Trazodone
(PHLBKPHSAVXXEF-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cccc(c1)N1CCN(CC1)CCCn1nc2n(c1=O)cccc2
- Type(s)
- Approved; Investigational
- ATC code(s)
- N06AX05
- Molecular Formula:
- C19H22ClN5O
- Molecular Weight:
- 371.864
- Log P:
- 2.3646
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 0
- TPSA:
- 45.78
- CAS Number(s):
- 19794-93-5; 25332-39-2
Synonym(s)
1.
Trazodone
2.
AF-1161
3.
Apo-Trazodone
4.
Deprax
5.
Desyrel
6.
Gen-Trazodone
7.
Molipaxin
8.
Novo-Trazodone
9.
Nu-Trazodone
10.
PMS-Trazodone
11.
Ratio-Trazodone
12.
Thombran
13.
Tradozone
14.
Trazodon Hexal
15.
Trazodon-Neuraxpharm
16.
Trazodone Hydrochloride
17.
Trazon
18.
Trittico
19.
AF 1161
20.
AF1161
21.
Apo Trazodone
22.
Gen Trazodone
23.
Novo Trazodone
24.
Nu Trazodone
25.
PMS Trazodone
26.
Ratio Trazodone
27.
RatioTrazodone
28.
Trazodon Neuraxpharm
29.
TrazodonNeuraxpharm
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 99 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 2 | Priapism | FAERS: 79 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 36 Canada Vigilance: 15 | 2071559 | CTD SIDER Canada Vigilance US FAERS |
| 4 | Product use in unapproved indication | FAERS: 34 | US FAERS | |
| 5 | Choking | FAERS: 29 | US FAERS | |
| 6 | Somnolence | FAERS: 28 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 7 | Headache | FAERS: 24 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 8 | Product use issue | FAERS: 24 | US FAERS | |
| 9 | Nausea | FAERS: 21 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Feeling abnormal | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Product substitution issue | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Wrong technique in product usage process | FAERS: 19 | US FAERS | |
| 13 | Product quality issue | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 14 | Toxicity to various agents | FAERS: 17 | US FAERS | |
| 15 | Drug ineffective for unapproved indication | FAERS: 16 | US FAERS | |
| 16 | Anxiety | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Product physical issue | FAERS: 15 | US FAERS | |
| 18 | Product shape issue | FAERS: 15 | US FAERS | |
| 19 | Drug prescribing error | FAERS: 14 | US FAERS | |
| 20 | Malaise | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 21 | Constipation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Asthenia | FAERS: 12 | 2071559 | CTD OFFSIDES SIDER US FAERS |
| 23 | Chest Pain | FAERS: 11 Canada Vigilance: 1 | 15238202 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 24 | Pain | FAERS: 11 Canada Vigilance: 1 | 12790215 12798668 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 25 | Palpitations | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 26 | Throat irritation | FAERS: 11 | US FAERS | |
| 27 | Tremor | FAERS: 11 Canada Vigilance: 2 | 9050436 | CTD SIDER Canada Vigilance US FAERS |
| 28 | Completed Suicide | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 29 | Eye pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Overdose | FAERS: 9 | US FAERS | |
| 31 | Agitation | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 32 | Erectile dysfunction | FAERS: 8 | 7604472 | CTD OFFSIDES SIDER US FAERS |
| 33 | Fatigue | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 34 | Suicide attempt | FAERS: 8 | SIDER US FAERS | |
| 35 | Visual Impairment | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Bradycardia | FAERS: 7 | SIDER US FAERS | |
| 37 | Dysphonia | FAERS: 7 | OFFSIDES US FAERS | |
| 38 | Myalgia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 40 | Product use complaint | FAERS: 7 | US FAERS | |
