oxybutynin
(XIQVNETUBQGFHX-UHFFFAOYSA-N)
Structure
- SMILES
- CCN(CC#CCOC(=O)C(c1ccccc1)(C1CCCCC1)O)CC
- Type(s)
- Approved; Investigational
- ATC code(s)
- G04BD04
- Molecular Formula:
- C22H31NO3
- Molecular Weight:
- 357.486
- Log P:
- 3.3429
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 49.77
- CAS Number(s):
- 5633-20-5
Synonym(s)
1.
oxybutynin
2.
4-(diethylamino)-2-butynyl-alpha-cyclohexyl-alpha-hydroxybenzeneacetate
3.
4-(diethylamino)-2-butynyl-alpha-phenylcyclohexaneglycolate
4.
Apo-Oxybutynin
5.
Contimin
6.
Cystonorm
7.
Cystrin
8.
Ditropan
9.
Dresplan
10.
Dridase
11.
Driptane
12.
Gen-Oxybutynin
13.
Novo-Oxybutynin
14.
Nu-Oxybutyn
15.
Oxyb AbZ
16.
Oxybugamma
17.
Oxybutin Holsten
18.
Oxybuton
19.
Oxybutynin AL
20.
Oxybutynin AZU
21.
Oxybutynin Heumann
22.
Oxybutynin Hexal
23.
Oxybutynin Stada
24.
Oxybutynin-Puren
25.
Oxybutynin-ratiopharm
26.
Oxymedin
27.
Oxytrol
28.
PMS-Oxybutynin
29.
Pollakisu
30.
Renamel
31.
Ryol
32.
Spasmex Oxybutynin
33.
Spasyt
34.
Tavor
35.
Zatur
36.
gelnique
37.
oxybutynin chloride
38.
oxybutynin hydrochloride
39.
oxybutynin von ct
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 1829 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 2 | Application site erythema | FAERS: 473 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Product adhesion issue | FAERS: 463 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Application site pruritus | FAERS: 287 | OFFSIDES SIDER US FAERS | |
| 5 | Product quality issue | FAERS: 278 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Pruritus | FAERS: 276 | SIDER US FAERS | |
| 7 | Erythema | FAERS: 226 | OFFSIDES SIDER US FAERS | |
| 8 | Application site rash | FAERS: 169 | OFFSIDES SIDER US FAERS | |
| 9 | Product use issue | FAERS: 135 | US FAERS | |
| 10 | Drug administered at inappropriate site | FAERS: 132 | US FAERS | |
| 11 | Inappropriate schedule of drug administration | FAERS: 131 | US FAERS | |
| 12 | Application site irritation | FAERS: 122 | US FAERS | |
| 13 | Dizziness | FAERS: 116 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Application site pain | FAERS: 112 | SIDER US FAERS | |
| 15 | Skin irritation | FAERS: 102 | US FAERS | |
| 16 | Drug effect incomplete | FAERS: 69 | US FAERS | |
| 17 | Constipation | FAERS: 68 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 18 | Incorrect drug administration duration | FAERS: 65 | US FAERS | |
| 19 | Wrong technique in drug usage process | FAERS: 63 | OFFSIDES US FAERS | |
| 20 | Pain | FAERS: 60 | OFFSIDES SIDER US FAERS | |
| 21 | Wrong technique in product usage process | FAERS: 60 | US FAERS | |
| 22 | Nausea | FAERS: 59 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 23 | Headache | FAERS: 57 | SIDER US FAERS | |
| 24 | Product closure removal difficult | FAERS: 54 | US FAERS | |
| 25 | Rash erythematous | FAERS: 54 | US FAERS | |
| 26 | Drug effect delayed | FAERS: 53 | US FAERS | |
| 27 | Expired product administered | FAERS: 53 | US FAERS | |
| 28 | Product packaging issue | FAERS: 53 | US FAERS | |
| 29 | Application site burn | FAERS: 49 | SIDER US FAERS | |
| 30 | Hypersensitivity | FAERS: 44 | SIDER US FAERS | |
| 31 | Back Pain | FAERS: 40 | SIDER US FAERS | |
| 32 | Urinary Retention | FAERS: 39 | SIDER US FAERS | |
| 33 | Somnolence | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Urinary Incontinence | FAERS: 36 | 3930473 15977961 | CTD US FAERS |
| 35 | Discomfort | FAERS: 35 | SIDER US FAERS | |
| 36 | Malaise | FAERS: 35 | SIDER US FAERS | |
| 37 | Burning sensation | FAERS: 33 | US FAERS | |
| 38 | Fatigue | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 39 | Feeling abnormal | FAERS: 30 | SIDER US FAERS | |
| 40 | Dysuria | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 41 | Adverse event | FAERS: 26 | OFFSIDES US FAERS | |
| 42 | Unevaluable event | FAERS: 26 | OFFSIDES US FAERS | |
| 43 | Urinary tract infection | FAERS: 26 | SIDER US FAERS | |
| 44 | Nocturia | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 45 | Overdose | FAERS: 25 | OFFSIDES US FAERS | |
| 46 | Application site discomfort | FAERS: 24 | US FAERS | |
| 47 | Urticaria | FAERS: 24 | SIDER US FAERS | |
| 48 | Anxiety | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 49 | Amnesia | FAERS: 21 | SIDER US FAERS | |
