Norethindrone
(VIKNJXKGJWUCNN-XGXHKTLJSA-N)
Structure
- SMILES
- C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
- Type(s)
- Approved
- ATC code(s)
- G03AA05; G03AB04; G03AC01; G03DC02; G03FA01; G03FB05
- Molecular Formula:
- C20H26O2
- Molecular Weight:
- 298.419
- Log P:
- 3.4925
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 37.3
- CAS Number(s):
- 68-22-4
Synonym(s)
1.
Norethindrone
2.
Ethinylnortestosterone
3.
Norethisterone
4.
Norpregneninolone
5.
Conceplan
6.
Micronor
7.
Monogest
8.
Nor-QD
9.
Norcolut
10.
Norcolute
11.
Norethindrone, (1 beta)-Isomer
12.
Norlutin
13.
Nor QD
14.
NorQD
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | No adverse event | FAERS: 270 | US FAERS | |
| 2 | Drug dose omission | FAERS: 176 | OFFSIDES US FAERS | |
| 3 | Product adhesion issue | FAERS: 150 | US FAERS | |
| 4 | Wrong technique in product usage process | FAERS: 132 | US FAERS | |
| 5 | Product quality issue | FAERS: 114 | OFFSIDES US FAERS | |
| 6 | Drug ineffective | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Application site erythema | FAERS: 82 | US FAERS | |
| 8 | Application site pruritus | FAERS: 80 | US FAERS | |
| 9 | Inappropriate schedule of drug administration | FAERS: 62 | OFFSIDES US FAERS | |
| 10 | Therapy cessation | FAERS: 57 | US FAERS | |
| 11 | Headache | FAERS: 45 Canada Vigilance: 7 | 9678128 19443681 | CTD SIDER Canada Vigilance US FAERS |
| 12 | Application site irritation | FAERS: 42 | US FAERS | |
| 13 | Pregnancy on oral contraceptive | FAERS: 42 Canada Vigilance: 11 | Canada Vigilance OFFSIDES US FAERS | |
| 14 | Drug administration error | FAERS: 39 | US FAERS | |
| 15 | Product storage error | FAERS: 38 | US FAERS | |
| 16 | Drug exposure during pregnancy | FAERS: 36 | OFFSIDES US FAERS | |
| 17 | Incorrect product storage | FAERS: 36 | US FAERS | |
| 18 | Metrorrhagia | FAERS: 35 | SIDER US FAERS | |
| 19 | Drug prescribing error | FAERS: 32 | US FAERS | |
| 20 | Night sweats | FAERS: 31 | US FAERS | |
| 21 | Dizziness | FAERS: 30 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 22 | Nausea | FAERS: 30 Canada Vigilance: 4 | 9678128 19443681 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 23 | Application site rash | FAERS: 26 | US FAERS | |
| 24 | Drug administered at inappropriate site | FAERS: 25 | US FAERS | |
| 25 | Abdominal Pain | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 26 | Application site pain | FAERS: 23 | US FAERS | |
| 27 | Fatigue | FAERS: 22 Canada Vigilance: 2 | 19443681 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 28 | Breast tenderness | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Incorrect drug administration duration | FAERS: 18 | US FAERS | |
| 30 | Weight decreased | FAERS: 18 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 31 | Palpitations | FAERS: 17 | US FAERS | |
| 32 | Feeling abnormal | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Malaise | FAERS: 16 | US FAERS | |
| 34 | Nervousness | FAERS: 15 | SIDER US FAERS | |
| 35 | Suppressed lactation | FAERS: 15 Canada Vigilance: 48 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 36 | Asthenia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 37 | Erythema | FAERS: 13 | US FAERS | |
| 38 | Mood swings | FAERS: 13 | SIDER US FAERS | |
| 39 | Pruritus | FAERS: 13 | 15728406 | CTD SIDER US FAERS |
| 40 | Application site urticaria | FAERS: 12 | US FAERS | |
