Ipratropium
(LHLMOSXCXGLMMN-CLTUNHJMSA-M)
Structure
- SMILES
- OCC(c1ccccc1)C(=O)OC1C[C@@H]2CC[C@H](C1)[N+]2(C)C(C)C.[Br-]
- Molecular Formula:
- C20H30BrNO3
- Molecular Weight:
- 412.361
- Log P:
- -0.1831
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 46.53
- CAS Number(s):
- 22254-24-6; 24358-20-1; 58073-59-9; 60251-88-9
Synonym(s)
1.
Ipratropium
2.
N-Isopropylatropine
3.
(endo,syn)-(+-)-3-(3-Hydroxy-1-oxo-2-phenylpropoxy)-8-methyl-8-(1-methylethyl)-8-azoniabicyclo(3.2.1)octane
4.
Atrovent
5.
Ipratropium Bromide
6.
Ipratropium Bromide Anhydrous
7.
Ipratropium Bromide Monohydrate
8.
Ipratropium Bromide, (endo,anti)-Isomer
9.
Ipratropium Bromide, (exo,syn)-Isomer
10.
Ipratropium Bromide, endo-Isomer
11.
Itrop
12.
Sch-1000
13.
Sch-1178
14.
N Isopropylatropine
15.
Sch 1000
16.
Sch 1178
17.
Sch1000
18.
Sch1178
External Link(s)
| MeSH | D009241 |
| PubChem Compound | 657308 |
| BindingDB | 50021892 |
| ChEBI | 46659 |
| CHEMBL | CHEMBL1464005 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 122 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 2 | Product quality issue | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 28 | US FAERS | |
| 4 | Asthma | FAERS: 25 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Headache | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Dizziness | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Pneumonia | FAERS: 20 | US FAERS | |
| 8 | Medication Error | FAERS: 17 | US FAERS | |
| 9 | Dysgeusia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Nasal discomfort | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 11 | Oropharyngeal pain | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 12 | Epistaxis | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Tachycardia | FAERS: 14 | US FAERS | |
| 14 | Bronchitis | FAERS: 13 | OFFSIDES US FAERS | |
| 15 | Dysphonia | FAERS: 13 | OFFSIDES US FAERS | |
| 16 | Nausea | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Pharmaceutical product complaint | FAERS: 13 | US FAERS | |
| 18 | Product dose omission | FAERS: 13 | US FAERS | |
| 19 | Eye pain | FAERS: 12 | US FAERS | |
| 20 | Throat irritation | FAERS: 12 | US FAERS | |
| 21 | Tremor | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 22 | Wheezing | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Productive Cough | FAERS: 11 | OFFSIDES US FAERS | |
| 24 | Chest Pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 25 | Chest discomfort | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Palpitations | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Asthenia | FAERS: 9 | OFFSIDES US FAERS | |
| 28 | Mydriasis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Feeling abnormal | FAERS: 8 | OFFSIDES US FAERS | |
| 30 | Abdominal discomfort | FAERS: 7 | OFFSIDES US FAERS | |
| 31 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 32 | Anaphylactic shock | FAERS: 7 | US FAERS | |
| 33 | Back Pain | FAERS: 7 | US FAERS | |
| 34 | Drug administered to patient of inappropriate age | FAERS: 7 | US FAERS | |
| 35 | Hypersensitivity | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 37 | Incorrect route of drug administration | FAERS: 7 | US FAERS | |
| 38 | Influenza | FAERS: 7 | US FAERS | |
| 39 | Pain | FAERS: 7 | OFFSIDES US FAERS | |
| 40 | Respiratory Failure | FAERS: 7 | OFFSIDES US FAERS | |
| 41 | Urinary Retention | FAERS: 7 | US FAERS | |
| 42 | Bronchospasm | FAERS: 6 | US FAERS | |
| 43 | Constipation | FAERS: 6 | US FAERS | |
| 44 | Dyspepsia | FAERS: 6 | OFFSIDES US FAERS | |
