Ticagrelor
(OEKWJQXRCDYSHL-FNOIDJSQSA-N)
Structure
- SMILES
- CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(c(c2)F)F)c2c(n1)n(nn2)[C@@H]1C[C@@H]([C@H]([C@H]1O)O)OCCO
- Type(s)
- Approved
- ATC code(s)
- B01AC24
- Molecular Formula:
- C23H28F2N6O4S
- Molecular Weight:
- 522.568
- Log P:
- 2.0867
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 4
- TPSA:
- 163.74
- CAS Number(s):
- 274693-27-5
Synonym(s)
1.
Ticagrelor
2.
3-(7-((2-(3,4-Difluorophenyl)cyclopropyl)amino)-5-(propylthio)-3H-(1-3)-triazolo(4,5-d)pyrimidin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol
3.
AZD 6140
4.
AZD-6140
5.
AZD6140
6.
Brilinta
7.
Brilique
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 430 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 2 | Myocardial Infarction | FAERS: 422 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 331 | US FAERS | |
| 4 | Drug dose omission | FAERS: 289 | US FAERS | |
| 5 | Chest Pain | FAERS: 235 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Feeling abnormal | FAERS: 233 | SIDER US FAERS | |
| 7 | Asthenia | FAERS: 203 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 8 | Thrombosis in device | FAERS: 190 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 9 | Vascular stent thrombosis | FAERS: 183 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 10 | Dizziness | FAERS: 176 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Intentional product misuse | FAERS: 152 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Headache | FAERS: 116 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Nausea | FAERS: 115 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Epistaxis | FAERS: 102 | SIDER US FAERS | |
| 15 | Anxiety | FAERS: 101 | US FAERS | |
| 16 | Chest discomfort | FAERS: 99 | US FAERS | |
| 17 | Memory impairment | FAERS: 97 | US FAERS | |
| 18 | Cerebrovascular accident | FAERS: 90 | US FAERS | |
| 19 | Pain | FAERS: 86 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Thrombosis | FAERS: 78 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Vomiting | FAERS: 75 | SIDER US FAERS | |
| 22 | Acute myocardial infarction | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Stress | FAERS: 71 | US FAERS | |
| 24 | Bradycardia | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Somnolence | FAERS: 67 | US FAERS | |
| 26 | Cardiac Arrest | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Nasopharyngitis | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Product use issue | FAERS: 52 | US FAERS | |
| 29 | Back Pain | FAERS: 51 | SIDER US FAERS | |
| 30 | Angina Pectoris | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Device occlusion | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Visual Impairment | FAERS: 47 | US FAERS | |
| 33 | Weight decreased | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Adverse event | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 35 | Pneumonia | FAERS: 46 | US FAERS | |
| 36 | Abdominal discomfort | FAERS: 45 | US FAERS | |
| 37 | Diabetes Mellitus | FAERS: 45 | US FAERS | |
| 38 | Infarction | FAERS: 44 | US FAERS | |
| 39 | Nervousness | FAERS: 42 | US FAERS | |
| 40 | Hypotension | FAERS: 41 | SIDER US FAERS | |
| 41 | Syncope | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 42 | Thrombocytopenia | FAERS: 38 | US FAERS | |
| 43 | Pruritus | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 44 | Acute Coronary Syndrome | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Arthralgia | FAERS: 36 | US FAERS | |
| 46 | Palpitations | FAERS: 35 | US FAERS | |
| 47 | Atrial Fibrillation | FAERS: 34 | SIDER US FAERS | |
| 48 | Intentional drug misuse | FAERS: 32 | US FAERS | |
| 49 | Therapy cessation | FAERS: 30 | US FAERS | |
| 50 | Amnesia | FAERS: 29 | US FAERS | |
| 51 | Atrioventricular Block | FAERS: 29 | US FAERS | |
| 52 | Vascular occlusion | FAERS: 29 | US FAERS | |
| 53 | Drug ineffective | FAERS: 26 | US FAERS | |
| 54 | Dysphonia | FAERS: 26 | US FAERS | |
| 55 | Vascular stent occlusion | FAERS: 26 | US FAERS | |
| 56 | Mental impairment | FAERS: 25 | US FAERS | |
| 57 | Discomfort | FAERS: 24 | US FAERS | |
| 58 | Electrocardiogram abnormal | FAERS: 24 | US FAERS | |
| 59 | Peripheral swelling | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Urticaria | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Agitation | FAERS: 22 | US FAERS | |
| 62 | Coronary Artery Disease | FAERS: 22 Canada Vigilance: 1 | 20620737 | CTD Canada Vigilance US FAERS |
| 63 | Dyspepsia | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 64 | Tremor | FAERS: 22 | US FAERS | |
