HhAntag691
(BPQMGSKTAYIVFO-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(c1ccc(cc1Cl)S(=O)(=O)C)Nc1ccc(c(c1)c1ccccn1)Cl
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX43
- Molecular Formula:
- C19H14Cl2N2O3S
- Molecular Weight:
- 421.297
- Log P:
- 5.8650
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 84.51
- CAS Number(s):
- 879085-55-9
Synonym(s)
1.
HhAntag691
2.
GDC 0449
3.
GDC-0449
4.
GDC0449
5.
NSC 747691
6.
NSC-747691
7.
NSC747691
8.
R 3616
9.
R-3616
10.
R3616 cpd
11.
RG 3616
12.
RG-3616
13.
RG3616
14.
erivedge
15.
vismodegib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Alopecia | FAERS: 568 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 2 | Dysgeusia | FAERS: 393 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 3 | Ageusia | FAERS: 335 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 4 | Fatigue | FAERS: 279 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 5 | Weight decreased | FAERS: 229 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 6 | Nausea | FAERS: 214 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 7 | Arthralgia | FAERS: 97 | SIDER US FAERS | |
| 8 | Constipation | FAERS: 97 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Myalgia | FAERS: 82 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 10 | Asthenia | FAERS: 79 | SIDER US FAERS | |
| 11 | Vomiting | FAERS: 74 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 12 | Squamous cell carcinoma | FAERS: 67 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Basal cell carcinoma | FAERS: 65 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 14 | Headache | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Malaise | FAERS: 54 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Drug ineffective | FAERS: 51 | US FAERS | |
| 17 | No adverse event | FAERS: 51 | US FAERS | |
| 18 | Dehydration | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Pain | FAERS: 42 | SIDER US FAERS | |
| 20 | Dizziness | FAERS: 37 | US FAERS | |
| 21 | Disease Progression | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Abdominal discomfort | FAERS: 31 | US FAERS | |
| 23 | Abdominal Pain | FAERS: 28 | SIDER US FAERS | |
| 24 | Cerebrovascular accident | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Pneumonia | FAERS: 28 | US FAERS | |
| 26 | Pruritus | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Back Pain | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Alanine Aminotransferase Increased | FAERS: 18 | US FAERS | |
| 29 | Intentional product use issue | FAERS: 18 | US FAERS | |
| 30 | Hepatotoxicity | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Aspartate Aminotransferase Increased | FAERS: 15 | SIDER US FAERS | |
| 32 | Dyspepsia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Dementia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Lymphocyte count decreased | FAERS: 14 | US FAERS | |
| 35 | Myocardial Infarction | FAERS: 14 | US FAERS | |
| 36 | Therapy cessation | FAERS: 14 | US FAERS | |
| 37 | Blood creatinine increased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Erythema | FAERS: 13 | US FAERS | |
| 39 | General physical health deterioration | FAERS: 13 | US FAERS | |
| 40 | Pulmonary Embolism | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Sepsis | FAERS: 13 | US FAERS | |
| 42 | Thrombosis | FAERS: 13 | US FAERS | |
| 43 | Blood creatine phosphokinase increased | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Feeling abnormal | FAERS: 12 | US FAERS | |
| 45 | Hypogeusia | FAERS: 12 | SIDER US FAERS | |
| 46 | Pregnancy | FAERS: 12 | US FAERS | |
| 47 | Syncope | FAERS: 12 | US FAERS | |
| 48 | Chest Pain | FAERS: 11 | US FAERS | |
| 49 | Hypotension | FAERS: 11 | US FAERS | |
| 50 | Urinary tract infection | FAERS: 11 | US FAERS | |
| 51 | Squamous cell carcinoma of skin | FAERS: 10 | US FAERS | |
| 52 | Actinic keratosis | FAERS: 9 | US FAERS | |
| 53 | Bone pain | FAERS: 9 | US FAERS | |
| 54 | Embolism | FAERS: 9 | US FAERS | |
| 55 | Hypophagia | FAERS: 9 | US FAERS | |
| 56 | Therapy non-responder | FAERS: 9 | US FAERS | |
| 57 | Visual Impairment | FAERS: 9 | US FAERS | |
| 58 | Acne | FAERS: 8 | US FAERS | |