| 45 | Erythema | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 46 | Pruritus | FAERS: 6 | US FAERS | |
| 47 | Urticaria | FAERS: 6 | US FAERS | |
| 48 | Visual Impairment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Accidental underdose | FAERS: 5 | US FAERS | |
| 50 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 51 | Cataract | FAERS: 5 | OFFSIDES US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 53 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 54 | Overdose | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 56 | Pulmonary congestion | FAERS: 5 | US FAERS | |
| 57 | Retching | FAERS: 5 | US FAERS | |
| 58 | Unevaluable event | FAERS: 5 | US FAERS | |
| 59 | Wrong drug administered | FAERS: 5 | US FAERS | |
| 60 | Accidental exposure | FAERS: 4 | US FAERS | |
| 61 | Alopecia | FAERS: 4 | US FAERS | |
| 62 | Burning sensation | FAERS: 4 | US FAERS | |
| 63 | Choking | FAERS: 4 | OFFSIDES US FAERS | |
| 64 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 65 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 66 | Fatigue | FAERS: 4 | OFFSIDES US FAERS | |
| 67 | Food Allergy | FAERS: 4 | US FAERS | |
| 68 | Glaucoma | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 69 | Infection | FAERS: 4 | US FAERS | |
| 70 | Myocardial Infarction | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 71 | Nasopharyngitis | FAERS: 4 | OFFSIDES US FAERS | |
| 72 | Nervousness | FAERS: 4 | US FAERS | |
| 73 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 74 | Product use issue | FAERS: 4 | US FAERS | |
| 75 | Respiratory distress | FAERS: 4 | US FAERS | |
| 76 | Sneezing | FAERS: 4 | US FAERS | |
| 77 | Stomatitis | FAERS: 4 | US FAERS | |
| 78 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 79 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 80 | Anxiety | FAERS: 3 | US FAERS | |
| 81 | Aphonia | FAERS: 3 | US FAERS | |
| 82 | Blindness | FAERS: 3 | US FAERS | |
| 83 | Depressed mood | FAERS: 3 | OFFSIDES US FAERS | |
| 84 | Drug dose omission | FAERS: 3 | US FAERS | |
| 85 | Dry skin | FAERS: 3 | OFFSIDES US FAERS | |
| 86 | Flatulence | FAERS: 3 | US FAERS | |
| 87 | Laryngitis | FAERS: 3 | US FAERS | |
| 88 | Lip swelling | FAERS: 3 | US FAERS | |
| 89 | Macular degeneration | FAERS: 3 | US FAERS | |
| 90 | Oral pain | FAERS: 3 | US FAERS | |
| 91 | Product substitution issue | FAERS: 3 | US FAERS | |
| 92 | Rhinitis | FAERS: 3 | US FAERS | |
| 93 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 94 | Tinnitus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Vertigo | FAERS: 3 | US FAERS | |
| 96 | Vomiting | FAERS: 3 | US FAERS | |
| 97 | Accidental overdose | FAERS: 2 | US FAERS | |
| 98 | Ageusia | FAERS: 2 | US FAERS | |
| 99 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 100 | Asphyxia | FAERS: 2 | US FAERS | |
| 101 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 102 | Breath alcohol test positive | FAERS: 2 | US FAERS | |
| 103 | Chills | FAERS: 2 | US FAERS | |
| 104 | Cold sweat | FAERS: 2 | US FAERS | |
| 105 | Cyanosis | FAERS: 2 | OFFSIDES US FAERS | |
| 106 | Delusional disorder, persecutory type | FAERS: 2 | US FAERS | |
| 107 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 108 | Discomfort | FAERS: 2 | US FAERS | |
| 109 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 110 | Dysuria | FAERS: 2 | US FAERS | |
| 111 | Endometrial Hyperplasia | FAERS: 2 | US FAERS | |
| 112 | Extra dose administered | FAERS: 2 | US FAERS | |
| 113 | Eye irritation | FAERS: 2 | US FAERS | |
