Bromocriptine
(NOJMTMIRQRDZMT-GSPXQYRGSA-N)
Structure
- SMILES
- CS(=O)(=O)O.CC(C[C@H]1C(=O)N2CCC[C@H]2[C@]2(N1C(=O)[C@@](O2)(NC(=O)[C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c([nH]3)Br)C(C)C)O)C
- Molecular Formula:
- C33H44BrN5O8S
- Molecular Weight:
- 750.700
- Log P:
- 3.9822
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 180.96
- CAS Number(s):
- 22260-51-1
Synonym(s)
1.
Bromocriptine
2.
2-Bromoergocryptine
3.
Bromocryptin
4.
2-Bromo-alpha-ergocryptine
5.
2-Bromo-alpha-ergokryptine
6.
2-Bromoergocryptine Mesylate
7.
2-Bromoergocryptine Methanesulfonate
8.
2-Bromoergokryptine
9.
Bromocriptin
10.
Bromocriptine Mesylate
11.
CB-154
12.
Parlodel
13.
2 Bromo alpha ergocryptine
14.
2 Bromo alpha ergokryptine
15.
2 Bromoergocryptine
16.
2 Bromoergocryptine Mesylate
17.
2 Bromoergocryptine Methanesulfonate
18.
2 Bromoergokryptine
19.
CB 154
20.
CB154
21.
Mesylate, 2-Bromoergocryptine
22.
Mesylate, Bromocriptine
23.
Methanesulfonate, 2-Bromoergocryptine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 67 | US FAERS | |
| 2 | Nausea | FAERS: 60 | US FAERS | |
| 3 | Dizziness | FAERS: 51 | US FAERS | |
| 4 | Drug exposure during pregnancy | FAERS: 49 | US FAERS | |
| 5 | Vomiting | FAERS: 46 | US FAERS | |
| 6 | Syncope | FAERS: 32 | US FAERS | |
| 7 | Malaise | FAERS: 28 | US FAERS | |
| 8 | Blood prolactin increased | FAERS: 27 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 26 | US FAERS | |
| 10 | Somnolence | FAERS: 23 | US FAERS | |
| 11 | Maternal exposure during pregnancy | FAERS: 17 | US FAERS | |
| 12 | Hypotension | FAERS: 16 | US FAERS | |
| 13 | Pain | FAERS: 15 | US FAERS | |
| 14 | Anxiety | FAERS: 14 | US FAERS | |
| 15 | Asthenia | FAERS: 14 | US FAERS | |
| 16 | Tremor | FAERS: 14 | US FAERS | |
| 17 | Fatigue | FAERS: 13 | US FAERS | |
| 18 | Drug ineffective | FAERS: 12 | US FAERS | |
| 19 | Retching | FAERS: 11 | US FAERS | |
| 20 | Vertigo | FAERS: 10 | US FAERS | |
| 21 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 22 | Pallor | FAERS: 8 | US FAERS | |
| 23 | Swelling | FAERS: 8 | US FAERS | |
| 24 | Visual Impairment | FAERS: 8 | US FAERS | |
| 25 | Visual disturbance | FAERS: 8 | US FAERS | |
| 26 | Cardiomegaly | FAERS: 7 | US FAERS | |
| 27 | Neck Pain | FAERS: 7 | US FAERS | |
| 28 | Peripartum cardiomyopathy | FAERS: 7 | US FAERS | |
| 29 | Abdominal Pain | FAERS: 6 | US FAERS | |
| 30 | Arthralgia | FAERS: 6 | US FAERS | |
| 31 | Blindness | FAERS: 6 | US FAERS | |
| 32 | Drug dose omission | FAERS: 6 | US FAERS | |
| 33 | Dysarthria | FAERS: 6 | US FAERS | |
| 34 | Ejection Fraction Decreased | FAERS: 6 | US FAERS | |
| 35 | Eye pain | FAERS: 6 | US FAERS | |
| 36 | Memory impairment | FAERS: 6 | US FAERS | |
| 37 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 38 | Neuroleptic Malignant Syndrome | FAERS: 6 | US FAERS | |
| 39 | Obsessive-Compulsive Disorder | FAERS: 6 | US FAERS | |
| 40 | Accidental exposure | FAERS: 5 | US FAERS | |
| 41 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 42 | Brain natriuretic peptide increased | FAERS: 5 | US FAERS | |
| 43 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 44 | Cold sweat | FAERS: 5 | US FAERS | |
| 45 | Delirium | FAERS: 5 | US FAERS | |
| 46 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 47 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 48 | Hypothyroidism | FAERS: 5 | US FAERS | |
| 49 | Myalgia | FAERS: 5 | US FAERS | |
| 50 | Pulmonary congestion | FAERS: 5 | US FAERS | |
| 51 | Shock | FAERS: 5 | US FAERS | |
| 52 | Sinus bradycardia | FAERS: 5 | US FAERS | |
| 53 | Suicide attempt | FAERS: 5 | US FAERS | |
| 54 | Tachycardia | FAERS: 5 | US FAERS | |
| 55 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 56 | Agitation | FAERS: 4 | US FAERS | |
| 57 | Alopecia | FAERS: 4 | US FAERS | |
| 58 | Aortic valve sclerosis | FAERS: 4 | US FAERS | |
| 59 | Aphasia | FAERS: 4 | US FAERS | |
| 60 | Chest Pain | FAERS: 4 | US FAERS | |
| 61 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 62 | Disorientation | FAERS: 4 | US FAERS | |
| 63 | Drug Dependence | FAERS: 4 | US FAERS | |
| 64 | Dysgeusia | FAERS: 4 | US FAERS | |
| 65 | Dysuria | FAERS: 4 | US FAERS | |
| 66 | Gastritis | FAERS: 4 | US FAERS | |
| 67 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 68 | Head discomfort | FAERS: 4 | US FAERS | |
