venetoclax
(LQBVNQSMGBZMKD-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc(cc1)C1=C(CCC(C1)(C)C)CN1CCN(CC1)c1ccc(c(c1)Oc1cnc2c(c1)cc[nH]2)C(=O)NS(=O)(=O)c1ccc(c(c1)[N+](=O)[O-])NCC1CCOCC1
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX52
- Molecular Formula:
- C45H50ClN7O7S
- Molecular Weight:
- 868.439
- Log P:
- 10.7307
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 3
- TPSA:
- 183.09
- CAS Number(s):
- 1257044-40-8
Synonym(s)
1.
venetoclax
2.
4-(4-((2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-en-1-yl)methyl)piperazin-1-yl)-N-((3-nitro-4-((tetrahydro-2H-pyran-4-ylmethyl)amino)phenyl)sulfonyl)-2-(1H-pyrrolo(2,3-b)pyridin-5-yloxy)benzamide
3.
ABT-199
4.
GDC-0199
5.
RG-7601
6.
RG7601
7.
Venclexta
8.
benzamide, 4-(4-((2-(4-chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl)methyl)-1-piperazinyl)-n-((3-nitro-4-(((tetrahydro-2h-pyran-4-yl)methyl)amino)phenyl)sulfonyl)-2-(1h-pyrrolo(2,3-b)pyridin-5-yloxy)-
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Intentional product use issue | FAERS: 430 | US FAERS | |
| 2 | Disease Progression | FAERS: 129 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Neutropenia | FAERS: 113 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 4 | Pneumonia | FAERS: 106 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 5 | Infection | FAERS: 102 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Drug ineffective | FAERS: 75 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 7 | Fatigue | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Sepsis | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Asthenia | FAERS: 60 | US FAERS | |
| 10 | Nausea | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Hospice Care | FAERS: 56 | US FAERS | |
| 12 | Malaise | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | White blood cell count decreased | FAERS: 55 | US FAERS | |
| 14 | Thrombocytopenia | FAERS: 44 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 15 | Richter's syndrome | FAERS: 43 | US FAERS | |
| 16 | Pancytopenia | FAERS: 37 | US FAERS | |
| 17 | Lymphadenopathy | FAERS: 35 | US FAERS | |
| 18 | Vomiting | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | General physical health deterioration | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Product use in unapproved indication | FAERS: 32 | US FAERS | |
| 21 | Blood count abnormal | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Pain | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Febrile Neutropenia | FAERS: 29 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 24 | Malignant neoplasm progression | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Cytopenia | FAERS: 26 | US FAERS | |
| 26 | Dehydration | FAERS: 23 | US FAERS | |
| 27 | Respiratory Failure | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Toxicity to various agents | FAERS: 21 | US FAERS | |
| 29 | Blood creatinine increased | FAERS: 20 | US FAERS | |
| 30 | Dizziness | FAERS: 20 | US FAERS | |
| 31 | Stem cell transplant | FAERS: 20 | US FAERS | |
| 32 | Weight decreased | FAERS: 20 | US FAERS | |
| 33 | Septic Shock | FAERS: 19 | US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 17 | US FAERS | |
| 35 | Splenomegaly | FAERS: 17 | US FAERS | |
| 36 | Atrial Fibrillation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Chills | FAERS: 16 | US FAERS | |
| 38 | Constipation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Influenza | FAERS: 16 | US FAERS | |
| 40 | Feeling abnormal | FAERS: 14 | US FAERS | |
| 41 | Hypotension | FAERS: 14 | US FAERS | |
| 42 | Pruritus | FAERS: 14 | US FAERS | |
| 43 | Acute kidney injury | FAERS: 13 | US FAERS | |
| 44 | Blood lactate dehydrogenase increased | FAERS: 13 | US FAERS | |
| 45 | Cellulitis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Lymphoma | FAERS: 13 | US FAERS | |
| 47 | Mantle cell lymphoma | FAERS: 13 | US FAERS | |
| 48 | No adverse event | FAERS: 13 | US FAERS | |
| 49 | Peripheral swelling | FAERS: 13 | US FAERS | |
| 50 | Blood sodium decreased | FAERS: 12 | US FAERS | |
| 51 | MYELODYSPLASTIC SYNDROME | FAERS: 12 | US FAERS | |
| 52 | Platelet Transfusion | FAERS: 12 | US FAERS | |
| 53 | Transplant | FAERS: 12 | US FAERS | |
