Donepezil
(XWAIAVWHZJNZQQ-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc2c(cc1OC)CC(C2=O)CC1CCN(CC1)Cc1ccccc1.Cl
- Molecular Formula:
- C24H30ClNO3
- Molecular Weight:
- 415.953
- Log P:
- 5.1010
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 38.77
- CAS Number(s):
- 110119-84-1; 120011-70-3
Synonym(s)
1.
Donepezil
2.
1-Benzyl-4-((5,6-dimethoxy-1-indanon)-2-yl)methylpiperidine hydrochloride
3.
Aricept
4.
Donepezil Hydrochloride
5.
Donepezilium Oxalate Trihydrate
6.
E 2020
7.
E-2020
8.
E2020
9.
Eranz
External Link(s)
| MeSH | D000077265 |
| PubChem Compound | 44263804 10916711 5741 |
| BindingDB | 50342148 50271227 |
| CHEMBL | CHEMBL1678 |
| KEGG | dr:D00670 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vomiting | FAERS: 88 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 2 | Bradycardia | FAERS: 81 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 71 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 4 | Delirium | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Dizziness | FAERS: 49 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 6 | Somnolence | FAERS: 45 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 7 | Syncope | FAERS: 44 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 8 | Rhabdomyolysis | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Drug ineffective | FAERS: 33 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 10 | Agitation | FAERS: 31 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 11 | Sudden death | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Overdose | FAERS: 27 | US FAERS | |
| 13 | Malaise | FAERS: 25 | US FAERS | |
| 14 | Asthenia | FAERS: 23 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 15 | Cardiac Arrest | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Weight decreased | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Dehydration | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Fatigue | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 19 | Headache | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Tremor | FAERS: 19 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 21 | Feeling abnormal | FAERS: 18 | US FAERS | |
| 22 | Memory impairment | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Altered state of consciousness | FAERS: 16 | US FAERS | |
| 24 | Abdominal Pain | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 25 | Accidental overdose | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Dementia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Pneumonia | FAERS: 14 | US FAERS | |
| 28 | Medication Error | FAERS: 13 | US FAERS | |
| 29 | Urinary Incontinence | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Depressed Level of Consciousness | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Mental status changes | FAERS: 12 | US FAERS | |
| 32 | Activities of daily living impaired | FAERS: 11 | US FAERS | |
| 33 | Cerebrovascular accident | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Drooling | FAERS: 11 | US FAERS | |
| 35 | Hypotension | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Pancytopenia | FAERS: 11 | US FAERS | |
| 37 | Restlessness | FAERS: 11 | US FAERS | |
| 38 | Sinus bradycardia | FAERS: 11 | US FAERS | |
| 39 | Torticollis | FAERS: 11 | US FAERS | |
| 40 | Abdominal discomfort | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Atrioventricular Block | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Myocardial Infarction | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Anxiety | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 45 | General physical health deterioration | FAERS: 9 | US FAERS | |
| 46 | Suicide attempt | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Abasia | FAERS: 8 | US FAERS | |
| 48 | Anger | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Chest Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Epilepsy | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 51 | Incontinence | FAERS: 8 | US FAERS | |
| 52 | Neuroleptic Malignant Syndrome | FAERS: 8 | US FAERS | |
| 53 | Paranoia | FAERS: 8 | US FAERS | |
| 54 | Product quality issue | FAERS: 8 | US FAERS | |
| 55 | Product substitution issue | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Anorexia | FAERS: 7 | US FAERS | |
| 57 | Pallor | FAERS: 7 | US FAERS | |
