Ezetimibe, Simvastatin Drug Combination
(PNAMDJVUJCJOIX-IUNFJCKHSA-N)
Structure
- SMILES
- Oc1ccc(cc1)[C@@H]1[C@@H](CC[C@@H](c2ccc(cc2)F)O)C(=O)N1c1ccc(cc1)F.CCC(C(=O)O[C@H]1C[C@@H](C)C=C2[C@H]1[C@@H](CC[C@@H]1C[C@@H](O)CC(=O)O1)[C@H](C=C2)C)(C)C
- Molecular Formula:
- C49H59F2NO8
- Molecular Weight:
- 827.991
- Log P:
- 9.5389
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 3
- TPSA:
- 133.6
- CAS Number(s):
- 444313-53-5
Synonym(s)
1.
Ezetimibe, Simvastatin Drug Combination
2.
Ezetimibe Simvastatin Drug Combination
3.
Ezetimibe-Simvastatin Combination
4.
Ezetimibe-Simvastatin Drug Combination
5.
Inegy
6.
Vytorin
7.
Combination, Ezetimibe-Simvastatin
8.
Combination, Ezetimibe-Simvastatin Drug
9.
Drug Combination, Ezetimibe-Simvastatin
10.
Ezetimibe Simvastatin Combination
External Link(s)
| MeSH | D000069499 |
| PubChem Compound | 9832423 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myalgia | FAERS: 258 | US FAERS | |
| 2 | Rhabdomyolysis | FAERS: 219 | US FAERS | |
| 3 | Pain | FAERS: 117 | 19167588 | CTD US FAERS |
| 4 | Blood creatine phosphokinase increased | FAERS: 103 | US FAERS | |
| 5 | Myocardial Infarction | FAERS: 98 | US FAERS | |
| 6 | Asthenia | FAERS: 83 | US FAERS | |
| 7 | Arthralgia | FAERS: 81 | US FAERS | |
| 8 | Cerebrovascular accident | FAERS: 78 | US FAERS | |
| 9 | Anxiety | FAERS: 62 | US FAERS | |
| 10 | Fatigue | FAERS: 56 | US FAERS | |
| 11 | Arteriosclerosis | FAERS: 55 | US FAERS | |
| 12 | No adverse event | FAERS: 55 | US FAERS | |
| 13 | Adverse event | FAERS: 51 | US FAERS | |
| 14 | Pancreatitis | FAERS: 51 | US FAERS | |
| 15 | Chest Pain | FAERS: 41 | US FAERS | |
| 16 | Nausea | FAERS: 41 | US FAERS | |
| 17 | Dizziness | FAERS: 38 | US FAERS | |
| 18 | Drug ineffective | FAERS: 34 | US FAERS | |
| 19 | Headache | FAERS: 32 | US FAERS | |
| 20 | Back Pain | FAERS: 29 | US FAERS | |
| 21 | Blood cholesterol increased | FAERS: 27 | US FAERS | |
| 22 | Drug dose omission | FAERS: 26 | US FAERS | |
| 23 | Malaise | FAERS: 25 | US FAERS | |
| 24 | Pruritus | FAERS: 24 | US FAERS | |
| 25 | Vomiting | FAERS: 24 | US FAERS | |
| 26 | Alanine Aminotransferase Increased | FAERS: 22 | US FAERS | |
| 27 | Hepatitis | FAERS: 20 | US FAERS | |
| 28 | Abasia | FAERS: 19 | US FAERS | |
| 29 | Abdominal Pain | FAERS: 19 | US FAERS | |
| 30 | Aspartate Aminotransferase Increased | FAERS: 19 | US FAERS | |
| 31 | muscle injury | FAERS: 19 | US FAERS | |
| 32 | Inappropriate schedule of drug administration | FAERS: 18 | US FAERS | |
| 33 | Memory impairment | FAERS: 18 | US FAERS | |
| 34 | Neck Pain | FAERS: 18 | US FAERS | |
| 35 | Amnesia | FAERS: 17 | US FAERS | |
| 36 | Activities of daily living impaired | FAERS: 16 | US FAERS | |
| 37 | Chromaturia | FAERS: 16 | US FAERS | |
| 38 | Feeling abnormal | FAERS: 16 | US FAERS | |
| 39 | Musculoskeletal Pain | FAERS: 16 | US FAERS | |
| 40 | Blood creatinine increased | FAERS: 15 | US FAERS | |
| 41 | Myopathy | FAERS: 14 | US FAERS | |
| 42 | Palpitations | FAERS: 14 | US FAERS | |
| 43 | Pneumonia | FAERS: 14 | US FAERS | |
| 44 | Cholelithiasis | FAERS: 13 | US FAERS | |
| 45 | Myositis | FAERS: 13 | US FAERS | |
| 46 | Product quality issue | FAERS: 13 | US FAERS | |
| 47 | Anorexia | FAERS: 12 | US FAERS | |
| 48 | Weight decreased | FAERS: 12 | US FAERS | |
| 49 | jaundice | FAERS: 12 | US FAERS | |
| 50 | Coronary Artery Disease | FAERS: 11 | US FAERS | |
| 51 | Medication Error | FAERS: 11 | US FAERS | |
| 52 | Arthritis | FAERS: 10 | US FAERS | |
| 53 | Joint swelling | FAERS: 10 | US FAERS | |
| 54 | Wrong technique in drug usage process | FAERS: 10 | US FAERS | |