| 65 | Oropharyngeal pain | FAERS: 20 | US FAERS | |
| 66 | Activities of daily living impaired | FAERS: 19 | US FAERS | |
| 67 | Hypersensitivity | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 68 | Emotional disorder | FAERS: 18 | US FAERS | |
| 69 | Frustration tolerance decreased | FAERS: 18 | US FAERS | |
| 70 | Product use in unapproved indication | FAERS: 18 | US FAERS | |
| 71 | Abdominal Pain | FAERS: 17 | SIDER US FAERS | |
| 72 | Bronchospasm | FAERS: 17 | US FAERS | |
| 73 | Asphyxia | FAERS: 16 | US FAERS | |
| 74 | Circumstance or information capable of leading to medication error | FAERS: 16 | US FAERS | |
| 75 | Constipation | FAERS: 16 | SIDER US FAERS | |
| 76 | Pericardial effusion | FAERS: 16 | US FAERS | |
| 77 | Vertigo | FAERS: 16 | SIDER US FAERS | |
| 78 | Arthritis | FAERS: 15 | US FAERS | |
| 79 | Asthma | FAERS: 15 | US FAERS | |
| 80 | Flushing | FAERS: 15 | US FAERS | |
| 81 | Wheezing | FAERS: 15 | US FAERS | |
| 82 | Dehydration | FAERS: 14 | US FAERS | |
| 83 | Musculoskeletal Pain | FAERS: 14 | US FAERS | |
| 84 | Myalgia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Arterial restenosis | FAERS: 13 | US FAERS | |
| 86 | Blood glucose increased | FAERS: 13 | US FAERS | |
| 87 | Depressed mood | FAERS: 13 | US FAERS | |
| 88 | Erythema | FAERS: 13 | US FAERS | |
| 89 | Flatulence | FAERS: 13 | US FAERS | |
| 90 | Gout | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 91 | Influenza | FAERS: 13 | US FAERS | |
| 92 | Vascular stent stenosis | FAERS: 13 | US FAERS | |
| 93 | Alopecia | FAERS: 12 | US FAERS | |
| 94 | Cataract | FAERS: 12 | US FAERS | |
| 95 | Feeling Cold | FAERS: 12 | US FAERS | |
| 96 | Anger | FAERS: 11 | US FAERS | |
| 97 | Blood urine present | FAERS: 11 | SIDER US FAERS | |
| 98 | Cholelithiasis | FAERS: 11 | US FAERS | |
| 99 | Gastric ulcer | FAERS: 11 | US FAERS | |
| 100 | Lethargy | FAERS: 11 | US FAERS | |
| 101 | Sepsis | FAERS: 11 | US FAERS | |
| 102 | Sinoatrial Block | FAERS: 11 | US FAERS | |
| 103 | Swelling | FAERS: 11 | US FAERS | |
| 104 | Vascular stent restenosis | FAERS: 11 | US FAERS | |
| 105 | Angioedema | FAERS: 10 | SIDER US FAERS | |
| 106 | Increased tendency to bruise | FAERS: 10 | SIDER US FAERS | |
| 107 | Intentional product use issue | FAERS: 10 | US FAERS | |
| 108 | Laceration | FAERS: 10 | US FAERS | |
| 109 | Limb discomfort | FAERS: 10 | US FAERS | |
| 110 | Limb injury | FAERS: 10 | US FAERS | |
| 111 | Lip swelling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Tachycardia | FAERS: 10 | US FAERS | |
| 113 | Acute kidney injury | FAERS: 9 | US FAERS | |
| 114 | Aneurysm | FAERS: 9 | US FAERS | |
| 115 | Blindness | FAERS: 9 | US FAERS | |
| 116 | Chromaturia | FAERS: 9 | US FAERS | |
| 117 | Complication associated with device | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Disorientation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Drug prescribing error | FAERS: 9 | US FAERS | |
| 120 | Dry skin | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Infection | FAERS: 9 | US FAERS | |
| 122 | Joint swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Menorrhagia | FAERS: 9 | US FAERS | |
| 124 | Nephrolithiasis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | No adverse event | FAERS: 9 | US FAERS | |
| 126 | Post procedural complication | FAERS: 9 | US FAERS | |
| 127 | Product dose omission | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Toothache | FAERS: 9 | US FAERS | |
| 129 | Ulcer | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Urinary tract infection | FAERS: 9 | US FAERS | |
| 131 | Abasia | FAERS: 8 | US FAERS | |
| 132 | Brain Death | FAERS: 8 | US FAERS | |
| 133 | Bronchitis | FAERS: 8 | US FAERS | |
| 134 | Chills | FAERS: 8 | US FAERS | |
| 135 | Cold sweat | FAERS: 8 | US FAERS | |
| 136 | Diverticulitis | FAERS: 8 | US FAERS | |
| 137 | Dysgeusia | FAERS: 8 | US FAERS | |
| 138 | Ejection Fraction Decreased | FAERS: 8 | US FAERS | |
| 139 | Hyperventilation | FAERS: 8 | US FAERS | |
| 140 | Pericarditis | FAERS: 8 | US FAERS | |
| 141 | Pulmonary Embolism | FAERS: 8 | US FAERS | |
| 142 | Respiratory distress | FAERS: 8 | US FAERS | |
| 143 | Sneezing | FAERS: 8 | US FAERS | |
| 144 | Stent malfunction | FAERS: 8 | US FAERS | |
| 145 | Apparent death | FAERS: 7 | US FAERS | |
| 146 | Crying | FAERS: 7 | US FAERS | |
| 147 | Musculoskeletal discomfort | FAERS: 7 | US FAERS | |
| 148 | Musculoskeletal stiffness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Platelet function test abnormal | FAERS: 7 | US FAERS | |
| 150 | Productive Cough | FAERS: 7 | US FAERS | |