| 50 | Application site reaction | FAERS: 21 | SIDER US FAERS | |
| 51 | Application site swelling | FAERS: 21 | US FAERS | |
| 52 | Drug ineffective for unapproved indication | FAERS: 21 | US FAERS | |
| 53 | Agitation | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 54 | Asthenia | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 55 | Abdominal discomfort | FAERS: 18 | SIDER US FAERS | |
| 56 | Cystitis | FAERS: 18 | SIDER US FAERS | |
| 57 | Application site exfoliation | FAERS: 17 | US FAERS | |
| 58 | Drug administration error | FAERS: 17 | US FAERS | |
| 59 | Drug prescribing error | FAERS: 17 | US FAERS | |
| 60 | Dry skin | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 61 | Skin reaction | FAERS: 16 | US FAERS | |
| 62 | Application site vesicles | FAERS: 15 | SIDER US FAERS | |
| 63 | Chest Pain | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 64 | Medication residue present | FAERS: 14 | US FAERS | |
| 65 | Pharmaceutical product complaint | FAERS: 14 | US FAERS | |
| 66 | Thirst | FAERS: 14 | SIDER US FAERS | |
| 67 | Arthralgia | FAERS: 13 | SIDER US FAERS | |
| 68 | Incorrect dose administered | FAERS: 13 | US FAERS | |
| 69 | Peripheral swelling | FAERS: 13 | US FAERS | |
| 70 | Abdominal Pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 71 | Delirium | FAERS: 12 | 17163294 | CTD US FAERS |
| 72 | Drug dose omission | FAERS: 12 | US FAERS | |
| 73 | Product substitution issue | FAERS: 12 | US FAERS | |
| 74 | Swelling | FAERS: 12 | US FAERS | |
| 75 | Therapeutic response unexpected | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Dehydration | FAERS: 11 | OFFSIDES US FAERS | |
| 77 | Disorientation | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 78 | Drug effect variable | FAERS: 11 | US FAERS | |
| 79 | Medication Error | FAERS: 11 | US FAERS | |
| 80 | Application site papules | FAERS: 10 | US FAERS | |
| 81 | Application site urticaria | FAERS: 10 | OFFSIDES US FAERS | |
| 82 | Application site warmth | FAERS: 10 | US FAERS | |
| 83 | Chromaturia | FAERS: 10 | US FAERS | |
| 84 | Drug Dependence | FAERS: 10 | US FAERS | |
| 85 | Dysgeusia | FAERS: 10 | SIDER US FAERS | |
| 86 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 87 | Myalgia | FAERS: 10 | US FAERS | |
| 88 | Palpitations | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 89 | Product residue present | FAERS: 10 | US FAERS | |
| 90 | Vomiting | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 91 | Application site inflammation | FAERS: 9 | US FAERS | |
| 92 | Application site scar | FAERS: 9 | US FAERS | |
| 93 | Bladder pain | FAERS: 9 | SIDER US FAERS | |
| 94 | Circumstance or information capable of leading to medication error | FAERS: 9 | US FAERS | |
| 95 | Inappropriate schedule of product administration | FAERS: 9 | US FAERS | |
| 96 | Nasopharyngitis | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 97 | Nervousness | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 98 | Pain of skin | FAERS: 9 | OFFSIDES US FAERS | |
| 99 | Visual Impairment | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 100 | Alopecia | FAERS: 8 | OFFSIDES US FAERS | |
| 101 | Application site erosion | FAERS: 8 | US FAERS | |
| 102 | Dyspepsia | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 103 | Flatulence | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 104 | Product label issue | FAERS: 8 | US FAERS | |
| 105 | Product use complaint | FAERS: 8 | US FAERS | |
| 106 | Syncope | FAERS: 8 | SIDER US FAERS | |
| 107 | Vertigo | FAERS: 8 | US FAERS | |
| 108 | Application site dryness | FAERS: 7 | US FAERS | |
| 109 | Memory impairment | FAERS: 7 | SIDER US FAERS | |
| 110 | Product package associated injury | FAERS: 7 | US FAERS | |
| 111 | Product packaging quantity issue | FAERS: 7 | US FAERS | |
| 112 | Product physical issue | FAERS: 7 | US FAERS | |
| 113 | Therapeutic response changed | FAERS: 7 | US FAERS | |
| 114 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 115 | Drug abuse | FAERS: 6 | US FAERS | |
| 116 | Lip swelling | FAERS: 6 | US FAERS | |
| 117 | Tremor | FAERS: 6 | US FAERS | |
| 118 | Angioedema | FAERS: 5 | SIDER US FAERS | |
| 119 | Bladder spasm | FAERS: 5 | OFFSIDES US FAERS | |
| 120 | Blood urine present | FAERS: 5 | US FAERS | |
