Rifaximin
(NZCRJKRKKOLAOJ-XRCRFVBUSA-N)
Structure
- SMILES
- CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C2=O)c2c(c(c3C)O)c(O)c(c3c2nc2n3ccc(c2)C)NC(=O)/C(=C\C=C\[C@@H]([C@@H]([C@H]([C@H]([C@H]([C@@H]([C@@H]1C)OC(=O)C)C)O)C)O)C)/C
- Type(s)
- Approved; Investigational
- ATC code(s)
- A07AA11; D06AX11
- Molecular Formula:
- C43H51N3O11
- Molecular Weight:
- 785.879
- Log P:
- 6.2958
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 5
- TPSA:
- 198.38
- CAS Number(s):
- 80621-81-4; 88747-56-2
Synonym(s)
1.
Rifaximin
2.
4-Deoxy-4'-methylpyrido(1',2'-1,2)imidazo(5,4C)rifamycin
3.
L 105
4.
L-105
5.
Redactiv
6.
Xifaxan
7.
L105
External Link(s)
| MeSH | D000078262 |
| PubChem Compound | 6436173 |
| BindingDB | 50347620 |
| ChEBI | 75246 |
| CHEMBL | CHEMBL1617 |
| DrugBank | DB01220 |
| DrugCentral | 2379 |
| KEGG | dr:D02554 |
| Therapeutic Target Database | D04ITO |
| ZINC | 169621200 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Ammonia increased | FAERS: 154 | OFFSIDES US FAERS | |
| 2 | Drug ineffective | FAERS: 140 | OFFSIDES US FAERS | |
| 3 | Drug dose omission | FAERS: 127 | US FAERS | |
| 4 | Malaise | FAERS: 125 | SIDER US FAERS | |
| 5 | Nausea | FAERS: 104 | OFFSIDES SIDER US FAERS | |
| 6 | Therapy cessation | FAERS: 96 | US FAERS | |
| 7 | Dizziness | FAERS: 83 | SIDER US FAERS | |
| 8 | Fatigue | FAERS: 83 | SIDER US FAERS | |
| 9 | Headache | FAERS: 69 | SIDER US FAERS | |
| 10 | Vomiting | FAERS: 68 | SIDER US FAERS | |
| 11 | No adverse event | FAERS: 64 | US FAERS | |
| 12 | Asthenia | FAERS: 63 | OFFSIDES SIDER US FAERS | |
| 13 | Inability to afford medication | FAERS: 61 | US FAERS | |
| 14 | Hepatic Encephalopathy | FAERS: 60 | US FAERS | |
| 15 | Pneumonia | FAERS: 56 | SIDER US FAERS | |
| 16 | Abdominal Pain | FAERS: 52 | OFFSIDES SIDER US FAERS | |
| 17 | Hospice Care | FAERS: 48 | US FAERS | |
| 18 | Constipation | FAERS: 46 | SIDER US FAERS | |
| 19 | Memory impairment | FAERS: 45 | SIDER US FAERS | |
| 20 | Feeling abnormal | FAERS: 44 | SIDER US FAERS | |
| 21 | Product use in unapproved indication | FAERS: 44 | US FAERS | |
| 22 | Ascites | FAERS: 42 | OFFSIDES SIDER US FAERS | |
| 23 | Wrong technique in product usage process | FAERS: 40 | US FAERS | |
| 24 | Flatulence | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 25 | Abdominal discomfort | FAERS: 35 | SIDER US FAERS | |
| 26 | Product supply issue | FAERS: 34 | US FAERS | |
| 27 | Urinary tract infection | FAERS: 33 | US FAERS | |
| 28 | Pain | FAERS: 32 | SIDER US FAERS | |
| 29 | Sepsis | FAERS: 31 | US FAERS | |
| 30 | Irritable Bowel Syndrome | FAERS: 28 | US FAERS | |
| 31 | Dehydration | FAERS: 27 | OFFSIDES SIDER US FAERS | |
| 32 | Tremor | FAERS: 27 | SIDER US FAERS | |
| 33 | Product availability issue | FAERS: 26 | US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 25 | US FAERS | |
| 35 | Peripheral swelling | FAERS: 25 | US FAERS | |
| 36 | Drug ineffective for unapproved indication | FAERS: 24 | US FAERS | |
| 37 | Unevaluable event | FAERS: 24 | US FAERS | |
| 38 | Weight decreased | FAERS: 24 | SIDER US FAERS | |
| 39 | Pruritus | FAERS: 22 | SIDER US FAERS | |
| 40 | Somnolence | FAERS: 21 | US FAERS | |
| 41 | Disorientation | FAERS: 20 | US FAERS | |
| 42 | Insurance issue | FAERS: 20 | US FAERS | |
| 43 | Product use complaint | FAERS: 20 | US FAERS | |
| 44 | Diabetes Mellitus | FAERS: 19 | US FAERS | |
| 45 | Drug effect incomplete | FAERS: 18 | US FAERS | |
| 46 | Intentional product use issue | FAERS: 18 | US FAERS | |
| 47 | Arthralgia | FAERS: 17 | SIDER US FAERS | |
| 48 | Anxiety | FAERS: 16 | US FAERS | |
| 49 | Back Pain | FAERS: 16 | SIDER US FAERS | |
| 50 | Disease recurrence | FAERS: 16 | US FAERS | |
| 51 | Drug prescribing error | FAERS: 16 | OFFSIDES US FAERS | |
| 52 | Therapeutic response unexpected | FAERS: 16 | US FAERS | |
| 53 | Chest Pain | FAERS: 15 | SIDER US FAERS | |
| 54 | Gastrointestinal bacterial overgrowth | FAERS: 15 | US FAERS | |