| 114 | Feeling jittery | FAERS: 2 | US FAERS | |
| 115 | Gout | FAERS: 2 | US FAERS | |
| 116 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 117 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 118 | Intestinal scarring | FAERS: 2 | US FAERS | |
| 119 | Joint swelling | FAERS: 2 | US FAERS | |
| 120 | Laceration | FAERS: 2 | US FAERS | |
| 121 | Lower respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 122 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 123 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 124 | Medical device implantation | FAERS: 2 | US FAERS | |
| 125 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 126 | No adverse event | FAERS: 2 | US FAERS | |
| 127 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 128 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 129 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 130 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 131 | Physical product label issue | FAERS: 2 | US FAERS | |
| 132 | Pneumothorax | FAERS: 2 | OFFSIDES US FAERS | |
| 133 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 134 | Stress | FAERS: 2 | US FAERS | |
| 135 | Swelling | FAERS: 2 | US FAERS | |
| 136 | Toothache | FAERS: 2 | US FAERS | |
| 137 | Upper respiratory fungal infection | FAERS: 2 | US FAERS | |
| 138 | Uterine Polyp | FAERS: 2 | US FAERS | |
| 139 | Abasia | FAERS: 1 | OFFSIDES US FAERS | |
| 140 | Accidental death | FAERS: 1 | US FAERS | |
| 141 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 142 | Acute respiratory failure | FAERS: 1 | OFFSIDES US FAERS | |
| 143 | Adverse event | FAERS: 1 | US FAERS | |
| 144 | Agitation | FAERS: 1 | US FAERS | |
| 145 | Amnesia | FAERS: 1 | OFFSIDES US FAERS | |
| 146 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 147 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 148 | Anger | FAERS: 1 | US FAERS | |
| 149 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 150 | Anorexia | FAERS: 1 | US FAERS | |
| 151 | Anosmia | FAERS: 1 | US FAERS | |
| 152 | Aphasia | FAERS: 1 | US FAERS | |
| 153 | Arthralgia | FAERS: 1 | US FAERS | |
| 154 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 155 | Back disorder | FAERS: 1 | US FAERS | |
| 156 | Bedridden | FAERS: 1 | US FAERS | |
| 157 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 158 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 159 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 160 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 161 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 162 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 163 | Bronchopulmonary Dysplasia | FAERS: 1 | US FAERS | |
| 164 | Candidiasis | FAERS: 1 | US FAERS | |
| 165 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 166 | Cartilage injury | FAERS: 1 | US FAERS | |
| 167 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 168 | Cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 169 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 170 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 171 | Cholestasis | FAERS: 1 | US FAERS | |
| 172 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 173 | Crying | FAERS: 1 | US FAERS | |
| 174 | Cystitis | FAERS: 1 | US FAERS | |
| 175 | Cyst | FAERS: 1 | US FAERS | |
| 176 | Decreased bronchial secretion | FAERS: 1 | US FAERS | |
| 177 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 178 | Dehydration | FAERS: 1 | OFFSIDES US FAERS | |
| 179 | Delirium | FAERS: 1 | US FAERS | |
