Sumatriptan
(PORMUFZNYQJOEI-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)CCC(=O)O.CNS(=O)(=O)Cc1ccc2c(c1)c(CCN(C)C)c[nH]2
- Molecular Formula:
- C18H27N3O6S
- Molecular Weight:
- 413.488
- Log P:
- 2.7287
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 4
- TPSA:
- 148.18
- CAS Number(s):
- 103628-48-4
Synonym(s)
1.
Sumatriptan
2.
3-(2-(Dimethylamino)ethyl)-N-methyl-1H-indole-5-methanesulfonamide
3.
GR-43175
4.
Imigran
5.
Sumatriptan Succinate
6.
GR 43175
7.
GR43175
8.
Succinate, Sumatriptan
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 1425 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 2 | Device malfunction | FAERS: 444 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 3 | Injection site pain | FAERS: 276 | US FAERS | |
| 4 | Pharmaceutical product complaint | FAERS: 266 | US FAERS | |
| 5 | Headache | FAERS: 257 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 6 | Nausea | FAERS: 246 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 7 | Product quality issue | FAERS: 239 | US FAERS | |
| 8 | Accidental exposure to product | FAERS: 220 | US FAERS | |
| 9 | Vomiting | FAERS: 159 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 10 | Drug dose omission | FAERS: 129 | US FAERS | |
| 11 | Chest discomfort | FAERS: 119 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 12 | Dizziness | FAERS: 119 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 13 | Chest Pain | FAERS: 117 Canada Vigilance: 27 | Canada Vigilance US FAERS | |
| 14 | Malaise | FAERS: 111 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 15 | Injection site bruising | FAERS: 93 | US FAERS | |
| 16 | Product substitution issue | FAERS: 87 | US FAERS | |
| 17 | Pain | FAERS: 81 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 18 | Feeling abnormal | FAERS: 79 | US FAERS | |
| 19 | Incorrect dose administered by device | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Myocardial Infarction | FAERS: 71 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Somnolence | FAERS: 71 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 22 | Drug administration error | FAERS: 60 | US FAERS | |
| 23 | Palpitations | FAERS: 60 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 24 | Adverse event | FAERS: 57 | US FAERS | |
| 25 | Incorrect route of drug administration | FAERS: 56 | US FAERS | |
| 26 | Injection site urticaria | FAERS: 56 | US FAERS | |
| 27 | Fatigue | FAERS: 53 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 28 | Wrong technique in product usage process | FAERS: 51 | US FAERS | |
| 29 | Medication Error | FAERS: 50 | US FAERS | |
| 30 | Hypersensitivity | FAERS: 47 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 31 | Muscle tightness | FAERS: 46 | US FAERS | |
| 32 | Drug exposure during pregnancy | FAERS: 45 | US FAERS | |
| 33 | Anxiety | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Burning sensation | FAERS: 44 | US FAERS | |
| 35 | Urticaria | FAERS: 44 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 36 | Asthenia | FAERS: 42 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 37 | Dysgeusia | FAERS: 42 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 38 | Drug administered at inappropriate site | FAERS: 39 | US FAERS | |
| 39 | Injection site erythema | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Product complaint | FAERS: 38 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 41 | Cerebrovascular accident | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Overdose | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Myalgia | FAERS: 34 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 44 | Neck Pain | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 45 | Abdominal discomfort | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 46 | Flushing | FAERS: 33 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 47 | Device use error | FAERS: 29 | US FAERS | |
| 48 | Tremor | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Arthralgia | FAERS: 27 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 50 | Drug effect incomplete | FAERS: 27 | US FAERS | |
| 51 | Injection site injury | FAERS: 27 | US FAERS | |
| 52 | Product dose omission | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Wrong technique in drug usage process | FAERS: 23 | US FAERS | |
| 54 | Device leakage | FAERS: 20 | US FAERS | |