| 58 | Pleurothotonus | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Shock | FAERS: 7 | US FAERS | |
| 60 | Sick Sinus Syndrome | FAERS: 7 | US FAERS | |
| 61 | Amnesia | FAERS: 6 | US FAERS | |
| 62 | Aphasia | FAERS: 6 | US FAERS | |
| 63 | Blood creatine phosphokinase increased | FAERS: 6 | US FAERS | |
| 64 | Disease Progression | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Drug withdrawal syndrome | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Pain | FAERS: 6 | US FAERS | |
| 67 | Pruritus | FAERS: 6 | US FAERS | |
| 68 | Urinary tract infection | FAERS: 6 | US FAERS | |
| 69 | Duodenal Ulcer | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 71 | Hypersensitivity | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Lethargy | FAERS: 5 | US FAERS | |
| 73 | Middle insomnia | FAERS: 5 | US FAERS | |
| 74 | Musculoskeletal stiffness | FAERS: 5 | US FAERS | |
| 75 | Palpitations | FAERS: 5 | US FAERS | |
| 76 | Personality Change | FAERS: 5 | US FAERS | |
| 77 | Accidental drug intake by child | FAERS: 4 | US FAERS | |
| 78 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 79 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 80 | Accidental exposure | FAERS: 4 | US FAERS | |
| 81 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 82 | Chorea | FAERS: 4 | US FAERS | |
| 83 | Completed Suicide | FAERS: 4 | US FAERS | |
| 84 | Constipation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Disorientation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Dyspepsia | FAERS: 4 | US FAERS | |
| 87 | Euphoric mood | FAERS: 4 | US FAERS | |
| 88 | Hypersomnia | FAERS: 4 | US FAERS | |
| 89 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 90 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 91 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 92 | Neurodermatitis | FAERS: 4 | US FAERS | |
| 93 | Neutropenia | FAERS: 4 | US FAERS | |
| 94 | Pancreatitis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 95 | Presyncope | FAERS: 4 | US FAERS | |
| 96 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 97 | Respiratory Depression | FAERS: 4 | US FAERS | |
| 98 | Schizophrenia | FAERS: 4 | US FAERS | |
| 99 | Arthralgia | FAERS: 3 | US FAERS | |
| 100 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 101 | Automatism | FAERS: 3 | US FAERS | |
| 102 | Back Pain | FAERS: 3 | US FAERS | |
| 103 | Bipolar I disorder | FAERS: 3 | US FAERS | |
| 104 | Blood alkaline phosphatase increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 106 | Bradykinesia | FAERS: 3 | US FAERS | |
| 107 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 108 | Complex partial seizures | FAERS: 3 | US FAERS | |
| 109 | Crying | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Diverticulitis | FAERS: 3 | US FAERS | |
| 111 | Drug administration error | FAERS: 3 | US FAERS | |
| 112 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 113 | Hypomania | FAERS: 3 | US FAERS | |
| 114 | Jealous delusion | FAERS: 3 | US FAERS | |
| 115 | Lipase increased | FAERS: 3 | US FAERS | |
| 116 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 117 | Myalgia | FAERS: 3 | US FAERS | |
| 118 | Myoglobin blood increased | FAERS: 3 | US FAERS | |
| 119 | Physical assault | FAERS: 3 | US FAERS | |
| 120 | Poriomania | FAERS: 3 | US FAERS | |
| 121 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 122 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 123 | Respiratory arrest | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 125 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 126 | Status Epilepticus | FAERS: 3 | US FAERS | |
| 127 | Unevaluable event | FAERS: 3 | US FAERS | |
| 128 | Urticaria | FAERS: 3 | US FAERS | |
| 129 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 130 | Acarodermatitis | FAERS: 2 | US FAERS | |
| 131 | Adams-Stokes Syndrome | FAERS: 2 | US FAERS | |
| 132 | Akinesia | FAERS: 2 | US FAERS | |
| 133 | Alanine Aminotransferase Increased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 134 | Alopecia | FAERS: 2 | US FAERS | |
| 135 | Aphagia | FAERS: 2 | US FAERS | |
| 136 | Bedridden | FAERS: 2 | US FAERS | |
| 137 | Belligerence | FAERS: 2 | US FAERS | |
| 138 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 139 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 140 | Bruxism | FAERS: 2 | US FAERS | |
| 141 | Catatonia | FAERS: 2 | US FAERS | |