| 180 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 181 | Device Failure | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 182 | Device leakage | FAERS: 1 | US FAERS | |
| 183 | Disability | FAERS: 1 | US FAERS | |
| 184 | Disorientation | FAERS: 1 | US FAERS | |
| 185 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 186 | Drug administration error | FAERS: 1 | US FAERS | |
| 187 | Dysarthria | FAERS: 1 | US FAERS | |
| 188 | Ear discomfort | FAERS: 1 | US FAERS | |
| 189 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 190 | Encephalitis | FAERS: 1 | US FAERS | |
| 191 | Eructation | FAERS: 1 | US FAERS | |
| 192 | Expired product administered | FAERS: 1 | US FAERS | |
| 193 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 194 | Eye Infection | FAERS: 1 | US FAERS | |
| 195 | Feeling Cold | FAERS: 1 | US FAERS | |
| 196 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 197 | Flat affect | FAERS: 1 | US FAERS | |
| 198 | Food Poisoning | FAERS: 1 | US FAERS | |
| 199 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 200 | Fracture | FAERS: 1 | US FAERS | |
| 201 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 202 | General physical health deterioration | FAERS: 1 | OFFSIDES US FAERS | |
| 203 | Gingival Recession | FAERS: 1 | US FAERS | |
| 204 | Gingival erythema | FAERS: 1 | US FAERS | |
| 205 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 206 | Hepatitis C | FAERS: 1 | US FAERS | |
| 207 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 208 | Hypersomnia | FAERS: 1 | US FAERS | |
| 209 | Hyperventilation | FAERS: 1 | OFFSIDES US FAERS | |
| 210 | Hypogeusia | FAERS: 1 | US FAERS | |
| 211 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 212 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 213 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 214 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 215 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 216 | Inflammation | FAERS: 1 | US FAERS | |
| 217 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 218 | Intracranial mass | FAERS: 1 | US FAERS | |
| 219 | Laryngospasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 220 | Limb injury | FAERS: 1 | OFFSIDES US FAERS | |
| 221 | Lung Abscess | FAERS: 1 | US FAERS | |
| 222 | Medication residue | FAERS: 1 | US FAERS | |
| 223 | Megacolon | FAERS: 1 | US FAERS | |
| 224 | Mental status changes | FAERS: 1 | OFFSIDES US FAERS | |
| 225 | Multiple allergies | FAERS: 1 | US FAERS | |
| 226 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 227 | Muscle tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 228 | Myalgia | FAERS: 1 | US FAERS | |
| 229 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 230 | Nerve injury | FAERS: 1 | US FAERS | |
| 231 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 232 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 233 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 234 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 235 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 236 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 237 | Panic Disorder | FAERS: 1 | US FAERS | |
| 238 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 239 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 240 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 241 | Product administration error | FAERS: 1 | US FAERS | |
| 242 | Product container issue | FAERS: 1 | US FAERS | |
| 243 | Product container seal issue | FAERS: 1 | US FAERS | |
| 244 | Protein total decreased | FAERS: 1 | US FAERS | |