| 55 | Abdominal discomfort | FAERS: 9 | US FAERS | |
| 56 | Alopecia | FAERS: 9 | US FAERS | |
| 57 | Arthropathy | FAERS: 9 | US FAERS | |
| 58 | Cholecystitis | FAERS: 9 | US FAERS | |
| 59 | Constipation | FAERS: 9 | US FAERS | |
| 60 | Dehydration | FAERS: 9 | US FAERS | |
| 61 | Musculoskeletal stiffness | FAERS: 9 | US FAERS | |
| 62 | Urticaria | FAERS: 9 | US FAERS | |
| 63 | Angina Pectoris | FAERS: 8 | US FAERS | |
| 64 | Blindness | FAERS: 8 | US FAERS | |
| 65 | Burning sensation | FAERS: 8 | US FAERS | |
| 66 | Chest discomfort | FAERS: 8 | US FAERS | |
| 67 | Dementia | FAERS: 8 | US FAERS | |
| 68 | Flatulence | FAERS: 8 | US FAERS | |
| 69 | Thrombocytopenia | FAERS: 8 | US FAERS | |
| 70 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 71 | Blood alkaline phosphatase increased | FAERS: 7 | US FAERS | |
| 72 | Cataract | FAERS: 7 | US FAERS | |
| 73 | Diabetes Mellitus | FAERS: 7 | US FAERS | |
| 74 | Discomfort | FAERS: 7 | US FAERS | |
| 75 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 76 | Impaired work ability | FAERS: 7 | US FAERS | |
| 77 | Rotator cuff syndrome | FAERS: 7 | US FAERS | |
| 78 | Syncope | FAERS: 7 | US FAERS | |
| 79 | Tremor | FAERS: 7 | US FAERS | |
| 80 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 81 | Blood triglycerides increased | FAERS: 6 | US FAERS | |
| 82 | Joint stiffness | FAERS: 6 | US FAERS | |
| 83 | Product substitution issue | FAERS: 6 | US FAERS | |
| 84 | Somnolence | FAERS: 6 | US FAERS | |
| 85 | Tooth Loss | FAERS: 6 | US FAERS | |
| 86 | Urinary tract infection | FAERS: 6 | US FAERS | |
| 87 | Visual disturbance | FAERS: 6 | US FAERS | |
| 88 | Aphasia | FAERS: 5 | US FAERS | |
| 89 | Blood cholesterol abnormal | FAERS: 5 | US FAERS | |
| 90 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 91 | Bone pain | FAERS: 5 | US FAERS | |
| 92 | Cutis Laxa | FAERS: 5 | US FAERS | |
| 93 | Deafness | FAERS: 5 | US FAERS | |
| 94 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 95 | Hepatic necrosis | FAERS: 5 | US FAERS | |
| 96 | Hypothyroidism | FAERS: 5 | US FAERS | |
| 97 | Influenza | FAERS: 5 | US FAERS | |
| 98 | Pancreatic carcinoma | FAERS: 5 | US FAERS | |
| 99 | Transaminases increased | FAERS: 5 | US FAERS | |
| 100 | Ascites | FAERS: 4 | US FAERS | |
| 101 | Asthma | FAERS: 4 | US FAERS | |
| 102 | Blood creatine phosphokinase MB increased | FAERS: 4 | US FAERS | |
| 103 | Diplopia | FAERS: 4 | US FAERS | |
| 104 | Diverticulitis | FAERS: 4 | US FAERS | |
| 105 | Erythema | FAERS: 4 | US FAERS | |
| 106 | Hepatitis B | FAERS: 4 | US FAERS | |
| 107 | Inflammation | FAERS: 4 | US FAERS | |
| 108 | Low density lipoprotein increased | FAERS: 4 | US FAERS | |
| 109 | Neuralgia | FAERS: 4 | US FAERS | |
| 110 | Overdose | FAERS: 4 | US FAERS | |
| 111 | Pancytopenia | FAERS: 4 | US FAERS | |
| 112 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 113 | Polymyalgia Rheumatica | FAERS: 4 | US FAERS | |
| 114 | Product use issue | FAERS: 4 | US FAERS | |
| 115 | Swelling | FAERS: 4 | US FAERS | |
| 116 | Throat irritation | FAERS: 4 | US FAERS | |
| 117 | Thrombosis | FAERS: 4 | US FAERS | |
| 118 | Ventricular hypertrophy | FAERS: 4 | US FAERS | |
| 119 | Vertigo | FAERS: 4 | US FAERS | |
| 120 | Visual Impairment | FAERS: 4 | US FAERS | |
| 121 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 122 | Aortic Aneurysm | FAERS: 3 | US FAERS | |
| 123 | Appendicitis | FAERS: 3 | US FAERS | |
| 124 | Blood creatine phosphokinase abnormal | FAERS: 3 | US FAERS | |
| 125 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 126 | Bradycardia | FAERS: 3 | US FAERS | |