| 55 | Pruritus | FAERS: 20 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 56 | Amnesia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Injection site irritation | FAERS: 19 | US FAERS | |
| 58 | Therapeutic response delayed | FAERS: 19 | US FAERS | |
| 59 | Drug Dependence | FAERS: 18 | US FAERS | |
| 60 | Injection site laceration | FAERS: 18 | US FAERS | |
| 61 | Erythema | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Musculoskeletal stiffness | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Product packaging issue | FAERS: 16 | US FAERS | |
| 64 | Therapeutic response unexpected with drug substitution | FAERS: 16 | US FAERS | |
| 65 | Cardiac Arrest | FAERS: 15 | US FAERS | |
| 66 | Expired product administered | FAERS: 15 | US FAERS | |
| 67 | Injection Site Reaction | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 68 | Therapeutic response unexpected | FAERS: 15 | US FAERS | |
| 69 | Blindness | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 70 | Disability | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Head discomfort | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Hemiplegia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Incorrect dose administered | FAERS: 14 | US FAERS | |
| 74 | Abdominal Pain | FAERS: 13 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 75 | Impaired work ability | FAERS: 13 | US FAERS | |
| 76 | Nervousness | FAERS: 13 | US FAERS | |
| 77 | No adverse event | FAERS: 13 | US FAERS | |
| 78 | Device Failure | FAERS: 12 | US FAERS | |
| 79 | Disorientation | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Drug abuser | FAERS: 12 | US FAERS | |
| 81 | Dyspepsia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Epistaxis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Eye irritation | FAERS: 12 | US FAERS | |
| 84 | Inappropriate schedule of drug administration | FAERS: 12 | US FAERS | |
| 85 | Visual Impairment | FAERS: 12 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 86 | Cerebral Infarction | FAERS: 11 | US FAERS | |
| 87 | Eye pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Musculoskeletal Pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Nasal discomfort | FAERS: 11 | US FAERS | |
| 90 | Needle issue | FAERS: 11 | US FAERS | |
| 91 | Stress | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Temperature intolerance | FAERS: 11 | US FAERS | |
| 93 | Tinnitus | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Angina Pectoris | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 95 | Aphasia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Device deployment issue | FAERS: 10 | US FAERS | |
| 97 | Expired drug administered | FAERS: 10 | US FAERS | |
| 98 | Oropharyngeal pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Swelling | FAERS: 10 | US FAERS | |
| 100 | Tachycardia | FAERS: 10 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 101 | Acute myocardial infarction | FAERS: 9 | US FAERS | |
| 102 | Atrial Fibrillation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Drug effect delayed | FAERS: 9 | US FAERS | |
| 104 | Injection site burning | FAERS: 9 | US FAERS | |
| 105 | Memory impairment | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 106 | Pharyngolaryngeal Pain | FAERS: 9 | US FAERS | |
| 107 | Photophobia | FAERS: 9 | US FAERS | |
| 108 | Syncope | FAERS: 9 | US FAERS | |
| 109 | Throat irritation | FAERS: 9 | US FAERS | |
| 110 | Agitation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Asthma | FAERS: 8 | US FAERS | |
| 112 | Back Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Cataract | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Chills | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Deafness | FAERS: 8 | US FAERS | |
| 116 | Electrocardiogram change | FAERS: 8 | US FAERS | |
| 117 | Injection site mass | FAERS: 8 | US FAERS | |
| 118 | Injury associated with device | FAERS: 8 | US FAERS | |
| 119 | Intentional drug misuse | FAERS: 8 | US FAERS | |
| 120 | Unevaluable event | FAERS: 8 | US FAERS | |
| 121 | Vertigo | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Accidental exposure | FAERS: 7 | US FAERS | |
| 123 | Angioedema | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 124 | Arthritis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Bedridden | FAERS: 7 | US FAERS | |