| 245 | Pulmonary Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 246 | Rash erythematous | FAERS: 1 | US FAERS | |
| 247 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 248 | Rhinalgia | FAERS: 1 | US FAERS | |
| 249 | Screaming | FAERS: 1 | US FAERS | |
| 250 | Secretion discharge | FAERS: 1 | US FAERS | |
| 251 | Sepsis | FAERS: 1 | US FAERS | |
| 252 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 253 | Sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 254 | Skin laceration | FAERS: 1 | OFFSIDES US FAERS | |
| 255 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 256 | Suicide attempt | FAERS: 1 | US FAERS | |
| 257 | Supraventricular tachyarrhythmia | FAERS: 1 | US FAERS | |
| 258 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 259 | Thermal burn | FAERS: 1 | US FAERS | |
| 260 | Throat cancer | FAERS: 1 | US FAERS | |
| 261 | Thrombosis | FAERS: 1 | US FAERS | |
| 262 | Total Lung Capacity | FAERS: 1 | US FAERS | |
| 263 | Tracheomalacia | FAERS: 1 | US FAERS | |
| 264 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 265 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 266 | Weight decreased | FAERS: 1 | US FAERS | |
| 267 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 268 | Abdominal Pain | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 269 | Abnormal clotting factor | OFFSIDES | ||
| 270 | Abscess | OFFSIDES | ||
| 271 | Abuse | OFFSIDES | ||
| 272 | Acanthosis | OFFSIDES | ||
| 273 | Acidosis | OFFSIDES | ||
| 274 | Actinomycosis | OFFSIDES | ||
| 275 | Acute bronchitis | OFFSIDES | ||
| 276 | Acute myocardial infarction | OFFSIDES | ||
| 277 | Acute sinusitis | OFFSIDES | ||
| 278 | Agraphia | OFFSIDES | ||
| 279 | Allergy to chemicals | OFFSIDES | ||
| 280 | Alveolitis | OFFSIDES | ||
| 281 | Anal Fissure | OFFSIDES | ||
| 282 | Anorectal discomfort | OFFSIDES | ||
| 283 | Aortic Aneurysm | OFFSIDES | ||
| 284 | Aphagia | OFFSIDES | ||
| 285 | Atelectasis | OFFSIDES | ||
| 286 | Atherosclerosis | OFFSIDES | ||
| 287 | Atrial tachycardia | OFFSIDES | ||
| 288 | Blood albumin decreased | OFFSIDES | ||
| 289 | Blood alkaline phosphatase increased | OFFSIDES | ||
| 290 | Blood chloride increased | OFFSIDES | ||
| 291 | Blood cholesterol | OFFSIDES | ||
| 292 | Blood count abnormal | OFFSIDES | ||
| 293 | Blood creatine phosphokinase increased | OFFSIDES | ||
| 294 | Blood creatinine increased | OFFSIDES | ||
| 295 | Blood fibrinogen | OFFSIDES | ||
| 296 | Blood pH increased | OFFSIDES | ||
| 297 | Blood phosphorus decreased | OFFSIDES | ||
| 298 | Bone pain | OFFSIDES | ||
| 299 | Bradycardia | OFFSIDES | ||
| 300 | Brain natriuretic peptide increased | OFFSIDES | ||
| 301 | Bursitis | OFFSIDES | ||
| 302 | Cardiac asthma | OFFSIDES | ||
| 303 | Cardiac enzymes increased | OFFSIDES | ||
| 304 | Cardioactive drug level above therapeutic | OFFSIDES | ||
| 305 | Cardioactive drug level increased | OFFSIDES | ||
| 306 | Cataract operation | OFFSIDES | ||
| 307 | Cerebellar infarction | OFFSIDES | ||
| 308 | Chondromalacia | OFFSIDES | ||
| 309 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 310 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 311 | Chronic respiratory failure | OFFSIDES | ||
| 312 | Chronic sinusitis | OFFSIDES | ||
| 313 | Clostridium colitis | OFFSIDES | ||
| 314 | Clostridium difficile colitis | OFFSIDES | ||
| 315 | Clostridium difficile toxin test positive | OFFSIDES | ||
| 316 | Cluster Headache | OFFSIDES | ||
| 317 | Compression fracture | OFFSIDES | ||
