Daptomycin
(DOAKLVKFURWEDJ-QCMAZARJSA-N)
Structure
- SMILES
- NCCC[C@@H]1NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@H](Cc2c[nH]c3c2cccc3)NC(=O)CCCCCCCCC)CC(=O)N)CC(=O)O)[C@@H](C)OC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC1=O)CC(=O)O)C)CC(=O)O)CO)[C@@H](CC(=O)O)C)CC(=O)c1ccccc1N
- Type(s)
- Approved; Investigational
- ATC code(s)
- J01XX09
- Molecular Formula:
- C72H101N17O26
- Molecular Weight:
- 1620.670
- Log P:
- 0.8828
- Hydrogen Bond Acceptor:
- 42
- Hydrogen Bond Donor:
- 22
- TPSA:
- 702.02
- CAS Number(s):
- 103060-53-3
Synonym(s)
1.
Daptomycin
2.
Cubicin
3.
Daptomycin, 9-L beta-Aspartic Acid
4.
Deptomycin
5.
LY-146032
6.
Daptomycin, 9 L beta Aspartic Acid
7.
LY 146032
8.
LY146032
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood creatine phosphokinase increased | FAERS: 192 Canada Vigilance: 24 | Canada Vigilance US FAERS | |
| 2 | Eosinophilic Pneumonia | FAERS: 131 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 3 | Rhabdomyolysis | FAERS: 79 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Antimicrobial susceptibility test resistant | FAERS: 70 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 5 | No adverse event | FAERS: 66 | US FAERS | |
| 6 | Pathogen resistance | FAERS: 52 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 7 | Drug ineffective for unapproved indication | FAERS: 50 | US FAERS | |
| 8 | Drug ineffective | FAERS: 49 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 9 | Pneumonia | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Infection | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Myalgia | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Endocarditis | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | treatment failure | FAERS: 34 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 14 | Sepsis | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Product use issue | FAERS: 32 | US FAERS | |
| 16 | Septic Shock | FAERS: 32 | US FAERS | |
| 17 | Pneumonitis | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Adverse event | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Eosinophilia | FAERS: 27 | US FAERS | |
| 20 | Product use in unapproved indication | FAERS: 27 | US FAERS | |
| 21 | Blood creatinine increased | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 22 | Chills | FAERS: 25 | US FAERS | |
| 23 | Incorrect product storage | FAERS: 23 | US FAERS | |
| 24 | Respiratory Failure | FAERS: 23 | US FAERS | |
| 25 | Product quality issue | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Drug resistance | FAERS: 19 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 27 | Osteomyelitis | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 28 | Product preparation error | FAERS: 19 | US FAERS | |
| 29 | Vomiting | FAERS: 19 | US FAERS | |
| 30 | Asthenia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Enterococcal infection | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 32 | Hypersensitivity | FAERS: 15 | US FAERS | |
| 33 | Myositis | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Neutropenia | FAERS: 15 | US FAERS | |
| 35 | Pulmonary Eosinophilia | FAERS: 15 | US FAERS | |
| 36 | Device related infection | FAERS: 13 | US FAERS | |
| 37 | Thrombocytopenia | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 38 | Aspartate Aminotransferase Increased | FAERS: 12 | US FAERS | |
| 39 | Dizziness | FAERS: 12 | US FAERS | |
| 40 | Fatigue | FAERS: 12 | US FAERS | |
| 41 | Inappropriate schedule of drug administration | FAERS: 12 | US FAERS | |
| 42 | Nausea | FAERS: 12 | US FAERS | |
| 43 | Pancytopenia | FAERS: 12 | US FAERS | |
| 44 | Alanine Aminotransferase Increased | FAERS: 11 | US FAERS | |
| 45 | Arthralgia | FAERS: 11 | US FAERS | |
| 46 | Cardiac Arrest | FAERS: 11 | US FAERS | |
| 47 | Cellulitis | FAERS: 11 | US FAERS | |
| 48 | Myopathy | FAERS: 11 | US FAERS | |
| 49 | Pruritus | FAERS: 11 | US FAERS | |
| 50 | Pulmonary Embolism | FAERS: 11 | US FAERS | |
| 51 | Cerebrovascular accident | FAERS: 10 | US FAERS | |
| 52 | Hypotension | FAERS: 10 | US FAERS | |