| 126 | Bradycardia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 127 | Cluster Headache | FAERS: 7 | US FAERS | |
| 128 | Depressed Level of Consciousness | FAERS: 7 | US FAERS | |
| 129 | Drug dispensing error | FAERS: 7 | US FAERS | |
| 130 | Dysarthria | FAERS: 7 | US FAERS | |
| 131 | Hemiparesis | FAERS: 7 | US FAERS | |
| 132 | Hypotension | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Impaired driving ability | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Injection site scar | FAERS: 7 | US FAERS | |
| 135 | Limb discomfort | FAERS: 7 | US FAERS | |
| 136 | Musculoskeletal discomfort | FAERS: 7 | US FAERS | |
| 137 | Nasopharyngitis | FAERS: 7 | US FAERS | |
| 138 | Product availability issue | FAERS: 7 | US FAERS | |
| 139 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 140 | Reversible cerebral vasoconstriction syndrome | FAERS: 7 | US FAERS | |
| 141 | Tension Headache | FAERS: 7 | US FAERS | |
| 142 | Vasospasm | FAERS: 7 | US FAERS | |
| 143 | Visual disturbance | FAERS: 7 | US FAERS | |
| 144 | Wrong technique in device usage process | FAERS: 7 | US FAERS | |
| 145 | Accidental needle stick | FAERS: 6 | US FAERS | |
| 146 | Arthropathy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Cardiac Flutter | FAERS: 6 | US FAERS | |
| 148 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 149 | Dependence | FAERS: 6 | US FAERS | |
| 150 | Device difficult to use | FAERS: 6 | US FAERS | |
| 151 | Discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 153 | Ejection Fraction Decreased | FAERS: 6 | US FAERS | |
| 154 | Euphoric mood | FAERS: 6 | US FAERS | |
| 155 | General physical health deterioration | FAERS: 6 | US FAERS | |
| 156 | Hyperacusis | FAERS: 6 | US FAERS | |
| 157 | Inability to afford medication | FAERS: 6 | US FAERS | |
| 158 | Incorrect route of product administration | FAERS: 6 | US FAERS | |
| 159 | Infection | FAERS: 6 | US FAERS | |
| 160 | Injection site discomfort | FAERS: 6 | US FAERS | |
| 161 | Injection site pruritus | FAERS: 6 | US FAERS | |
| 162 | Injection site stinging | FAERS: 6 | US FAERS | |
| 163 | Intentional product use issue | FAERS: 6 | US FAERS | |
| 164 | Lethargy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 166 | Meningitis | FAERS: 6 | US FAERS | |
| 167 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 168 | Product use issue | FAERS: 6 | US FAERS | |
| 169 | Unresponsive to stimuli | FAERS: 6 | US FAERS | |
| 170 | Alopecia | FAERS: 5 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 171 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 172 | Anosmia | FAERS: 5 | US FAERS | |
| 173 | Cerebral vasoconstriction | FAERS: 5 | US FAERS | |
| 174 | Cyanosis | FAERS: 5 | US FAERS | |
| 175 | Dehydration | FAERS: 5 | US FAERS | |
| 176 | Device breakage | FAERS: 5 | US FAERS | |
| 177 | Device defective | FAERS: 5 | US FAERS | |
| 178 | Device ineffective | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 179 | Drug abuse | FAERS: 5 | US FAERS | |
| 180 | Drug exposure via breast milk | FAERS: 5 | US FAERS | |
| 181 | Fibromyalgia | FAERS: 5 | US FAERS | |
| 182 | Foreign body trauma | FAERS: 5 | US FAERS | |
| 183 | Immobile | FAERS: 5 | US FAERS | |
| 184 | Incontinence | FAERS: 5 | US FAERS | |
| 185 | Injection site scab | FAERS: 5 | US FAERS | |
| 186 | Injection site vesicles | FAERS: 5 | US FAERS | |
| 187 | Intentional product misuse | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Irritable Bowel Syndrome | FAERS: 5 | US FAERS | |
| 189 | Laceration | FAERS: 5 | US FAERS | |
| 190 | Lip swelling | FAERS: 5 | US FAERS | |
| 191 | Lymphadenopathy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Medication overuse headache | FAERS: 5 | US FAERS | |
| 193 | Nonspecific reaction | FAERS: 5 | US FAERS | |
| 194 | Performance status decreased | FAERS: 5 | US FAERS | |
| 195 | Thrombosis | FAERS: 5 | US FAERS | |
| 196 | Weight decreased | FAERS: 5 | US FAERS | |
| 197 | Wheezing | FAERS: 5 | US FAERS | |
| 198 | Agonal death struggle | FAERS: 4 | US FAERS | |
| 199 | Aneurysm | FAERS: 4 | US FAERS | |
| 200 | Blood pressure immeasurable | FAERS: 4 | US FAERS | |
| 201 | Cataplexy | FAERS: 4 | US FAERS | |
| 202 | Choking | FAERS: 4 | US FAERS | |
| 203 | Cystitis | FAERS: 4 | US FAERS | |
| 204 | Drug Tolerance | FAERS: 4 | US FAERS | |
| 205 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 206 | Drug screen positive | FAERS: 4 | US FAERS | |