| 54 | Back Pain | FAERS: 11 | US FAERS | |
| 55 | Drug dose omission | FAERS: 11 | US FAERS | |
| 56 | Full blood count decreased | FAERS: 11 | US FAERS | |
| 57 | Headache | FAERS: 11 | US FAERS | |
| 58 | Incorrect dose administered | FAERS: 10 | US FAERS | |
| 59 | Myocardial Infarction | FAERS: 10 | US FAERS | |
| 60 | Nasopharyngitis | FAERS: 10 | US FAERS | |
| 61 | Neutrophil count decreased | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Sinusitis | FAERS: 10 | US FAERS | |
| 63 | Thrombosis | FAERS: 10 | US FAERS | |
| 64 | Hypophagia | FAERS: 9 | US FAERS | |
| 65 | Skin lesion | FAERS: 9 | US FAERS | |
| 66 | Abdominal Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Arthralgia | FAERS: 8 | US FAERS | |
| 68 | Cardiac Arrest | FAERS: 8 | US FAERS | |
| 69 | treatment failure | FAERS: 8 | US FAERS | |
| 70 | Bacterial sepsis | FAERS: 7 | US FAERS | |
| 71 | Diffuse Large B-Cell Lymphoma | FAERS: 7 | US FAERS | |
| 72 | Intentional device use issue | FAERS: 7 | US FAERS | |
| 73 | Memory impairment | FAERS: 7 | US FAERS | |
| 74 | Myalgia | FAERS: 7 | US FAERS | |
| 75 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 76 | Blood potassium decreased | FAERS: 6 | US FAERS | |
| 77 | Chest Pain | FAERS: 6 | US FAERS | |
| 78 | Haematotoxicity | FAERS: 6 | US FAERS | |
| 79 | Head discomfort | FAERS: 6 | US FAERS | |
| 80 | Hypoxia | FAERS: 6 | US FAERS | |
| 81 | Lower respiratory tract infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Metabolic acidosis | FAERS: 6 | US FAERS | |
| 83 | Pericardial effusion | FAERS: 6 | US FAERS | |
| 84 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 85 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 86 | Tremor | FAERS: 6 | US FAERS | |
| 87 | Unevaluable event | FAERS: 6 | US FAERS | |
| 88 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 89 | nervous system disorder | FAERS: 6 | US FAERS | |
| 90 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 91 | Adverse event | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Appendicitis | FAERS: 5 | US FAERS | |
| 93 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 94 | Blood magnesium decreased | FAERS: 5 | US FAERS | |
| 95 | Clostridium difficile infection | FAERS: 5 | US FAERS | |
| 96 | Deafness | FAERS: 5 | US FAERS | |
| 97 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 98 | Gastrointestinal infection | FAERS: 5 | US FAERS | |
| 99 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 100 | Hypersomnia | FAERS: 5 | US FAERS | |
| 101 | Intestinal Obstruction | FAERS: 5 | US FAERS | |
| 102 | Leukocytosis | FAERS: 5 | US FAERS | |
| 103 | Lymphocyte count increased | FAERS: 5 | US FAERS | |
| 104 | Mental status changes | FAERS: 5 | US FAERS | |
| 105 | Neutropenic sepsis | FAERS: 5 | US FAERS | |
| 106 | Overdose | FAERS: 5 | US FAERS | |
| 107 | Palliative Care | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Product use issue | FAERS: 5 | US FAERS | |
| 109 | Squamous cell carcinoma | FAERS: 5 | US FAERS | |
| 110 | Swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Therapeutic product effect decreased | FAERS: 5 | US FAERS | |
| 112 | Therapy non-responder | FAERS: 5 | US FAERS | |
| 113 | Transaminases increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 115 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 116 | Blood phosphorus increased | FAERS: 4 | US FAERS | |
| 117 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 118 | Bronchopulmonary Aspergillosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Cataract | FAERS: 4 | US FAERS | |
| 120 | Chemotherapy | FAERS: 4 | US FAERS | |
| 121 | Colitis | FAERS: 4 | US FAERS | |
| 122 | Diverticulitis | FAERS: 4 | US FAERS | |
| 123 | Dry skin | FAERS: 4 | US FAERS | |
| 124 | Dysgeusia | FAERS: 4 | US FAERS | |
| 125 | Emotional distress | FAERS: 4 | US FAERS | |
| 126 | Fluid overload | FAERS: 4 | US FAERS | |
| 127 | Gout | FAERS: 4 | US FAERS | |
| 128 | Hepatitis B | FAERS: 4 | US FAERS | |
| 129 | Hepatitis | FAERS: 4 | US FAERS | |
| 130 | Hernia | FAERS: 4 | US FAERS | |
| 131 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 132 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 133 | Leukopenia | FAERS: 4 | US FAERS | |