| 53 | Leukopenia | FAERS: 10 | US FAERS | |
| 54 | Disease recurrence | FAERS: 9 | US FAERS | |
| 55 | Enterococcal sepsis | FAERS: 9 | US FAERS | |
| 56 | Headache | FAERS: 9 | US FAERS | |
| 57 | Incorrect dose administered | FAERS: 9 | US FAERS | |
| 58 | Tachycardia | FAERS: 9 | US FAERS | |
| 59 | Tremor | FAERS: 9 | US FAERS | |
| 60 | Urticaria | FAERS: 9 | US FAERS | |
| 61 | Circumstance or information capable of leading to medication error | FAERS: 8 | US FAERS | |
| 62 | Disease Progression | FAERS: 8 | US FAERS | |
| 63 | Drug administration error | FAERS: 8 | US FAERS | |
| 64 | Hepatitis | FAERS: 8 | US FAERS | |
| 65 | Malaise | FAERS: 8 | US FAERS | |
| 66 | Malignant neoplasm progression | FAERS: 8 | US FAERS | |
| 67 | Mental status changes | FAERS: 8 | US FAERS | |
| 68 | Myocardial Infarction | FAERS: 8 | US FAERS | |
| 69 | Overdose | FAERS: 8 | US FAERS | |
| 70 | Prescribed overdose | FAERS: 8 | US FAERS | |
| 71 | Anaphylactic shock | FAERS: 7 | US FAERS | |
| 72 | Creatinine renal clearance decreased | FAERS: 7 | US FAERS | |
| 73 | Embolism | FAERS: 7 | US FAERS | |
| 74 | Wheezing | FAERS: 7 | US FAERS | |
| 75 | Deep Vein Thrombosis | FAERS: 6 | US FAERS | |
| 76 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 77 | Ejection Fraction Decreased | FAERS: 6 | US FAERS | |
| 78 | Medication Error | FAERS: 6 | US FAERS | |
| 79 | Pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 81 | Abscess | FAERS: 5 | US FAERS | |
| 82 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 83 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 84 | Brain Abscess | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Cardiac valve vegetation | FAERS: 5 | US FAERS | |
| 86 | Chest Pain | FAERS: 5 | US FAERS | |
| 87 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 88 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 89 | Intercepted medication error | FAERS: 5 | US FAERS | |
| 90 | Product storage error | FAERS: 5 | US FAERS | |
| 91 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 92 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 93 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 94 | Anxiety | FAERS: 4 | US FAERS | |
| 95 | Back Pain | FAERS: 4 | US FAERS | |
| 96 | Cardiac valve abscess | FAERS: 4 | US FAERS | |
| 97 | Deafness | FAERS: 4 | US FAERS | |
| 98 | Disease complication | FAERS: 4 | US FAERS | |
| 99 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 100 | Drug dose omission | FAERS: 4 | US FAERS | |
| 101 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 102 | Infusion Site Extravasation | FAERS: 4 | US FAERS | |
| 103 | Lethargy | FAERS: 4 | US FAERS | |
| 104 | Night sweats | FAERS: 4 | US FAERS | |
| 105 | Oliguria | FAERS: 4 | US FAERS | |
| 106 | Respiratory distress | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Septic embolus | FAERS: 4 | US FAERS | |
| 108 | Shock | FAERS: 4 | US FAERS | |
| 109 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 110 | Sudden death | FAERS: 4 | US FAERS | |
| 111 | Systemic Inflammatory Response Syndrome | FAERS: 4 | US FAERS | |
| 112 | Thrombophlebitis | FAERS: 4 | US FAERS | |
| 113 | Transaminases increased | FAERS: 4 | US FAERS | |
| 114 | Alopecia | FAERS: 3 | US FAERS | |
| 115 | Bacterial sepsis | FAERS: 3 | US FAERS | |
| 116 | Blood creatinine abnormal | FAERS: 3 | US FAERS | |
| 117 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 118 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 119 | Blood urea increased | FAERS: 3 | US FAERS | |
| 120 | Bronchopneumonia | FAERS: 3 | US FAERS | |
| 121 | Bronchopulmonary Aspergillosis | FAERS: 3 | US FAERS | |
| 122 | Dehydration | FAERS: 3 | US FAERS | |
| 123 | Delirium | FAERS: 3 | US FAERS | |
| 124 | Diffuse alveolar damage | FAERS: 3 | US FAERS | |
| 125 | Electromechanical dissociation | FAERS: 3 | US FAERS | |
| 126 | Extravasation | FAERS: 3 | US FAERS | |
| 127 | Infusion site pain | FAERS: 3 | US FAERS | |
| 128 | Injection site extravasation | FAERS: 3 | US FAERS | |