| 127 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 128 | Choking | FAERS: 3 | US FAERS | |
| 129 | Crying | FAERS: 3 | US FAERS | |
| 130 | Depression suicidal | FAERS: 3 | US FAERS | |
| 131 | Diplegia | FAERS: 3 | US FAERS | |
| 132 | Diverticulum | FAERS: 3 | US FAERS | |
| 133 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 134 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 135 | Expired product administered | FAERS: 3 | US FAERS | |
| 136 | Fibromyalgia | FAERS: 3 | US FAERS | |
| 137 | Flank Pain | FAERS: 3 | US FAERS | |
| 138 | Gait inability | FAERS: 3 | US FAERS | |
| 139 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 140 | Gastritis | FAERS: 3 | US FAERS | |
| 141 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 142 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 143 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 144 | Gout | FAERS: 3 | US FAERS | |
| 145 | Hypotension | FAERS: 3 | US FAERS | |
| 146 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 147 | Joint Instability | FAERS: 3 | US FAERS | |
| 148 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 149 | Low density lipoprotein abnormal | FAERS: 3 | US FAERS | |
| 150 | Lymphoma | FAERS: 3 | US FAERS | |
| 151 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 152 | Multiple Myeloma | FAERS: 3 | US FAERS | |
| 153 | Muscle necrosis | FAERS: 3 | US FAERS | |
| 154 | Muscle tightness | FAERS: 3 | US FAERS | |
| 155 | Myasthenia Gravis | FAERS: 3 | US FAERS | |
| 156 | Polymyositis | FAERS: 3 | US FAERS | |
| 157 | Product physical issue | FAERS: 3 | US FAERS | |
| 158 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 159 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 160 | Renal cyst | FAERS: 3 | US FAERS | |
| 161 | Respiratory distress | FAERS: 3 | US FAERS | |
| 162 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 163 | Sciatica | FAERS: 3 | US FAERS | |
| 164 | Sepsis | FAERS: 3 | US FAERS | |
| 165 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 166 | Vasculitis | FAERS: 3 | US FAERS | |
| 167 | Accidental overdose | FAERS: 2 | US FAERS | |
| 168 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 169 | Ageusia | FAERS: 2 | US FAERS | |
| 170 | Amaurosis Fugax | FAERS: 2 | US FAERS | |
| 171 | Angioedema | FAERS: 2 | US FAERS | |
| 172 | Angioplasty | FAERS: 2 | US FAERS | |
| 173 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 174 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 175 | Bedridden | FAERS: 2 | US FAERS | |
| 176 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 177 | Blood creatine phosphokinase MB abnormal | FAERS: 2 | US FAERS | |
| 178 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 179 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 180 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 181 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 182 | Blood triglycerides abnormal | FAERS: 2 | US FAERS | |
| 183 | Blood urea increased | FAERS: 2 | US FAERS | |
| 184 | Bone erosion | FAERS: 2 | US FAERS | |
| 185 | Chills | FAERS: 2 | US FAERS | |
| 186 | Cholestasis | FAERS: 2 | US FAERS | |
| 187 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 188 | Drug administration error | FAERS: 2 | US FAERS | |
| 189 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 190 | Drug level increased | FAERS: 2 | US FAERS | |
| 191 | Dysgeusia | FAERS: 2 | US FAERS | |
| 192 | Dyspepsia | FAERS: 2 | US FAERS | |
| 193 | Dysphemia | FAERS: 2 | US FAERS | |
| 194 | Dysphonia | FAERS: 2 | US FAERS | |
| 195 | Economic problem | FAERS: 2 | US FAERS | |
| 196 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 197 | Epistaxis | FAERS: 2 | US FAERS | |