| 134 | Metastatic Neoplasm | FAERS: 4 | US FAERS | |
| 135 | Mucormycosis | FAERS: 4 | US FAERS | |
| 136 | Product dispensing error | FAERS: 4 | US FAERS | |
| 137 | Respiratory distress | FAERS: 4 | US FAERS | |
| 138 | Therapy cessation | FAERS: 4 | US FAERS | |
| 139 | Visual Impairment | FAERS: 4 | US FAERS | |
| 140 | intensive care | FAERS: 4 | US FAERS | |
| 141 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 142 | Alopecia | FAERS: 3 | US FAERS | |
| 143 | Amnesia | FAERS: 3 | US FAERS | |
| 144 | Aphasia | FAERS: 3 | US FAERS | |
| 145 | Ataxia | FAERS: 3 | US FAERS | |
| 146 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 147 | Blast cell count increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Blastic plasmacytoid dendritic cell neoplasia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Blood urea increased | FAERS: 3 | US FAERS | |
| 150 | Bone pain | FAERS: 3 | US FAERS | |
| 151 | Cholecystitis | FAERS: 3 | US FAERS | |
| 152 | Clostridium difficile colitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Cystitis | FAERS: 3 | US FAERS | |
| 154 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 155 | Escherichia infection | FAERS: 3 | US FAERS | |
| 156 | Escherichia sepsis | FAERS: 3 | US FAERS | |
| 157 | Escherichia urinary tract infection | FAERS: 3 | US FAERS | |
| 158 | Full blood count abnormal | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Gait inability | FAERS: 3 | US FAERS | |
| 160 | Gastrointestinal toxicity | FAERS: 3 | US FAERS | |
| 161 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 162 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 163 | Hepatosplenomegaly | FAERS: 3 | US FAERS | |
| 164 | Hyperpyrexia | FAERS: 3 | US FAERS | |
| 165 | Ileus | FAERS: 3 | US FAERS | |
| 166 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 167 | Inflammation | FAERS: 3 | US FAERS | |
| 168 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 169 | Lymphadenitis | FAERS: 3 | US FAERS | |
| 170 | Lymphocyte count decreased | FAERS: 3 | US FAERS | |
| 171 | Monoclonal immunoglobulin present | FAERS: 3 | US FAERS | |
| 172 | Monocyte count decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 174 | Osteopenia | FAERS: 3 | US FAERS | |
| 175 | Phlebitis | FAERS: 3 | US FAERS | |
| 176 | Platelet count abnormal | FAERS: 3 | US FAERS | |
| 177 | Poisoning | FAERS: 3 | US FAERS | |
| 178 | Post procedural infection | FAERS: 3 | US FAERS | |
| 179 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 180 | Splenectomy | FAERS: 3 | US FAERS | |
| 181 | Stomatitis | FAERS: 3 | US FAERS | |
| 182 | Subcutaneous Abscess | FAERS: 3 | US FAERS | |
| 183 | Syncope | FAERS: 3 | US FAERS | |
| 184 | Tachycardia | FAERS: 3 | US FAERS | |
| 185 | Terminal state | FAERS: 3 | US FAERS | |
| 186 | Tuberculosis | FAERS: 3 | US FAERS | |
| 187 | Urinary Retention | FAERS: 3 | US FAERS | |
| 188 | Urticaria | FAERS: 3 | US FAERS | |
| 189 | Vascular device infection | FAERS: 3 | US FAERS | |
| 190 | jaundice | FAERS: 3 | US FAERS | |
| 191 | ATRIAL ENLARGEMENT | FAERS: 2 | US FAERS | |
| 192 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 193 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 194 | Anal abscess | FAERS: 2 | US FAERS | |
| 195 | Angioplasty | FAERS: 2 | US FAERS | |
| 196 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 197 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 198 | Anxiety | FAERS: 2 | US FAERS | |
| 199 | Aphonia | FAERS: 2 | US FAERS | |
| 200 | Arthropathy | FAERS: 2 | US FAERS | |
| 201 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 202 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 203 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 204 | Blood product transfusion dependent | FAERS: 2 | US FAERS | |
| 205 | Blood urine present | FAERS: 2 | US FAERS | |
| 206 | Bone marrow infiltration | FAERS: 2 | US FAERS | |
| 207 | Bradycardia | FAERS: 2 | US FAERS | |
| 208 | Bruxism | FAERS: 2 | US FAERS | |
| 209 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 210 | Chest discomfort | FAERS: 2 | US FAERS | |
| 211 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 212 | Cholestasis | FAERS: 2 | US FAERS | |