| 55 | Urticaria | FAERS: 15 | 11792017 | CTD SIDER US FAERS |
| 56 | Dyspepsia | FAERS: 14 | US FAERS | |
| 57 | Incorrect dose administered | FAERS: 14 | US FAERS | |
| 58 | Myalgia | FAERS: 14 | SIDER US FAERS | |
| 59 | Swelling | FAERS: 14 | US FAERS | |
| 60 | Amnesia | FAERS: 13 | SIDER US FAERS | |
| 61 | Clostridium difficile infection | FAERS: 13 | US FAERS | |
| 62 | Hypotension | FAERS: 13 | SIDER US FAERS | |
| 63 | Product difficult to swallow | FAERS: 13 | US FAERS | |
| 64 | Adverse event | FAERS: 12 | US FAERS | |
| 65 | Disease complication | FAERS: 12 | US FAERS | |
| 66 | Drug administration error | FAERS: 12 | US FAERS | |
| 67 | Joint swelling | FAERS: 12 | US FAERS | |
| 68 | Loss of personal independence in daily activities | FAERS: 12 | US FAERS | |
| 69 | Nasopharyngitis | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 70 | Ammonia abnormal | FAERS: 11 | US FAERS | |
| 71 | Dementia | FAERS: 11 | US FAERS | |
| 72 | General physical health deterioration | FAERS: 11 | US FAERS | |
| 73 | Hypersensitivity | FAERS: 11 | SIDER US FAERS | |
| 74 | Unresponsive to stimuli | FAERS: 11 | US FAERS | |
| 75 | Drug effective for unapproved indication | FAERS: 10 | US FAERS | |
| 76 | Lethargy | FAERS: 10 | OFFSIDES US FAERS | |
| 77 | Myocardial Infarction | FAERS: 10 | US FAERS | |
| 78 | Respiratory Failure | FAERS: 10 | US FAERS | |
| 79 | Terminal state | FAERS: 10 | US FAERS | |
| 80 | Bedridden | FAERS: 9 | US FAERS | |
| 81 | Blood sodium decreased | FAERS: 9 | US FAERS | |
| 82 | Chills | FAERS: 9 | US FAERS | |
| 83 | Expired product administered | FAERS: 9 | US FAERS | |
| 84 | Infection | FAERS: 9 | SIDER US FAERS | |
| 85 | Influenza | FAERS: 9 | US FAERS | |
| 86 | Septic Shock | FAERS: 9 | US FAERS | |
| 87 | Symptom recurrence | FAERS: 9 | US FAERS | |
| 88 | Blood glucose increased | FAERS: 8 | US FAERS | |
| 89 | Medication residue present | FAERS: 8 | US FAERS | |
| 90 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 91 | Product size issue | FAERS: 8 | US FAERS | |
| 92 | Product use issue | FAERS: 8 | US FAERS | |
| 93 | Blood creatinine increased | FAERS: 7 | US FAERS | |
| 94 | Blood glucose decreased | FAERS: 7 | US FAERS | |
| 95 | Cellulitis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 96 | Discomfort | FAERS: 7 | SIDER US FAERS | |
| 97 | Disease Progression | FAERS: 7 | US FAERS | |
| 98 | Fluid overload | FAERS: 7 | OFFSIDES US FAERS | |
| 99 | Impaired work ability | FAERS: 7 | US FAERS | |
| 100 | Intestinal Obstruction | FAERS: 7 | US FAERS | |
| 101 | Acute kidney injury | FAERS: 6 | US FAERS | |
| 102 | Alopecia | FAERS: 6 | US FAERS | |
| 103 | Ankle Fracture | FAERS: 6 | US FAERS | |
| 104 | Back disorder | FAERS: 6 | US FAERS | |
| 105 | Bowel movement irregularity | FAERS: 6 | US FAERS | |
| 106 | Bronchitis | FAERS: 6 | US FAERS | |
| 107 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 108 | Chromaturia | FAERS: 6 | US FAERS | |
| 109 | Dysgeusia | FAERS: 6 | US FAERS | |
| 110 | Dysphonia | FAERS: 6 | OFFSIDES US FAERS | |
| 111 | Eructation | FAERS: 6 | US FAERS | |
| 112 | Mental status changes | FAERS: 6 | US FAERS | |
| 113 | Throat irritation | FAERS: 6 | US FAERS | |
| 114 | Thrombosis | FAERS: 6 | US FAERS | |
| 115 | Tinnitus | FAERS: 6 | SIDER US FAERS | |
| 116 | Visual Impairment | FAERS: 6 | US FAERS | |
| 117 | Abasia | FAERS: 5 | US FAERS | |
| 118 | Aphasia | FAERS: 5 | US FAERS | |
| 119 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 120 | Burning sensation | FAERS: 5 | OFFSIDES US FAERS | |
| 121 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 122 | Crying | FAERS: 5 | US FAERS | |
| 123 | Drug administered to patient of inappropriate age | FAERS: 5 | US FAERS | |
| 124 | Erythema | FAERS: 5 | US FAERS | |
| 125 | Gastrointestinal motility disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 126 | Incoherent | FAERS: 5 | US FAERS | |
| 127 | Medication Error | FAERS: 5 | US FAERS | |