| 121 | Chills | FAERS: 5 | US FAERS | |
| 122 | Device adhesion issue | FAERS: 5 | US FAERS | |
| 123 | Drug administered to patient of inappropriate age | FAERS: 5 | US FAERS | |
| 124 | Dysphonia | FAERS: 5 | SIDER US FAERS | |
| 125 | Eye pain | FAERS: 5 | SIDER US FAERS | |
| 126 | Hypotension | FAERS: 5 | 6510843 | CTD SIDER US FAERS |
| 127 | Incorrect product storage | FAERS: 5 | US FAERS | |
| 128 | Inflammation | FAERS: 5 | US FAERS | |
| 129 | Joint swelling | FAERS: 5 | US FAERS | |
| 130 | Laceration | FAERS: 5 | US FAERS | |
| 131 | No adverse event | FAERS: 5 | US FAERS | |
| 132 | Aphasia | FAERS: 4 | US FAERS | |
| 133 | Application site discharge | FAERS: 4 | US FAERS | |
| 134 | Application site hypersensitivity | FAERS: 4 | US FAERS | |
| 135 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 136 | Dementia | FAERS: 4 | US FAERS | |
| 137 | Diplopia | FAERS: 4 | US FAERS | |
| 138 | Drug toxicity | FAERS: 4 | US FAERS | |
| 139 | Incontinence | FAERS: 4 | OFFSIDES US FAERS | |
| 140 | Polyuria | FAERS: 4 | US FAERS | |
| 141 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 142 | Presyncope | FAERS: 4 | US FAERS | |
| 143 | Therapeutic product ineffective | FAERS: 4 | US FAERS | |
| 144 | Thermal burn | FAERS: 4 | US FAERS | |
| 145 | Urinary hesitation | FAERS: 4 | SIDER US FAERS | |
| 146 | Weight decreased | FAERS: 4 | US FAERS | |
| 147 | treatment failure | FAERS: 4 | US FAERS | |
| 148 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 149 | Application site infection | FAERS: 3 | US FAERS | |
| 150 | Application site laceration | FAERS: 3 | US FAERS | |
| 151 | Application site scab | FAERS: 3 | US FAERS | |
| 152 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 153 | Dysarthria | FAERS: 3 | US FAERS | |
| 154 | Eye irritation | FAERS: 3 | SIDER US FAERS | |
| 155 | Flank Pain | FAERS: 3 | SIDER US FAERS | |
| 156 | Hallucinations, mixed | FAERS: 3 | US FAERS | |
| 157 | Hydronephrosis | FAERS: 3 | OFFSIDES US FAERS | |
| 158 | Impaired work ability | FAERS: 3 | US FAERS | |
| 159 | Infection | FAERS: 3 | SIDER US FAERS | |
| 160 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 161 | Lethargy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 162 | Medication residue | FAERS: 3 | US FAERS | |
| 163 | Mental status changes | FAERS: 3 | OFFSIDES US FAERS | |
| 164 | Middle insomnia | FAERS: 3 | US FAERS | |
| 165 | Musculoskeletal discomfort | FAERS: 3 | SIDER US FAERS | |
| 166 | Night sweats | FAERS: 3 | US FAERS | |
| 167 | Oral pain | FAERS: 3 | US FAERS | |
| 168 | Oropharyngeal pain | FAERS: 3 | SIDER US FAERS | |
| 169 | Pneumonia | FAERS: 3 | US FAERS | |
| 170 | Product administered at inappropriate site | FAERS: 3 | US FAERS | |
| 171 | Product dose omission | FAERS: 3 | US FAERS | |
| 172 | Product lot number issue | FAERS: 3 | US FAERS | |
| 173 | Product prescribing error | FAERS: 3 | US FAERS | |
| 174 | Restlessness | FAERS: 3 | US FAERS | |
| 175 | Skin hypertrophy | FAERS: 3 | OFFSIDES US FAERS | |
| 176 | Stomatitis | FAERS: 3 | SIDER US FAERS | |
| 177 | Urine output increased | FAERS: 3 | US FAERS | |
| 178 | Abasia | FAERS: 2 | OFFSIDES US FAERS | |
| 179 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 180 | Accidental overdose | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Aneurysm | FAERS: 2 | US FAERS | |
| 182 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 183 | Anticholinergic Syndrome | FAERS: 2 | US FAERS | |
| 184 | Anuria | FAERS: 2 | US FAERS | |
| 185 | Aphonia | FAERS: 2 | US FAERS | |
| 186 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 187 | Application site acne | FAERS: 2 | US FAERS | |
| 188 | Application site nodule | FAERS: 2 | US FAERS | |
| 189 | Boredom | FAERS: 2 | US FAERS | |
| 190 | Chemical injury | FAERS: 2 | US FAERS | |
| 191 | Cor pulmonale | FAERS: 2 | US FAERS | |
| 192 | Corneal Infection | FAERS: 2 | US FAERS | |
| 193 | Creutzfeldt-Jakob disease | FAERS: 2 | US FAERS | |
| 194 | Cyanosis | FAERS: 2 | US FAERS | |
| 195 | Dental caries | FAERS: 2 | OFFSIDES US FAERS | |
| 196 | Dependence | FAERS: 2 | US FAERS | |
| 197 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 198 | Device material issue | FAERS: 2 | US FAERS | |