| 213 | Chromaturia | FAERS: 2 | US FAERS | |
| 214 | Complications of bone marrow transplant | FAERS: 2 | US FAERS | |
| 215 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 216 | Dermatitis | FAERS: 2 | US FAERS | |
| 217 | Device related infection | FAERS: 2 | US FAERS | |
| 218 | Device related sepsis | FAERS: 2 | US FAERS | |
| 219 | Diffuse large B-cell lymphoma refractory | FAERS: 2 | US FAERS | |
| 220 | Discomfort | FAERS: 2 | US FAERS | |
| 221 | Disease recurrence | FAERS: 2 | US FAERS | |
| 222 | Disease risk factor | FAERS: 2 | US FAERS | |
| 223 | Diverticulum | FAERS: 2 | US FAERS | |
| 224 | Donor leukocyte infusion | FAERS: 2 | US FAERS | |
| 225 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 226 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 227 | Dysarthria | FAERS: 2 | US FAERS | |
| 228 | Dysuria | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Ecchymosis | FAERS: 2 | US FAERS | |
| 230 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 231 | Epilepsy | FAERS: 2 | US FAERS | |
| 232 | Epistaxis | FAERS: 2 | US FAERS | |
| 233 | Erythema | FAERS: 2 | US FAERS | |
| 234 | Exploratory operation | FAERS: 2 | US FAERS | |
| 235 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 236 | Febrile bone marrow aplasia | FAERS: 2 | US FAERS | |
| 237 | Food Poisoning | FAERS: 2 | US FAERS | |
| 238 | Genital swelling | FAERS: 2 | US FAERS | |
| 239 | Granulocytes abnormal | FAERS: 2 | US FAERS | |
| 240 | Hemiplegia | FAERS: 2 | US FAERS | |
| 241 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 242 | Hyperleukocytosis | FAERS: 2 | US FAERS | |
| 243 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 244 | Intra-abdominal fluid collection | FAERS: 2 | US FAERS | |
| 245 | Joint Instability | FAERS: 2 | US FAERS | |
| 246 | Joint swelling | FAERS: 2 | US FAERS | |
| 247 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 248 | Lethargy | FAERS: 2 | US FAERS | |
| 249 | Limb injury | FAERS: 2 | US FAERS | |
| 250 | Lip swelling | FAERS: 2 | US FAERS | |
| 251 | Lower respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 252 | Lymphocytosis | FAERS: 2 | US FAERS | |
| 253 | Mantle cell lymphoma refractory | FAERS: 2 | US FAERS | |
| 254 | Medical device discomfort | FAERS: 2 | US FAERS | |
| 255 | Medication Error | FAERS: 2 | US FAERS | |
| 256 | Mental impairment | FAERS: 2 | US FAERS | |
| 257 | Multimorbidity | FAERS: 2 | US FAERS | |
| 258 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 259 | Myocarditis | FAERS: 2 | US FAERS | |
| 260 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 261 | Nerve injury | FAERS: 2 | US FAERS | |
| 262 | Oncologic complication | FAERS: 2 | US FAERS | |
| 263 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 264 | Palpitations | FAERS: 2 | US FAERS | |
| 265 | Pancreatitis | FAERS: 2 | US FAERS | |
| 266 | Pathogen resistance | FAERS: 2 | US FAERS | |
| 267 | Petechiae | FAERS: 2 | US FAERS | |
| 268 | Post procedural complication | FAERS: 2 | US FAERS | |
| 269 | Post procedural constipation | FAERS: 2 | US FAERS | |
| 270 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 271 | Procedural complication | FAERS: 2 | US FAERS | |
| 272 | Proctitis | FAERS: 2 | US FAERS | |
| 273 | Product size issue | FAERS: 2 | US FAERS | |
| 274 | Product storage error | FAERS: 2 | US FAERS | |
| 275 | Product use complaint | FAERS: 2 | US FAERS | |
| 276 | Protein total decreased | FAERS: 2 | US FAERS | |
| 277 | Refractory cancer | FAERS: 2 | US FAERS | |
| 278 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 279 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 280 | Retching | FAERS: 2 | US FAERS | |
| 281 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 282 | Salvage Therapy | FAERS: 2 | US FAERS | |
| 283 | Skin laceration | FAERS: 2 | US FAERS | |
| 284 | Somnolence | FAERS: 2 | US FAERS | |
| 285 | Splenic Infarction | FAERS: 2 | US FAERS | |
| 286 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 287 | Stress | FAERS: 2 | US FAERS | |
| 288 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 289 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 290 | Tinnitus | FAERS: 2 | US FAERS | |
| 291 | Tooth Infection | FAERS: 2 | US FAERS | |