| 198 | Expired drug administered | FAERS: 2 | US FAERS | |
| 199 | Eye pain | FAERS: 2 | US FAERS | |
| 200 | Facial Pain | FAERS: 2 | US FAERS | |
| 201 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 202 | Food Allergy | FAERS: 2 | US FAERS | |
| 203 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 204 | Hemiparesis | FAERS: 2 | US FAERS | |
| 205 | High density lipoprotein increased | FAERS: 2 | US FAERS | |
| 206 | Hypersomnia | FAERS: 2 | US FAERS | |
| 207 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 208 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 209 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 210 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 211 | Lichen Planus | FAERS: 2 | US FAERS | |
| 212 | Limb discomfort | FAERS: 2 | US FAERS | |
| 213 | Lipoma | FAERS: 2 | US FAERS | |
| 214 | Malabsorption | FAERS: 2 | US FAERS | |
| 215 | Middle insomnia | FAERS: 2 | US FAERS | |
| 216 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 217 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 218 | Muscle strain | FAERS: 2 | US FAERS | |
| 219 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 220 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 221 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 222 | Nodule | FAERS: 2 | US FAERS | |
| 223 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 224 | Pancreatic Neoplasm | FAERS: 2 | US FAERS | |
| 225 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 226 | Post procedural complication | FAERS: 2 | US FAERS | |
| 227 | Product dose omission | FAERS: 2 | US FAERS | |
| 228 | Product label issue | FAERS: 2 | US FAERS | |
| 229 | Proteinuria | FAERS: 2 | US FAERS | |
| 230 | Renal pain | FAERS: 2 | US FAERS | |
| 231 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 232 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 233 | Septic Shock | FAERS: 2 | US FAERS | |
| 234 | Shoulder Pain | FAERS: 2 | US FAERS | |
| 235 | Sinusitis | FAERS: 2 | US FAERS | |
| 236 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 237 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 238 | Stress | FAERS: 2 | US FAERS | |
| 239 | Tachycardia | FAERS: 2 | US FAERS | |
| 240 | Tension | FAERS: 2 | US FAERS | |
| 241 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 242 | Vascular calcification | FAERS: 2 | US FAERS | |
| 243 | Walking aid user | FAERS: 2 | US FAERS | |
| 244 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 245 | ovarian neoplasm | FAERS: 2 | US FAERS | |
| 246 | treatment failure | FAERS: 2 | US FAERS | |
| 247 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 248 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 249 | Acidosis | FAERS: 1 | US FAERS | |
| 250 | Acne | FAERS: 1 | US FAERS | |
| 251 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 252 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 253 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 254 | Agitation | FAERS: 1 | US FAERS | |
| 255 | Angiogram abnormal | FAERS: 1 | US FAERS | |
| 256 | Anticonvulsant drug level decreased | FAERS: 1 | US FAERS | |
| 257 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 258 | Aspergillosis | FAERS: 1 | US FAERS | |
| 259 | Ataxia | FAERS: 1 | US FAERS | |
| 260 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 261 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 262 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 263 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 264 | Back disorder | FAERS: 1 | US FAERS | |
| 265 | Bacteria blood identified | FAERS: 1 | US FAERS | |