| 129 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 130 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 131 | Myocardiac abscess | FAERS: 3 | US FAERS | |
| 132 | Myoclonus | FAERS: 3 | US FAERS | |
| 133 | Myoglobin blood increased | FAERS: 3 | US FAERS | |
| 134 | Occult blood positive | FAERS: 3 | US FAERS | |
| 135 | Opiates positive | FAERS: 3 | US FAERS | |
| 136 | Pancreatitis | FAERS: 3 | US FAERS | |
| 137 | Post procedural complication | FAERS: 3 | US FAERS | |
| 138 | Procedural complication | FAERS: 3 | US FAERS | |
| 139 | Product contamination physical | FAERS: 3 | US FAERS | |
| 140 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 141 | Pulmonary toxicity | FAERS: 3 | US FAERS | |
| 142 | Staphylococcus test positive | FAERS: 3 | US FAERS | |
| 143 | Superinfection | FAERS: 3 | US FAERS | |
| 144 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 145 | VIIth nerve paralysis | FAERS: 3 | US FAERS | |
| 146 | nervous system disorder | FAERS: 3 | US FAERS | |
| 147 | Actinomycosis | FAERS: 2 | US FAERS | |
| 148 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 149 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 150 | Alveolitis | FAERS: 2 | US FAERS | |
| 151 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 152 | Angioedema | FAERS: 2 | US FAERS | |
| 153 | Anuria | FAERS: 2 | US FAERS | |
| 154 | Aortic Rupture | FAERS: 2 | US FAERS | |
| 155 | Aphasia | FAERS: 2 | US FAERS | |
| 156 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 157 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 158 | BK virus infection | FAERS: 2 | US FAERS | |
| 159 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 160 | Blood creatine phosphokinase abnormal | FAERS: 2 | US FAERS | |
| 161 | Bradycardia | FAERS: 2 | US FAERS | |
| 162 | Bronchitis | FAERS: 2 | US FAERS | |
| 163 | Burning sensation | FAERS: 2 | US FAERS | |
| 164 | Cardiac procedure complication | FAERS: 2 | US FAERS | |
| 165 | Catheter bacteraemia | FAERS: 2 | US FAERS | |
| 166 | Chest discomfort | FAERS: 2 | US FAERS | |
| 167 | Cholestasis | FAERS: 2 | US FAERS | |
| 168 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 169 | Discomfort | FAERS: 2 | US FAERS | |
| 170 | Drug level below therapeutic | FAERS: 2 | US FAERS | |
| 171 | Drug level decreased | FAERS: 2 | US FAERS | |
| 172 | Dyspnoea exacerbated | FAERS: 2 | US FAERS | |
| 173 | Embolic stroke | FAERS: 2 | US FAERS | |
| 174 | Enterobacter sepsis | FAERS: 2 | US FAERS | |
| 175 | Erythema | FAERS: 2 | US FAERS | |
| 176 | Fluid overload | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Flushing | FAERS: 2 | US FAERS | |
| 178 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 179 | Hypocoagulable state | FAERS: 2 | US FAERS | |
| 180 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 181 | Injection site pain | FAERS: 2 | US FAERS | |
| 182 | Joint swelling | FAERS: 2 | US FAERS | |
| 183 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 184 | Leukocytosis | FAERS: 2 | US FAERS | |
| 185 | Lung consolidation | FAERS: 2 | US FAERS | |
| 186 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 187 | Mediastinitis | FAERS: 2 | US FAERS | |
| 188 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 189 | Nodule | FAERS: 2 | US FAERS | |
| 190 | Palpitations | FAERS: 2 | US FAERS | |
| 191 | Panniculitis | FAERS: 2 | US FAERS | |
| 192 | Paranoia | FAERS: 2 | US FAERS | |
| 193 | Phlebitis | FAERS: 2 | US FAERS | |
| 194 | Photophobia | FAERS: 2 | US FAERS | |
| 195 | Polymyositis | FAERS: 2 | US FAERS | |
| 196 | Product closure issue | FAERS: 2 | US FAERS | |
| 197 | Product contamination | FAERS: 2 | US FAERS | |
| 198 | Product dispensing error | FAERS: 2 | US FAERS | |
| 199 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 200 | Red man syndrome | FAERS: 2 | US FAERS | |
| 201 | Septic arthritis staphylococcal | FAERS: 2 | US FAERS | |
| 202 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 203 | Spondylitis | FAERS: 2 | US FAERS | |
| 204 | Staphylococcal osteomyelitis | FAERS: 2 | US FAERS | |
| 205 | Stenotrophomonas test positive | FAERS: 2 | US FAERS | |