| 151 | Shock | FAERS: 7 | SIDER US FAERS | |
| 152 | Sinusitis | FAERS: 7 | US FAERS | |
| 153 | Sleep disorder due to general medical condition, insomnia type | FAERS: 7 | US FAERS | |
| 154 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 155 | Blood cholesterol increased | FAERS: 6 | US FAERS | |
| 156 | Blood creatinine increased | FAERS: 6 | SIDER US FAERS | |
| 157 | Cardiac Tamponade | FAERS: 6 | SIDER US FAERS | |
| 158 | Cerebral disorder | FAERS: 6 | US FAERS | |
| 159 | Choking | FAERS: 6 | US FAERS | |
| 160 | Cholecystitis | FAERS: 6 | US FAERS | |
| 161 | Deafness | FAERS: 6 | US FAERS | |
| 162 | Deep Vein Thrombosis | FAERS: 6 | US FAERS | |
| 163 | Dementia | FAERS: 6 | US FAERS | |
| 164 | Ear discomfort | FAERS: 6 | US FAERS | |
| 165 | Middle insomnia | FAERS: 6 | US FAERS | |
| 166 | Myocardial necrosis marker increased | FAERS: 6 | US FAERS | |
| 167 | Nodule | FAERS: 6 | US FAERS | |
| 168 | Overdose | FAERS: 6 | US FAERS | |
| 169 | Panic Disorder | FAERS: 6 | US FAERS | |
| 170 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 171 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 172 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 173 | Throat irritation | FAERS: 6 | US FAERS | |
| 174 | Tinnitus | FAERS: 6 | US FAERS | |
| 175 | Troponin increased | FAERS: 6 | US FAERS | |
| 176 | Aphasia | FAERS: 5 | US FAERS | |
| 177 | Back disorder | FAERS: 5 | US FAERS | |
| 178 | Cheyne-Stokes Respiration | FAERS: 5 | US FAERS | |
| 179 | Cystitis | FAERS: 5 | US FAERS | |
| 180 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 181 | Eye pain | FAERS: 5 | US FAERS | |
| 182 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 183 | Hernia | FAERS: 5 | US FAERS | |
| 184 | Hypokinesia | FAERS: 5 | US FAERS | |
| 185 | Hypophagia | FAERS: 5 | US FAERS | |
| 186 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 187 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 188 | Medication Error | FAERS: 5 | US FAERS | |
| 189 | Medication residue present | FAERS: 5 | US FAERS | |
| 190 | Multiple allergies | FAERS: 5 | US FAERS | |
| 191 | Neck Pain | FAERS: 5 | US FAERS | |
| 192 | Neutropenia | FAERS: 5 | US FAERS | |
| 193 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 194 | Secretion discharge | FAERS: 5 | US FAERS | |
| 195 | Tension | FAERS: 5 | US FAERS | |
| 196 | Ageusia | FAERS: 4 | US FAERS | |
| 197 | Aortic Aneurysm | FAERS: 4 | US FAERS | |
| 198 | Aphonia | FAERS: 4 | US FAERS | |
| 199 | Arthropathy | FAERS: 4 | US FAERS | |
| 200 | Atrial Flutter | FAERS: 4 | US FAERS | |
| 201 | Carotid artery occlusion | FAERS: 4 | US FAERS | |
| 202 | Colitis | FAERS: 4 | US FAERS | |
| 203 | Duodenal Ulcer | FAERS: 4 | US FAERS | |
| 204 | Dysgraphia | FAERS: 4 | US FAERS | |
| 205 | Eructation | FAERS: 4 | US FAERS | |
| 206 | Impatience | FAERS: 4 | US FAERS | |
| 207 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 208 | Incoherent | FAERS: 4 | US FAERS | |
| 209 | Insurance issue | FAERS: 4 | US FAERS | |
| 210 | Mental status changes | FAERS: 4 | US FAERS | |
| 211 | Pancreatitis | FAERS: 4 | US FAERS | |
| 212 | Pancytopenia | FAERS: 4 | US FAERS | |
| 213 | Procedural complication | FAERS: 4 | US FAERS | |
| 214 | Product physical issue | FAERS: 4 | US FAERS | |
| 215 | Product supply issue | FAERS: 4 | US FAERS | |
| 216 | Respiratory Depression | FAERS: 4 | US FAERS | |
| 217 | Respiratory tract congestion | FAERS: 4 | US FAERS | |
| 218 | Restlessness | FAERS: 4 | US FAERS | |
| 219 | Sciatica | FAERS: 4 | US FAERS | |
| 220 | Skin irritation | FAERS: 4 | US FAERS | |
| 221 | Sudden death | FAERS: 4 | US FAERS | |
| 222 | Thrombocytopenic purpura | FAERS: 4 | US FAERS | |
| 223 | Venous occlusion | FAERS: 4 | US FAERS | |
| 224 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 225 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 226 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 227 | Appendicitis | FAERS: 3 | US FAERS | |
| 228 | Arterial thrombosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Atelectasis | FAERS: 3 | US FAERS | |
| 230 | Blood blister | FAERS: 3 | US FAERS | |
| 231 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 232 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 233 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 234 | Burning sensation | FAERS: 3 | US FAERS | |
| 235 | Cellulitis | FAERS: 3 | US FAERS | |
| 236 | Delirium | FAERS: 3 | US FAERS | |
| 237 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 238 | Diplopia | FAERS: 3 | US FAERS | |
| 239 | Drug resistance | FAERS: 3 | US FAERS | |