| 199 | Device use error | FAERS: 2 | US FAERS | |
| 200 | Disease recurrence | FAERS: 2 | US FAERS | |
| 201 | Enuresis | FAERS: 2 | US FAERS | |
| 202 | Eructation | FAERS: 2 | SIDER US FAERS | |
| 203 | Feeling jittery | FAERS: 2 | US FAERS | |
| 204 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 205 | Hypohidrosis | FAERS: 2 | SIDER US FAERS | |
| 206 | Ileus | FAERS: 2 | US FAERS | |
| 207 | Initial insomnia | FAERS: 2 | US FAERS | |
| 208 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 209 | Laryngitis | FAERS: 2 | US FAERS | |
| 210 | Limb injury | FAERS: 2 | US FAERS | |
| 211 | Muscle strain | FAERS: 2 | US FAERS | |
| 212 | Neck Pain | FAERS: 2 | US FAERS | |
| 213 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 214 | Nodule | FAERS: 2 | US FAERS | |
| 215 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 216 | Pallor | FAERS: 2 | US FAERS | |
| 217 | Polydipsia | FAERS: 2 | US FAERS | |
| 218 | Product dispensing error | FAERS: 2 | US FAERS | |
| 219 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 220 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 221 | Quality of life decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 222 | Renal pain | FAERS: 2 | US FAERS | |
| 223 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 224 | Scab | FAERS: 2 | US FAERS | |
| 225 | Sinusitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 226 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 227 | Skin lesion | FAERS: 2 | US FAERS | |
| 228 | Tachycardia | FAERS: 2 | 6510843 | CTD SIDER US FAERS |
| 229 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 230 | Throat irritation | FAERS: 2 | US FAERS | |
| 231 | Urge Incontinence | FAERS: 2 | OFFSIDES US FAERS | |
| 232 | Vasculitis | FAERS: 2 | US FAERS | |
| 233 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 234 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 235 | Wheezing | FAERS: 2 | US FAERS | |
| 236 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 237 | furuncle | FAERS: 2 | US FAERS | |
| 238 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 239 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 240 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 241 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 242 | Accidental underdose | FAERS: 1 | US FAERS | |
| 243 | Acne | FAERS: 1 | US FAERS | |
| 244 | Activities of daily living impaired | FAERS: 1 | OFFSIDES US FAERS | |
| 245 | Administration related reaction | FAERS: 1 | US FAERS | |
| 246 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 247 | Ageusia | FAERS: 1 | SIDER US FAERS | |
| 248 | Anal Fissure | FAERS: 1 | US FAERS | |
| 249 | Anger | FAERS: 1 | US FAERS | |
| 250 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 251 | Angle Closure Glaucoma | FAERS: 1 | SIDER US FAERS | |
| 252 | Anhidrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 253 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 254 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 255 | Anorexia | FAERS: 1 | SIDER US FAERS | |
| 256 | Application site eczema | FAERS: 1 | US FAERS | |
| 257 | Application site injury | FAERS: 1 | US FAERS | |
| 258 | Application site macule | FAERS: 1 | US FAERS | |
| 259 | Application site ulcer | FAERS: 1 | US FAERS | |
| 260 | Arthritis | FAERS: 1 | SIDER US FAERS | |
| 261 | Arthropathy | FAERS: 1 | SIDER US FAERS | |
| 262 | Asterixis | FAERS: 1 | OFFSIDES US FAERS | |
| 263 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 264 | Automatic bladder | FAERS: 1 | US FAERS | |
| 265 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 266 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 267 | Bladder discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 268 | Blindness | FAERS: 1 | 18476934 | CTD US FAERS |
| 269 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 270 | Blood creatinine increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 271 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 272 | Blood glucose increased | FAERS: 1 | SIDER US FAERS | |
| 273 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 274 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 275 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 276 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 277 | Bradykinesia | FAERS: 1 | US FAERS | |