| 206 | Syncope | FAERS: 2 | US FAERS | |
| 207 | Terminal state | FAERS: 2 | US FAERS | |
| 208 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 209 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 210 | Ulcer | FAERS: 2 | US FAERS | |
| 211 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 212 | Visual disturbance | FAERS: 2 | US FAERS | |
| 213 | Wound Infection | FAERS: 2 | US FAERS | |
| 214 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 215 | jaundice | FAERS: 2 | US FAERS | |
| 216 | Abasia | FAERS: 1 | US FAERS | |
| 217 | Abdominal Abscess | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 219 | Accidental death | FAERS: 1 | US FAERS | |
| 220 | Accidental overdose | FAERS: 1 | US FAERS | |
| 221 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 222 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 223 | Acute graft versus host disease in intestine | FAERS: 1 | US FAERS | |
| 224 | Acute graft versus host disease in liver | FAERS: 1 | US FAERS | |
| 225 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 226 | Agitation | FAERS: 1 | US FAERS | |
| 227 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 228 | Ammonia increased | FAERS: 1 | US FAERS | |
| 229 | Amnesia | FAERS: 1 | US FAERS | |
| 230 | Amputation | FAERS: 1 | US FAERS | |
| 231 | Antibiotic resistant Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 232 | Antimicrobial susceptibility test intermediate | FAERS: 1 | US FAERS | |
| 233 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 234 | Apparent death | FAERS: 1 | US FAERS | |
| 235 | Application site infection | FAERS: 1 | US FAERS | |
| 236 | Arthritis | FAERS: 1 | US FAERS | |
| 237 | Arthropathy | FAERS: 1 | US FAERS | |
| 238 | Asthenopia | FAERS: 1 | US FAERS | |
| 239 | Ataxia | FAERS: 1 | US FAERS | |
| 240 | Atelectasis | FAERS: 1 | US FAERS | |
| 241 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 242 | Bacterial disease carrier | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Blood creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 244 | Blood culture negative | FAERS: 1 | US FAERS | |
| 245 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 246 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 247 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 248 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 249 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 250 | Bone pain | FAERS: 1 | US FAERS | |
| 251 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 252 | Bronchospasm | FAERS: 1 | US FAERS | |
| 253 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 254 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 255 | Cardiac infection | FAERS: 1 | US FAERS | |
| 256 | Cardiac valve replacement complication | FAERS: 1 | US FAERS | |
| 257 | Catheter culture positive | FAERS: 1 | US FAERS | |
| 258 | Catheter related complication | FAERS: 1 | US FAERS | |
| 259 | Catheter related infection | FAERS: 1 | US FAERS | |
| 260 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 261 | Catheter site pain | FAERS: 1 | US FAERS | |
| 262 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 263 | Cholangitis | FAERS: 1 | US FAERS | |
| 264 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 265 | Colitis | FAERS: 1 | US FAERS | |
| 266 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 267 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 268 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 269 | Cyanosis | FAERS: 1 | US FAERS | |
| 270 | Dementia | FAERS: 1 | US FAERS | |
| 271 | Device dislocation | FAERS: 1 | US FAERS | |
| 272 | Device related sepsis | FAERS: 1 | US FAERS | |
| 273 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 274 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 275 | Diabetic foot infection | FAERS: 1 | US FAERS | |
| 276 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 277 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 278 | Drug toxicity | FAERS: 1 | US FAERS | |
| 279 | Dysgeusia | FAERS: 1 | US FAERS | |