| 240 | Dysentery | FAERS: 3 | US FAERS | |
| 241 | Ecchymosis | FAERS: 3 | SIDER US FAERS | |
| 242 | Emotional distress | FAERS: 3 | US FAERS | |
| 243 | Fluid overload | FAERS: 3 | US FAERS | |
| 244 | Gastrointestinal Pain | FAERS: 3 | SIDER US FAERS | |
| 245 | Hemiparesis | FAERS: 3 | US FAERS | |
| 246 | Hypersomnia | FAERS: 3 | US FAERS | |
| 247 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 248 | Ileus | FAERS: 3 | US FAERS | |
| 249 | In-stent coronary artery restenosis | FAERS: 3 | US FAERS | |
| 250 | Inability to afford medication | FAERS: 3 | US FAERS | |
| 251 | Inflammation | FAERS: 3 | US FAERS | |
| 252 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 253 | Laryngitis | FAERS: 3 | US FAERS | |
| 254 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 255 | Nasal Polyps | FAERS: 3 | US FAERS | |
| 256 | Peripheral artery thrombosis | FAERS: 3 | US FAERS | |
| 257 | Petechiae | FAERS: 3 | SIDER US FAERS | |
| 258 | Photophobia | FAERS: 3 | US FAERS | |
| 259 | Presyncope | FAERS: 3 | SIDER US FAERS | |
| 260 | Product quality issue | FAERS: 3 | US FAERS | |
| 261 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 262 | Purpura | FAERS: 3 | US FAERS | |
| 263 | Rash erythematous | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Reocclusion | FAERS: 3 | US FAERS | |
| 265 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 266 | Sluggishness | FAERS: 3 | US FAERS | |
| 267 | Thrombocytosis | FAERS: 3 | US FAERS | |
| 268 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 269 | Urinary Retention | FAERS: 3 | US FAERS | |
| 270 | Ventricular arrhythmia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 271 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 272 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 273 | Accidental overdose | FAERS: 2 | US FAERS | |
| 274 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 275 | Animal scratch | FAERS: 2 | US FAERS | |
| 276 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 277 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 278 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 279 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 280 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 281 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 282 | Bone pain | FAERS: 2 | US FAERS | |
| 283 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 284 | Breast tenderness | FAERS: 2 | US FAERS | |
| 285 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 286 | Cardiac ventricular thrombosis | FAERS: 2 | US FAERS | |
| 287 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 288 | Choking sensation | FAERS: 2 | US FAERS | |
| 289 | Completed Suicide | FAERS: 2 | US FAERS | |
| 290 | Coronary artery insufficiency | FAERS: 2 | US FAERS | |
| 291 | Coronary artery reocclusion | FAERS: 2 | US FAERS | |
| 292 | Dental caries | FAERS: 2 | US FAERS | |
| 293 | Disease Progression | FAERS: 2 | US FAERS | |
| 294 | Disease complication | FAERS: 2 | US FAERS | |
| 295 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 296 | Drowning | FAERS: 2 | US FAERS | |
| 297 | Embolic stroke | FAERS: 2 | US FAERS | |
| 298 | Embolism | FAERS: 2 | US FAERS | |
| 299 | Eosinophilia | FAERS: 2 | US FAERS | |
| 300 | Facial Pain | FAERS: 2 | US FAERS | |
| 301 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 302 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 303 | Gait inability | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Gastritis | FAERS: 2 | SIDER US FAERS | |
| 305 | Hepatitis | FAERS: 2 | US FAERS | |
| 306 | Hypoxia | FAERS: 2 | US FAERS | |
| 307 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 308 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 309 | Impaired work ability | FAERS: 2 | US FAERS | |
| 310 | Incontinence | FAERS: 2 | US FAERS | |
| 311 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 312 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 313 | Laziness | FAERS: 2 | US FAERS | |
| 314 | Leukopenia | FAERS: 2 | US FAERS | |
| 315 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 316 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 317 | Meniscus injury | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 318 | Mental Fatigue | FAERS: 2 | US FAERS | |
| 319 | Metastasis | FAERS: 2 | US FAERS | |
| 320 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 321 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 322 | Obesity | FAERS: 2 | US FAERS | |
| 323 | Paranoia | FAERS: 2 | US FAERS | |
| 324 | Paraplegia | FAERS: 2 | US FAERS | |
| 325 | Performance status decreased | FAERS: 2 | US FAERS | |