| 41 | Drug exposure via breast milk | FAERS: 12 | OFFSIDES US FAERS | |
| 42 | Menorrhagia | FAERS: 12 Canada Vigilance: 3 | 19016686 | CTD SIDER Canada Vigilance US FAERS |
| 43 | Alopecia | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 44 | Anxiety | FAERS: 11 | OFFSIDES US FAERS | |
| 45 | Depressed mood | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 46 | Drug dispensing error | FAERS: 10 | US FAERS | |
| 47 | Drug withdrawal syndrome | FAERS: 10 | US FAERS | |
| 48 | Exposure during breast feeding | FAERS: 10 | US FAERS | |
| 49 | Hormone level abnormal | FAERS: 10 | OFFSIDES US FAERS | |
| 50 | Hypersensitivity | FAERS: 10 | SIDER US FAERS | |
| 51 | Product administered at inappropriate site | FAERS: 10 | US FAERS | |
| 52 | Syncope | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 53 | Adverse event | FAERS: 9 | OFFSIDES US FAERS | |
| 54 | Back Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Peripheral swelling | FAERS: 9 | US FAERS | |
| 56 | Pharmaceutical product complaint | FAERS: 9 | US FAERS | |
| 57 | Product use issue | FAERS: 9 | US FAERS | |
| 58 | Skin irritation | FAERS: 9 | US FAERS | |
| 59 | Urticaria | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Application site burn | FAERS: 8 | US FAERS | |
| 61 | Application site exfoliation | FAERS: 8 | US FAERS | |
| 62 | Application site reaction | FAERS: 8 | US FAERS | |
| 63 | Application site vesicles | FAERS: 8 | US FAERS | |
| 64 | Chest Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 65 | Medication Error | FAERS: 8 | US FAERS | |
| 66 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 67 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 68 | Crying | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Dehydration | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Emotional disorder | FAERS: 7 | OFFSIDES US FAERS | |
| 71 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 72 | Pulmonary Embolism | FAERS: 7 | 820501 | CTD SIDER US FAERS |
| 73 | Uterine spasm | FAERS: 7 | OFFSIDES US FAERS | |
| 74 | Acne | FAERS: 6 | SIDER US FAERS | |
| 75 | Application site swelling | FAERS: 6 | US FAERS | |
| 76 | Constipation | FAERS: 6 | US FAERS | |
| 77 | Ectopic Pregnancy | FAERS: 6 | US FAERS | |
| 78 | Skin reaction | FAERS: 6 | US FAERS | |
| 79 | Vulvovaginal dryness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Abdominal discomfort | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Application site dryness | FAERS: 5 | US FAERS | |
| 82 | Application site hypersensitivity | FAERS: 5 | US FAERS | |
| 83 | Deep Vein Thrombosis | FAERS: 5 | SIDER US FAERS | |
| 84 | Mental impairment | FAERS: 5 | OFFSIDES US FAERS | |
| 85 | Pain | FAERS: 5 | OFFSIDES US FAERS | |
| 86 | Product dose omission | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 87 | Product substitution issue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Somnolence | FAERS: 5 | SIDER US FAERS | |
| 89 | Tinnitus | FAERS: 5 | US FAERS | |
| 90 | Vomiting | FAERS: 5 | SIDER US FAERS | |
| 91 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 92 | Accidental drug intake by child | FAERS: 4 | US FAERS | |
| 93 | Agitation | FAERS: 4 | US FAERS | |
| 94 | Application site erosion | FAERS: 4 | US FAERS | |
| 95 | Application site inflammation | FAERS: 4 | US FAERS | |
| 96 | Arthralgia | FAERS: 4 | US FAERS | |
| 97 | Bronchitis | FAERS: 4 | OFFSIDES US FAERS | |