| 69 | Hypophysectomy | FAERS: 4 | US FAERS | |
| 70 | Labyrinthitis | FAERS: 4 | US FAERS | |
| 71 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 72 | Ocular icterus | FAERS: 4 | US FAERS | |
| 73 | Palpitations | FAERS: 4 | US FAERS | |
| 74 | Photophobia | FAERS: 4 | US FAERS | |
| 75 | Pregnancy | FAERS: 4 | US FAERS | |
| 76 | Proteinuria | FAERS: 4 | US FAERS | |
| 77 | Pruritus | FAERS: 4 | US FAERS | |
| 78 | Tinnitus | FAERS: 4 | US FAERS | |
| 79 | Toothache | FAERS: 4 | US FAERS | |
| 80 | Trigeminal Neuralgia | FAERS: 4 | US FAERS | |
| 81 | nervous system disorder | FAERS: 4 | US FAERS | |
| 82 | Abasia | FAERS: 3 | US FAERS | |
| 83 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 84 | Abdominal tenderness | FAERS: 3 | US FAERS | |
| 85 | Acne | FAERS: 3 | US FAERS | |
| 86 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 87 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 88 | Amnesia | FAERS: 3 | US FAERS | |
| 89 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 90 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 91 | Breast Feeding | FAERS: 3 | US FAERS | |
| 92 | Cholecystitis | FAERS: 3 | US FAERS | |
| 93 | Disease Progression | FAERS: 3 | US FAERS | |
| 94 | Ectopic Pregnancy | FAERS: 3 | US FAERS | |
| 95 | Electroencephalogram abnormal | FAERS: 3 | US FAERS | |
| 96 | Epilepsy | FAERS: 3 | US FAERS | |
| 97 | Fallopian tube perforation | FAERS: 3 | US FAERS | |
| 98 | Feeling of body temperature change | FAERS: 3 | US FAERS | |
| 99 | Hemiplegia | FAERS: 3 | US FAERS | |
| 100 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 101 | Laparotomy | FAERS: 3 | US FAERS | |
| 102 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 103 | Nervousness | FAERS: 3 | US FAERS | |
| 104 | Pancytopenia | FAERS: 3 | US FAERS | |
| 105 | Presyncope | FAERS: 3 | US FAERS | |
| 106 | Product use issue | FAERS: 3 | US FAERS | |
| 107 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 108 | Salpingectomy | FAERS: 3 | US FAERS | |
| 109 | Stress | FAERS: 3 | US FAERS | |
| 110 | Uterine cervical pain | FAERS: 3 | US FAERS | |
| 111 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 112 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 113 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 114 | Acromegaly | FAERS: 2 | US FAERS | |
| 115 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 116 | Amaurosis | FAERS: 2 | US FAERS | |
| 117 | Anal Ulcer | FAERS: 2 | US FAERS | |
| 118 | Apparent death | FAERS: 2 | US FAERS | |
| 119 | Arterial Injury | FAERS: 2 | US FAERS | |
| 120 | Arthropathy | FAERS: 2 | US FAERS | |
| 121 | Asthenopia | FAERS: 2 | US FAERS | |
| 122 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 123 | Autoimmune thyroiditis | FAERS: 2 | US FAERS | |
| 124 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 125 | Back Pain | FAERS: 2 | US FAERS | |
| 126 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 127 | Blood corticotrophin increased | FAERS: 2 | US FAERS | |
| 128 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 129 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 130 | Blood urea increased | FAERS: 2 | US FAERS | |
| 131 | Breast engorgement | FAERS: 2 | US FAERS | |
| 132 | Breast hyperplasia | FAERS: 2 | US FAERS | |
| 133 | Brief psychotic disorder, with postpartum onset | FAERS: 2 | US FAERS | |
| 134 | Bromoderma | FAERS: 2 | US FAERS | |
| 135 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 136 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 137 | Cataract | FAERS: 2 | US FAERS | |
| 138 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 139 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 140 | Cheilitis | FAERS: 2 | US FAERS | |
| 141 | Cholestasis | FAERS: 2 | US FAERS | |
| 142 | Clubbing | FAERS: 2 | US FAERS | |
| 143 | Consciousness fluctuating | FAERS: 2 | US FAERS | |
| 144 | Constipation | FAERS: 2 | US FAERS | |
| 145 | Crying | FAERS: 2 | US FAERS | |
| 146 | Cyanosis | FAERS: 2 | US FAERS | |
| 147 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 148 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 149 | Dehydration | FAERS: 2 | US FAERS | |
| 150 | Dementia | FAERS: 2 | US FAERS | |
| 151 | Dentofacial anomaly | FAERS: 2 | US FAERS | |
| 152 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 153 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 154 | Diplopia | FAERS: 2 | US FAERS | |