| 326 | Peripheral artery occlusion | FAERS: 2 | US FAERS | |
| 327 | Personality Change | FAERS: 2 | US FAERS | |
| 328 | Phlebitis | FAERS: 2 | US FAERS | |
| 329 | Platelet aggregation abnormal | FAERS: 2 | US FAERS | |
| 330 | Platelet aggregation decreased | FAERS: 2 | US FAERS | |
| 331 | Pneumonitis | FAERS: 2 | US FAERS | |
| 332 | Pneumothorax | FAERS: 2 | US FAERS | |
| 333 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 334 | Product dispensing error | FAERS: 2 | US FAERS | |
| 335 | Product name confusion | FAERS: 2 | US FAERS | |
| 336 | Product size issue | FAERS: 2 | US FAERS | |
| 337 | Product used for unknown indication | FAERS: 2 | US FAERS | |
| 338 | Psoriasis | FAERS: 2 | US FAERS | |
| 339 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 340 | Rales | FAERS: 2 | US FAERS | |
| 341 | Renal Colic | FAERS: 2 | US FAERS | |
| 342 | Renal cyst | FAERS: 2 | US FAERS | |
| 343 | Renal pain | FAERS: 2 | US FAERS | |
| 344 | Scab | FAERS: 2 | US FAERS | |
| 345 | Sinus headache | FAERS: 2 | US FAERS | |
| 346 | Stenosis | FAERS: 2 | US FAERS | |
| 347 | Stomatitis | FAERS: 2 | US FAERS | |
| 348 | Suicide attempt | FAERS: 2 | US FAERS | |
| 349 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 350 | Thrombotic stroke | FAERS: 2 | US FAERS | |
| 351 | Tooth Infection | FAERS: 2 | US FAERS | |
| 352 | Tooth Loss | FAERS: 2 | US FAERS | |
| 353 | Unevaluable event | FAERS: 2 | US FAERS | |
| 354 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 355 | Vascular dissection | FAERS: 2 | US FAERS | |
| 356 | Vascular rupture | FAERS: 2 | US FAERS | |
| 357 | Vasculitis | FAERS: 2 | US FAERS | |
| 358 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 359 | jaundice | FAERS: 2 | US FAERS | |
| 360 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 361 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 362 | Acne | FAERS: 1 | US FAERS | |
| 363 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 364 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 365 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 366 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 367 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 368 | Allodynia | FAERS: 1 | US FAERS | |
| 369 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 370 | Anal Fissure | FAERS: 1 | US FAERS | |
| 371 | Angioplasty | FAERS: 1 | US FAERS | |
| 372 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 373 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 374 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 375 | Application site discomfort | FAERS: 1 | US FAERS | |
| 376 | Application site swelling | FAERS: 1 | US FAERS | |
| 377 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 378 | Ascites | FAERS: 1 | US FAERS | |
| 379 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 380 | Asthenopia | FAERS: 1 | US FAERS | |
| 381 | Ataxia | FAERS: 1 | US FAERS | |
| 382 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 383 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 384 | Bipolar II disorder | FAERS: 1 | US FAERS | |
| 385 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 386 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 387 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 388 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 389 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 390 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 391 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 392 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 393 | Blood urea increased | FAERS: 1 | US FAERS | |
| 394 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 395 | Brain Contusion | FAERS: 1 | US FAERS | |
| 396 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 397 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 398 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 399 | Breath Holding | FAERS: 1 | US FAERS | |
| 400 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 401 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 402 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 403 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 404 | CREST Syndrome | FAERS: 1 | US FAERS | |
| 405 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 406 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 407 | Cardiac function disturbance postoperative | FAERS: 1 | US FAERS | |
| 408 | Cardiac perforation | FAERS: 1 | US FAERS | |
| 409 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 410 | Cardiac valve rupture | FAERS: 1 | US FAERS | |