| 41 | Tinnitus | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 42 | Abdominal discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 43 | Arthralgia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 44 | Hypersomnia | FAERS: 6 | US FAERS | |
| 45 | Mental status changes | FAERS: 6 | US FAERS | |
| 46 | Product difficult to swallow | FAERS: 6 | US FAERS | |
| 47 | Product size issue | FAERS: 6 | US FAERS | |
| 48 | Restlessness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Serotonin Syndrome | FAERS: 6 | CTD SIDER US FAERS | |
| 50 | Swelling | FAERS: 6 | US FAERS | |
| 51 | Urinary Incontinence | FAERS: 6 | SIDER US FAERS | |
| 52 | Weight decreased | FAERS: 6 | SIDER US FAERS | |
| 53 | Adverse event | FAERS: 5 | US FAERS | |
| 54 | Alopecia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 55 | Amnesia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 56 | Chest discomfort | FAERS: 5 | US FAERS | |
| 57 | Depressed Level of Consciousness | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 58 | Drug abuse | FAERS: 5 | US FAERS | |
| 59 | Dyspepsia | FAERS: 5 | US FAERS | |
| 60 | Erection increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Memory impairment | FAERS: 5 | SIDER US FAERS | |
| 62 | Poor quality sleep | FAERS: 5 | SIDER US FAERS | |
| 63 | Syncope | FAERS: 5 | 2635019 3674239 | CTD SIDER US FAERS |
| 64 | Vomiting | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 65 | Anger | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 66 | Angioedema | FAERS: 4 | US FAERS | |
| 67 | Atrial Fibrillation | FAERS: 4 | 3977562 | CTD SIDER US FAERS |
| 68 | Burning sensation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Drug screen positive | FAERS: 4 | US FAERS | |
| 70 | Hypersensitivity | FAERS: 4 | SIDER US FAERS | |
| 71 | Intentional product misuse | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Lip swelling | FAERS: 4 | US FAERS | |
| 73 | Night sweats | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Pruritus | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 75 | treatment failure | FAERS: 4 | US FAERS | |
| 76 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 77 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 78 | Ataxia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 79 | Discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 80 | Disorientation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 81 | Drug dispensing error | FAERS: 3 | OFFSIDES US FAERS | |
| 82 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 83 | Dysarthria | FAERS: 3 | 18562067 | CTD SIDER US FAERS |
| 84 | Gait inability | FAERS: 3 | US FAERS | |
| 85 | Gluten sensitivity | FAERS: 3 | US FAERS | |
| 86 | Hyperreflexia | FAERS: 3 | OFFSIDES US FAERS | |
| 87 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 88 | Initial insomnia | FAERS: 3 | US FAERS | |
| 89 | Intentional product use issue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Middle insomnia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Muscle Rigidity | FAERS: 3 | 7854515 9050436 | CTD US FAERS |
| 92 | Oropharyngeal pain | FAERS: 3 | OFFSIDES US FAERS | |
| 93 | Product formulation issue | FAERS: 3 | US FAERS | |
| 94 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 95 | Restless Legs Syndrome | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Retching | FAERS: 3 | US FAERS | |
| 97 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 98 | Wrong patient received medication | FAERS: 3 | US FAERS | |
| 99 | Abdominal Pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 100 | Accidental overdose | FAERS: 2 | US FAERS | |
| 101 | Ankle Fracture | FAERS: 2 | OFFSIDES US FAERS | |
| 102 | Back Pain | FAERS: 2 | SIDER US FAERS | |