| 266 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 267 | Biliary Colic | FAERS: 1 | US FAERS | |
| 268 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 269 | Blepharitis | FAERS: 1 | US FAERS | |
| 270 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 271 | Blood blister | FAERS: 1 | US FAERS | |
| 272 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 273 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 274 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 275 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 276 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 277 | Blood urine present | FAERS: 1 | US FAERS | |
| 278 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 279 | Breast Cyst | FAERS: 1 | US FAERS | |
| 280 | Bronchitis | FAERS: 1 | US FAERS | |
| 281 | Bronchopulmonary disease | FAERS: 1 | US FAERS | |
| 282 | Bursitis | FAERS: 1 | US FAERS | |
| 283 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 284 | Cardiac Death | FAERS: 1 | US FAERS | |
| 285 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 286 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 287 | Carotid bruit | FAERS: 1 | US FAERS | |
| 288 | Cataract operation | FAERS: 1 | US FAERS | |
| 289 | Cellulitis | FAERS: 1 | US FAERS | |
| 290 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 291 | Chemotherapy | FAERS: 1 | US FAERS | |
| 292 | Cholangitis | FAERS: 1 | US FAERS | |
| 293 | Cluster Headache | FAERS: 1 | US FAERS | |
| 294 | Colectomy | FAERS: 1 | US FAERS | |
| 295 | Colon adenoma | FAERS: 1 | US FAERS | |
| 296 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 297 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 298 | Cyanosis | FAERS: 1 | US FAERS | |
| 299 | Cyst | FAERS: 1 | US FAERS | |
| 300 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 301 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 302 | Dengue Fever | FAERS: 1 | US FAERS | |
| 303 | Depressed mood | FAERS: 1 | US FAERS | |
| 304 | Dermatitis | FAERS: 1 | US FAERS | |
| 305 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 306 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 307 | Disability | FAERS: 1 | US FAERS | |
| 308 | Disease complication | FAERS: 1 | US FAERS | |
| 309 | Disorientation | FAERS: 1 | US FAERS | |
| 310 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 311 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 312 | Dry skin | FAERS: 1 | US FAERS | |
| 313 | Dysarthria | FAERS: 1 | US FAERS | |
| 314 | Eczema | FAERS: 1 | US FAERS | |
| 315 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 316 | Embolic stroke | FAERS: 1 | US FAERS | |
| 317 | Endometriosis | FAERS: 1 | US FAERS | |
| 318 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 319 | Eosinophilia | FAERS: 1 | US FAERS | |
| 320 | Exposure to chemical pollution | FAERS: 1 | US FAERS | |
| 321 | Eye inflammation | FAERS: 1 | US FAERS | |
| 322 | Fibrosis | FAERS: 1 | US FAERS | |
| 323 | Formication | FAERS: 1 | US FAERS | |
| 324 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 325 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 326 | Gastrectomy | FAERS: 1 | US FAERS | |
| 327 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 328 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 329 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 330 | Glioblastoma | FAERS: 1 | US FAERS | |
| 331 | Glioma | FAERS: 1 | US FAERS | |
| 332 | Gliosis | FAERS: 1 | US FAERS | |
| 333 | Global Amnesia | FAERS: 1 | US FAERS | |
| 334 | Glossitis | FAERS: 1 | US FAERS | |