| 411 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 412 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 413 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 414 | Carditis | FAERS: 1 | US FAERS | |
| 415 | Carotid artery restenosis | FAERS: 1 | US FAERS | |
| 416 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 417 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 418 | Cerebral vascular occlusion | FAERS: 1 | US FAERS | |
| 419 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 420 | Chemical peritonitis | FAERS: 1 | US FAERS | |
| 421 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 422 | Cholestasis | FAERS: 1 | US FAERS | |
| 423 | Chondrosis | FAERS: 1 | US FAERS | |
| 424 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 425 | Coagulation time abnormal | FAERS: 1 | US FAERS | |
| 426 | Coagulation time shortened | FAERS: 1 | US FAERS | |
| 427 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 428 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 429 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 430 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 431 | Cyanosis | FAERS: 1 | US FAERS | |
| 432 | Cyst | FAERS: 1 | US FAERS | |
| 433 | Dengue Fever | FAERS: 1 | US FAERS | |
| 434 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 435 | Device breakage | FAERS: 1 | US FAERS | |
| 436 | Device defective | FAERS: 1 | US FAERS | |
| 437 | Device malfunction | FAERS: 1 | US FAERS | |
| 438 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 439 | Diabetic arteritis | FAERS: 1 | US FAERS | |
| 440 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 441 | Disease recurrence | FAERS: 1 | US FAERS | |
| 442 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 443 | Diverticulum | FAERS: 1 | US FAERS | |
| 444 | Drug abuse | FAERS: 1 | US FAERS | |
| 445 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 446 | Drug administration error | FAERS: 1 | US FAERS | |
| 447 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 448 | Dysarthria | FAERS: 1 | US FAERS | |
| 449 | Dyslexia | FAERS: 1 | US FAERS | |
| 450 | Dysuria | FAERS: 1 | US FAERS | |
| 451 | Ear, nose and throat examination abnormal | FAERS: 1 | US FAERS | |
| 452 | Economic problem | FAERS: 1 | US FAERS | |
| 453 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 454 | Endocarditis | FAERS: 1 | US FAERS | |
| 455 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 456 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 457 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 458 | Epilepsy | FAERS: 1 | US FAERS | |
| 459 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 460 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 461 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 462 | Euphoric mood | FAERS: 1 | US FAERS | |
| 463 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 464 | Expired drug administered | FAERS: 1 | US FAERS | |
| 465 | Extra dose administered | FAERS: 1 | US FAERS | |
| 466 | Eye Infection | FAERS: 1 | US FAERS | |
| 467 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 468 | Feeling jittery | FAERS: 1 | US FAERS | |
| 469 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 470 | Food Poisoning | FAERS: 1 | US FAERS | |
| 471 | Frustration | FAERS: 1 | US FAERS | |
| 472 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 473 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 474 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 475 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 476 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 477 | Gingivitis | FAERS: 1 | US FAERS | |
| 478 | Glaucoma | FAERS: 1 | US FAERS | |
| 479 | Gliomatosis cerebri | FAERS: 1 | US FAERS | |
| 480 | Glioma | FAERS: 1 | US FAERS | |
| 481 | Graft overgrowth | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 482 | Graft thrombosis | FAERS: 1 | US FAERS | |
| 483 | Haematinuria | FAERS: 1 | US FAERS | |
| 484 | Hemiplegia | FAERS: 1 | US FAERS | |
| 485 | Hepatitis C | FAERS: 1 | US FAERS | |
| 486 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 487 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 488 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 489 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 490 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 491 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 492 | Hypogeusia | FAERS: 1 | US FAERS | |
| 493 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 494 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 495 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 496 | Implant site pain | FAERS: 1 | US FAERS | |