| 98 | Chills | FAERS: 4 | US FAERS | |
| 99 | Discomfort | FAERS: 4 | US FAERS | |
| 100 | Dyspepsia | FAERS: 4 | 19443681 | CTD SIDER US FAERS |
| 101 | Electrolyte depletion | FAERS: 4 | US FAERS | |
| 102 | Expired product administered | FAERS: 4 | US FAERS | |
| 103 | Hypotension | FAERS: 4 | US FAERS | |
| 104 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 105 | Pneumonia | FAERS: 4 | US FAERS | |
| 106 | Premenstrual syndrome | FAERS: 4 | US FAERS | |
| 107 | Prescribed underdose | FAERS: 4 | US FAERS | |
| 108 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 109 | Thrombophlebitis | FAERS: 4 | SIDER US FAERS | |
| 110 | jaundice | FAERS: 4 | US FAERS | |
| 111 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 112 | Amnesia | FAERS: 3 | OFFSIDES US FAERS | |
| 113 | Application site warmth | FAERS: 3 | US FAERS | |
| 114 | Bronchiectasis | FAERS: 3 | US FAERS | |
| 115 | Chest discomfort | FAERS: 3 | US FAERS | |
| 116 | Chromaturia | FAERS: 3 | US FAERS | |
| 117 | Circumstance or information capable of leading to medication error | FAERS: 3 | OFFSIDES US FAERS | |
| 118 | Emotional distress | FAERS: 3 | US FAERS | |
| 119 | Epistaxis | FAERS: 3 | US FAERS | |
| 120 | Eschar | FAERS: 3 | US FAERS | |
| 121 | General physical health deterioration | FAERS: 3 | OFFSIDES US FAERS | |
| 122 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 123 | Joint swelling | FAERS: 3 | US FAERS | |
| 124 | Laceration | FAERS: 3 | US FAERS | |
| 125 | Mass excision | FAERS: 3 | US FAERS | |
| 126 | Myocardial Infarction | FAERS: 3 | SIDER US FAERS | |
| 127 | Pelvic Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Pharmaceutical product counterfeit | FAERS: 3 | OFFSIDES US FAERS | |
| 129 | Product packaging issue | FAERS: 3 | US FAERS | |
| 130 | Productive Cough | FAERS: 3 | US FAERS | |
| 131 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 132 | Restlessness | FAERS: 3 | US FAERS | |
| 133 | Skin necrosis | FAERS: 3 | US FAERS | |
| 134 | Swelling | FAERS: 3 | US FAERS | |
| 135 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 136 | Vertigo | FAERS: 3 | US FAERS | |
| 137 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 138 | Alanine Aminotransferase Increased | FAERS: 2 | OFFSIDES US FAERS | |
| 139 | Anger | FAERS: 2 | OFFSIDES US FAERS | |
| 140 | Angioedema | FAERS: 2 | US FAERS | |
| 141 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 142 | Application site ulcer | FAERS: 2 | US FAERS | |
| 143 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 144 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 145 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 146 | Autophobia | FAERS: 2 | US FAERS | |
| 147 | Biopsy | FAERS: 2 | US FAERS | |
| 148 | Blindness | FAERS: 2 | SIDER US FAERS | |
| 149 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 150 | Blood glucose decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 151 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 152 | Blood triglycerides increased | FAERS: 2 | OFFSIDES US FAERS | |
| 153 | Breast Cyst | FAERS: 2 | US FAERS | |
| 154 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 155 | Cataract operation | FAERS: 2 | OFFSIDES US FAERS | |
| 156 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 157 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 158 | Completed Suicide | FAERS: 2 | US FAERS | |
| 159 | Cystitis | FAERS: 2 | US FAERS | |