| 278 | Bronchitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 279 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 280 | Bronchospasm | FAERS: 1 | US FAERS | |
| 281 | Cachexia | FAERS: 1 | US FAERS | |
| 282 | Carcinoma | FAERS: 1 | US FAERS | |
| 283 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 284 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 285 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 286 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 287 | Cataract | FAERS: 1 | OFFSIDES US FAERS | |
| 288 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 289 | Cervical polyp | FAERS: 1 | US FAERS | |
| 290 | Cheilitis | FAERS: 1 | US FAERS | |
| 291 | Chest discomfort | FAERS: 1 | SIDER US FAERS | |
| 292 | Choking | FAERS: 1 | US FAERS | |
| 293 | Clumsiness | FAERS: 1 | US FAERS | |
| 294 | Cold sweat | FAERS: 1 | US FAERS | |
| 295 | Colitis | FAERS: 1 | SIDER US FAERS | |
| 296 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 297 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 298 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 299 | Deafness | FAERS: 1 | US FAERS | |
| 300 | Delusion of reference | FAERS: 1 | US FAERS | |
| 301 | Deprescribing error | FAERS: 1 | US FAERS | |
| 302 | Depressed Level of Consciousness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Device difficult to use | FAERS: 1 | US FAERS | |
| 304 | Disability | FAERS: 1 | US FAERS | |
| 305 | Diverticulitis | FAERS: 1 | US FAERS | |
| 306 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 307 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 308 | Dyschezia | FAERS: 1 | US FAERS | |
| 309 | Ear discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 310 | Economic problem | FAERS: 1 | US FAERS | |
| 311 | Electromyogram abnormal | FAERS: 1 | US FAERS | |
| 312 | Endodontic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 313 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 314 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 315 | Epistaxis | FAERS: 1 | SIDER US FAERS | |
| 316 | Erectile dysfunction | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 317 | Erythromelalgia | FAERS: 1 | US FAERS | |
| 318 | Escherichia infection | FAERS: 1 | US FAERS | |
| 319 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 320 | Excoriation | FAERS: 1 | US FAERS | |
| 321 | Expired drug administered | FAERS: 1 | US FAERS | |
| 322 | Eye inflammation | FAERS: 1 | US FAERS | |
| 323 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 324 | Feeling Cold | FAERS: 1 | US FAERS | |
| 325 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 326 | Flushing | FAERS: 1 | SIDER US FAERS | |
| 327 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 328 | Formication | FAERS: 1 | US FAERS | |
| 329 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 330 | Gait inability | FAERS: 1 | US FAERS | |
| 331 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 332 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 333 | General symptom | FAERS: 1 | US FAERS | |
| 334 | Gingival Recession | FAERS: 1 | US FAERS | |
| 335 | Glossitis | FAERS: 1 | SIDER US FAERS | |
| 336 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 337 | Heat Stroke | FAERS: 1 | SIDER US FAERS | |
| 338 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 339 | Hunger | FAERS: 1 | US FAERS | |
| 340 | Hypersomnia | FAERS: 1 | US FAERS | |
| 341 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 342 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 343 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 344 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 345 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 346 | Intentional misuse | FAERS: 1 | US FAERS | |
| 347 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 348 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 349 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 350 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 351 | Intraocular pressure fluctuation | FAERS: 1 | US FAERS | |
| 352 | Joint injury | FAERS: 1 | OFFSIDES US FAERS | |
| 353 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 354 | Lacrimation decreased | FAERS: 1 | SIDER US FAERS | |