| 497 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 498 | Incision site pain | FAERS: 1 | US FAERS | |
| 499 | Incision site swelling | FAERS: 1 | US FAERS | |
| 500 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 501 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 502 | Infection in an immunocompromised host | FAERS: 1 | US FAERS | |
| 503 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 504 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 505 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 506 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 507 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 508 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 509 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 510 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 511 | Intracranial mass | FAERS: 1 | US FAERS | |
| 512 | Irregular breathing | FAERS: 1 | US FAERS | |
| 513 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 514 | Itching scar | FAERS: 1 | US FAERS | |
| 515 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 516 | Joint injury | FAERS: 1 | US FAERS | |
| 517 | Joint stiffness | FAERS: 1 | US FAERS | |
| 518 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 519 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 520 | Leukocytosis | FAERS: 1 | US FAERS | |
| 521 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 522 | Lipase increased | FAERS: 1 | US FAERS | |
| 523 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 524 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 525 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 526 | Lymphoma | FAERS: 1 | US FAERS | |
| 527 | Macular degeneration | FAERS: 1 | US FAERS | |
| 528 | Malignant ascites | FAERS: 1 | US FAERS | |
| 529 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 530 | Mastitis | FAERS: 1 | US FAERS | |
| 531 | Medical device site calcification | FAERS: 1 | US FAERS | |
| 532 | Meningitis | FAERS: 1 | US FAERS | |
| 533 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 534 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 535 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 536 | Miliaria | FAERS: 1 | US FAERS | |
| 537 | Monoparesis | FAERS: 1 | US FAERS | |
| 538 | Monoplegia | FAERS: 1 | US FAERS | |
| 539 | Motion Sickness | FAERS: 1 | US FAERS | |
| 540 | Muscle strain | FAERS: 1 | US FAERS | |
| 541 | Muscle tightness | FAERS: 1 | US FAERS | |
| 542 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 543 | Neuralgia | FAERS: 1 | US FAERS | |
| 544 | New daily persistent headache | FAERS: 1 | US FAERS | |
| 545 | Nocturia | FAERS: 1 | US FAERS | |
| 546 | Non-cardiac chest pain | FAERS: 1 | SIDER US FAERS | |
| 547 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 548 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 549 | Obstruction | FAERS: 1 | US FAERS | |
| 550 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 551 | Ocular icterus | FAERS: 1 | US FAERS | |
| 552 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 553 | Oral pain | FAERS: 1 | US FAERS | |
| 554 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 555 | Pallor | FAERS: 1 | US FAERS | |
| 556 | Papillary muscle disorder | FAERS: 1 | US FAERS | |
| 557 | Paroxysmal atrioventricular block | FAERS: 1 | US FAERS | |
| 558 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 559 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 560 | Percutaneous Coronary Intervention | FAERS: 1 | US FAERS | |
| 561 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 562 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 563 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 564 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 565 | Peritonitis | FAERS: 1 | US FAERS | |
| 566 | Platelet aggregation inhibition | FAERS: 1 | US FAERS | |
| 567 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 568 | Poisoning | FAERS: 1 | US FAERS | |
| 569 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 570 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 571 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 572 | Postoperative renal failure | FAERS: 1 | US FAERS | |
| 573 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 574 | Product barcode issue | FAERS: 1 | US FAERS | |
| 575 | Product container issue | FAERS: 1 | US FAERS | |
| 576 | Product contamination | FAERS: 1 | US FAERS | |
| 577 | Product counterfeit | FAERS: 1 | US FAERS | |
| 578 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 579 | Product packaging issue | FAERS: 1 | US FAERS | |