| 160 | Cyst | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Deafness | FAERS: 2 | US FAERS | |
| 162 | Depression suicidal | FAERS: 2 | US FAERS | |
| 163 | Disability | FAERS: 2 | US FAERS | |
| 164 | Dry skin | FAERS: 2 | US FAERS | |
| 165 | Epilepsy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 167 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 168 | Flatulence | FAERS: 2 | SIDER US FAERS | |
| 169 | Head discomfort | FAERS: 2 | US FAERS | |
| 170 | Hemiparesis | FAERS: 2 | OFFSIDES US FAERS | |
| 171 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 172 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 173 | Impaired work ability | FAERS: 2 | US FAERS | |
| 174 | Inappropriate schedule of product administration | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Influenza | FAERS: 2 | US FAERS | |
| 176 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 177 | Intentional self-injury | FAERS: 2 | OFFSIDES US FAERS | |
| 178 | Lactation Disorder | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 179 | Lactose Intolerance | FAERS: 2 | OFFSIDES US FAERS | |
| 180 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 181 | Myalgia | FAERS: 2 | US FAERS | |
| 182 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 183 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 184 | Papule | FAERS: 2 | US FAERS | |
| 185 | Paranoia | FAERS: 2 | US FAERS | |
| 186 | Pemphigus | FAERS: 2 | US FAERS | |
| 187 | Pregnancy on contraceptive | FAERS: 2 | US FAERS | |
| 188 | Pregnancy | FAERS: 2 | SIDER US FAERS | |
| 189 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 190 | Product dosage form confusion | FAERS: 2 | US FAERS | |
| 191 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 192 | Renal pain | FAERS: 2 | US FAERS | |
| 193 | Retching | FAERS: 2 | US FAERS | |
| 194 | Rosacea | FAERS: 2 | US FAERS | |
| 195 | Tachycardia | FAERS: 2 | US FAERS | |
| 196 | Therapeutic product contamination | FAERS: 2 | US FAERS | |
| 197 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 198 | Thrombosis | FAERS: 2 | SIDER US FAERS | |
| 199 | Tooth Infection | FAERS: 2 | US FAERS | |
| 200 | Tremor | FAERS: 2 | US FAERS | |
| 201 | Violence-related symptom | FAERS: 2 | OFFSIDES US FAERS | |
| 202 | furuncle | FAERS: 2 | US FAERS | |
| 203 | Abasia | FAERS: 1 | US FAERS | |
| 204 | Abdominal mass | FAERS: 1 | US FAERS | |
| 205 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 206 | Accidental exposure | FAERS: 1 | US FAERS | |
| 207 | Activities of daily living impaired | FAERS: 1 | OFFSIDES US FAERS | |
| 208 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 209 | Agoraphobia | FAERS: 1 | US FAERS | |
| 210 | Aneurysm | FAERS: 1 | US FAERS | |
| 211 | Anhedonia | FAERS: 1 | US FAERS | |
| 212 | Anorexia | FAERS: 1 | US FAERS | |
| 213 | Application site discomfort | FAERS: 1 | US FAERS | |
| 214 | Application site eczema | FAERS: 1 | US FAERS | |
| 215 | Application site laceration | FAERS: 1 | US FAERS | |
| 216 | Application site nodule | FAERS: 1 | US FAERS | |
| 217 | Application site scar | FAERS: 1 | US FAERS | |
| 218 | Arthropod bite | FAERS: 1 | US FAERS | |
| 219 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 220 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 221 | Bile acid malabsorption | FAERS: 1 | US FAERS | |
| 222 | Blood alkaline phosphatase increased | FAERS: 1 | OFFSIDES US FAERS | |