| 155 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 156 | Dyspnoea exacerbated | FAERS: 2 | US FAERS | |
| 157 | Dystonia | FAERS: 2 | US FAERS | |
| 158 | Emotional distress | FAERS: 2 | US FAERS | |
| 159 | Empty Sella Syndrome | FAERS: 2 | US FAERS | |
| 160 | Encephalocele | FAERS: 2 | US FAERS | |
| 161 | Epistaxis | FAERS: 2 | US FAERS | |
| 162 | Erythema | FAERS: 2 | US FAERS | |
| 163 | Expired product administered | FAERS: 2 | US FAERS | |
| 164 | Feeling Cold | FAERS: 2 | US FAERS | |
| 165 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 166 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 167 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 168 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 169 | Hypothalamo-pituitary disorder | FAERS: 2 | US FAERS | |
| 170 | Hysterectomy | FAERS: 2 | US FAERS | |
| 171 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 172 | Infection | FAERS: 2 | US FAERS | |
| 173 | Inflammation | FAERS: 2 | US FAERS | |
| 174 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 175 | Joint injury | FAERS: 2 | US FAERS | |
| 176 | Keratorhexis | FAERS: 2 | US FAERS | |
| 177 | Lacrimation decreased | FAERS: 2 | US FAERS | |
| 178 | Lactation Disorder | FAERS: 2 | US FAERS | |
| 179 | Leukocytosis | FAERS: 2 | US FAERS | |
| 180 | Loose tooth | FAERS: 2 | US FAERS | |
| 181 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 182 | Mastitis | FAERS: 2 | US FAERS | |
| 183 | Meningorrhagia | FAERS: 2 | US FAERS | |
| 184 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 185 | Microlithiasis | FAERS: 2 | US FAERS | |
| 186 | Mitral Valve Stenosis | FAERS: 2 | US FAERS | |
| 187 | Night sweats | FAERS: 2 | US FAERS | |
| 188 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 189 | Otosclerosis | FAERS: 2 | US FAERS | |
| 190 | Overdose | FAERS: 2 | US FAERS | |
| 191 | PO2 decreased | FAERS: 2 | US FAERS | |
| 192 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 193 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 194 | Pharmaceutical product counterfeit | FAERS: 2 | US FAERS | |
| 195 | Pituitary infarction | FAERS: 2 | US FAERS | |
| 196 | Pneumocystis jiroveci pneumonia | FAERS: 2 | US FAERS | |
| 197 | Pneumonia | FAERS: 2 | US FAERS | |
| 198 | Polyuria | FAERS: 2 | US FAERS | |
| 199 | Prolactinoma | FAERS: 2 | US FAERS | |
| 200 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 201 | Renal cyst | FAERS: 2 | US FAERS | |
| 202 | Respiratory distress | FAERS: 2 | US FAERS | |
| 203 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 204 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 205 | Schizophrenia | FAERS: 2 | US FAERS | |
| 206 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 207 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 208 | Skin reaction | FAERS: 2 | US FAERS | |
| 209 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 210 | Thrombosis | FAERS: 2 | US FAERS | |
| 211 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 212 | Transient psychosis | FAERS: 2 | US FAERS | |
| 213 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 214 | Tumour haemorrhage | FAERS: 2 | US FAERS | |
| 215 | Urticaria | FAERS: 2 | US FAERS | |
| 216 | Weight decreased | FAERS: 2 | US FAERS | |
| 217 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 218 | Abscess | FAERS: 1 | US FAERS | |
| 219 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 220 | Acute tonsillitis | FAERS: 1 | US FAERS | |
| 221 | Ageusia | FAERS: 1 | US FAERS | |
| 222 | Akinesia | FAERS: 1 | US FAERS | |
| 223 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 224 | Anencephaly | FAERS: 1 | US FAERS | |
| 225 | Aneurysm | FAERS: 1 | US FAERS | |
| 226 | Anger | FAERS: 1 | US FAERS | |
| 227 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 228 | Angiogram cerebral abnormal | FAERS: 1 | US FAERS | |
| 229 | Anorexia | FAERS: 1 | US FAERS | |
| 230 | Anosmia | FAERS: 1 | US FAERS | |
| 231 | Anuria | FAERS: 1 | US FAERS | |
| 232 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 233 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 234 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 235 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 236 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 237 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 238 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 239 | Blood growth hormone abnormal | FAERS: 1 | US FAERS | |