| 292 | Transfusion Reaction | FAERS: 2 | US FAERS | |
| 293 | Urinary straining | FAERS: 2 | US FAERS | |
| 294 | Vertigo | FAERS: 2 | US FAERS | |
| 295 | Wound Complication | FAERS: 2 | US FAERS | |
| 296 | furuncle | FAERS: 2 | US FAERS | |
| 297 | Abasia | FAERS: 1 | US FAERS | |
| 298 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 299 | Abdominal mass | FAERS: 1 | US FAERS | |
| 300 | Abscess | FAERS: 1 | US FAERS | |
| 301 | Acantholysis | FAERS: 1 | US FAERS | |
| 302 | Accidental overdose | FAERS: 1 | US FAERS | |
| 303 | Acquired von Willebrand's disease | FAERS: 1 | US FAERS | |
| 304 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 305 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 306 | Ageusia | FAERS: 1 | US FAERS | |
| 307 | Agitation | FAERS: 1 | US FAERS | |
| 308 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 309 | Alveolitis | FAERS: 1 | US FAERS | |
| 310 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 311 | Anal Fistula | FAERS: 1 | US FAERS | |
| 312 | Aneurysm | FAERS: 1 | US FAERS | |
| 313 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 314 | Anisocytosis | FAERS: 1 | US FAERS | |
| 315 | Anorectal cellulitis | FAERS: 1 | US FAERS | |
| 316 | Anorectal infection | FAERS: 1 | US FAERS | |
| 317 | Anosmia | FAERS: 1 | US FAERS | |
| 318 | Antibody test positive | FAERS: 1 | US FAERS | |
| 319 | Anuria | FAERS: 1 | US FAERS | |
| 320 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 321 | Apparent death | FAERS: 1 | US FAERS | |
| 322 | Arthropod bite | FAERS: 1 | US FAERS | |
| 323 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 324 | Aspergillus test | FAERS: 1 | US FAERS | |
| 325 | Asphyxia | FAERS: 1 | US FAERS | |
| 326 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 327 | B-lymphocyte abnormalities | FAERS: 1 | US FAERS | |
| 328 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 329 | Bladder pain | FAERS: 1 | US FAERS | |
| 330 | Blast cell count decreased | FAERS: 1 | US FAERS | |
| 331 | Blast cells present | FAERS: 1 | US FAERS | |
| 332 | Blepharospasm | FAERS: 1 | US FAERS | |
| 333 | Blindness | FAERS: 1 | US FAERS | |
| 334 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 335 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 336 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 337 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 338 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 339 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 340 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 341 | Blood lactate dehydrogenase abnormal | FAERS: 1 | US FAERS | |
| 342 | Blood lactate dehydrogenase decreased | FAERS: 1 | US FAERS | |
| 343 | Blood lactic acid decreased | FAERS: 1 | US FAERS | |
| 344 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 345 | Blood stem cell transplant failure | FAERS: 1 | US FAERS | |
| 346 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 347 | Blood uric acid decreased | FAERS: 1 | US FAERS | |
| 348 | Blunted affect | FAERS: 1 | US FAERS | |
| 349 | Bone marrow necrosis | FAERS: 1 | US FAERS | |
| 350 | Bone marrow reticulin fibrosis | FAERS: 1 | US FAERS | |
| 351 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 352 | Burning sensation | FAERS: 1 | US FAERS | |
| 353 | Bursitis | FAERS: 1 | US FAERS | |
| 354 | Cachexia | FAERS: 1 | US FAERS | |
| 355 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 356 | Cardiac infection | FAERS: 1 | US FAERS | |
| 357 | Cardiac telemetry abnormal | FAERS: 1 | US FAERS | |
| 358 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 359 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 360 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 361 | Choking | FAERS: 1 | US FAERS | |
| 362 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 363 | Chylothorax | FAERS: 1 | US FAERS | |
| 364 | Colectomy | FAERS: 1 | US FAERS | |
| 365 | Completed Suicide | FAERS: 1 | US FAERS | |
| 366 | Complication associated with device | FAERS: 1 | US FAERS | |