| 207 | Electrocardiogram abnormal | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 208 | Epilepsy | FAERS: 4 | US FAERS | |
| 209 | Expired device used | FAERS: 4 | US FAERS | |
| 210 | Glaucoma | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Injection site extravasation | FAERS: 4 | US FAERS | |
| 212 | Intracranial Aneurysm | FAERS: 4 | US FAERS | |
| 213 | Labile blood pressure | FAERS: 4 | US FAERS | |
| 214 | Lipoma | FAERS: 4 | US FAERS | |
| 215 | Medication residue | FAERS: 4 | US FAERS | |
| 216 | Overweight | FAERS: 4 | US FAERS | |
| 217 | Pain of skin | FAERS: 4 | US FAERS | |
| 218 | Pneumonia | FAERS: 4 | US FAERS | |
| 219 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 220 | Posterior reversible encephalopathy syndrome | FAERS: 4 | US FAERS | |
| 221 | Retching | FAERS: 4 | US FAERS | |
| 222 | Serotonin Syndrome | FAERS: 4 | US FAERS | |
| 223 | Sinusitis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 224 | Syringe issue | FAERS: 4 | US FAERS | |
| 225 | Trismus | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 226 | Vasculitis | FAERS: 4 | US FAERS | |
| 227 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 228 | treatment failure | FAERS: 4 | US FAERS | |
| 229 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 230 | Anger | FAERS: 3 | US FAERS | |
| 231 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 232 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 233 | Bone pain | FAERS: 3 | US FAERS | |
| 234 | Bruxism | FAERS: 3 | US FAERS | |
| 235 | Cardiac enzymes increased | FAERS: 3 | US FAERS | |
| 236 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 237 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 238 | Cerebellar infarction | FAERS: 3 | US FAERS | |
| 239 | Cold sweat | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 240 | Constipation | FAERS: 3 | US FAERS | |
| 241 | Crying | FAERS: 3 | US FAERS | |
| 242 | Device use issue | FAERS: 3 | US FAERS | |
| 243 | Emotional distress | FAERS: 3 | US FAERS | |
| 244 | Facial Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 245 | Feeling Cold | FAERS: 3 | US FAERS | |
| 246 | Feeling jittery | FAERS: 3 | US FAERS | |
| 247 | Flatulence | FAERS: 3 | US FAERS | |
| 248 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 249 | Hypokinesia | FAERS: 3 | US FAERS | |
| 250 | Hypoventilation | FAERS: 3 | US FAERS | |
| 251 | Influenza | FAERS: 3 | US FAERS | |
| 252 | Joint stiffness | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 253 | Medical device complication | FAERS: 3 | US FAERS | |
| 254 | Oropharyngeal swelling | FAERS: 3 | US FAERS | |
| 255 | Pallor | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Paresis | FAERS: 3 | US FAERS | |
| 257 | Product formulation issue | FAERS: 3 | US FAERS | |
| 258 | Product label issue | FAERS: 3 | US FAERS | |
| 259 | Product package associated injury | FAERS: 3 | US FAERS | |
| 260 | Product physical issue | FAERS: 3 | US FAERS | |
| 261 | Shock | FAERS: 3 | US FAERS | |
| 262 | Sinus headache | FAERS: 3 | US FAERS | |
| 263 | Sunburn | FAERS: 3 | US FAERS | |
| 264 | Troponin increased | FAERS: 3 | US FAERS | |
| 265 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 266 | Ventricular Dysfunction | FAERS: 3 | US FAERS | |
| 267 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 268 | Wolff-Parkinson-White Syndrome | FAERS: 3 | US FAERS | |
| 269 | Allodynia | FAERS: 2 | US FAERS | |
| 270 | Amimia | FAERS: 2 | US FAERS | |
| 271 | Anaphylactoid Reaction | FAERS: 2 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 272 | Apathy | FAERS: 2 | US FAERS | |
| 273 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 274 | Autoimmune thyroiditis | FAERS: 2 | US FAERS | |
| 275 | Autonomic Dysreflexia | FAERS: 2 | US FAERS | |
| 276 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 277 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 278 | Blood urine present | FAERS: 2 | US FAERS | |
| 279 | Breast tenderness | FAERS: 2 | US FAERS | |
| 280 | Cardiac discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 282 | Circumstance or information capable of leading to device use error | FAERS: 2 | US FAERS | |
| 283 | Contrast media allergy | FAERS: 2 | US FAERS | |
| 284 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 285 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 286 | Drug resistance | FAERS: 2 | US FAERS | |