| 355 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 356 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 357 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 358 | Macular degeneration | FAERS: 1 | US FAERS | |
| 359 | Mastication disorder | FAERS: 1 | US FAERS | |
| 360 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 361 | Mental impairment | FAERS: 1 | US FAERS | |
| 362 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 363 | Miliaria | FAERS: 1 | US FAERS | |
| 364 | Mouth swelling | FAERS: 1 | US FAERS | |
| 365 | Multiple allergies | FAERS: 1 | US FAERS | |
| 366 | Muscle tightness | FAERS: 1 | US FAERS | |
| 367 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 368 | Musculoskeletal stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 369 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 370 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 371 | Neuralgia | FAERS: 1 | US FAERS | |
| 372 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 373 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 374 | Ocular icterus | FAERS: 1 | US FAERS | |
| 375 | Onychoclasis | FAERS: 1 | US FAERS | |
| 376 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 377 | Oral infection | FAERS: 1 | US FAERS | |
| 378 | Oral pruritus | FAERS: 1 | US FAERS | |
| 379 | Packaging design issue | FAERS: 1 | US FAERS | |
| 380 | Pancreatitis | FAERS: 1 | US FAERS | |
| 381 | Pancytopenia | FAERS: 1 | US FAERS | |
| 382 | Papule | FAERS: 1 | US FAERS | |
| 383 | Paranoia | FAERS: 1 | SIDER US FAERS | |
| 384 | Patella replacement | FAERS: 1 | US FAERS | |
| 385 | Pelvic discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 386 | Pericarditis | FAERS: 1 | US FAERS | |
| 387 | Perineal erythema | FAERS: 1 | US FAERS | |
| 388 | Perineal pain | FAERS: 1 | US FAERS | |
| 389 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 390 | Pharyngitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 391 | Photophobia | FAERS: 1 | US FAERS | |
| 392 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 393 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 394 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 395 | Product availability issue | FAERS: 1 | US FAERS | |
| 396 | Product distribution issue | FAERS: 1 | US FAERS | |
| 397 | Product formulation issue | FAERS: 1 | US FAERS | |
| 398 | Product label confusion | FAERS: 1 | US FAERS | |
| 399 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 400 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 401 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 402 | Product storage error | FAERS: 1 | US FAERS | |
| 403 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 404 | Rectal fissure | FAERS: 1 | US FAERS | |
| 405 | Respiratory distress | FAERS: 1 | US FAERS | |
| 406 | Resting Tremor | FAERS: 1 | US FAERS | |
| 407 | Retching | FAERS: 1 | US FAERS | |
| 408 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 409 | Rosacea | FAERS: 1 | US FAERS | |
| 410 | Senile dementia | FAERS: 1 | US FAERS | |
| 411 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 412 | Sepsis | FAERS: 1 | US FAERS | |
| 413 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 414 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 415 | Skin discomfort | FAERS: 1 | US FAERS | |
| 416 | Skin tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 417 | Sluggishness | FAERS: 1 | US FAERS | |
| 418 | Sneezing | FAERS: 1 | US FAERS | |
| 419 | Somnambulism | FAERS: 1 | US FAERS | |
| 420 | Specific gravity urine decreased | FAERS: 1 | US FAERS | |
| 421 | Strabismus | FAERS: 1 | US FAERS | |
| 422 | Sunburn | FAERS: 1 | US FAERS | |
| 423 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 424 | Tension | FAERS: 1 | SIDER US FAERS | |
| 425 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 426 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 427 | Tinnitus | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 428 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 429 | Tonsillitis | FAERS: 1 | US FAERS | |
| 430 | Toothache | FAERS: 1 | US FAERS | |
| 431 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 432 | Trismus | FAERS: 1 | US FAERS | |