| 103 | Chills | FAERS: 2 | SIDER US FAERS | |
| 104 | Deafness | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 105 | Delirium | FAERS: 2 | 6584039 9817628 | CTD US FAERS |
| 106 | Drug dose omission | FAERS: 2 | US FAERS | |
| 107 | Drug effective for unapproved indication | FAERS: 2 | US FAERS | |
| 108 | Dysgeusia | FAERS: 2 | SIDER US FAERS | |
| 109 | Erythema | FAERS: 2 | US FAERS | |
| 110 | False positive investigation result | FAERS: 2 | US FAERS | |
| 111 | Feeling Cold | FAERS: 2 | US FAERS | |
| 112 | Food Allergy | FAERS: 2 | US FAERS | |
| 113 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 114 | Glaucoma | FAERS: 2 | US FAERS | |
| 115 | Hypotension | FAERS: 2 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 116 | Inappropriate schedule of drug administration | FAERS: 2 | OFFSIDES US FAERS | |
| 117 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 118 | Menorrhagia | FAERS: 2 | US FAERS | |
| 119 | Musculoskeletal stiffness | FAERS: 2 | SIDER US FAERS | |
| 120 | Myoclonus | FAERS: 2 | CTD US FAERS | |
| 121 | Narcolepsy | FAERS: 2 | US FAERS | |
| 122 | Neck Pain | FAERS: 2 | 6614244 | CTD US FAERS |
| 123 | Orthosis user | FAERS: 2 | US FAERS | |
| 124 | Paranoia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 125 | Poisoning | FAERS: 2 | US FAERS | |
| 126 | Product prescribing error | FAERS: 2 | US FAERS | |
| 127 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 128 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 129 | Spontaneous penile erection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Tachycardia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 131 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 132 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 133 | Therapy cessation | FAERS: 2 | US FAERS | |
| 134 | Urinary Retention | FAERS: 2 | 1969249 | CTD SIDER US FAERS |
| 135 | Urticaria | FAERS: 2 | SIDER US FAERS | |
| 136 | Wheezing | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 138 | nervous system disorder | FAERS: 2 | US FAERS | |
| 139 | Abscess of eyelid | FAERS: 1 | US FAERS | |
| 140 | Activation syndrome | FAERS: 1 | US FAERS | |
| 141 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 142 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 143 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 144 | Amputation of penis | FAERS: 1 | US FAERS | |
| 145 | Apparent death | FAERS: 1 | US FAERS | |
| 146 | Asphyxia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Asthenopia | FAERS: 1 | US FAERS | |
| 148 | Bipolar Disorder | FAERS: 1 | CTD OFFSIDES US FAERS | |
| 149 | Bipolar I disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 150 | Blepharochalasis | FAERS: 1 | US FAERS | |
| 151 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 152 | Blood lead | FAERS: 1 | US FAERS | |
| 153 | Blood potassium decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 154 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 155 | Bradykinesia | FAERS: 1 | US FAERS | |
| 156 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 157 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 158 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 159 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 160 | Cerebrovascular accident | FAERS: 1 | SIDER US FAERS | |
| 161 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 162 | Corneal Scar | FAERS: 1 | US FAERS | |
| 163 | Crying | FAERS: 1 | US FAERS | |
| 164 | Dehydration | FAERS: 1 | OFFSIDES US FAERS | |
| 165 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 166 | Dementia | FAERS: 1 | 11575062 12587811 | CTD US FAERS |
| 167 | Depressed mood | FAERS: 1 | OFFSIDES US FAERS | |