| 318 | Confabulation | OFFSIDES | ||
| 319 | Congenital tracheomalacia | OFFSIDES | ||
| 320 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 321 | Conjunctival abrasion | OFFSIDES | ||
| 322 | Cystocele | OFFSIDES | ||
| 323 | Deafness | OFFSIDES | ||
| 324 | Decreased Libido | OFFSIDES | ||
| 325 | Demyelination | OFFSIDES | ||
| 326 | Dental Fistula | OFFSIDES | ||
| 327 | Dental caries | OFFSIDES | ||
| 328 | Denture wearer | OFFSIDES | ||
| 329 | Device related infection | OFFSIDES | ||
| 330 | Diabetes | OFFSIDES | ||
| 331 | Diarrhea | OFFSIDES | ||
| 332 | Diastolic dysfunction | OFFSIDES | ||
| 333 | Diet refusal | OFFSIDES | ||
| 334 | Diverticulosis | OFFSIDES | ||
| 335 | Diverticulum | OFFSIDES | ||
| 336 | Drug toxicity | OFFSIDES | ||
| 337 | Drug withdrawal headache | OFFSIDES | ||
| 338 | Dyspnoea exacerbated | OFFSIDES | ||
| 339 | Ejection Fraction Decreased | OFFSIDES | ||
| 340 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 341 | Electrocardiogram change | OFFSIDES | ||
| 342 | Electrolyte depletion | OFFSIDES | ||
| 343 | Electromechanical dissociation | OFFSIDES | ||
| 344 | Embolism | OFFSIDES | ||
| 345 | Emergency Care | OFFSIDES | ||
| 346 | Emotional distress | OFFSIDES | ||
| 347 | Endodontic procedure | OFFSIDES | ||
| 348 | Enterobacter pneumonia | OFFSIDES | ||
| 349 | Escherichia sepsis | OFFSIDES | ||
| 350 | Extremity contracture | OFFSIDES | ||
| 351 | Eye inflammation | OFFSIDES | ||
| 352 | Febrile Neutropenia | OFFSIDES | ||
| 353 | Flushing | Canada Vigilance: 1 | Canada Vigilance | |
| 354 | Formication | OFFSIDES | ||
| 355 | Gangrene | OFFSIDES | ||
| 356 | Gastric ulcer | OFFSIDES | ||
| 357 | General physical condition | OFFSIDES | ||
| 358 | Gestational Diabetes | OFFSIDES | ||
| 359 | Glossitis | OFFSIDES | ||
| 360 | Granulocytosis | OFFSIDES | ||
| 361 | Grip strength | OFFSIDES | ||
| 362 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 363 | Hypercapnia | OFFSIDES | ||
| 364 | Hyperkeratosis | OFFSIDES | ||
| 365 | Hyperpigmentation | OFFSIDES | ||
| 366 | Hypophagia | OFFSIDES | ||
| 367 | Hypoxia | OFFSIDES | ||
| 368 | Immobile | OFFSIDES | ||
| 369 | Incision site complication | OFFSIDES | ||
| 370 | Infected cyst | OFFSIDES | ||
| 371 | Infective exacerbation of chronic obstructive airways disease | OFFSIDES | ||
| 372 | Infusion site mobility decreased | OFFSIDES | ||
| 373 | Injection site dermatitis | OFFSIDES | ||
| 374 | Injection site erythema | OFFSIDES | ||
| 375 | Intention tremor | OFFSIDES | ||
| 376 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 377 | Intervertebral disc disorder | OFFSIDES | ||
| 378 | Iridocele | OFFSIDES | ||
| 379 | Joint Instability | OFFSIDES | ||
| 380 | Joint Range of Motion Decreased | OFFSIDES | ||
| 381 | Joint sprain | OFFSIDES | ||
| 382 | Joint stiffness | OFFSIDES | ||
| 383 | Kidney Failure | OFFSIDES | ||
| 384 | Labile blood pressure | OFFSIDES | ||
| 385 | Large intestine perforation | OFFSIDES | ||
| 386 | Lethargy | OFFSIDES | ||
| 387 | Ligament injury | OFFSIDES | ||
| 388 | Loose tooth | OFFSIDES | ||
| 389 | Lung consolidation | OFFSIDES | ||
| 390 | Lung infection pseudomonal | OFFSIDES | ||
| 391 | Lymphedema | OFFSIDES | ||
| 392 | Markedly reduced dietary intake | OFFSIDES | ||
| 393 | Meningioma | OFFSIDES | ||
| 394 | Morphea | OFFSIDES | ||
| 395 | Muscle Fatigue | OFFSIDES | ||
| 396 | Muscle necrosis | OFFSIDES | ||
| 397 | Musculoskeletal discomfort | OFFSIDES | ||
| 398 | Nephrectomy | OFFSIDES | ||