| 367 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 368 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 369 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 370 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 371 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 372 | Critical Illness | FAERS: 1 | US FAERS | |
| 373 | Cytogenetic analysis abnormal | FAERS: 1 | US FAERS | |
| 374 | Delirium | FAERS: 1 | US FAERS | |
| 375 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 376 | Depressed mood | FAERS: 1 | US FAERS | |
| 377 | Device connection issue | FAERS: 1 | US FAERS | |
| 378 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 379 | Diffuse large B-cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 380 | Diplopia | FAERS: 1 | US FAERS | |
| 381 | Disease complication | FAERS: 1 | US FAERS | |
| 382 | Disorientation | FAERS: 1 | US FAERS | |
| 383 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 384 | Drug level decreased | FAERS: 1 | US FAERS | |
| 385 | Drug resistance | FAERS: 1 | US FAERS | |
| 386 | Drug screen positive | FAERS: 1 | US FAERS | |
| 387 | Dyschezia | FAERS: 1 | US FAERS | |
| 388 | Dyspepsia | FAERS: 1 | US FAERS | |
| 389 | Dysphonia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 391 | Elbow operation | FAERS: 1 | US FAERS | |
| 392 | Elephantiasis | FAERS: 1 | US FAERS | |
| 393 | Embolic stroke | FAERS: 1 | US FAERS | |
| 394 | Encephalitis | FAERS: 1 | US FAERS | |
| 395 | Enteritis | FAERS: 1 | US FAERS | |
| 396 | Enterocolitis | FAERS: 1 | US FAERS | |
| 397 | Eosinophilia | FAERS: 1 | US FAERS | |
| 398 | Expired product administered | FAERS: 1 | US FAERS | |
| 399 | Eye Infection | FAERS: 1 | US FAERS | |
| 400 | Eye inflammation | FAERS: 1 | US FAERS | |
| 401 | Fanconi Syndrome | FAERS: 1 | US FAERS | |
| 402 | Febrile infection | FAERS: 1 | US FAERS | |
| 403 | Feeling Cold | FAERS: 1 | US FAERS | |
| 404 | Fibrosis | FAERS: 1 | US FAERS | |
| 405 | Flatulence | FAERS: 1 | US FAERS | |
| 406 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 407 | Fluid replacement | FAERS: 1 | US FAERS | |
| 408 | Flushing | FAERS: 1 | US FAERS | |
| 409 | Full blood count increased | FAERS: 1 | US FAERS | |
| 410 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 411 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 412 | Gastric Lavage | FAERS: 1 | US FAERS | |
| 413 | Gastric infection | FAERS: 1 | US FAERS | |
| 414 | Gastritis | FAERS: 1 | US FAERS | |
| 415 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 416 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 417 | Gastrostomy | FAERS: 1 | US FAERS | |
| 418 | General symptom | FAERS: 1 | US FAERS | |
| 419 | Glaucoma | FAERS: 1 | US FAERS | |
| 420 | Glioblastoma | FAERS: 1 | US FAERS | |
| 421 | Glomerular vascular disorder | FAERS: 1 | US FAERS | |
| 422 | Granulocytosis | FAERS: 1 | US FAERS | |
| 423 | Granuloma | FAERS: 1 | US FAERS | |
| 424 | Groin infection | FAERS: 1 | US FAERS | |
| 425 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 426 | Hemiparesis | FAERS: 1 | US FAERS | |
| 427 | Hemiplegic migraine | FAERS: 1 | US FAERS | |
| 428 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 429 | Hepatic infection fungal | FAERS: 1 | US FAERS | |
| 430 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 431 | Hydrothorax | FAERS: 1 | US FAERS | |
| 432 | Hyperferritinaemia | FAERS: 1 | US FAERS | |
| 433 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 434 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 435 | Hyperventilation | FAERS: 1 | US FAERS | |
| 436 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 437 | Hypogonadism | FAERS: 1 | US FAERS | |
| 438 | Hypokinesia | FAERS: 1 | US FAERS | |
| 439 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 440 | Ileal Stenosis | FAERS: 1 | US FAERS | |
| 441 | Immunoglobulins abnormal | FAERS: 1 | US FAERS | |
| 442 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 443 | Impaired work ability | FAERS: 1 | US FAERS | |
| 444 | Inappropriate schedule of product administration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 445 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 446 | Infected cyst | FAERS: 1 | US FAERS | |
| 447 | Infusion site thrombosis | FAERS: 1 | US FAERS | |
| 448 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 449 | Intestinal mucosal hypertrophy | FAERS: 1 | US FAERS | |