| 223 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 224 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 225 | Bone pain | FAERS: 1 | US FAERS | |
| 226 | Breast Feeding | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 227 | Breast cancer stage II | FAERS: 1 | US FAERS | |
| 228 | Burning sensation | FAERS: 1 | US FAERS | |
| 229 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 230 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 231 | Chloasma | FAERS: 1 | SIDER US FAERS | |
| 232 | Choking | FAERS: 1 | US FAERS | |
| 233 | Cholestasis | FAERS: 1 | 7100632 15728406 | CTD US FAERS |
| 234 | Cold sweat | FAERS: 1 | US FAERS | |
| 235 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 236 | Corneal abscess | FAERS: 1 | US FAERS | |
| 237 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 238 | Dementia | FAERS: 1 | US FAERS | |
| 239 | Device defective | FAERS: 1 | US FAERS | |
| 240 | Device leakage | FAERS: 1 | US FAERS | |
| 241 | Diplopia | FAERS: 1 | US FAERS | |
| 242 | Disease Progression | FAERS: 1 | US FAERS | |
| 243 | Disease recurrence | FAERS: 1 | US FAERS | |
| 244 | Disorientation | FAERS: 1 | US FAERS | |
| 245 | Dissociation | FAERS: 1 | US FAERS | |
| 246 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 247 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 248 | Dysarthria | FAERS: 1 | US FAERS | |
| 249 | Dysgeusia | FAERS: 1 | US FAERS | |
| 250 | Dyspareunia | FAERS: 1 | OFFSIDES US FAERS | |
| 251 | Eczema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 253 | Embolic stroke | FAERS: 1 | US FAERS | |
| 254 | Embolism | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 255 | Endometrial adenocarcinoma | FAERS: 1 | US FAERS | |
| 256 | Epinephrine increased | FAERS: 1 | US FAERS | |
| 257 | Episcleritis | FAERS: 1 | US FAERS | |
| 258 | Erythema Nodosum | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 259 | Exposure via breast milk | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 260 | Eye irritation | FAERS: 1 | US FAERS | |
| 261 | Facial paralysis | FAERS: 1 | US FAERS | |
| 262 | Feeling Cold | FAERS: 1 | OFFSIDES US FAERS | |
| 263 | Feeling jittery | FAERS: 1 | US FAERS | |
| 264 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 265 | Food craving | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 266 | Gene Mutation | FAERS: 1 | US FAERS | |
| 267 | Heavy exposure to ultraviolet light | FAERS: 1 | US FAERS | |
| 268 | Hepatic Infarction | FAERS: 1 | US FAERS | |
| 269 | Hostility | FAERS: 1 | US FAERS | |
| 270 | Hyperplasia | FAERS: 1 | US FAERS | |
| 271 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 272 | Hyperventilation | FAERS: 1 | US FAERS | |
| 273 | Hypokinesia | FAERS: 1 | US FAERS | |
| 274 | Hysterectomy | FAERS: 1 | US FAERS | |
| 275 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 276 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 277 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 278 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 279 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 280 | Lethargy | FAERS: 1 | US FAERS | |
| 281 | Leukopenia | FAERS: 1 | US FAERS | |
| 282 | Macular degeneration | FAERS: 1 | US FAERS | |
| 283 | Malignant breast lump removal | FAERS: 1 | US FAERS | |
| 284 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 285 | Mastectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 286 | Mastitis | FAERS: 1 | US FAERS | |