| 128 | Pancreatitis | FAERS: 5 | US FAERS | |
| 129 | Poor quality sleep | FAERS: 5 | OFFSIDES US FAERS | |
| 130 | Rehabilitation therapy | FAERS: 5 | US FAERS | |
| 131 | Retching | FAERS: 5 | US FAERS | |
| 132 | Sinusitis | FAERS: 5 | US FAERS | |
| 133 | Tachycardia | FAERS: 5 | US FAERS | |
| 134 | Thrombocytopenia | FAERS: 5 | US FAERS | |
| 135 | Abdominal cavity drainage | FAERS: 4 | US FAERS | |
| 136 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 137 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 138 | Cataract | FAERS: 4 | US FAERS | |
| 139 | Chest discomfort | FAERS: 4 | US FAERS | |
| 140 | Choking | FAERS: 4 | US FAERS | |
| 141 | Cystitis | FAERS: 4 | US FAERS | |
| 142 | Deafness | FAERS: 4 | US FAERS | |
| 143 | Delirium | FAERS: 4 | US FAERS | |
| 144 | Diverticulitis | FAERS: 4 | US FAERS | |
| 145 | Drug resistance | FAERS: 4 | US FAERS | |
| 146 | Gait inability | FAERS: 4 | US FAERS | |
| 147 | Gastrointestinal infection | FAERS: 4 | US FAERS | |
| 148 | Hepatorenal Syndrome | FAERS: 4 | US FAERS | |
| 149 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 150 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 151 | Limb injury | FAERS: 4 | US FAERS | |
| 152 | Portal shunt procedure | FAERS: 4 | US FAERS | |
| 153 | Product storage error | FAERS: 4 | US FAERS | |
| 154 | Splenomegaly | FAERS: 4 | US FAERS | |
| 155 | Stomatitis | FAERS: 4 | US FAERS | |
| 156 | Stress | FAERS: 4 | OFFSIDES US FAERS | |
| 157 | Syncope | FAERS: 4 | SIDER US FAERS | |
| 158 | Vertigo | FAERS: 4 | SIDER US FAERS | |
| 159 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 160 | Agitation | FAERS: 3 | US FAERS | |
| 161 | Alcohol abuse | FAERS: 3 | US FAERS | |
| 162 | Anger | FAERS: 3 | US FAERS | |
| 163 | Arthropathy | FAERS: 3 | US FAERS | |
| 164 | Asthma | FAERS: 3 | US FAERS | |
| 165 | Biliary Colic | FAERS: 3 | US FAERS | |
| 166 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 167 | Bradycardia | FAERS: 3 | US FAERS | |
| 168 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 169 | Clostridium difficile colitis | FAERS: 3 | OFFSIDES US FAERS | |
| 170 | Drooling | FAERS: 3 | US FAERS | |
| 171 | Drug effect variable | FAERS: 3 | US FAERS | |
| 172 | Dry skin | FAERS: 3 | US FAERS | |
| 173 | Dysuria | FAERS: 3 | SIDER US FAERS | |
| 174 | Enterococcal infection | FAERS: 3 | US FAERS | |
| 175 | Eosinophilia | FAERS: 3 | US FAERS | |
| 176 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 177 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 178 | Fracture | FAERS: 3 | US FAERS | |
| 179 | Gastrointestinal Pain | FAERS: 3 | SIDER US FAERS | |
| 180 | Hepatitis C | FAERS: 3 | OFFSIDES US FAERS | |
| 181 | Hernia | FAERS: 3 | US FAERS | |
| 182 | Hypophagia | FAERS: 3 | OFFSIDES US FAERS | |
| 183 | Impaired quality of life | FAERS: 3 | US FAERS | |
| 184 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 185 | Intra-abdominal fluid collection | FAERS: 3 | US FAERS | |
| 186 | Laryngitis | FAERS: 3 | US FAERS | |
| 187 | Mental impairment | FAERS: 3 | US FAERS | |
| 188 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 189 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 190 | Nervousness | FAERS: 3 | US FAERS | |
| 191 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 192 | Pallor | FAERS: 3 | US FAERS | |
| 193 | Palpitations | FAERS: 3 | US FAERS | |
| 194 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 195 | Physical disability | FAERS: 3 | US FAERS | |
| 196 | Poisoning | FAERS: 3 | US FAERS | |
| 197 | Product dose omission | FAERS: 3 | US FAERS | |
| 198 | Productive Cough | FAERS: 3 | US FAERS | |
| 199 | Solar lentigo | FAERS: 3 | US FAERS | |
| 200 | Throat cancer | FAERS: 3 | US FAERS | |
| 201 | Ulcer | FAERS: 3 | US FAERS | |
| 202 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 203 | Urinary Retention | FAERS: 3 | US FAERS | |
| 204 | intensive care | FAERS: 3 | US FAERS | |
| 205 | Abdominal Infection | FAERS: 2 | US FAERS | |