| 450 | Intraosseous angioma | FAERS: 1 | US FAERS | |
| 451 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 452 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 453 | Joint debridement | FAERS: 1 | US FAERS | |
| 454 | Joint stiffness | FAERS: 1 | US FAERS | |
| 455 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 456 | Laryngitis | FAERS: 1 | US FAERS | |
| 457 | Laziness | FAERS: 1 | US FAERS | |
| 458 | Leukapheresis | FAERS: 1 | US FAERS | |
| 459 | Light chain analysis decreased | FAERS: 1 | US FAERS | |
| 460 | Light chain analysis increased | FAERS: 1 | US FAERS | |
| 461 | Limb mass | FAERS: 1 | US FAERS | |
| 462 | Limb operation | FAERS: 1 | US FAERS | |
| 463 | Lip Infection | FAERS: 1 | US FAERS | |
| 464 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 465 | Lung consolidation | FAERS: 1 | US FAERS | |
| 466 | Lymph node palpable | FAERS: 1 | US FAERS | |
| 467 | Lymphadenitis viral | FAERS: 1 | US FAERS | |
| 468 | Lymphoma transformation | FAERS: 1 | US FAERS | |
| 469 | Lymphopenia | FAERS: 1 | US FAERS | |
| 470 | Lymphoplasmacytoid lymphoma/immunocytoma | FAERS: 1 | US FAERS | |
| 471 | Malignant histiocytosis | FAERS: 1 | US FAERS | |
| 472 | Malignant transformation | FAERS: 1 | US FAERS | |
| 473 | Malnutrition | FAERS: 1 | US FAERS | |
| 474 | Mantle cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 475 | Mantle cell lymphoma stage IV | FAERS: 1 | US FAERS | |
| 476 | Manual Lymphatic Drainage | FAERS: 1 | US FAERS | |
| 477 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 478 | Medical device change | FAERS: 1 | US FAERS | |
| 479 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 480 | Medical procedure | FAERS: 1 | US FAERS | |
| 481 | Meningioma | FAERS: 1 | US FAERS | |
| 482 | Metastasis | FAERS: 1 | US FAERS | |
| 483 | Microcytosis | FAERS: 1 | US FAERS | |
| 484 | Micrographic skin surgery | FAERS: 1 | US FAERS | |
| 485 | Middle insomnia | FAERS: 1 | US FAERS | |
| 486 | Monocyte percentage increased | FAERS: 1 | US FAERS | |
| 487 | Mood swings | FAERS: 1 | US FAERS | |
| 488 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 489 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 490 | Neck Pain | FAERS: 1 | US FAERS | |
| 491 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 492 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 493 | Nervousness | FAERS: 1 | US FAERS | |
| 494 | Neuritis | FAERS: 1 | US FAERS | |
| 495 | Neuroblastoma | FAERS: 1 | US FAERS | |
| 496 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 497 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 498 | Neutrophil count abnormal | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 499 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 500 | Night sweats | FAERS: 1 | US FAERS | |
| 501 | Nocturia | FAERS: 1 | US FAERS | |
| 502 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 503 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 504 | Oliguria | FAERS: 1 | US FAERS | |
| 505 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 506 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 507 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 508 | Oral pain | FAERS: 1 | US FAERS | |
| 509 | Orbital infection | FAERS: 1 | US FAERS | |
| 510 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 511 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 512 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 513 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 514 | Page kidney | FAERS: 1 | US FAERS | |
| 515 | Pallor | FAERS: 1 | US FAERS | |
| 516 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 517 | Paracentesis | FAERS: 1 | US FAERS | |
| 518 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 519 | Patella replacement | FAERS: 1 | US FAERS | |
| 520 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 521 | Perirectal abscess | FAERS: 1 | US FAERS | |
| 522 | Personality Change | FAERS: 1 | US FAERS | |
| 523 | Pharyngeal lesion | FAERS: 1 | US FAERS | |
| 524 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 525 | Pneumonitis | FAERS: 1 | US FAERS | |
| 526 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 527 | Polydipsia | FAERS: 1 | US FAERS | |