| 399 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 400 | Nephrotic Syndrome | OFFSIDES | ||
| 401 | Nervous tension | OFFSIDES | ||
| 402 | Neutrophil function disorder | OFFSIDES | ||
| 403 | Non-cardiac chest pain | OFFSIDES | ||
| 404 | Optic Disc Edema | OFFSIDES | ||
| 405 | Orthopnea | OFFSIDES | ||
| 406 | Osteoporosis | OFFSIDES | ||
| 407 | Pancreatic enzymes increased | OFFSIDES | ||
| 408 | Papilloma | OFFSIDES | ||
| 409 | Paranoia | Canada Vigilance: 1 | Canada Vigilance | |
| 410 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 411 | Pelvic mass | OFFSIDES | ||
| 412 | Periodontitis | OFFSIDES | ||
| 413 | Peripheral embolism | OFFSIDES | ||
| 414 | Peripheral occlusive disease | OFFSIDES | ||
| 415 | Peritonsillar Abscess | OFFSIDES | ||
| 416 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 417 | Pharyngitis | Canada Vigilance: 1 | Canada Vigilance | |
| 418 | Poor peripheral circulation | OFFSIDES | ||
| 419 | Poor quality sleep | OFFSIDES | ||
| 420 | Post procedural pain | OFFSIDES | ||
| 421 | Postoperative wound complication | OFFSIDES | ||
| 422 | Presbyopia | OFFSIDES | ||
| 423 | Procedural complication | OFFSIDES | ||
| 424 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 425 | Psychiatric symptom | OFFSIDES | ||
| 426 | Psychomotor skills impaired | OFFSIDES | ||
| 427 | Quality of life decreased | OFFSIDES | ||
| 428 | Radiculitis | OFFSIDES | ||
| 429 | Rales | OFFSIDES | ||
| 430 | Rectal fissure | OFFSIDES | ||
| 431 | Rectal polyp | OFFSIDES | ||
| 432 | Renal cyst | OFFSIDES | ||
| 433 | Renal tubular necrosis | OFFSIDES | ||
| 434 | Respiratory arrest | Canada Vigilance: 1 | Canada Vigilance | |
| 435 | Respiratory tract congestion | Canada Vigilance: 1 | Canada Vigilance | |
| 436 | Retinal Degeneration | OFFSIDES | ||
| 437 | Rhinorrhea | OFFSIDES | ||
| 438 | Schizoaffective Disorder | OFFSIDES | ||
| 439 | Scleritis | OFFSIDES | ||
| 440 | Sclerodactylia | OFFSIDES | ||
| 441 | Scrotal irritation | OFFSIDES | ||
| 442 | Sensory level abnormal | OFFSIDES | ||
| 443 | Septic Shock | OFFSIDES | ||
| 444 | Sequestrectomy | OFFSIDES | ||
| 445 | Sinus bradycardia | OFFSIDES | ||
| 446 | Sinus operation | OFFSIDES | ||
| 447 | Skin Induration | OFFSIDES | ||
| 448 | Skin hypertrophy | OFFSIDES | ||
| 449 | Skin tightness | OFFSIDES | ||
| 450 | Soft Tissue Injuries | OFFSIDES | ||
| 451 | Somnolence | Canada Vigilance: 1 | Canada Vigilance | |
| 452 | Spinal column stenosis | OFFSIDES | ||
| 453 | Staring | OFFSIDES | ||
| 454 | Subcutaneous nodule | OFFSIDES | ||
| 455 | Sudden Cardiac Death | OFFSIDES | ||
| 456 | Syringomyelia | OFFSIDES | ||
| 457 | Tenosynovitis | OFFSIDES | ||
| 458 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 459 | Therapeutic product ineffective | Canada Vigilance: 1 | Canada Vigilance | |
| 460 | Tongue biting | OFFSIDES | ||
| 461 | Tooth Extraction | OFFSIDES | ||
| 462 | Tooth Infection | OFFSIDES | ||
| 463 | Tracheitis | OFFSIDES | ||
| 464 | Umbilical hernia perforation | OFFSIDES | ||
| 465 | Urinary tract infection pseudomonal | OFFSIDES | ||
| 466 | Urine flow decreased | OFFSIDES | ||
| 467 | Uterine Cancer | OFFSIDES | ||
| 468 | Venous stasis | OFFSIDES | ||
| 469 | Venous stenosis | OFFSIDES | ||
| 470 | Ventricular Fibrillation | OFFSIDES | ||
| 471 | Ventricular hypokinesia | OFFSIDES | ||
| 472 | Wheelchair user | OFFSIDES | ||
| 473 | Wound Infection | OFFSIDES | ||
| 474 | Wound infection bacterial | OFFSIDES | ||
| 475 | angiogram | OFFSIDES | ||
| 476 | furuncle | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.