| 287 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 288 | Drug withdrawal headache | FAERS: 2 | US FAERS | |
| 289 | Dysphonia | FAERS: 2 | US FAERS | |
| 290 | Economic problem | FAERS: 2 | US FAERS | |
| 291 | Ectopic Pregnancy | FAERS: 2 | US FAERS | |
| 292 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 293 | Elevated mood | FAERS: 2 | US FAERS | |
| 294 | Emergency Care | FAERS: 2 | US FAERS | |
| 295 | Emotional disorder | FAERS: 2 | US FAERS | |
| 296 | Encephalomalacia | FAERS: 2 | US FAERS | |
| 297 | Eosinophilic myocarditis | FAERS: 2 | US FAERS | |
| 298 | Exposure via skin contact | FAERS: 2 | US FAERS | |
| 299 | Facial Paresis | FAERS: 2 | US FAERS | |
| 300 | Food Allergy | FAERS: 2 | US FAERS | |
| 301 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 302 | Frustration | FAERS: 2 | US FAERS | |
| 303 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 304 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 305 | Heart sounds abnormal | FAERS: 2 | US FAERS | |
| 306 | Hyperkinesia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 308 | Hypoxia | FAERS: 2 | US FAERS | |
| 309 | Hysterectomy | FAERS: 2 | US FAERS | |
| 310 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 311 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 312 | Infertility | FAERS: 2 | US FAERS | |
| 313 | Injection site warmth | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Intermittent Claudication | FAERS: 2 | US FAERS | |
| 315 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 316 | Intranasal numbness | FAERS: 2 | US FAERS | |
| 317 | Limb injury | FAERS: 2 | US FAERS | |
| 318 | Lipoatrophy | FAERS: 2 | US FAERS | |
| 319 | Live Birth | FAERS: 2 | US FAERS | |
| 320 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 321 | Malignant Hypertension | FAERS: 2 | US FAERS | |
| 322 | Malnutrition | FAERS: 2 | US FAERS | |
| 323 | Menopause | FAERS: 2 | US FAERS | |
| 324 | Middle insomnia | FAERS: 2 | US FAERS | |
| 325 | Multiple allergies | FAERS: 2 | US FAERS | |
| 326 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 327 | Myocarditis | FAERS: 2 | US FAERS | |
| 328 | Neuralgia | FAERS: 2 | US FAERS | |
| 329 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 330 | Personality Change | FAERS: 2 | US FAERS | |
| 331 | Petechiae | FAERS: 2 | US FAERS | |
| 332 | Pituitary enlargement | FAERS: 2 | US FAERS | |
| 333 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 334 | Postoperative thrombosis | FAERS: 2 | US FAERS | |
| 335 | Pregnancy | FAERS: 2 | US FAERS | |
| 336 | Presyncope | FAERS: 2 | US FAERS | |
| 337 | Product blister packaging issue | FAERS: 2 | US FAERS | |
| 338 | Product label confusion | FAERS: 2 | US FAERS | |
| 339 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 340 | Product storage error | FAERS: 2 | US FAERS | |
| 341 | Product supply issue | FAERS: 2 | US FAERS | |
| 342 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 343 | Purpura | FAERS: 2 | US FAERS | |
| 344 | Rash erythematous | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 345 | Rebound effect | FAERS: 2 | US FAERS | |
| 346 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 347 | Sensation of blood flow | FAERS: 2 | US FAERS | |
| 348 | Sepsis | FAERS: 2 | US FAERS | |
| 349 | Skin reaction | FAERS: 2 | US FAERS | |
| 350 | Staring | FAERS: 2 | US FAERS | |
| 351 | Stillbirth | FAERS: 2 | US FAERS | |
| 352 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 353 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 354 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 355 | Thirst | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 356 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 357 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 358 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 359 | nervous system disorder | FAERS: 2 | US FAERS | |
| 360 | Abasia | FAERS: 1 | US FAERS | |
| 361 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 362 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 363 | Accidental overdose | FAERS: 1 | US FAERS | |
| 364 | Accidental underdose | FAERS: 1 | US FAERS | |
| 365 | Acute psychosis | FAERS: 1 | US FAERS | |
| 366 | Administration site bruise | FAERS: 1 | US FAERS | |
| 367 | Akinesia | FAERS: 1 | US FAERS | |