| 433 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 434 | Urinary bladder atrophy | FAERS: 1 | US FAERS | |
| 435 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 436 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 437 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 438 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 439 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 440 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 441 | White blood cell count abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 442 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 443 | Wound Complication | FAERS: 1 | US FAERS | |
| 444 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 445 | muscle injury | FAERS: 1 | US FAERS | |
| 446 | AIDS Dementia Complex | OFFSIDES | ||
| 447 | Abdominal sepsis | OFFSIDES | ||
| 448 | Abnormal vision | OFFSIDES SIDER | ||
| 449 | Acid reflux | OFFSIDES | ||
| 450 | Acute bronchitis | OFFSIDES | ||
| 451 | Acute graft versus host disease in liver | OFFSIDES | ||
| 452 | Acute myocardial infarction | OFFSIDES | ||
| 453 | Acute respiratory failure | OFFSIDES | ||
| 454 | Akathisia | SIDER | ||
| 455 | Alveoloplasty | OFFSIDES | ||
| 456 | Amblyopia | SIDER | ||
| 457 | Anaphylactic shock | SIDER | ||
| 458 | Anti-HBc IgG antibody positive | OFFSIDES | ||
| 459 | Aortic Aneurysm | OFFSIDES | ||
| 460 | Arthropod bite | OFFSIDES | ||
| 461 | Arthroscopy | OFFSIDES | ||
| 462 | Aspiration Pneumonia | OFFSIDES | ||
| 463 | Asthma | SIDER | ||
| 464 | Ataxia | Canada Vigilance: 1 | Canada Vigilance | |
| 465 | Barium swallow abnormal | OFFSIDES | ||
| 466 | Beta 2 microglobulin increased | OFFSIDES | ||
| 467 | Bipolar Disorder | OFFSIDES | ||
| 468 | Bipolar I disorder | OFFSIDES | ||
| 469 | Bloated feeling | SIDER | ||
| 470 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 471 | Blood Glucose | OFFSIDES | ||
| 472 | Blood cholesterol | OFFSIDES | ||
| 473 | Blood electrolytes decreased | OFFSIDES | ||
| 474 | Blood iron increased | OFFSIDES | ||
| 475 | Blood potassium decreased | OFFSIDES | ||
| 476 | Blood triglycerides increased | OFFSIDES | ||
| 477 | Body Temperature | OFFSIDES | ||
| 478 | Bone lesion | OFFSIDES | ||
| 479 | Bone swelling | OFFSIDES | ||
| 480 | Brain scan abnormal | OFFSIDES | ||
| 481 | Bursitis | OFFSIDES | ||
| 482 | Candida sepsis | OFFSIDES | ||
| 483 | Cardioactive drug level above therapeutic | OFFSIDES | ||
| 484 | Catalepsy | 10888308 | CTD | |
| 485 | Cataract operation | OFFSIDES | ||
| 486 | Catheter related infection | OFFSIDES | ||
| 487 | Cellulitis | OFFSIDES | ||
| 488 | Central nervous system lesion | OFFSIDES | ||
| 489 | Cerebral cyst | OFFSIDES | ||
| 490 | Choking sensation | OFFSIDES | ||
| 491 | Cholangiolitis | OFFSIDES | ||
| 492 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 493 | Circumoral paresthesia | SIDER | ||
| 494 | Cognition Disorders | 9434659 18384584 | CTD | |
| 495 | Completed Suicide | OFFSIDES | ||
| 496 | Confabulation | OFFSIDES | ||
| 497 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 498 | Conjunctivitis | SIDER | ||
| 499 | Creatinine increased | SIDER | ||
| 500 | Cutaneous hypersensitivity | SIDER | ||
| 501 | Cycloplegia | SIDER | ||
| 502 | Cyst | OFFSIDES | ||
| 503 | Demyelination | OFFSIDES | ||
| 504 | Dermatomyositis | OFFSIDES | ||
| 505 | Detrusor instability | SIDER | ||
| 506 | Device malfunction | OFFSIDES | ||
| 507 | Diabetes | OFFSIDES | ||
| 508 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 509 | Diabetic Nephropathy | OFFSIDES | ||
| 510 | Dialysis disequilibrium syndrome | OFFSIDES | ||
| 511 | Diarrhea | OFFSIDES | ||
| 512 | Disturbance in sexual arousal | SIDER | ||
| 513 | Drowsiness | SIDER | ||
| 514 | Duodenitis | OFFSIDES | ||
| 515 | Ear and labyrinth disorders | SIDER | ||
| 516 | Early satiety | OFFSIDES | ||
| 517 | Ecchymosis | Canada Vigilance: 1 | Canada Vigilance | |
| 518 | Ejection Fraction Decreased | OFFSIDES | ||
| 519 | Emergency Care | OFFSIDES | ||
| 520 | Emotional distress | OFFSIDES | ||
| 521 | Encephalomalacia | OFFSIDES | ||
| 522 | Endometriosis | OFFSIDES | ||
| 523 | Enlargement abdomen | SIDER | ||
| 524 | Eosinophilic myocarditis | OFFSIDES | ||
| 525 | Epididymitis | OFFSIDES | ||
| 526 | Epiglottitis | Canada Vigilance: 1 | Canada Vigilance | |