| 206 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 207 | Abscess | FAERS: 2 | US FAERS | |
| 208 | Accidental overdose | FAERS: 2 | OFFSIDES US FAERS | |
| 209 | Acne | FAERS: 2 | US FAERS | |
| 210 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 211 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 212 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 213 | Aneurysm | FAERS: 2 | US FAERS | |
| 214 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 215 | Aphonia | FAERS: 2 | US FAERS | |
| 216 | Arthritis | FAERS: 2 | US FAERS | |
| 217 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 218 | Biliary sepsis | FAERS: 2 | US FAERS | |
| 219 | Blindness | FAERS: 2 | US FAERS | |
| 220 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 221 | Blood iron decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 222 | Cataract operation | FAERS: 2 | US FAERS | |
| 223 | Cholecystitis | FAERS: 2 | US FAERS | |
| 224 | Clostridium colitis | FAERS: 2 | US FAERS | |
| 225 | Compression fracture | FAERS: 2 | US FAERS | |
| 226 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 227 | Depressed mood | FAERS: 2 | US FAERS | |
| 228 | Device related infection | FAERS: 2 | US FAERS | |
| 229 | Disability | FAERS: 2 | US FAERS | |
| 230 | Dysphemia | FAERS: 2 | US FAERS | |
| 231 | Eczema | FAERS: 2 | US FAERS | |
| 232 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 233 | Erysipelas | FAERS: 2 | US FAERS | |
| 234 | Escherichia infection | FAERS: 2 | US FAERS | |
| 235 | Expulsion of medication | FAERS: 2 | US FAERS | |
| 236 | Extra dose administered | FAERS: 2 | US FAERS | |
| 237 | Eye irritation | FAERS: 2 | US FAERS | |
| 238 | Flushing | FAERS: 2 | SIDER US FAERS | |
| 239 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 240 | Full blood count increased | FAERS: 2 | US FAERS | |
| 241 | Gastritis | FAERS: 2 | US FAERS | |
| 242 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 243 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 244 | Genital swelling | FAERS: 2 | US FAERS | |
| 245 | Hepatic Infection | FAERS: 2 | US FAERS | |
| 246 | Hepatic cancer stage IV | FAERS: 2 | US FAERS | |
| 247 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 248 | Hunger | FAERS: 2 | US FAERS | |
| 249 | Hypoxia | FAERS: 2 | US FAERS | |
| 250 | Hysterectomy | FAERS: 2 | US FAERS | |
| 251 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 252 | Joint injury | FAERS: 2 | US FAERS | |
| 253 | Leukocytosis | FAERS: 2 | US FAERS | |
| 254 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 255 | Megacolon | FAERS: 2 | OFFSIDES US FAERS | |
| 256 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 257 | Muscle tightness | FAERS: 2 | US FAERS | |
| 258 | Musculoskeletal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 259 | Myocarditis | FAERS: 2 | US FAERS | |
| 260 | Neck Pain | FAERS: 2 | SIDER US FAERS | |
| 261 | Ocular icterus | FAERS: 2 | OFFSIDES US FAERS | |
| 262 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 263 | Overdose | FAERS: 2 | US FAERS | |
| 264 | Post procedural complication | FAERS: 2 | US FAERS | |
| 265 | Probiotic therapy | FAERS: 2 | US FAERS | |
| 266 | Product physical issue | FAERS: 2 | US FAERS | |
| 267 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 268 | Purpura | FAERS: 2 | US FAERS | |
| 269 | Purulent discharge | FAERS: 2 | US FAERS | |
| 270 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 271 | Renal cyst | FAERS: 2 | US FAERS | |
| 272 | Respiratory distress | FAERS: 2 | US FAERS | |
| 273 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 274 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 275 | Schizophrenia | FAERS: 2 | US FAERS | |
| 276 | Secretion discharge | FAERS: 2 | US FAERS | |
| 277 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 278 | Sluggishness | FAERS: 2 | US FAERS | |
| 279 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 280 | Therapeutic product effective for unapproved indication | FAERS: 2 | US FAERS | |