| 287 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 288 | Memory impairment | FAERS: 1 | US FAERS | |
| 289 | Moaning | FAERS: 1 | US FAERS | |
| 290 | Multiple Sclerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 291 | Muscle Rigidity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 293 | Musculoskeletal stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 294 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 295 | Nipple pain | FAERS: 1 | US FAERS | |
| 296 | Obesity surgery | FAERS: 1 | US FAERS | |
| 297 | Ocular icterus | FAERS: 1 | US FAERS | |
| 298 | Oral pain | FAERS: 1 | US FAERS | |
| 299 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 300 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 301 | Ovarian adenoma | FAERS: 1 | US FAERS | |
| 302 | Packaging design issue | FAERS: 1 | US FAERS | |
| 303 | Panic Disorder | FAERS: 1 | US FAERS | |
| 304 | Petechiae | FAERS: 1 | US FAERS | |
| 305 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 306 | Pregnancy test positive | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Presyncope | FAERS: 1 | US FAERS | |
| 308 | Product administration error | FAERS: 1 | US FAERS | |
| 309 | Product contamination | FAERS: 1 | US FAERS | |
| 310 | Product identification number issue | FAERS: 1 | US FAERS | |
| 311 | Product label confusion | FAERS: 1 | US FAERS | |
| 312 | Product label issue | FAERS: 1 | US FAERS | |
| 313 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 314 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 315 | Rash erythematous | FAERS: 1 | US FAERS | |
| 316 | Salpingitis | FAERS: 1 | US FAERS | |
| 317 | Schizophrenia | FAERS: 1 | US FAERS | |
| 318 | Screaming | FAERS: 1 | US FAERS | |
| 319 | Sinusitis | FAERS: 1 | US FAERS | |
| 320 | Skin Erosion | FAERS: 1 | US FAERS | |
| 321 | Skin lesion | FAERS: 1 | US FAERS | |
| 322 | Sluggishness | FAERS: 1 | US FAERS | |
| 323 | Spina Bifida | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 324 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 325 | Splenomegaly | FAERS: 1 | US FAERS | |
| 326 | Tension | FAERS: 1 | SIDER US FAERS | |
| 327 | Thirst | FAERS: 1 | US FAERS | |
| 328 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 329 | Tongue blistering | FAERS: 1 | US FAERS | |
| 330 | Tonsillitis | FAERS: 1 | US FAERS | |
| 331 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 332 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 333 | Ultrasound liver abnormal | FAERS: 1 | US FAERS | |
| 334 | Underweight | FAERS: 1 | US FAERS | |
| 335 | Unevaluable event | FAERS: 1 | US FAERS | |
| 336 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 337 | Uterine Polyp | FAERS: 1 | OFFSIDES US FAERS | |
| 338 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 339 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 340 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 341 | Yawning | FAERS: 1 | US FAERS | |
| 342 | Abdominal Cramps | SIDER | ||
| 343 | Abdominal bloating | SIDER | ||
| 344 | Abnormal cervical smear | OFFSIDES | ||
| 345 | Abnormal vision | OFFSIDES | ||
| 346 | Acne Vulgaris | 8222658 | CTD | |
| 347 | Activated Protein C Resistance | 15333036 | CTD | |
| 348 | Acute Coronary Syndrome | SIDER | ||
| 349 | Adenocarcinoma | OFFSIDES | ||
| 350 | Adenoma | 204807 3105752 | CTD | |
| 351 | Ageusia | OFFSIDES | ||