| 527 | Escherichia sepsis | OFFSIDES | ||
| 528 | Euphoric mood | Canada Vigilance: 1 | Canada Vigilance | |
| 529 | Facial Neuralgia | OFFSIDES | ||
| 530 | Failure to Thrive | OFFSIDES | ||
| 531 | Folliculitis | OFFSIDES | ||
| 532 | Gambling | OFFSIDES | ||
| 533 | Gastroenteritis | OFFSIDES | ||
| 534 | General physical health deterioration | OFFSIDES | ||
| 535 | Gingival blister | OFFSIDES | ||
| 536 | Glaucoma | SIDER | ||
| 537 | Hallucinations | 8562668 17163294 | CTD | |
| 538 | Haptoglobin Decreased | OFFSIDES | ||
| 539 | Hepatic necrosis | OFFSIDES | ||
| 540 | Hoarseness | SIDER | ||
| 541 | Hyaluronic acid increased | OFFSIDES | ||
| 542 | Hydrocephalus | OFFSIDES | ||
| 543 | Hyperkeratosis | OFFSIDES | ||
| 544 | Hyperkinesia | SIDER | ||
| 545 | Hypoaesthesia facial | OFFSIDES | ||
| 546 | Hypokinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 547 | Increased upper airway secretion | SIDER | ||
| 548 | Infected cyst | OFFSIDES | ||
| 549 | Infestation | SIDER | ||
| 550 | Inflicted injury | SIDER | ||
| 551 | Influenza | SIDER | ||
| 552 | Infusion site mobility decreased | OFFSIDES | ||
| 553 | Instillation site pain | OFFSIDES | ||
| 554 | Intervertebral disc disorder | OFFSIDES | ||
| 555 | Intestinal infarction | OFFSIDES | ||
| 556 | Iritis | SIDER | ||
| 557 | Joint Instability | OFFSIDES | ||
| 558 | Joint Range of Motion Decreased | OFFSIDES | ||
| 559 | Joint sprain | OFFSIDES | ||
| 560 | Joint stiffness | OFFSIDES | ||
| 561 | Keratitis sicca | OFFSIDES | ||
| 562 | Keratoconjunctivitis Sicca | SIDER | ||
| 563 | Ligament rupture | OFFSIDES | ||
| 564 | Lumbar radiculopathy | OFFSIDES | ||
| 565 | Macule | SIDER | ||
| 566 | Malnutrition | SIDER | ||
| 567 | Markedly reduced dietary intake | OFFSIDES | ||
| 568 | Memory Disorders | 17163294 | CTD | |
| 569 | Mood swings | SIDER | ||
| 570 | Multiple sclerosis relapse | OFFSIDES | ||
| 571 | Muscle Weakness | OFFSIDES | ||
| 572 | Musculoskeletal chest pain | OFFSIDES | ||
| 573 | Mydriasis | SIDER | ||
| 574 | Myelodysplasia | OFFSIDES | ||
| 575 | Myeloma recurrence | OFFSIDES | ||
| 576 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 577 | Open wound | OFFSIDES | ||
| 578 | Optic Nerve Glioma | OFFSIDES | ||
| 579 | Osteomyelitis | OFFSIDES | ||
| 580 | Oxygen supplementation | OFFSIDES | ||
| 581 | Paraparesis | OFFSIDES | ||
| 582 | Parasomnia | OFFSIDES | ||
| 583 | Pericardial effusion | OFFSIDES | ||
| 584 | Periodontitis | OFFSIDES | ||
| 585 | Personality Change | Canada Vigilance: 1 | Canada Vigilance | |
| 586 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 587 | Pharyngolaryngeal Pain | SIDER | ||
| 588 | Physical disability | OFFSIDES | ||
| 589 | Pituitary enlargement | OFFSIDES | ||
| 590 | Post procedural infection | OFFSIDES | ||
| 591 | Postictal headache | OFFSIDES | ||
| 592 | Productive Cough | OFFSIDES | ||
| 593 | Psychoses, Substance-Induced | 17163294 | CTD | |
| 594 | Rectal Prolapse | OFFSIDES | ||
| 595 | Renal cyst | OFFSIDES | ||
| 596 | Residual urine volume | SIDER | ||
| 597 | Respiratory tract congestion | OFFSIDES | ||
| 598 | Rhinitis | OFFSIDES SIDER | ||
| 599 | Sclerodactylia | OFFSIDES | ||
| 600 | Seizures | 18476934 | CTD | |
| 601 | Sequestrectomy | OFFSIDES | ||
| 602 | Shock | SIDER | ||
| 603 | Sinus Arrhythmia | SIDER | ||
| 604 | Sinus headache | OFFSIDES SIDER | ||
| 605 | Skin Induration | OFFSIDES | ||
| 606 | Soft tissue inflammation | OFFSIDES | ||
| 607 | Spinal column stenosis | OFFSIDES | ||
| 608 | Spinal fusion surgery | OFFSIDES | ||
| 609 | Stem cell transplant | OFFSIDES | ||
| 610 | Stress | OFFSIDES | ||
| 611 | Subcutaneous nodule | OFFSIDES | ||
| 612 | Tenosynovitis | SIDER | ||
| 613 | Thrombocytopenia | Canada Vigilance: 1 | Canada Vigilance | |
| 614 | Tobacco user | OFFSIDES | ||
| 615 | Tooth Extraction | OFFSIDES | ||
| 616 | Transaminases increased | OFFSIDES | ||
| 617 | Transferrin saturation increased | OFFSIDES | ||
| 618 | Urethritis noninfective | SIDER | ||
| 619 | Urethritis | SIDER | ||
| 620 | Vasodilation procedure | SIDER | ||
| 621 | Vasodilation | SIDER | ||
| 622 | Vesiculobullous rash | SIDER | ||
| 623 | Walking aid user | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.