| 142 | Cellulitis | FAERS: 2 | US FAERS | |
| 143 | Cerebral Thrombosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Chest discomfort | FAERS: 2 | US FAERS | |
| 145 | Chills | FAERS: 2 | US FAERS | |
| 146 | Colitis | FAERS: 2 | US FAERS | |
| 147 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 148 | Depressed mood | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Diet refusal | FAERS: 2 | US FAERS | |
| 150 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 151 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 152 | Drug level increased | FAERS: 2 | US FAERS | |
| 153 | Duodenal perforation | FAERS: 2 | US FAERS | |
| 154 | Dystonia | FAERS: 2 | US FAERS | |
| 155 | Emotional distress | FAERS: 2 | US FAERS | |
| 156 | Feeling Cold | FAERS: 2 | US FAERS | |
| 157 | Flushing | FAERS: 2 | US FAERS | |
| 158 | Food aversion | FAERS: 2 | US FAERS | |
| 159 | Fracture | FAERS: 2 | US FAERS | |
| 160 | Gamma-Glutamyltransferase Increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Glaucoma | FAERS: 2 | US FAERS | |
| 162 | Heat Stroke | FAERS: 2 | US FAERS | |
| 163 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 164 | Hostility | FAERS: 2 | US FAERS | |
| 165 | Hypophagia | FAERS: 2 | US FAERS | |
| 166 | Hypoventilation | FAERS: 2 | US FAERS | |
| 167 | Impaired work ability | FAERS: 2 | US FAERS | |
| 168 | Inflammation | FAERS: 2 | US FAERS | |
| 169 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 170 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 171 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 172 | Mental impairment | FAERS: 2 | US FAERS | |
| 173 | Myoclonus | FAERS: 2 | US FAERS | |
| 174 | Night sweats | FAERS: 2 | US FAERS | |
| 175 | Ophthalmoplegia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Overconfidence | FAERS: 2 | US FAERS | |
| 177 | Product use issue | FAERS: 2 | US FAERS | |
| 178 | Purpura | FAERS: 2 | US FAERS | |
| 179 | Rash erythematous | FAERS: 2 | US FAERS | |
| 180 | Respiratory distress | FAERS: 2 | US FAERS | |
| 181 | Screaming | FAERS: 2 | US FAERS | |
| 182 | Septic Shock | FAERS: 2 | US FAERS | |
| 183 | Sleep Talking | FAERS: 2 | US FAERS | |
| 184 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 185 | Stress | FAERS: 2 | US FAERS | |
| 186 | Stupor | FAERS: 2 | US FAERS | |
| 187 | Tachycardia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Thirst decreased | FAERS: 2 | US FAERS | |
| 189 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 190 | Thrombosis | FAERS: 2 | US FAERS | |
| 191 | Toothache | FAERS: 2 | US FAERS | |
| 192 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 193 | Urinary Retention | FAERS: 2 | US FAERS | |
| 194 | Vertigo | FAERS: 2 | US FAERS | |
| 195 | Visual Impairment | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 197 | Wrong technique in product usage process | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | jaundice | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 199 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 200 | Abulia | FAERS: 1 | US FAERS | |
| 201 | Acidosis | FAERS: 1 | US FAERS | |
| 202 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 203 | Acute psychosis | FAERS: 1 | US FAERS | |
| 204 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 205 | Amylase increased | FAERS: 1 | US FAERS | |
| 206 | Aneurysm | FAERS: 1 | US FAERS | |
| 207 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 208 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 209 | Apathy | FAERS: 1 | US FAERS | |
| 210 | Apparent death | FAERS: 1 | US FAERS | |
| 211 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 212 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 213 | Asphyxia | FAERS: 1 | US FAERS | |
| 214 | Asthma | FAERS: 1 | US FAERS | |
| 215 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 216 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 217 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 218 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 219 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 220 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 221 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 222 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 223 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 224 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 225 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 226 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 227 | Brief psychotic disorder with marked stressors | FAERS: 1 | US FAERS | |