| 352 | Alanine aminotransferase abnormal | OFFSIDES | ||
| 353 | Allergic rash | SIDER | ||
| 354 | Allergy test positive | OFFSIDES | ||
| 355 | Anaphylactic shock | SIDER | ||
| 356 | Anaphylactoid Reaction | SIDER | ||
| 357 | Anhidrosis | OFFSIDES | ||
| 358 | Anorectal discomfort | OFFSIDES | ||
| 359 | Anosmia | OFFSIDES | ||
| 360 | Anovulation | SIDER | ||
| 361 | Apathy | OFFSIDES | ||
| 362 | Apparent death | OFFSIDES | ||
| 363 | Arterial thromboembolism | SIDER | ||
| 364 | Arthritis | OFFSIDES | ||
| 365 | Arthropathy | OFFSIDES | ||
| 366 | Arthroscopy | OFFSIDES | ||
| 367 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 368 | Aspergillosis | OFFSIDES | ||
| 369 | Atrial septal defect 2 | 830309 | CTD | |
| 370 | Aura | OFFSIDES | ||
| 371 | Autoimmune thyroiditis | OFFSIDES | ||
| 372 | Bed rest | OFFSIDES | ||
| 373 | Biopsy breast abnormal | OFFSIDES | ||
| 374 | Biopsy site unspecified abnormal | OFFSIDES | ||
| 375 | Blood Glucose | OFFSIDES | ||
| 376 | Blood thyroid stimulating hormone increased | OFFSIDES | ||
| 377 | Bone Diseases | 4416533 | CTD | |
| 378 | Carbohydrate tolerance decreased | SIDER | ||
| 379 | Carcinoma | SIDER | ||
| 380 | Cardiac perforation | OFFSIDES | ||
| 381 | Cardiovascular Diseases | 87143 | CTD | |
| 382 | Cellulitis | OFFSIDES | ||
| 383 | Cerebral Thrombosis | SIDER | ||
| 384 | Choking sensation | OFFSIDES | ||
| 385 | Cholestasis of pregnancy | OFFSIDES | ||
| 386 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 387 | Confabulation | OFFSIDES | ||
| 388 | Demyelination | OFFSIDES | ||
| 389 | Dermatitis hemorrhagic | SIDER | ||
| 390 | Dermatitis | SIDER | ||
| 391 | Dextrocardia | 4416533 | CTD | |
| 392 | Diabetic Foot | OFFSIDES | ||
| 393 | Diabetic Nephropathy | OFFSIDES | ||
| 394 | Diarrhea | 19443681 | CTD OFFSIDES | |
| 395 | Dilatation intrahepatic duct acquired | OFFSIDES | ||
| 396 | Disorders of Sex Development | 4416533 | CTD | |
| 397 | Double Outlet Right Ventricle | 830309 | CTD | |
| 398 | Drowsiness | OFFSIDES SIDER | ||
| 399 | Drug addict | OFFSIDES | ||
| 400 | Drug level changed | OFFSIDES | ||
| 401 | Drug withdrawal headache | OFFSIDES | ||
| 402 | Dysmenorrhea | OFFSIDES | ||
| 403 | Dysphemia | OFFSIDES | ||
| 404 | Ebstein Anomaly | 830309 | CTD | |
| 405 | Enuresis | OFFSIDES | ||
| 406 | Enzyme abnormality | OFFSIDES | ||
| 407 | Epiglottitis | OFFSIDES | ||
| 408 | Erythema Multiforme | SIDER | ||
| 409 | Euphoric mood | OFFSIDES | ||
| 410 | Feeding and Eating Disorders | 19443681 | CTD | |
| 411 | Fibromyalgia | OFFSIDES | ||
| 412 | Formication | OFFSIDES | ||
| 413 | Frustration | OFFSIDES | ||
| 414 | Gastrointestinal Pain | SIDER | ||
| 415 | Genital discharge | SIDER | ||
| 416 | Globulinuria | OFFSIDES | ||
| 417 | Hepatic Veno-Occlusive Disease | 9845522 | CTD | |
| 418 | Hepatitis | SIDER | ||
| 419 | Hepatotoxicity | OFFSIDES | ||
| 420 | Hirsutism | SIDER | ||
| 421 | Hunger | Canada Vigilance: 1 | Canada Vigilance | |
| 422 | Hypophagia | Canada Vigilance: 2 | Canada Vigilance | |
| 423 | Incorrect product administration duration | Canada Vigilance: 1 | Canada Vigilance | |
| 424 | Infantile Colic | Canada Vigilance: 1 | Canada Vigilance | |
| 425 | Infertility | SIDER | ||
| 426 | Inhibitory drug interaction | OFFSIDES | ||
| 427 | Injection site erythema | OFFSIDES | ||
| 428 | Injection site nodule | OFFSIDES | ||