| 580 | Product prescribing error | FAERS: 1 | US FAERS | |
| 581 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 582 | Product residue present | FAERS: 1 | US FAERS | |
| 583 | Product use complaint | FAERS: 1 | US FAERS | |
| 584 | Proteinuria | FAERS: 1 | US FAERS | |
| 585 | Prothrombin level abnormal | FAERS: 1 | US FAERS | |
| 586 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 587 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 588 | Pulmonary hilar enlargement | FAERS: 1 | US FAERS | |
| 589 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 590 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 591 | Puncture site discharge | FAERS: 1 | US FAERS | |
| 592 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 593 | Rebound effect | FAERS: 1 | US FAERS | |
| 594 | Rectal polyp | FAERS: 1 | US FAERS | |
| 595 | Regurgitation | FAERS: 1 | US FAERS | |
| 596 | Renal mass | FAERS: 1 | US FAERS | |
| 597 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 598 | Reperfusion arrhythmia | FAERS: 1 | US FAERS | |
| 599 | Respiratory rate | FAERS: 1 | US FAERS | |
| 600 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 601 | Retching | FAERS: 1 | US FAERS | |
| 602 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 603 | Retroperitoneal abscess | FAERS: 1 | US FAERS | |
| 604 | Rhabdomyolysis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 605 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 606 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 607 | Schizotypal Personality Disorder | FAERS: 1 | US FAERS | |
| 608 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 609 | Sense of oppression | FAERS: 1 | US FAERS | |
| 610 | Septic Shock | FAERS: 1 | US FAERS | |
| 611 | Septic embolus | FAERS: 1 | US FAERS | |
| 612 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 613 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 614 | Skin Induration | FAERS: 1 | US FAERS | |
| 615 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 616 | Skin lesion | FAERS: 1 | US FAERS | |
| 617 | Skin reaction | FAERS: 1 | US FAERS | |
| 618 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 619 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 620 | Staring | FAERS: 1 | US FAERS | |
| 621 | Stupor | FAERS: 1 | US FAERS | |
| 622 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 623 | Suicide threat | FAERS: 1 | US FAERS | |
| 624 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 625 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 626 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 627 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 628 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 629 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 630 | Thermal burn | FAERS: 1 | US FAERS | |
| 631 | Thirst | FAERS: 1 | US FAERS | |
| 632 | Throat cancer | FAERS: 1 | US FAERS | |
| 633 | Tongue biting | FAERS: 1 | US FAERS | |
| 634 | Tongue eruption | FAERS: 1 | US FAERS | |
| 635 | Tongue erythema | FAERS: 1 | US FAERS | |
| 636 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 637 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 638 | Tuberculosis | FAERS: 1 | US FAERS | |
| 639 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 640 | Underweight | FAERS: 1 | US FAERS | |
| 641 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 642 | Urinary tract discomfort | FAERS: 1 | US FAERS | |
| 643 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 644 | Vascular access site pain | FAERS: 1 | US FAERS | |
| 645 | Vascular compression | FAERS: 1 | US FAERS | |
| 646 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 647 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 648 | Ventricular dyssynchrony | FAERS: 1 | US FAERS | |
| 649 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 650 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 651 | Wheelchair user | FAERS: 1 | US FAERS | |
| 652 | Wound Complication | FAERS: 1 | US FAERS | |
| 653 | Wrong schedule | FAERS: 1 | US FAERS | |
| 654 | Yawning | FAERS: 1 | US FAERS | |
| 655 | effusion | FAERS: 1 | US FAERS | |
| 656 | furuncle | FAERS: 1 | US FAERS | |
| 657 | prostatitis | FAERS: 1 | US FAERS | |
| 658 | Benign Prostatic Hyperplasia | Canada Vigilance: 3 | Canada Vigilance | |
| 659 | Dyspnea | 20620737 28041785 | CTD | |
| 660 | Ear and labyrinth disorders | SIDER | ||
| 661 | Major bleed | SIDER | ||
| 662 | Metrorrhagia | SIDER | ||
| 663 | Minor bleed | SIDER | ||
| 664 | Oliguria | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.