| 335 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 336 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 337 | Heat Stroke | FAERS: 1 | US FAERS | |
| 338 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 339 | Hepatic dysplasia | FAERS: 1 | US FAERS | |
| 340 | Hepatitis B positive | FAERS: 1 | US FAERS | |
| 341 | Hepatitis C | FAERS: 1 | US FAERS | |
| 342 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 343 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 344 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 345 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 346 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 347 | Hypogonadism | FAERS: 1 | US FAERS | |
| 348 | Hypoventilation | FAERS: 1 | US FAERS | |
| 349 | Hysterectomy | FAERS: 1 | US FAERS | |
| 350 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 351 | Immobile | FAERS: 1 | US FAERS | |
| 352 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 353 | Impaired self-care | FAERS: 1 | US FAERS | |
| 354 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 355 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 356 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 357 | Infection | FAERS: 1 | US FAERS | |
| 358 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 359 | Insulin-requiring type 2 diabetes mellitus | FAERS: 1 | US FAERS | |
| 360 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 361 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 362 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 363 | Laryngitis | FAERS: 1 | US FAERS | |
| 364 | Laryngospasm | FAERS: 1 | US FAERS | |
| 365 | Lethargy | FAERS: 1 | US FAERS | |
| 366 | Ligament rupture | FAERS: 1 | US FAERS | |
| 367 | Limb operation | FAERS: 1 | US FAERS | |
| 368 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 369 | Lip swelling | FAERS: 1 | US FAERS | |
| 370 | Lipase increased | FAERS: 1 | US FAERS | |
| 371 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 372 | Loss of proprioception | FAERS: 1 | US FAERS | |
| 373 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 374 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 375 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 376 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 377 | Mastectomy | FAERS: 1 | US FAERS | |
| 378 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 379 | Meniscus injury | FAERS: 1 | US FAERS | |
| 380 | Mental impairment | FAERS: 1 | US FAERS | |
| 381 | Mental status changes | FAERS: 1 | US FAERS | |
| 382 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 383 | Metaplasia | FAERS: 1 | US FAERS | |
| 384 | Metastasis | FAERS: 1 | US FAERS | |
| 385 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 386 | Monoplegia | FAERS: 1 | US FAERS | |
| 387 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 388 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 389 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 390 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 391 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 392 | Nephritis | FAERS: 1 | US FAERS | |
| 393 | Nerve injury | FAERS: 1 | US FAERS | |
| 394 | Neutropenia | FAERS: 1 | US FAERS | |
| 395 | Night sweats | FAERS: 1 | US FAERS | |
| 396 | Nipple pain | FAERS: 1 | US FAERS | |
| 397 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 398 | Ocular icterus | FAERS: 1 | US FAERS | |
| 399 | Osteopenia | FAERS: 1 | US FAERS | |
| 400 | Osteoporosis | FAERS: 1 | US FAERS | |
| 401 | Overweight | FAERS: 1 | US FAERS | |
| 402 | PO2 decreased | FAERS: 1 | US FAERS | |
| 403 | Panic Disorder | FAERS: 1 | US FAERS | |
| 404 | Paranoia | FAERS: 1 | US FAERS | |