| 429 | Jaundice, Obstructive | 5639192 15728406 | CTD | |
| 430 | Kidney Failure | OFFSIDES | ||
| 431 | Labile hypertension | OFFSIDES | ||
| 432 | Lack of satiety | Canada Vigilance: 1 | Canada Vigilance | |
| 433 | Leukopenia neonatal | OFFSIDES | ||
| 434 | Live Birth | OFFSIDES | ||
| 435 | Liver neoplasms | 204807 3105752 25058030 | CTD | |
| 436 | Low density lipoprotein increased | SIDER | ||
| 437 | Lupus-like syndrome | OFFSIDES | ||
| 438 | Lymphangitis | OFFSIDES | ||
| 439 | Lymphedema | OFFSIDES | ||
| 440 | Macrognathia | OFFSIDES | ||
| 441 | Meniscus operation | OFFSIDES | ||
| 442 | Mesenteric Vascular Occlusion | 4121539 | CTD | |
| 443 | Micturition frequency decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 444 | Middle insomnia | OFFSIDES | ||
| 445 | Monoclonal Gammopathy of Undetermined Significance | 820501 | CTD | |
| 446 | Mononucleosis syndrome | OFFSIDES | ||
| 447 | Morbid thoughts | OFFSIDES | ||
| 448 | Movement Disorders | 5354812 | CTD | |
| 449 | Muscle Weakness | OFFSIDES | ||
| 450 | Muscle tightness | OFFSIDES | ||
| 451 | Myopia | OFFSIDES | ||
| 452 | Nervous tension | OFFSIDES | ||
| 453 | Neurilemmoma | OFFSIDES | ||
| 454 | Neurodermatitis | OFFSIDES | ||
| 455 | Nicotine Dependence | OFFSIDES | ||
| 456 | Optic Neuritis | OFFSIDES SIDER | ||
| 457 | Partner stress | OFFSIDES | ||
| 458 | Personality change due to a general medical condition | OFFSIDES | ||
| 459 | Physical breast examination abnormal | OFFSIDES | ||
| 460 | Physical examination abnormal | OFFSIDES | ||
| 461 | Poor feeding infant | Canada Vigilance: 1 | Canada Vigilance | |
| 462 | Poor quality sleep | Canada Vigilance: 1 | Canada Vigilance | |
| 463 | Post procedural complication | OFFSIDES | ||
| 464 | Post procedural infection | OFFSIDES | ||
| 465 | Postmenopausal bleeding | OFFSIDES | ||
| 466 | Pregnancy with contraceptive device | Canada Vigilance: 1 | Canada Vigilance | |
| 467 | Progesterone receptor assay | OFFSIDES | ||
| 468 | Prurigo | SIDER | ||
| 469 | Pseudotumor Cerebri | 6805652 | CTD | |
| 470 | Psychiatric symptom | OFFSIDES | ||
| 471 | Purpura | SIDER | ||
| 472 | Restrictive pulmonary disease | OFFSIDES | ||
| 473 | Retinal vascular thrombosis | SIDER | ||
| 474 | Right atrial dilatation | OFFSIDES | ||
| 475 | Scan lymph nodes | OFFSIDES | ||
| 476 | Seroma | OFFSIDES | ||
| 477 | Sexually active | SIDER | ||
| 478 | Skin Induration | OFFSIDES | ||
| 479 | Sleep Talking | OFFSIDES | ||
| 480 | Spasm | 5784655 | CTD | |
| 481 | Stress | OFFSIDES | ||
| 482 | Stridor | OFFSIDES | ||
| 483 | Synovial Cyst | OFFSIDES | ||
| 484 | Taste Disorders | 19443681 | CTD | |
| 485 | Temperature intolerance | OFFSIDES | ||
| 486 | Therapeutic procedure | OFFSIDES | ||
| 487 | Thyroid cancer metastatic | OFFSIDES | ||
| 488 | Tobacco user | OFFSIDES | ||
| 489 | Tongue eruption | OFFSIDES | ||
| 490 | Ultrasound breast abnormal | OFFSIDES | ||
| 491 | Unspecified visual loss | SIDER | ||
| 492 | Venoocclusive disease | OFFSIDES | ||
| 493 | Venous Thromboembolism | 19016686 | CTD | |
| 494 | Ventricular Fibrillation | OFFSIDES | ||
| 495 | Vitamin A Deficiency | OFFSIDES | ||
| 496 | Vocal Cord Paralysis | OFFSIDES | ||
| 497 | Vulvovaginal adhesion | OFFSIDES | ||
| 498 | Vulvovaginal burning sensation | OFFSIDES | ||
| 499 | Weight Gain | 8222658 | CTD OFFSIDES | |
| 500 | Weight decrease neonatal | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.