| 281 | Thermal burn | FAERS: 2 | US FAERS | |
| 282 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 283 | Wrong drug administered | FAERS: 2 | OFFSIDES US FAERS | |
| 284 | jaundice | FAERS: 2 | US FAERS | |
| 285 | pseudomembranous colitis | FAERS: 2 | US FAERS | |
| 286 | Abdominal tenderness | FAERS: 1 | SIDER US FAERS | |
| 287 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 288 | Acute hepatitis C | FAERS: 1 | US FAERS | |
| 289 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 290 | Ageusia | FAERS: 1 | SIDER US FAERS | |
| 291 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 292 | Alcohol Use Disorder | FAERS: 1 | US FAERS | |
| 293 | Alcohol rehabilitation | FAERS: 1 | US FAERS | |
| 294 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 295 | Alpha 1 foetoprotein decreased | FAERS: 1 | US FAERS | |
| 296 | Ammonia decreased | FAERS: 1 | US FAERS | |
| 297 | Anal discomfort | FAERS: 1 | US FAERS | |
| 298 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 299 | Anorectal infection | FAERS: 1 | US FAERS | |
| 300 | Anuria | FAERS: 1 | US FAERS | |
| 301 | Apparent death | FAERS: 1 | US FAERS | |
| 302 | Arthropod bite | FAERS: 1 | US FAERS | |
| 303 | Arthroscopy | FAERS: 1 | US FAERS | |
| 304 | Aspartate Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 305 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 306 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 307 | Bacterial prostatitis | FAERS: 1 | US FAERS | |
| 308 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 309 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 310 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 311 | Blister rupture | FAERS: 1 | US FAERS | |
| 312 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 313 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 314 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 315 | Blood bilirubin decreased | FAERS: 1 | US FAERS | |
| 316 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 317 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 318 | Blood electrolytes increased | FAERS: 1 | US FAERS | |
| 319 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 320 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 321 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 322 | Blood thyroid stimulating hormone increased | FAERS: 1 | OFFSIDES US FAERS | |
| 323 | Bone erosion | FAERS: 1 | US FAERS | |
| 324 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 325 | Bradykinesia | FAERS: 1 | US FAERS | |
| 326 | Brain Abscess | FAERS: 1 | US FAERS | |
| 327 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 328 | Breast tenderness | FAERS: 1 | US FAERS | |
| 329 | Bursitis | FAERS: 1 | US FAERS | |
| 330 | CREST Syndrome | FAERS: 1 | US FAERS | |
| 331 | Cardiac perforation | FAERS: 1 | US FAERS | |
| 332 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 333 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 334 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 335 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 336 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 337 | Chemotherapy | FAERS: 1 | US FAERS | |
| 338 | Cholangitis | FAERS: 1 | US FAERS | |
| 339 | Clostridium difficile toxin test positive | FAERS: 1 | US FAERS | |
| 340 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 341 | Clumsiness | FAERS: 1 | US FAERS | |
| 342 | Cluster Headache | FAERS: 1 | US FAERS | |
| 343 | Colectomy | FAERS: 1 | US FAERS | |
| 344 | Colitis | FAERS: 1 | SIDER US FAERS | |
| 345 | Complication associated with device | FAERS: 1 | US FAERS | |
| 346 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 347 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 348 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 349 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 350 | Device dislocation | FAERS: 1 | US FAERS | |
| 351 | Device occlusion | FAERS: 1 | US FAERS | |