| 280 | Dyspepsia | FAERS: 1 | US FAERS | |
| 281 | Dystonia | FAERS: 1 | US FAERS | |
| 282 | Ecchymosis | FAERS: 1 | US FAERS | |
| 283 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 284 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 285 | Emphysematous Cholecystitis | FAERS: 1 | US FAERS | |
| 286 | Encephalitis | FAERS: 1 | US FAERS | |
| 287 | Endocarditis enterococcal | FAERS: 1 | US FAERS | |
| 288 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 289 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 290 | Eosinophil percentage increased | FAERS: 1 | US FAERS | |
| 291 | Erysipelas | FAERS: 1 | US FAERS | |
| 292 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 293 | Escherichia infection | FAERS: 1 | US FAERS | |
| 294 | Eye irritation | FAERS: 1 | US FAERS | |
| 295 | False positive investigation result | FAERS: 1 | US FAERS | |
| 296 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 297 | Fascial rupture | FAERS: 1 | US FAERS | |
| 298 | Fasciitis | FAERS: 1 | US FAERS | |
| 299 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 300 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 301 | Fibrosis | FAERS: 1 | US FAERS | |
| 302 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 303 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 304 | Gangrene | FAERS: 1 | US FAERS | |
| 305 | Gastritis | FAERS: 1 | US FAERS | |
| 306 | Heparin-induced thrombocytopenia | FAERS: 1 | US FAERS | |
| 307 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 308 | Histoplasmosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 310 | Hypophagia | FAERS: 1 | US FAERS | |
| 311 | Hypoxia | FAERS: 1 | US FAERS | |
| 312 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 313 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 314 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 315 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 316 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 317 | Induration | FAERS: 1 | US FAERS | |
| 318 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 319 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 320 | Influenza | FAERS: 1 | US FAERS | |
| 321 | Infusion site discharge | FAERS: 1 | US FAERS | |
| 322 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 323 | Injection related reaction | FAERS: 1 | US FAERS | |
| 324 | Injection site erythema | FAERS: 1 | US FAERS | |
| 325 | Injection site irritation | FAERS: 1 | US FAERS | |
| 326 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 327 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 328 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 329 | Iritis | FAERS: 1 | US FAERS | |
| 330 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 331 | Joint stiffness | FAERS: 1 | US FAERS | |
| 332 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 333 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 334 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 335 | Limb injury | FAERS: 1 | US FAERS | |
| 336 | Lipase increased | FAERS: 1 | US FAERS | |
| 337 | Liver and small intestine transplant | FAERS: 1 | US FAERS | |
| 338 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 339 | Medical device complication | FAERS: 1 | US FAERS | |
| 340 | Meningitis enterococcal | FAERS: 1 | US FAERS | |
| 341 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 342 | Metabolic function test abnormal | FAERS: 1 | US FAERS | |
| 343 | Microbiology test abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 344 | Minimum inhibitory concentration increased | FAERS: 1 | US FAERS | |
| 345 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 346 | Multiple use of single-use product | FAERS: 1 | US FAERS | |
| 347 | Muscle tightness | FAERS: 1 | US FAERS | |
| 348 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 349 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 350 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 351 | Myocarditis | FAERS: 1 | US FAERS | |
| 352 | Myoglobin urine present | FAERS: 1 | US FAERS | |