| 368 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 369 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 370 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 371 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 372 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 373 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 374 | Anorexia | FAERS: 1 | US FAERS | |
| 375 | Anuria | FAERS: 1 | US FAERS | |
| 376 | Appendicitis | FAERS: 1 | US FAERS | |
| 377 | Application site urticaria | FAERS: 1 | US FAERS | |
| 378 | Arthropod bite | FAERS: 1 | US FAERS | |
| 379 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 380 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 381 | Aura | FAERS: 1 | US FAERS | |
| 382 | Bladder pain | FAERS: 1 | US FAERS | |
| 383 | Blighted ovum | FAERS: 1 | US FAERS | |
| 384 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 385 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 386 | Blood blister | FAERS: 1 | US FAERS | |
| 387 | Blood caffeine | FAERS: 1 | US FAERS | |
| 388 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 389 | Blood ethanol | FAERS: 1 | US FAERS | |
| 390 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 391 | Blood potassium increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 392 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 393 | Breast engorgement | FAERS: 1 | US FAERS | |
| 394 | Breech Presentation | FAERS: 1 | US FAERS | |
| 395 | Bronchitis | FAERS: 1 | US FAERS | |
| 396 | Bronchospasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 397 | Cellulitis | FAERS: 1 | US FAERS | |
| 398 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 399 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 400 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 401 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 402 | Choking sensation | FAERS: 1 | US FAERS | |
| 403 | Chromaturia | FAERS: 1 | US FAERS | |
| 404 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 405 | Cleft Palate | FAERS: 1 | US FAERS | |
| 406 | Clumsiness | FAERS: 1 | US FAERS | |
| 407 | Complication associated with device | FAERS: 1 | US FAERS | |
| 408 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 409 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 410 | Congenital aqueductal stenosis | FAERS: 1 | US FAERS | |
| 411 | Conjunctivitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 412 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 413 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 414 | Corneal Scar | FAERS: 1 | US FAERS | |
| 415 | Delirium | FAERS: 1 | US FAERS | |
| 416 | Depressed mood | FAERS: 1 | US FAERS | |
| 417 | Device damage | FAERS: 1 | US FAERS | |
| 418 | Device occlusion | FAERS: 1 | US FAERS | |
| 419 | Device physical property issue | FAERS: 1 | US FAERS | |
| 420 | Diplopia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 421 | Disease Progression | FAERS: 1 | US FAERS | |
| 422 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 423 | Drug level increased | FAERS: 1 | US FAERS | |
| 424 | Dry skin | FAERS: 1 | US FAERS | |
| 425 | Dysphemia | FAERS: 1 | US FAERS | |
| 426 | Dystonia | FAERS: 1 | US FAERS | |
| 427 | Electrocardiogram poor R-wave progression | FAERS: 1 | US FAERS | |
| 428 | Embolism | FAERS: 1 | US FAERS | |
| 429 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 430 | Eosinophilia | FAERS: 1 | US FAERS | |
| 431 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 432 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 433 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 434 | Extra dose administered | FAERS: 1 | US FAERS | |
| 435 | Eye inflammation | FAERS: 1 | US FAERS | |
| 436 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 437 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 438 | Fibromuscular Dysplasia | FAERS: 1 | US FAERS | |
| 439 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 440 | Formication | FAERS: 1 | US FAERS | |
| 441 | Galactostasis | FAERS: 1 | US FAERS | |
| 442 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 443 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 444 | Gastrointestinal disorder congenital | FAERS: 1 | US FAERS | |
| 445 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 446 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 447 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 448 | Gastroschisis | FAERS: 1 | US FAERS | |