| 228 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 229 | Burning sensation | FAERS: 1 | US FAERS | |
| 230 | Cardiac Death | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 231 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 232 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 233 | Cataract | FAERS: 1 | US FAERS | |
| 234 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 235 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 236 | Choking | FAERS: 1 | US FAERS | |
| 237 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 238 | Chromaturia | FAERS: 1 | US FAERS | |
| 239 | Cold sweat | FAERS: 1 | US FAERS | |
| 240 | Confabulation | FAERS: 1 | US FAERS | |
| 241 | Creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 242 | Deafness | FAERS: 1 | US FAERS | |
| 243 | Dental caries | FAERS: 1 | US FAERS | |
| 244 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 245 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 246 | Discomfort | FAERS: 1 | US FAERS | |
| 247 | Drug abuse | FAERS: 1 | US FAERS | |
| 248 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 249 | Drug screen positive | FAERS: 1 | US FAERS | |
| 250 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 251 | Dry skin | FAERS: 1 | US FAERS | |
| 252 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 253 | Duodenal ulcer repair | FAERS: 1 | US FAERS | |
| 254 | Dysarthria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Dysgeusia | FAERS: 1 | US FAERS | |
| 256 | Dysphemia | FAERS: 1 | US FAERS | |
| 257 | Dysuria | FAERS: 1 | US FAERS | |
| 258 | Economic problem | FAERS: 1 | US FAERS | |
| 259 | Eczema | FAERS: 1 | US FAERS | |
| 260 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 261 | Elevated mood | FAERS: 1 | US FAERS | |
| 262 | Emotional disorder | FAERS: 1 | US FAERS | |
| 263 | Enteritis | FAERS: 1 | US FAERS | |
| 264 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 265 | Enterocolitis | FAERS: 1 | US FAERS | |
| 266 | Eosinophilia | FAERS: 1 | US FAERS | |
| 267 | Eructation | FAERS: 1 | US FAERS | |
| 268 | Extra dose administered | FAERS: 1 | US FAERS | |
| 269 | Eye Burns | FAERS: 1 | US FAERS | |
| 270 | Flight of ideas | FAERS: 1 | US FAERS | |
| 271 | Food Poisoning | FAERS: 1 | US FAERS | |
| 272 | Food craving | FAERS: 1 | US FAERS | |
| 273 | Gait inability | FAERS: 1 | US FAERS | |
| 274 | Gastritis | FAERS: 1 | US FAERS | |
| 275 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 276 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 277 | Haptoglobin increased | FAERS: 1 | US FAERS | |
| 278 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 279 | Hemiparesis | FAERS: 1 | US FAERS | |
| 280 | Hepatitis C | FAERS: 1 | US FAERS | |
| 281 | Hepatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 282 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 283 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 284 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 285 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 286 | Hypokinesia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 287 | Hypoxia | FAERS: 1 | US FAERS | |
| 288 | Ileus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Immobile | FAERS: 1 | US FAERS | |
| 290 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 291 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 292 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 293 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 294 | Infarction | FAERS: 1 | US FAERS | |
| 295 | Influenza | FAERS: 1 | US FAERS | |
| 296 | Initial insomnia | FAERS: 1 | US FAERS | |
| 297 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 298 | Intentional product misuse | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 299 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 300 | Intussusception | FAERS: 1 | US FAERS | |
| 301 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 302 | Leukopenia | FAERS: 1 | US FAERS | |
| 303 | Limb injury | FAERS: 1 | US FAERS | |
| 304 | Lip swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Living in residential institution | FAERS: 1 | US FAERS | |