| 240 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 241 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 242 | Bone erosion | FAERS: 1 | US FAERS | |
| 243 | Bone pain | FAERS: 1 | US FAERS | |
| 244 | Bradycardia | FAERS: 1 | US FAERS | |
| 245 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 246 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 247 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 248 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 249 | Burning sensation | FAERS: 1 | US FAERS | |
| 250 | Cachexia | FAERS: 1 | US FAERS | |
| 251 | Cataplexy | FAERS: 1 | US FAERS | |
| 252 | Catarrh | FAERS: 1 | US FAERS | |
| 253 | Cerebral arteritis | FAERS: 1 | US FAERS | |
| 254 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 255 | Chest discomfort | FAERS: 1 | US FAERS | |
| 256 | Chills | FAERS: 1 | US FAERS | |
| 257 | Cholangitis | FAERS: 1 | US FAERS | |
| 258 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 259 | Completed Suicide | FAERS: 1 | US FAERS | |
| 260 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 261 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 262 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 263 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 264 | Cystitis | FAERS: 1 | US FAERS | |
| 265 | Deafness | FAERS: 1 | US FAERS | |
| 266 | Death of relative | FAERS: 1 | US FAERS | |
| 267 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 268 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 269 | Depressed mood | FAERS: 1 | US FAERS | |
| 270 | Dermatitis | FAERS: 1 | US FAERS | |
| 271 | Device related infection | FAERS: 1 | US FAERS | |
| 272 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 273 | Drug abuse | FAERS: 1 | US FAERS | |
| 274 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 275 | Drug administration error | FAERS: 1 | US FAERS | |
| 276 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 277 | Drug resistance | FAERS: 1 | US FAERS | |
| 278 | Drug toxicity | FAERS: 1 | US FAERS | |
| 279 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 280 | Dry skin | FAERS: 1 | US FAERS | |
| 281 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 282 | Duodenitis | FAERS: 1 | US FAERS | |
| 283 | Dysgraphia | FAERS: 1 | US FAERS | |
| 284 | Dyspepsia | FAERS: 1 | US FAERS | |
| 285 | Ecchymosis | FAERS: 1 | US FAERS | |
| 286 | Eclampsia | FAERS: 1 | US FAERS | |
| 287 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 288 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 289 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 290 | Emotional disorder | FAERS: 1 | US FAERS | |
| 291 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 292 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 293 | Expired drug administered | FAERS: 1 | US FAERS | |
| 294 | Exposure to chemical pollution | FAERS: 1 | US FAERS | |
| 295 | Eye Burns | FAERS: 1 | US FAERS | |
| 296 | Facial Paresis | FAERS: 1 | US FAERS | |
| 297 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 298 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 299 | Fibrosis | FAERS: 1 | US FAERS | |
| 300 | Flatulence | FAERS: 1 | US FAERS | |
| 301 | Flight of ideas | FAERS: 1 | US FAERS | |
| 302 | Flushing | FAERS: 1 | US FAERS | |
| 303 | Folliculitis | FAERS: 1 | US FAERS | |
| 304 | Galactostasis | FAERS: 1 | US FAERS | |
| 305 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 306 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 307 | Gaze palsy | FAERS: 1 | US FAERS | |
| 308 | Genitourinary tract infection | FAERS: 1 | US FAERS | |
| 309 | Head Banging | FAERS: 1 | US FAERS | |
| 310 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 311 | Hemiparesis | FAERS: 1 | US FAERS | |
| 312 | Hyperpituitarism | FAERS: 1 | US FAERS | |
| 313 | Hypertrophy | FAERS: 1 | US FAERS | |
| 314 | Hypophagia | FAERS: 1 | US FAERS | |
| 315 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 316 | Immobile | FAERS: 1 | US FAERS | |
| 317 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 318 | Impaired work ability | FAERS: 1 | US FAERS | |