| 353 | N-terminal prohormone brain natriuretic peptide | FAERS: 1 | US FAERS | |
| 354 | Neck Pain | FAERS: 1 | US FAERS | |
| 355 | Nephritis allergic | FAERS: 1 | US FAERS | |
| 356 | Nephrotic Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 357 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 358 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 359 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 360 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 361 | Oral administration complication | FAERS: 1 | US FAERS | |
| 362 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 363 | Pallor | FAERS: 1 | US FAERS | |
| 364 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 365 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 366 | Peritonitis | FAERS: 1 | US FAERS | |
| 367 | Pleurisy | FAERS: 1 | US FAERS | |
| 368 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 369 | Pneumonia Pseudomonas aeruginosa | FAERS: 1 | US FAERS | |
| 370 | Pneumothorax | FAERS: 1 | US FAERS | |
| 371 | Pocket erosion | FAERS: 1 | US FAERS | |
| 372 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 373 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 374 | Postoperative infection | FAERS: 1 | US FAERS | |
| 375 | Product availability issue | FAERS: 1 | US FAERS | |
| 376 | Product identification number issue | FAERS: 1 | US FAERS | |
| 377 | Product impurity | FAERS: 1 | US FAERS | |
| 378 | Protein total decreased | FAERS: 1 | US FAERS | |
| 379 | Pseudomonas bronchitis | FAERS: 1 | US FAERS | |
| 380 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 381 | Pulmonary vasculitis | FAERS: 1 | US FAERS | |
| 382 | Rales | FAERS: 1 | US FAERS | |
| 383 | Rash erythematous | FAERS: 1 | US FAERS | |
| 384 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 385 | Renal abscess | FAERS: 1 | US FAERS | |
| 386 | Renal and pancreas transplant | FAERS: 1 | US FAERS | |
| 387 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 388 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 389 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 390 | Rhonchi | FAERS: 1 | US FAERS | |
| 391 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 392 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 393 | Secretion discharge | FAERS: 1 | US FAERS | |
| 394 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 395 | Serum Sickness | FAERS: 1 | US FAERS | |
| 396 | Sinus operation | FAERS: 1 | US FAERS | |
| 397 | Skin toxicity | FAERS: 1 | US FAERS | |
| 398 | Somnolence | FAERS: 1 | US FAERS | |
| 399 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 400 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 401 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 402 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 403 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 404 | Swelling | FAERS: 1 | US FAERS | |
| 405 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 406 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 407 | Thoracotomy | FAERS: 1 | US FAERS | |
| 408 | Throat irritation | FAERS: 1 | US FAERS | |
| 409 | Thrombocytosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 410 | Toothache | FAERS: 1 | US FAERS | |
| 411 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 412 | Unevaluable event | FAERS: 1 | US FAERS | |
| 413 | Vasculitis | FAERS: 1 | US FAERS | |
| 414 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 415 | Vertigo | FAERS: 1 | US FAERS | |
| 416 | Visual Impairment | FAERS: 1 | US FAERS | |
| 417 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 418 | Weaning failure | FAERS: 1 | US FAERS | |
| 419 | Weight decreased | FAERS: 1 | US FAERS | |
| 420 | effusion | FAERS: 1 | US FAERS | |
| 421 | Blood creatine increased | Canada Vigilance: 1 | Canada Vigilance | |
| 422 | Clostridium test positive | Canada Vigilance: 1 | Canada Vigilance | |
| 423 | Graft infection | Canada Vigilance: 1 | Canada Vigilance | |
| 424 | Product dose omission | Canada Vigilance: 1 | Canada Vigilance | |
| 425 | Serology abnormal | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.