| 352 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 353 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 354 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 355 | Dissociation | FAERS: 1 | US FAERS | |
| 356 | Diverticulum | FAERS: 1 | US FAERS | |
| 357 | Drug abuse | FAERS: 1 | US FAERS | |
| 358 | Drug dispensing error | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 360 | Drug screen positive | FAERS: 1 | US FAERS | |
| 361 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 362 | Dysarthria | FAERS: 1 | US FAERS | |
| 363 | Dysgraphia | FAERS: 1 | US FAERS | |
| 364 | Dystonia | FAERS: 1 | US FAERS | |
| 365 | Ear discomfort | FAERS: 1 | US FAERS | |
| 366 | Early satiety | FAERS: 1 | US FAERS | |
| 367 | Ecchymosis | FAERS: 1 | US FAERS | |
| 368 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 369 | Embolism | FAERS: 1 | US FAERS | |
| 370 | Emergency Care | FAERS: 1 | US FAERS | |
| 371 | Emotional disorder | FAERS: 1 | US FAERS | |
| 372 | Emotional distress | FAERS: 1 | US FAERS | |
| 373 | Emotional poverty | FAERS: 1 | US FAERS | |
| 374 | Epilepsy | FAERS: 1 | US FAERS | |
| 375 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 376 | Eye pain | FAERS: 1 | US FAERS | |
| 377 | Fear of falling | FAERS: 1 | US FAERS | |
| 378 | Feeding intolerance | FAERS: 1 | US FAERS | |
| 379 | Feeling jittery | FAERS: 1 | US FAERS | |
| 380 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 381 | Frustration | FAERS: 1 | US FAERS | |
| 382 | Gangrene | FAERS: 1 | US FAERS | |
| 383 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 384 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 385 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 386 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 387 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 388 | Gastrostomy tube site complication | FAERS: 1 | US FAERS | |
| 389 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 390 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 391 | Hemiplegia | FAERS: 1 | US FAERS | |
| 392 | Hepatic artery thrombosis | FAERS: 1 | US FAERS | |
| 393 | Hepatic cancer stage III | FAERS: 1 | US FAERS | |
| 394 | Hepatitis B virus test positive | FAERS: 1 | US FAERS | |
| 395 | Hepatitis B | FAERS: 1 | US FAERS | |
| 396 | Hepatitis | FAERS: 1 | US FAERS | |
| 397 | Hernia perforation | FAERS: 1 | US FAERS | |
| 398 | Hip surgery | FAERS: 1 | US FAERS | |
| 399 | Hydrogen breath test abnormal | FAERS: 1 | US FAERS | |
| 400 | Hypersomnia | FAERS: 1 | US FAERS | |
| 401 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 402 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 403 | Hypokinesia | FAERS: 1 | US FAERS | |
| 404 | Hypophysectomy | FAERS: 1 | US FAERS | |
| 405 | Ileal ulcer | FAERS: 1 | US FAERS | |
| 406 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 407 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 408 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 409 | Infection in an immunocompromised host | FAERS: 1 | US FAERS | |
| 410 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 411 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 412 | Infusion site discharge | FAERS: 1 | US FAERS | |
| 413 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 414 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 415 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 416 | Intracranial mass | FAERS: 1 | US FAERS | |
| 417 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Leukopenia | FAERS: 1 | US FAERS | |
| 419 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 420 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 421 | Lyme Disease | FAERS: 1 | US FAERS | |
| 422 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 423 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 424 | Mastitis | FAERS: 1 | US FAERS | |
| 425 | Medical device change | FAERS: 1 | US FAERS | |
| 426 | Medical procedure | FAERS: 1 | US FAERS | |