| 168 | Diplopia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 169 | Disability | FAERS: 1 | US FAERS | |
| 170 | Disease complication | FAERS: 1 | US FAERS | |
| 171 | Drug Tolerance | FAERS: 1 | OFFSIDES US FAERS | |
| 172 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 173 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 174 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 175 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 176 | Dry skin | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Dyslexia | FAERS: 1 | US FAERS | |
| 178 | Dystonia | FAERS: 1 | 3700695 9004068 | CTD US FAERS |
| 179 | Dysuria | FAERS: 1 | US FAERS | |
| 180 | Eczema | FAERS: 1 | US FAERS | |
| 181 | Emotional disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 182 | Enuresis | FAERS: 1 | US FAERS | |
| 183 | Epididymitis | FAERS: 1 | US FAERS | |
| 184 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 185 | Expired product administered | FAERS: 1 | US FAERS | |
| 186 | Extra dose administered | FAERS: 1 | US FAERS | |
| 187 | Feeling jittery | FAERS: 1 | US FAERS | |
| 188 | Female sexual arousal disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Fibrosis | FAERS: 1 | US FAERS | |
| 190 | Flatulence | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 191 | Flushing | FAERS: 1 | SIDER US FAERS | |
| 192 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 193 | Food Poisoning | FAERS: 1 | US FAERS | |
| 194 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 195 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 196 | Genital pain | FAERS: 1 | US FAERS | |
| 197 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 198 | Head discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 199 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 200 | Hostility | FAERS: 1 | SIDER US FAERS | |
| 201 | Hunger | FAERS: 1 | US FAERS | |
| 202 | Hypervigilance | FAERS: 1 | US FAERS | |
| 203 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 204 | Incoherent | FAERS: 1 | US FAERS | |
| 205 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 206 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 207 | Influenza | FAERS: 1 | US FAERS | |
| 208 | Injection site injury | FAERS: 1 | US FAERS | |
| 209 | Intentional drug misuse | FAERS: 1 | OFFSIDES US FAERS | |
| 210 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 211 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 212 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 213 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 214 | Joint swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Joint warmth | FAERS: 1 | US FAERS | |
| 216 | Laceration | FAERS: 1 | US FAERS | |
| 217 | Lethargy | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 218 | Limb discomfort | FAERS: 1 | US FAERS | |
| 219 | Medication Error | FAERS: 1 | US FAERS | |
| 220 | Meibomian gland dysfunction | FAERS: 1 | US FAERS | |
| 221 | Mental impairment | FAERS: 1 | OFFSIDES US FAERS | |
| 222 | Muscle tightness | FAERS: 1 | US FAERS | |
| 223 | Myocardial Infarction | FAERS: 1 | SIDER US FAERS | |
| 224 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 225 | Necrosis | FAERS: 1 | US FAERS | |
| 226 | Nervousness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 227 | Neuroleptic Malignant Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 228 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 229 | Osteoporosis | FAERS: 1 | OFFSIDES US FAERS | |
| 230 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 231 | PCO2 increased | FAERS: 1 | US FAERS | |
| 232 | PO2 decreased | FAERS: 1 | US FAERS | |