| 319 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 320 | Incoherent | FAERS: 1 | US FAERS | |
| 321 | Incontinence | FAERS: 1 | US FAERS | |
| 322 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 323 | Intubation | FAERS: 1 | US FAERS | |
| 324 | Lack of satiety | FAERS: 1 | US FAERS | |
| 325 | Lethargy | FAERS: 1 | US FAERS | |
| 326 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 327 | Lipohypertrophy | FAERS: 1 | US FAERS | |
| 328 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 329 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 330 | Lymphoma | FAERS: 1 | US FAERS | |
| 331 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 332 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 333 | Mastectomy | FAERS: 1 | US FAERS | |
| 334 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 335 | Meningism | FAERS: 1 | US FAERS | |
| 336 | Menorrhagia | FAERS: 1 | US FAERS | |
| 337 | Mental impairment | FAERS: 1 | US FAERS | |
| 338 | Mitral valve sclerosis | FAERS: 1 | US FAERS | |
| 339 | Mood swings | FAERS: 1 | US FAERS | |
| 340 | Multiple Pregnancy | FAERS: 1 | US FAERS | |
| 341 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 342 | Mydriasis | FAERS: 1 | US FAERS | |
| 343 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 344 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 345 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 346 | Oculogyration | FAERS: 1 | US FAERS | |
| 347 | Oliguria | FAERS: 1 | US FAERS | |
| 348 | Osteoporosis | FAERS: 1 | US FAERS | |
| 349 | Pain of skin | FAERS: 1 | US FAERS | |
| 350 | Paranoia | FAERS: 1 | US FAERS | |
| 351 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 352 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 353 | Petechiae | FAERS: 1 | US FAERS | |
| 354 | Pharyngitis | FAERS: 1 | US FAERS | |
| 355 | Phlebitis | FAERS: 1 | US FAERS | |
| 356 | Phonophobia | FAERS: 1 | US FAERS | |
| 357 | Pleurisy | FAERS: 1 | US FAERS | |
| 358 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 359 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 360 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 361 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 362 | Product quality issue | FAERS: 1 | US FAERS | |
| 363 | Product substitution issue | FAERS: 1 | US FAERS | |
| 364 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 365 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 366 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 367 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 368 | Purpura | FAERS: 1 | US FAERS | |
| 369 | Purulent discharge | FAERS: 1 | US FAERS | |
| 370 | Renal mass | FAERS: 1 | US FAERS | |
| 371 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 372 | Restlessness | FAERS: 1 | US FAERS | |
| 373 | Rhinitis | FAERS: 1 | US FAERS | |
| 374 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 375 | Secretory adenoma of pituitary | FAERS: 1 | US FAERS | |
| 376 | Serum Sickness | FAERS: 1 | US FAERS | |
| 377 | Sexual abuse | FAERS: 1 | US FAERS | |
| 378 | Sinusitis | FAERS: 1 | US FAERS | |
| 379 | Skin necrosis | FAERS: 1 | US FAERS | |
| 380 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 381 | Slow speech | FAERS: 1 | US FAERS | |
| 382 | Soliloquy | FAERS: 1 | US FAERS | |
| 383 | Stillbirth | FAERS: 1 | US FAERS | |
| 384 | Strawberry tongue | FAERS: 1 | US FAERS | |
| 385 | Sudden death | FAERS: 1 | US FAERS | |
| 386 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 387 | Surgical failure | FAERS: 1 | US FAERS | |
| 388 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 389 | Tension Headache | FAERS: 1 | US FAERS | |
| 390 | Tetany | FAERS: 1 | US FAERS | |
| 391 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 392 | Tonsillitis | FAERS: 1 | US FAERS | |
| 393 | Tricuspid valve sclerosis | FAERS: 1 | US FAERS | |
| 394 | Troponin T increased | FAERS: 1 | US FAERS | |
| 395 | Ultrasound skull abnormal | FAERS: 1 | US FAERS | |
| 396 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 397 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 398 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 399 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 400 | Viral myositis | FAERS: 1 | US FAERS | |
| 401 | Walking aid user | FAERS: 1 | US FAERS | |
| 402 | Yawning | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.