| 427 | Meningioma | FAERS: 1 | US FAERS | |
| 428 | Meniscus injury | FAERS: 1 | US FAERS | |
| 429 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 430 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 431 | Monoparesis | FAERS: 1 | US FAERS | |
| 432 | Multiple allergies | FAERS: 1 | US FAERS | |
| 433 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 434 | Muscle strain | FAERS: 1 | US FAERS | |
| 435 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 436 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 437 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 438 | Myositis | FAERS: 1 | US FAERS | |
| 439 | Neuralgia | FAERS: 1 | US FAERS | |
| 440 | Neutropenia | FAERS: 1 | SIDER US FAERS | |
| 441 | Nocturia | FAERS: 1 | US FAERS | |
| 442 | Obesity | FAERS: 1 | US FAERS | |
| 443 | Onychomycosis | FAERS: 1 | US FAERS | |
| 444 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 445 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 446 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 447 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 448 | Pasteurella test positive | FAERS: 1 | US FAERS | |
| 449 | Patient uncooperative | FAERS: 1 | US FAERS | |
| 450 | Personality Change | FAERS: 1 | US FAERS | |
| 451 | Petechiae | FAERS: 1 | US FAERS | |
| 452 | Pharmaceutical product complaint | FAERS: 1 | OFFSIDES US FAERS | |
| 453 | Pneumothorax | FAERS: 1 | US FAERS | |
| 454 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 455 | Portal hypertensive gastropathy | FAERS: 1 | US FAERS | |
| 456 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 457 | Product container issue | FAERS: 1 | US FAERS | |
| 458 | Product packaging issue | FAERS: 1 | US FAERS | |
| 459 | Product prescribing error | FAERS: 1 | US FAERS | |
| 460 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 461 | Product substitution issue | FAERS: 1 | US FAERS | |
| 462 | Pruritus Ani | FAERS: 1 | US FAERS | |
| 463 | Psoriasis | FAERS: 1 | OFFSIDES US FAERS | |
| 464 | Pubic pain | FAERS: 1 | US FAERS | |
| 465 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 466 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 467 | Rash erythematous | FAERS: 1 | US FAERS | |
| 468 | Rectal tenesmus | FAERS: 1 | SIDER US FAERS | |
| 469 | Renal pain | FAERS: 1 | US FAERS | |
| 470 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 471 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 472 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 473 | Rosacea | FAERS: 1 | US FAERS | |
| 474 | Sciatica | FAERS: 1 | US FAERS | |
| 475 | Screaming | FAERS: 1 | US FAERS | |
| 476 | Shunt thrombosis | FAERS: 1 | US FAERS | |
| 477 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 478 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 479 | Skin irritation | FAERS: 1 | US FAERS | |
| 480 | Skin lesion | FAERS: 1 | US FAERS | |
| 481 | Skin tightness | FAERS: 1 | US FAERS | |
| 482 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 483 | Starvation | FAERS: 1 | US FAERS | |
| 484 | Stoma complication | FAERS: 1 | US FAERS | |
| 485 | Stoma site reaction | FAERS: 1 | US FAERS | |
| 486 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 487 | Strangulated umbilical hernia | FAERS: 1 | US FAERS | |
| 488 | Suicide attempt | FAERS: 1 | US FAERS | |
| 489 | Sunburn | FAERS: 1 | SIDER US FAERS | |
| 490 | Surgical failure | FAERS: 1 | US FAERS | |
| 491 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 492 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 493 | Tetany | FAERS: 1 | US FAERS | |
| 494 | Thoracic cavity drainage | FAERS: 1 | US FAERS | |
| 495 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 496 | Transplant | FAERS: 1 | US FAERS | |
| 497 | Troponin increased | FAERS: 1 | US FAERS | |
| 498 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 499 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 500 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 501 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 502 | Viral epiglottitis | FAERS: 1 | US FAERS | |