| 233 | Pallor | FAERS: 1 | US FAERS | |
| 234 | Pancytopenia | FAERS: 1 | US FAERS | |
| 235 | Penile necrosis | FAERS: 1 | US FAERS | |
| 236 | Peripheral swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Personality Change | FAERS: 1 | US FAERS | |
| 238 | Personality change due to a general medical condition | FAERS: 1 | US FAERS | |
| 239 | Petechiae | FAERS: 1 | US FAERS | |
| 240 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 241 | Physical disability | FAERS: 1 | US FAERS | |
| 242 | Pneumothorax | FAERS: 1 | US FAERS | |
| 243 | Polydipsia | FAERS: 1 | US FAERS | |
| 244 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 245 | Product coating issue | FAERS: 1 | US FAERS | |
| 246 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 247 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 248 | Product identification number issue | FAERS: 1 | US FAERS | |
| 249 | Product lot number issue | FAERS: 1 | US FAERS | |
| 250 | Product package associated injury | FAERS: 1 | US FAERS | |
| 251 | Product storage error | FAERS: 1 | US FAERS | |
| 252 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 253 | Productive Cough | FAERS: 1 | US FAERS | |
| 254 | Psoriasis | FAERS: 1 | SIDER US FAERS | |
| 255 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 256 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 257 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 258 | Rhonchi | FAERS: 1 | US FAERS | |
| 259 | School refusal | FAERS: 1 | US FAERS | |
| 260 | Sexual Dysfunction | FAERS: 1 | SIDER US FAERS | |
| 261 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 262 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 263 | Sinus headache | FAERS: 1 | US FAERS | |
| 264 | Skin lesion | FAERS: 1 | US FAERS | |
| 265 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 266 | Sluggishness | FAERS: 1 | US FAERS | |
| 267 | Sodium retention | FAERS: 1 | US FAERS | |
| 268 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 269 | Stress | FAERS: 1 | OFFSIDES US FAERS | |
| 270 | Superinfection | FAERS: 1 | US FAERS | |
| 271 | Surgical failure | FAERS: 1 | US FAERS | |
| 272 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 273 | Tardive Dyskinesia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 274 | Tension | FAERS: 1 | SIDER US FAERS | |
| 275 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 276 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 277 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 278 | Therapy change | FAERS: 1 | US FAERS | |
| 279 | Throat cancer | FAERS: 1 | US FAERS | |
| 280 | Thrombosis | FAERS: 1 | US FAERS | |
| 281 | Toothache | FAERS: 1 | US FAERS | |
| 282 | Torticollis | FAERS: 1 | US FAERS | |
| 283 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 284 | Vertigo | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 285 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 286 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 287 | Waist circumference decreased | FAERS: 1 | US FAERS | |
| 288 | Water Intoxication | FAERS: 1 | US FAERS | |
| 289 | jaundice | FAERS: 1 | SIDER US FAERS | |
| 290 | pH body fluid decreased | FAERS: 1 | US FAERS | |
| 291 | Abasia | OFFSIDES | ||
| 292 | Abnormal vision | OFFSIDES | ||
| 293 | Acarodermatitis | OFFSIDES | ||
| 294 | Ache | SIDER | ||
| 295 | Acid reflux | OFFSIDES | ||
| 296 | Acquired macroglossia | OFFSIDES | ||
| 297 | Acute Coronary Syndrome | OFFSIDES SIDER | ||
| 298 | Acute respiratory failure | OFFSIDES | ||
| 299 | Adenoma | OFFSIDES | ||
| 300 | Affective Disorders, Psychotic | 2565491 | CTD | |
| 301 | Akathisia | SIDER | ||
| 302 | Allergy to arthropod sting | OFFSIDES | ||