| 449 | Head titubation | FAERS: 1 | US FAERS | |
| 450 | Hepatitis | FAERS: 1 | US FAERS | |
| 451 | Hunger | FAERS: 1 | US FAERS | |
| 452 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 453 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 454 | Hypersomnia | FAERS: 1 | US FAERS | |
| 455 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 456 | Hyperventilation | FAERS: 1 | US FAERS | |
| 457 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 458 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 459 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 460 | Immediate post-injection reaction | FAERS: 1 | US FAERS | |
| 461 | Immunology test abnormal | FAERS: 1 | US FAERS | |
| 462 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 463 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 464 | Injection site atrophy | FAERS: 1 | US FAERS | |
| 465 | Injection site pallor | FAERS: 1 | US FAERS | |
| 466 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 467 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 468 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 469 | Joint swelling | FAERS: 1 | US FAERS | |
| 470 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 471 | Laryngitis | FAERS: 1 | US FAERS | |
| 472 | Latex allergy | FAERS: 1 | US FAERS | |
| 473 | Leukopenia | FAERS: 1 | US FAERS | |
| 474 | Ligament injury | FAERS: 1 | US FAERS | |
| 475 | Lipase abnormal | FAERS: 1 | US FAERS | |
| 476 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 477 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 478 | Lymphoma | FAERS: 1 | US FAERS | |
| 479 | Macular degeneration | FAERS: 1 | US FAERS | |
| 480 | Malabsorption | FAERS: 1 | US FAERS | |
| 481 | Mastectomy | FAERS: 1 | US FAERS | |
| 482 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 483 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 484 | Medication residue present | FAERS: 1 | US FAERS | |
| 485 | Mental impairment | FAERS: 1 | US FAERS | |
| 486 | Mental status changes | FAERS: 1 | US FAERS | |
| 487 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 488 | Mood swings | FAERS: 1 | US FAERS | |
| 489 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 490 | Muscle Spasticity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 491 | Muscle strain | FAERS: 1 | US FAERS | |
| 492 | Myocardial rupture | FAERS: 1 | US FAERS | |
| 493 | Neonatal aspiration | FAERS: 1 | US FAERS | |
| 494 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 495 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 496 | Nerve injury | FAERS: 1 | US FAERS | |
| 497 | Nipple pain | FAERS: 1 | US FAERS | |
| 498 | No adverse effect | FAERS: 1 | US FAERS | |
| 499 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 500 | Normal delivery | FAERS: 1 | US FAERS | |
| 501 | Nuclear magnetic resonance imaging neck | FAERS: 1 | US FAERS | |
| 502 | Onychoclasis | FAERS: 1 | US FAERS | |
| 503 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 504 | Pancreatitis | FAERS: 1 | US FAERS | |
| 505 | Pancytopenia | FAERS: 1 | US FAERS | |
| 506 | Panic Disorder | FAERS: 1 | US FAERS | |
| 507 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 508 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 509 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 510 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 511 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 512 | Pericarditis | FAERS: 1 | US FAERS | |
| 513 | Peripheral occlusive disease | FAERS: 1 | US FAERS | |
| 514 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 515 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 516 | Phonophobia | FAERS: 1 | US FAERS | |
| 517 | Poisoning | FAERS: 1 | US FAERS | |
| 518 | Polydipsia | FAERS: 1 | US FAERS | |
| 519 | Polyuria | FAERS: 1 | US FAERS | |
| 520 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 521 | Post procedural fistula | FAERS: 1 | US FAERS | |
| 522 | Post procedural pain | FAERS: 1 | US FAERS | |
| 523 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 524 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 525 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 526 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 527 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 528 | Procedural complication | FAERS: 1 | US FAERS | |