| 528 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 529 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 530 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 531 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 532 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 533 | Presyncope | FAERS: 1 | US FAERS | |
| 534 | Product label confusion | FAERS: 1 | US FAERS | |
| 535 | Protein total increased | FAERS: 1 | US FAERS | |
| 536 | Protein urine present | FAERS: 1 | US FAERS | |
| 537 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 538 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 539 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 540 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 541 | Purpura | FAERS: 1 | US FAERS | |
| 542 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 543 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 544 | Rales | FAERS: 1 | US FAERS | |
| 545 | Rectal fissure | FAERS: 1 | US FAERS | |
| 546 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 547 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 548 | Renal pain | FAERS: 1 | US FAERS | |
| 549 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 550 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 551 | Restlessness | FAERS: 1 | US FAERS | |
| 552 | Reticulocytosis | FAERS: 1 | US FAERS | |
| 553 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 554 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 555 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 556 | Rhinitis | FAERS: 1 | US FAERS | |
| 557 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 558 | Sarcoma | FAERS: 1 | US FAERS | |
| 559 | Secretion discharge | FAERS: 1 | US FAERS | |
| 560 | Shock | FAERS: 1 | US FAERS | |
| 561 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 562 | Skin reaction | FAERS: 1 | US FAERS | |
| 563 | Sluggishness | FAERS: 1 | US FAERS | |
| 564 | Sneezing | FAERS: 1 | US FAERS | |
| 565 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 566 | Somnambulism | FAERS: 1 | US FAERS | |
| 567 | Spinal column injury | FAERS: 1 | US FAERS | |
| 568 | Splenic infection fungal | FAERS: 1 | US FAERS | |
| 569 | Staring | FAERS: 1 | US FAERS | |
| 570 | Steatohepatitis | FAERS: 1 | US FAERS | |
| 571 | Stoma Site Infection | FAERS: 1 | US FAERS | |
| 572 | Stoma site erythema | FAERS: 1 | US FAERS | |
| 573 | Stoma site inflammation | FAERS: 1 | US FAERS | |
| 574 | Sudden death | FAERS: 1 | US FAERS | |
| 575 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 576 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 577 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 578 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 579 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 580 | Tetany | FAERS: 1 | US FAERS | |
| 581 | Therapy change | FAERS: 1 | US FAERS | |
| 582 | Throat cancer | FAERS: 1 | US FAERS | |
| 583 | Throat irritation | FAERS: 1 | US FAERS | |
| 584 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 585 | Thyroid calcification | FAERS: 1 | US FAERS | |
| 586 | Toe operation | FAERS: 1 | US FAERS | |
| 587 | Tongue blistering | FAERS: 1 | US FAERS | |
| 588 | Tonsillitis | FAERS: 1 | US FAERS | |
| 589 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 590 | Toothache | FAERS: 1 | US FAERS | |
| 591 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 592 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 593 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 594 | Ureteral stent insertion | FAERS: 1 | US FAERS | |
| 595 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 596 | Urine ketone body | FAERS: 1 | US FAERS | |
| 597 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 598 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 599 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 600 | Wheezing | FAERS: 1 | US FAERS | |
| 601 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 602 | Wound Infection | FAERS: 1 | US FAERS | |
| 603 | Wrong dose | FAERS: 1 | US FAERS | |
| 604 | prostatitis | FAERS: 1 | US FAERS | |
| 605 | Pelvic Pain | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.