| 303 | Amphetamines | OFFSIDES | ||
| 304 | Amylase increased | SIDER | ||
| 305 | Angle Closure Glaucoma | SIDER | ||
| 306 | Anhedonia | OFFSIDES | ||
| 307 | Anhidrosis | OFFSIDES | ||
| 308 | Anorexia | 2565491 | CTD SIDER | |
| 309 | Antiphospholipid Syndrome | OFFSIDES | ||
| 310 | Anxiety Disorders | 2247245 3752308 | CTD | |
| 311 | Apathy | Canada Vigilance: 1 | Canada Vigilance | |
| 312 | Aphasia | SIDER | ||
| 313 | Arteriosclerosis | OFFSIDES | ||
| 314 | Arthropathy | OFFSIDES | ||
| 315 | Arthropod bite | OFFSIDES | ||
| 316 | Aseptic Meningitis | OFFSIDES | ||
| 317 | Atelectasis | OFFSIDES | ||
| 318 | Atrioventricular Block | SIDER | ||
| 319 | Aura | OFFSIDES | ||
| 320 | Autonomic neuropathy | OFFSIDES | ||
| 321 | Avascular necrosis | OFFSIDES | ||
| 322 | Bile Duct Stenosis | OFFSIDES | ||
| 323 | Biliary Dyskinesia | OFFSIDES | ||
| 324 | Bladder pain | SIDER | ||
| 325 | Bladder prolapse | OFFSIDES | ||
| 326 | Blepharitis | Canada Vigilance: 1 | Canada Vigilance | |
| 327 | Blepharospasm | Canada Vigilance: 1 | Canada Vigilance | |
| 328 | Blood Glucose | OFFSIDES | ||
| 329 | Blood alkaline phosphatase increased | OFFSIDES | ||
| 330 | Blood blister | OFFSIDES | ||
| 331 | Blood cholesterol abnormal | OFFSIDES | ||
| 332 | Blood cholesterol | OFFSIDES | ||
| 333 | Blood immunoglobulin G increased | OFFSIDES | ||
| 334 | Blood testosterone decreased | OFFSIDES | ||
| 335 | Blood triglycerides increased | OFFSIDES | ||
| 336 | Blood urine present | OFFSIDES | ||
| 337 | Blurred vision | OFFSIDES | ||
| 338 | Bone abscess | OFFSIDES | ||
| 339 | Bone lesion | OFFSIDES | ||
| 340 | Bone scan abnormal | OFFSIDES | ||
| 341 | Bone swelling | OFFSIDES | ||
| 342 | Brain Concussion | OFFSIDES | ||
| 343 | Bronchitis | OFFSIDES | ||
| 344 | Bruxism | OFFSIDES | ||
| 345 | Bursitis | OFFSIDES | ||
| 346 | Cardiac Arrest | SIDER | ||
| 347 | Cardiovascular Diseases | 277097 | CTD | |
| 348 | Cartilage injury | OFFSIDES | ||
| 349 | Catalepsy | 15614572 | CTD | |
| 350 | Cataract | OFFSIDES | ||
| 351 | Cellulitis | OFFSIDES | ||
| 352 | Cerebellar infarction | OFFSIDES | ||
| 353 | Cerebral artery occlusion | OFFSIDES | ||
| 354 | Cerebral artery stenosis | OFFSIDES | ||
| 355 | Chemical and Drug Induced Liver Injury | 15930079 19857765 23152190 | CTD | |
| 356 | Choking sensation | OFFSIDES | ||
| 357 | Cholestasis | 11793619 | CTD SIDER | |
| 358 | Chorea | 16636558 | CTD | |
| 359 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 360 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 361 | Chronic left ventricular failure | OFFSIDES | ||
| 362 | Clonus | OFFSIDES | ||
| 363 | Cognition Disorders | 9817628 | CTD | |
| 364 | Cold sweat | SIDER | ||
| 365 | Conduct Disorder | 2565491 | CTD | |
| 366 | Confabulation | OFFSIDES | ||
| 367 | Confusion | 7854515 | CTD | |
| 368 | Contact Dermatitis | OFFSIDES | ||
| 369 | Debridement | OFFSIDES | ||
| 370 | Demyelination | OFFSIDES | ||
| 371 | Dental caries | OFFSIDES | ||
| 372 | Depressive disorder |
277097
1969249 2310343 3378227 3690436 3724998 3752308 4066620 6418012 7726327 7855217 9669540 11474735 11818711 15014590 18083778 19623435 20305041 20482225 | CTD | |
| 373 | Dermatitis | SIDER | ||
| 374 | Dermatomyositis | OFFSIDES | ||
| 375 | Device Failure | OFFSIDES | ||
| 376 | Diabetes | OFFSIDES | ||
| 377 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 378 | Diabetic Foot | OFFSIDES | ||
| 379 | Diabetic Nephropathy | OFFSIDES | ||
| 380 | Diabetic Retinopathy | OFFSIDES | ||
| 381 | Diarrhea | OFFSIDES | ||
| 382 | Disease recurrence | OFFSIDES | ||
| 383 | Disturbance in sexual arousal | SIDER | ||
| 384 | Diuresis | SIDER | ||