| 503 | Vulvovaginal mycotic infection | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 505 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 506 | Walking aid user | FAERS: 1 | US FAERS | |
| 507 | Wound Complication | FAERS: 1 | US FAERS | |
| 508 | Wound Infection | FAERS: 1 | US FAERS | |
| 509 | colonoscopy | FAERS: 1 | US FAERS | |
| 510 | furuncle | FAERS: 1 | US FAERS | |
| 511 | prostatitis | FAERS: 1 | US FAERS | |
| 512 | Abdominal adhesions | OFFSIDES | ||
| 513 | Acantholysis | OFFSIDES | ||
| 514 | Anhedonia | OFFSIDES | ||
| 515 | Anorectal discomfort | SIDER | ||
| 516 | Anorexia | SIDER | ||
| 517 | Apathy | OFFSIDES | ||
| 518 | Asterixis | OFFSIDES | ||
| 519 | Ataxia | OFFSIDES | ||
| 520 | Bacteria stool identified | OFFSIDES | ||
| 521 | Blood Glucose | OFFSIDES | ||
| 522 | Blood and lymphatic system disorders | SIDER | ||
| 523 | Blood glucose fluctuation | OFFSIDES | ||
| 524 | Blood in stool | SIDER | ||
| 525 | Blood sodium | OFFSIDES | ||
| 526 | Bone pain | OFFSIDES | ||
| 527 | Bronchiolitis | OFFSIDES | ||
| 528 | Cardioactive drug level increased | OFFSIDES | ||
| 529 | Chemical and Drug Induced Liver Injury | 22790967 | CTD | |
| 530 | Circumstance or information capable of leading to medication error | OFFSIDES | ||
| 531 | Cirrhosis | OFFSIDES | ||
| 532 | Cold sweat | SIDER | ||
| 533 | Culture positive | OFFSIDES | ||
| 534 | Cyst | OFFSIDES | ||
| 535 | Dental abscess | OFFSIDES | ||
| 536 | Diabetes | OFFSIDES | ||
| 537 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 538 | Diarrhea | OFFSIDES | ||
| 539 | Drug Eruptions | 11792017 | CTD | |
| 540 | Dysentery | SIDER | ||
| 541 | Ear and labyrinth disorders | SIDER | ||
| 542 | Economic problem | OFFSIDES | ||
| 543 | Endodontic procedure | OFFSIDES | ||
| 544 | Enteritis | OFFSIDES | ||
| 545 | Eosinophilic myocarditis | OFFSIDES | ||
| 546 | Excoriation | OFFSIDES | ||
| 547 | Fibromyalgia | OFFSIDES | ||
| 548 | Granulocytosis | OFFSIDES | ||
| 549 | Hepatic calcification | OFFSIDES | ||
| 550 | Hepatic necrosis | OFFSIDES | ||
| 551 | Hepatotoxicity | OFFSIDES | ||
| 552 | High frequency ablation | OFFSIDES | ||
| 553 | Impetigo | OFFSIDES | ||
| 554 | Infestation | SIDER | ||
| 555 | Inflammatory Bowel Diseases | 22790967 | CTD | |
| 556 | Injection site erythema | OFFSIDES | ||
| 557 | Insulin-requiring type 2 diabetes mellitus | OFFSIDES | ||
| 558 | Intervertebral disc disorder | OFFSIDES | ||
| 559 | Kidney Failure | OFFSIDES | ||
| 560 | Large intestine perforation | OFFSIDES | ||
| 561 | Lymphocytosis | SIDER | ||
| 562 | Monocytosis | SIDER | ||
| 563 | Motion Sickness | SIDER | ||
| 564 | Muscle Weakness | OFFSIDES | ||
| 565 | Musculoskeletal chest pain | OFFSIDES | ||
| 566 | Nasal discomfort | OFFSIDES SIDER | ||
| 567 | Nasal passage irritation | SIDER | ||
| 568 | Nodule on extremity | OFFSIDES | ||
| 569 | Nodule | OFFSIDES | ||
| 570 | Osteosclerosis | OFFSIDES | ||
| 571 | Paracentesis | OFFSIDES | ||
| 572 | Peritonitis | OFFSIDES | ||
| 573 | Pharyngitis | SIDER | ||
| 574 | Pharyngolaryngeal Pain | SIDER | ||
| 575 | Polyuria | SIDER | ||
| 576 | Protein urine present | SIDER | ||
| 577 | Proteinuria | SIDER | ||
| 578 | Pulmonary toxicity | OFFSIDES | ||
| 579 | Rhinitis | SIDER | ||
| 580 | Rhinorrhea | OFFSIDES | ||
| 581 | Scab | OFFSIDES | ||
| 582 | Scotoma | OFFSIDES | ||
| 583 | Shock | SIDER | ||
| 584 | Sinus bradycardia | OFFSIDES | ||
| 585 | Splenic Infarction | OFFSIDES | ||
| 586 | Tooth Infection | OFFSIDES | ||
| 587 | Tooth repair | OFFSIDES | ||
| 588 | Transfusion Reaction | OFFSIDES | ||
| 589 | Upset stomach | SIDER | ||
| 590 | Urinary tract infection fungal | OFFSIDES | ||
| 591 | Urinary tract infection staphylococcal | OFFSIDES | ||
| 592 | Urine output increased | SIDER | ||
| 593 | Vascular calcification | OFFSIDES | ||
| 594 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.