| 529 | Product coating issue | FAERS: 1 | US FAERS | |
| 530 | Product contamination | FAERS: 1 | US FAERS | |
| 531 | Product contamination physical | FAERS: 1 | US FAERS | |
| 532 | Product counterfeit | FAERS: 1 | US FAERS | |
| 533 | Product deposit | FAERS: 1 | US FAERS | |
| 534 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 535 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 536 | Product shape issue | FAERS: 1 | US FAERS | |
| 537 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 538 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 539 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 540 | Renal pain | FAERS: 1 | US FAERS | |
| 541 | Respiratory Therapy | FAERS: 1 | US FAERS | |
| 542 | Respiratory distress | FAERS: 1 | US FAERS | |
| 543 | Restlessness | FAERS: 1 | US FAERS | |
| 544 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 545 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 546 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 547 | Rhinalgia | FAERS: 1 | US FAERS | |
| 548 | Rhinitis | FAERS: 1 | US FAERS | |
| 549 | Salpingitis | FAERS: 1 | US FAERS | |
| 550 | Scleroderma | FAERS: 1 | US FAERS | |
| 551 | Serum Sickness | FAERS: 1 | US FAERS | |
| 552 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 553 | Sinus pain | FAERS: 1 | US FAERS | |
| 554 | Skin Induration | FAERS: 1 | US FAERS | |
| 555 | Skin laceration | FAERS: 1 | US FAERS | |
| 556 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 557 | Skin test positive | FAERS: 1 | US FAERS | |
| 558 | Sluggishness | FAERS: 1 | US FAERS | |
| 559 | Sneezing | FAERS: 1 | US FAERS | |
| 560 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 561 | Splenomegaly | FAERS: 1 | US FAERS | |
| 562 | Status Migrainosus | FAERS: 1 | US FAERS | |
| 563 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 564 | Stridor | FAERS: 1 | US FAERS | |
| 565 | Suicide attempt | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 566 | Suicide threat | FAERS: 1 | US FAERS | |
| 567 | Tension | FAERS: 1 | US FAERS | |
| 568 | Terminal state | FAERS: 1 | US FAERS | |
| 569 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 570 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 571 | Therapy cessation | FAERS: 1 | US FAERS | |
| 572 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 573 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 574 | Toothache | FAERS: 1 | US FAERS | |
| 575 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 576 | Transaminases increased | FAERS: 1 | US FAERS | |
| 577 | Trigeminal Nerve Disorder | FAERS: 1 | US FAERS | |
| 578 | Troponin I increased | FAERS: 1 | US FAERS | |
| 579 | Troponin T increased | FAERS: 1 | US FAERS | |
| 580 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 581 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 582 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 583 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 584 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 585 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 586 | Vaginal pain | FAERS: 1 | US FAERS | |
| 587 | Vein pain | FAERS: 1 | US FAERS | |
| 588 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 589 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 590 | Vertebral Artery Dissection | FAERS: 1 | US FAERS | |
| 591 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 592 | Walking aid user | FAERS: 1 | US FAERS | |
| 593 | Colitis | Canada Vigilance: 1 | Canada Vigilance | |
| 594 | Device material issue | Canada Vigilance: 1 | Canada Vigilance | |
| 595 | Diverticulum | Canada Vigilance: 1 | Canada Vigilance | |
| 596 | Facial paralysis | Canada Vigilance: 1 | Canada Vigilance | |
| 597 | Injection site inflammation | Canada Vigilance: 1 | Canada Vigilance | |
| 598 | Laryngospasm | Canada Vigilance: 4 | Canada Vigilance | |
| 599 | Optic Neuritis | Canada Vigilance: 1 | Canada Vigilance | |
| 600 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 601 | Pharyngitis | Canada Vigilance: 2 | Canada Vigilance | |
| 602 | Rales | Canada Vigilance: 1 | Canada Vigilance | |
| 603 | Torticollis | Canada Vigilance: 3 | Canada Vigilance | |
| 604 | Vocal Cord Paralysis | Canada Vigilance: 1 | Canada Vigilance | |
| 605 | jaundice | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.