| 385 | Diverticulum | OFFSIDES | ||
| 386 | Drowsiness | OFFSIDES SIDER | ||
| 387 | Drug Overdose | 1571643 | CTD | |
| 388 | Drug addict | OFFSIDES | ||
| 389 | Drug delivery system malfunction | OFFSIDES | ||
| 390 | Drug level increased | Canada Vigilance: 1 | Canada Vigilance | |
| 391 | Drug toxicity | OFFSIDES | ||
| 392 | Drug withdrawal headache | OFFSIDES | ||
| 393 | Dyskinesia, Drug-Induced | 3690436 18562067 | CTD | |
| 394 | Dysmenorrhea | OFFSIDES | ||
| 395 | Dysthymic Disorder | OFFSIDES | ||
| 396 | Edema | 12798668 | CTD | |
| 397 | Electrocardiogram ST-T change | OFFSIDES | ||
| 398 | Electrocardiogram ST-T segment abnormal | OFFSIDES | ||
| 399 | Emotional distress | OFFSIDES | ||
| 400 | Endocarditis | OFFSIDES | ||
| 401 | Endodontic procedure | OFFSIDES | ||
| 402 | Endometrial disorder | OFFSIDES | ||
| 403 | Epilepsy, Complex Partial | 3711031 | CTD | |
| 404 | Epilepsy, Generalized | 8351689 | CTD | |
| 405 | Epilepsy | OFFSIDES | ||
| 406 | Erosive gastritis | OFFSIDES | ||
| 407 | Essential Tremor | 3296121 | CTD | |
| 408 | Eye Redness | SIDER | ||
| 409 | Fatty Liver | OFFSIDES | ||
| 410 | Fever | 9050436 | CTD | |
| 411 | Fibromyalgia | OFFSIDES | ||
| 412 | Fistula discharge | OFFSIDES | ||
| 413 | Gamma-Glutamyltransferase Increased | OFFSIDES | ||
| 414 | Gamma-glutamyltransferase abnormal | OFFSIDES | ||
| 415 | Gastroenteritis | OFFSIDES | ||
| 416 | Gastrointestinal discomfort | SIDER | ||
| 417 | Gene mutation identification test | OFFSIDES | ||
| 418 | Glycosuria | 8442906 | CTD | |
| 419 | Graft infection | OFFSIDES | ||
| 420 | Hallucinations | 9817628 | CTD | |
| 421 | Heart Block | 6496797 | CTD | |
| 422 | Hemiparesis | OFFSIDES | ||
| 423 | Hepatitis | 11793619 | CTD | |
| 424 | Hernia | OFFSIDES | ||
| 425 | Hirsutism | SIDER | ||
| 426 | Hydronephrosis | OFFSIDES | ||
| 427 | Hyperalgesia | 12790215 | CTD | |
| 428 | Hypertensive cardiomyopathy | OFFSIDES | ||
| 429 | Hypertrophic Cardiomyopathy | OFFSIDES | ||
| 430 | Hypesthesia | 18562067 | CTD | |
| 431 | Hypokinesia | SIDER | ||
| 432 | Hypomania | SIDER | ||
| 433 | Hyponatremia | 1571643 | CTD | |
| 434 | Hypotension, Orthostatic | CTD | ||
| 435 | Hypoxia | OFFSIDES | ||
| 436 | Incontinence | OFFSIDES SIDER | ||
| 437 | Inflammation | 12798668 | CTD | |
| 438 | Intention tremor | OFFSIDES | ||
| 439 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 440 | Intervertebral disc disorder | OFFSIDES | ||
| 441 | Jaundice, Obstructive | 6625402 | CTD | |
| 442 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 443 | Leukocytoclastic vasculitis | SIDER | ||
| 444 | Leukocytosis | SIDER | ||
| 445 | Leukonychia | SIDER | ||
| 446 | Lightheadedness | SIDER | ||
| 447 | Limb injury | OFFSIDES | ||
| 448 | Lipids abnormal | OFFSIDES | ||
| 449 | Liver Failure, Acute | 19857765 | CTD | |
| 450 | Long QT Syndrome | 15792261 18167038 | CTD | |
| 451 | Lumbar radiculopathy | OFFSIDES | ||
| 452 | Lung infection pseudomonal | OFFSIDES | ||
| 453 | Malocclusion | OFFSIDES | ||
| 454 | Memory Disorders | 2060544 | CTD | |
| 455 | Mental disorders | 16856516 | CTD | |
| 456 | Migraine Disorders | 1575270 | CTD | |
| 457 | Mononeuritis | OFFSIDES | ||
| 458 | Movement Disorders | 4066620 | CTD | |
| 459 | Multiple Sclerosis | OFFSIDES | ||
| 460 | Multiple drug overdose | OFFSIDES | ||
| 461 | Multiple sclerosis relapse | OFFSIDES | ||
| 462 | Musculoskeletal discomfort | SIDER | ||
| 463 | Myocardial calcification | OFFSIDES | ||
| 464 | Negative thoughts | OFFSIDES | ||
| 465 | Nephrolithiasis | OFFSIDES | ||
| 466 | Nervous tension | OFFSIDES | ||
| 467 | Neuropathic pain | OFFSIDES | ||
| 468 | Nocturia | OFFSIDES | ||
