Angioplasty | OFFSIDES | ||
| 390 | Antiphospholipid Syndrome | OFFSIDES | ||
| 391 | Arteriosclerosis | OFFSIDES | ||
| 392 | Aspartate Aminotransferase Increased | SIDER | ||
| 393 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 394 | Atherosclerosis | OFFSIDES | ||
| 395 | Atrial tachycardia | OFFSIDES | ||
| 396 | Autonomic neuropathy | OFFSIDES | ||
| 397 | Blood albumin abnormal | OFFSIDES | ||
| 398 | Blood albumin | OFFSIDES | ||
| 399 | Blood alkaline phosphatase | OFFSIDES | ||
| 400 | Blood gases abnormal | OFFSIDES | ||
| 401 | Blood phosphorus | OFFSIDES | ||
| 402 | Blood potassium increased | OFFSIDES | ||
| 403 | Brain scan abnormal | OFFSIDES | ||
| 404 | Bronchitis | OFFSIDES | ||
| 405 | Bruxism | OFFSIDES | ||
| 406 | Cardiac valve abscess | OFFSIDES | ||
| 407 | Cerebral sarcoidosis | OFFSIDES | ||
| 408 | Color blindness | OFFSIDES | ||
| 409 | Color vision change | SIDER | ||
| 410 | Congenital cystic kidney disease | OFFSIDES | ||
| 411 | Congenital hypertrichosis | OFFSIDES | ||
| 412 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 413 | Connective tissue inflammation | OFFSIDES | ||
| 414 | Contact Dermatitis | OFFSIDES | ||
| 415 | Creatine Phosphokinase Increased | SIDER | ||
| 416 | Creatinine increased | SIDER | ||
| 417 | Creutzfeldt-Jakob disease | OFFSIDES | ||
| 418 | Debridement | OFFSIDES | ||
| 419 | Demyelination | OFFSIDES | ||
| 420 | Dermatitis | SIDER | ||
| 421 | Diabetes Insipidus | OFFSIDES | ||
| 422 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 423 | Diabetic Autonomic Neuropathy | OFFSIDES | ||
| 424 | Drug withdrawal headache | OFFSIDES | ||
| 425 | Dry skin | OFFSIDES | ||
| 426 | Ear and labyrinth disorders | SIDER | ||
| 427 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 428 | Electromechanical dissociation | OFFSIDES | ||
| 429 | Endodontic procedure | OFFSIDES | ||
| 430 | Endophthalmitis | SIDER | ||
| 431 | Epicondylitis | OFFSIDES | ||
| 432 | Epididymitis | OFFSIDES | ||
| 433 | Exfoliative rash | OFFSIDES | ||
| 434 | Feeling of body temperature change | OFFSIDES | ||
| 435 | Fistula discharge | OFFSIDES | ||
| 436 | Fluid overload | OFFSIDES | ||
| 437 | Gambling | OFFSIDES | ||
| 438 | Gastroduodenitis | OFFSIDES | ||
| 439 | Gingival Hyperplasia | OFFSIDES | ||
| 440 | Granulocytosis | OFFSIDES | ||
| 441 | Haemoconcentration | OFFSIDES | ||
| 442 | Head titubation | OFFSIDES | ||
| 443 | Hepatic Vein Thrombosis | OFFSIDES | ||
| 444 | Hepatic congestion | OFFSIDES | ||
| 445 | Hiccough | OFFSIDES | ||
| 446 | House dust allergy | OFFSIDES | ||
| 447 | Hypoaesthesia facial | OFFSIDES | ||
| 448 | Hypophagia | OFFSIDES | ||
| 449 | Increased upper airway secretion | OFFSIDES | ||
| 450 | Infection | SIDER | ||
| 451 | Infestation | SIDER | ||
| 452 | Iritis | OFFSIDES | ||
| 453 | Keratitis sicca | OFFSIDES | ||
| 454 | Left atrial dilatation | OFFSIDES | ||
| 455 | Life expectancy shortened | OFFSIDES | ||
| 456 | Loose tooth | OFFSIDES | ||
| 457 | Lower respiratory tract infection bacterial | OFFSIDES | ||
| 458 | Lymphangitis | OFFSIDES | ||
| 459 | Mastication disorder | OFFSIDES | ||
| 460 | Mastoiditis | OFFSIDES | ||
| 461 | Nicotine Dependence | OFFSIDES | ||
| 462 | Nipple pain | OFFSIDES | ||
| 463 | Norepinephrine increased | OFFSIDES | ||
| 464 | Obstruction | OFFSIDES | ||
| 465 | Orchitis | OFFSIDES | ||
| 466 | Orthopnea | OFFSIDES | ||
| 467 | Osteomyelitis | OFFSIDES | ||
| 468 | Pancreatic Pseudocyst | OFFSIDES | ||
| 469 | Pancreatitis | OFFSIDES | ||
| 470 | Penile blister | OFFSIDES | ||
| 471 | Peripheral embolism | OFFSIDES | ||
| 472 | Personality Change | OFFSIDES | ||
| 473 | Phlebitis | OFFSIDES | ||
| 474 | Photodermatosis | OFFSIDES | ||
| 475 | Primary sequestrum | OFFSIDES | ||
| 476 | Productive Cough | OFFSIDES | ||
| 477 | Promotion of peripheral circulation | OFFSIDES | ||
| 478 | Pulmonary Hypertension | OFFSIDES | ||
| 479 | Purulence | OFFSIDES | ||
| 480 | Rales | OFFSIDES | ||
| 481 | Redness | SIDER | ||
| 482 | Renal tubular necrosis | OFFSIDES | ||
| 483 | Retinal infarction | OFFSIDES | ||
| 484 | Rhinorrhea | OFFSIDES | ||
| 485 | Scleral pigmentation | OFFSIDES | ||
| 486 | Secondary hypothyroidism | OFFSIDES | ||
| 487 | Semen viscosity | OFFSIDES | ||
| 488 | Septic phlebitis | OFFSIDES | ||
| 489 | Shock | SIDER | ||
| 490 | Sick Sinus Syndrome | OFFSIDES | ||
| 491 | Sinus operation | OFFSIDES | ||
| 492 | Sinus pain | SIDER | ||
| 493 | Soft Tissue Injuries | OFFSIDES | ||
| 494 | Splenic Infarction | OFFSIDES | ||
| 495 | Starvation | OFFSIDES | ||
| 496 | Sudden Cardiac Death | SIDER | ||
| 497 | Sweating | SIDER | ||
| 498 | Testicular mass | OFFSIDES | ||
| 499 | Thalamic infarction | OFFSIDES | ||
| 500 | Tooth Extraction | OFFSIDES | ||
| 501 | Tooth Infection | OFFSIDES | ||
| 502 | Unspecified visual loss | SIDER | ||
| 503 | Violence-related symptom | OFFSIDES | ||
| 504 | Visual colour distortions | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.