| 306 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 307 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 308 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 309 | Lymphoma | FAERS: 1 | US FAERS | |
| 310 | Macular degeneration | FAERS: 1 | US FAERS | |
| 311 | Macular rupture | FAERS: 1 | US FAERS | |
| 312 | Mastication disorder | FAERS: 1 | US FAERS | |
| 313 | Mastoiditis | FAERS: 1 | US FAERS | |
| 314 | Moaning | FAERS: 1 | US FAERS | |
| 315 | Mood swings | FAERS: 1 | US FAERS | |
| 316 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 317 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 318 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 319 | Necrosis | FAERS: 1 | US FAERS | |
| 320 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 321 | Nervousness | FAERS: 1 | US FAERS | |
| 322 | Neuralgia | FAERS: 1 | US FAERS | |
| 323 | Ocular icterus | FAERS: 1 | US FAERS | |
| 324 | Oligodipsia | FAERS: 1 | US FAERS | |
| 325 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 326 | PCO2 increased | FAERS: 1 | US FAERS | |
| 327 | PO2 decreased | FAERS: 1 | US FAERS | |
| 328 | Pemphigus | FAERS: 1 | US FAERS | |
| 329 | Peptic Ulcer | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 330 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 331 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 332 | Pericarditis | FAERS: 1 | US FAERS | |
| 333 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 334 | Peritonitis | FAERS: 1 | US FAERS | |
| 335 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 336 | Poverty of speech | FAERS: 1 | US FAERS | |
| 337 | Pressure of speech | FAERS: 1 | US FAERS | |
| 338 | Product administration error | FAERS: 1 | US FAERS | |
| 339 | Product packaging issue | FAERS: 1 | US FAERS | |
| 340 | Prurigo | FAERS: 1 | US FAERS | |
| 341 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 342 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 343 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 344 | Retching | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Rhinitis | FAERS: 1 | US FAERS | |
| 346 | Senile dementia | FAERS: 1 | US FAERS | |
| 347 | Septic embolus | FAERS: 1 | US FAERS | |
| 348 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 349 | Sinusitis | FAERS: 1 | US FAERS | |
| 350 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 351 | Skin reaction | FAERS: 1 | US FAERS | |
| 352 | Somnambulism | FAERS: 1 | US FAERS | |
| 353 | Staring | FAERS: 1 | US FAERS | |
| 354 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 355 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 356 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 357 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 358 | Tinnitus | FAERS: 1 | US FAERS | |
| 359 | Tooth Loss | FAERS: 1 | US FAERS | |
| 360 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 361 | Transaminases increased | FAERS: 1 | US FAERS | |
| 362 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 363 | Urine output increased | FAERS: 1 | US FAERS | |
| 364 | Vasospasm | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 365 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 366 | Ventricular arrhythmia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 367 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 368 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 369 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 370 | Bladder neck obstruction | Canada Vigilance: 1 | Canada Vigilance | |
| 371 | Embolism | Canada Vigilance: 1 | Canada Vigilance | |
| 372 | Epistaxis | Canada Vigilance: 1 | Canada Vigilance | |
| 373 | Erythema Multiforme | Canada Vigilance: 1 | Canada Vigilance | |
| 374 | Flatulence | Canada Vigilance: 1 | Canada Vigilance | |
| 375 | Gastrointestinal sounds abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 376 | Hyporeflexia | Canada Vigilance: 1 | Canada Vigilance | |
| 377 | Loss of personal independence in daily activities | Canada Vigilance: 1 | Canada Vigilance | |
| 378 | Pancreatic carcinoma | Canada Vigilance: 1 | Canada Vigilance | |
| 379 | Pathological fracture | Canada Vigilance: 2 | Canada Vigilance | |
| 380 | Phlebitis | Canada Vigilance: 1 | Canada Vigilance | |
| 381 | Product dose omission | Canada Vigilance: 1 | Canada Vigilance | |
| 382 | Tardive Dyskinesia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.