| 469 | Numbness | SIDER | ||
| 470 | Obesity | 9183245 | CTD | |
| 471 | Obsessive-Compulsive Disorder | 2521065 7726327 | CTD | |
| 472 | Opioid-Related Disorders | 393279 | CTD | |
| 473 | Opsoclonus-Myoclonus Syndrome | 1318289 | CTD | |
| 474 | Oral infection | OFFSIDES | ||
| 475 | Oral polypectomy | OFFSIDES | ||
| 476 | Oral torus | OFFSIDES | ||
| 477 | Osteomyelitis | OFFSIDES | ||
| 478 | Osteopenia | OFFSIDES | ||
| 479 | Pancreatitis | OFFSIDES | ||
| 480 | Panic Disorder | OFFSIDES | ||
| 481 | Paranoid reaction | SIDER | ||
| 482 | Personality Disorders | 11352540 | CTD | |
| 483 | Phantom pain | OFFSIDES | ||
| 484 | Photophobia | SIDER | ||
| 485 | Polyneuropathy | OFFSIDES | ||
| 486 | Polyuria | SIDER | ||
| 487 | Postmenopausal bleeding | OFFSIDES | ||
| 488 | Product counterfeit | OFFSIDES | ||
| 489 | Prostate cancer recurrent | OFFSIDES | ||
| 490 | Proteinuria | 8442906 | CTD | |
| 491 | Prothrombin level abnormal | OFFSIDES | ||
| 492 | Psychomotor Agitation | 9817628 | CTD | |
| 493 | Pulmonary Eosinophilia | 8520792 | CTD | |
| 494 | Quadriparesis | OFFSIDES | ||
| 495 | Reflex, Abnormal | 7854515 9050436 | CTD | |
| 496 | Renal cyst | OFFSIDES | ||
| 497 | Respiratory Insufficiency | 8520792 | CTD | |
| 498 | Retrograde ejaculation | SIDER | ||
| 499 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 500 | Rhinitis | OFFSIDES | ||
| 501 | Schizophrenia | 7868106 | CTD | |
| 502 | Seizures | 1571643 8434678 11111800 | CTD | |
| 503 | Shock | SIDER | ||
| 504 | Sigmoiditis | OFFSIDES | ||
| 505 | Sinus bradycardia | SIDER | ||
| 506 | Sinusitis | OFFSIDES | ||
| 507 | Sleep Deprivation | 19798453 | CTD | |
| 508 | Sleep Initiation and Maintenance Disorders | CTD | ||
| 509 | Sleep Wake Disorders | 19351801 19395429 | CTD | |
| 510 | Slurred speech | SIDER | ||
| 511 | Small Intestinal Stenosis | OFFSIDES | ||
| 512 | Spinal claudication | OFFSIDES | ||
| 513 | Spinal column stenosis | OFFSIDES | ||
| 514 | Spondylolisthesis | OFFSIDES | ||
| 515 | Stupor | SIDER | ||
| 516 | Substance Withdrawal Syndrome | CTD | ||
| 517 | Suicide | SIDER | ||
| 518 | Supraventricular tachycardia | OFFSIDES | ||
| 519 | Sweating | SIDER | ||
| 520 | Synovial Cyst | OFFSIDES | ||
| 521 | Tachycardia, Ventricular | 2361400 2424891 6881043 | CTD | |
| 522 | Taste peculiar | SIDER | ||
| 523 | Temperature intolerance | OFFSIDES | ||
| 524 | Temporal Arteritis | OFFSIDES | ||
| 525 | Tension Headache | OFFSIDES | ||
| 526 | Tetany | OFFSIDES | ||
| 527 | Tingling of extremity | SIDER | ||
| 528 | Tongue biting | OFFSIDES | ||
| 529 | Tongue blistering | OFFSIDES | ||
| 530 | Tooth Extraction | OFFSIDES | ||
| 531 | Tooth Infection | OFFSIDES | ||
| 532 | Tooth Loss | OFFSIDES | ||
| 533 | Torsades de Pointes | 15792261 | CTD | |
| 534 | Tranquillisation excessive | SIDER | ||
| 535 | Tri-iodothyronine abnormal | OFFSIDES | ||
| 536 | Ulcer | OFFSIDES | ||
| 537 | Urge Incontinence | OFFSIDES | ||
| 538 | Urinary hesitation | Canada Vigilance: 1 | Canada Vigilance | |
| 539 | Vaginal mucosal blistering | OFFSIDES | ||
| 540 | Vasculitis, Leukocytoclastic, Cutaneous | 6715616 | CTD | |
| 541 | Vasculitis | SIDER | ||
| 542 | Vasodilation procedure | SIDER | ||
| 543 | Vasodilation | SIDER | ||
| 544 | Venous thrombosis limb | OFFSIDES | ||
| 545 | Violence-related symptom | OFFSIDES | ||
| 546 | Vision Disorders | 2310343 | CTD | |
| 547 | Visual disturbance | SIDER | ||
| 548 | Wakefulness | SIDER | ||
| 549 | Weight Gain | OFFSIDES | ||
| 550 | Wound dehiscence | OFFSIDES | ||
| 551 | Xerostomia | 2521065 18562067 | CTD | |
| 552 | bad taste | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.