| 405 | Partner stress | FAERS: 1 | US FAERS | |
| 406 | Periarthritis | FAERS: 1 | US FAERS | |
| 407 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 408 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 409 | Personality Change | FAERS: 1 | US FAERS | |
| 410 | Photophobia | FAERS: 1 | US FAERS | |
| 411 | Poisoning | FAERS: 1 | US FAERS | |
| 412 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 413 | Polyuria | FAERS: 1 | US FAERS | |
| 414 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 415 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 416 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 417 | Post procedural nausea | FAERS: 1 | US FAERS | |
| 418 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 419 | Product availability issue | FAERS: 1 | US FAERS | |
| 420 | Product commingling | FAERS: 1 | US FAERS | |
| 421 | Product container issue | FAERS: 1 | US FAERS | |
| 422 | Product contamination | FAERS: 1 | US FAERS | |
| 423 | Product contamination chemical | FAERS: 1 | US FAERS | |
| 424 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 425 | Product identification number issue | FAERS: 1 | US FAERS | |
| 426 | Product lot number issue | FAERS: 1 | US FAERS | |
| 427 | Product use complaint | FAERS: 1 | US FAERS | |
| 428 | Protein total decreased | FAERS: 1 | US FAERS | |
| 429 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 430 | Renal Colic | FAERS: 1 | US FAERS | |
| 431 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 432 | Retching | FAERS: 1 | US FAERS | |
| 433 | Reticulocyte count increased | FAERS: 1 | US FAERS | |
| 434 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 435 | Shock | FAERS: 1 | US FAERS | |
| 436 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 437 | Skeletal injury | FAERS: 1 | US FAERS | |
| 438 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 439 | Skin nodule | FAERS: 1 | US FAERS | |
| 440 | Sneezing | FAERS: 1 | US FAERS | |
| 441 | Splenomegaly | FAERS: 1 | US FAERS | |
| 442 | Stomatitis | FAERS: 1 | US FAERS | |
| 443 | Subileus | FAERS: 1 | US FAERS | |
| 444 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 445 | Sudden death | FAERS: 1 | US FAERS | |
| 446 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 447 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 448 | Terminal state | FAERS: 1 | US FAERS | |
| 449 | Therapy cessation | FAERS: 1 | US FAERS | |
| 450 | Thermal burn | FAERS: 1 | US FAERS | |
| 451 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 452 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 453 | Tinnitus | FAERS: 1 | US FAERS | |
| 454 | Tongue biting | FAERS: 1 | US FAERS | |
| 455 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 456 | Transaminases | FAERS: 1 | US FAERS | |
| 457 | Ubiquinone decreased | FAERS: 1 | US FAERS | |
| 458 | Unevaluable event | FAERS: 1 | US FAERS | |
| 459 | Uterine Rupture | FAERS: 1 | US FAERS | |
| 460 | Vascular pain | FAERS: 1 | US FAERS | |
| 461 | Vascular rupture | FAERS: 1 | US FAERS | |
| 462 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 463 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 464 | Wheelchair user | FAERS: 1 | US FAERS | |
| 465 | colonoscopy | FAERS: 1 | US FAERS | |
| 466 | nervous system disorder | FAERS: 1 | US FAERS | |
| 467 | Chemical and Drug Induced Liver Injury | 18752389 | CTD | |
| 468 | Dyslipidemias | 19167588 | CTD | |
| 469 | Liver Failure, Acute | 18752389 | CTD | |
| 470 | Musculoskeletal Diseases | 19167588 | CTD | |
| 471 | Respiratory Tract Infections | 19167588 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.