| 59 | Amnesia | FAERS: 8 | US FAERS | |
| 60 | Anosmia | FAERS: 8 | US FAERS | |
| 61 | Deafness | FAERS: 8 | US FAERS | |
| 62 | Drug dose omission | FAERS: 8 | US FAERS | |
| 63 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 64 | Memory impairment | FAERS: 8 | US FAERS | |
| 65 | Somnolence | FAERS: 8 | US FAERS | |
| 66 | Tremor | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | jaundice | FAERS: 8 | US FAERS | |
| 68 | Anxiety | FAERS: 7 | US FAERS | |
| 69 | Drug resistance | FAERS: 7 | US FAERS | |
| 70 | Dry skin | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Erectile dysfunction | FAERS: 7 | US FAERS | |
| 72 | Gamma-Glutamyltransferase Increased | FAERS: 7 | US FAERS | |
| 73 | Hepatitis | FAERS: 7 | US FAERS | |
| 74 | Lethargy | FAERS: 7 | US FAERS | |
| 75 | Musculoskeletal Pain | FAERS: 7 | SIDER US FAERS | |
| 76 | Nasopharyngitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Peripheral swelling | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Sinusitis | FAERS: 7 | US FAERS | |
| 79 | Skin lesion | FAERS: 7 | US FAERS | |
| 80 | Transaminases increased | FAERS: 7 | US FAERS | |
| 81 | Urticaria | FAERS: 7 | US FAERS | |
| 82 | Arthropathy | FAERS: 6 | US FAERS | |
| 83 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 84 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 85 | Disease recurrence | FAERS: 6 | US FAERS | |
| 86 | Electrolyte imbalance | FAERS: 6 | US FAERS | |
| 87 | Feeling Cold | FAERS: 6 | US FAERS | |
| 88 | Flatulence | FAERS: 6 | US FAERS | |
| 89 | Ileus | FAERS: 6 | US FAERS | |
| 90 | Infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Palpitations | FAERS: 6 | US FAERS | |
| 92 | Swelling | FAERS: 6 | US FAERS | |
| 93 | Tooth Loss | FAERS: 6 | US FAERS | |
| 94 | White blood cell count decreased | FAERS: 6 | US FAERS | |
| 95 | Wrong technique in product usage process | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Arthritis | FAERS: 5 | US FAERS | |
| 97 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 98 | Cellulitis | FAERS: 5 | US FAERS | |
| 99 | Colitis | FAERS: 5 | US FAERS | |
| 100 | Cyst | FAERS: 5 | US FAERS | |
| 101 | Dysphonia | FAERS: 5 | US FAERS | |
| 102 | Epistaxis | FAERS: 5 | US FAERS | |
| 103 | Gastric ulcer | FAERS: 5 | US FAERS | |
| 104 | Malignant neoplasm progression | FAERS: 5 | US FAERS | |
| 105 | Musculoskeletal stiffness | FAERS: 5 | US FAERS | |
| 106 | Pancreatitis | FAERS: 5 | US FAERS | |
| 107 | Paraplegia | FAERS: 5 | US FAERS | |
| 108 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 109 | Rash erythematous | FAERS: 5 | US FAERS | |
| 110 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 111 | Tumour haemorrhage | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Acute kidney injury | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Angioedema | FAERS: 4 | US FAERS | |
| 114 | Blood alkaline phosphatase increased | FAERS: 4 | SIDER US FAERS | |
| 115 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 116 | Cholelithiasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Cholestasis | FAERS: 4 | US FAERS | |
| 118 | Cystitis | FAERS: 4 | US FAERS | |
| 119 | Duodenal Ulcer | FAERS: 4 | US FAERS | |
| 120 | Dysarthria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Exposure via father | FAERS: 4 | US FAERS | |
| 122 | Hypersomnia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Intercepted medication error | FAERS: 4 | US FAERS | |
| 124 | Limb injury | FAERS: 4 | US FAERS | |
| 125 | Lipase increased | FAERS: 4 | US FAERS | |
| 126 | Medication Error | FAERS: 4 | US FAERS | |
| 127 | Menopause | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 128 | Middle insomnia | FAERS: 4 | US FAERS | |
| 129 | Muscle Fatigue | FAERS: 4 | US FAERS | |
| 130 | Musculoskeletal chest pain | FAERS: 4 | SIDER US FAERS | |
| 131 | Neck Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 133 | Poor dental condition | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Productive Cough | FAERS: 4 | US FAERS | |
| 135 | Unevaluable event | FAERS: 4 | US FAERS | |
| 136 | Vertigo | FAERS: 4 | US FAERS | |
| 137 | treatment failure | FAERS: 4 | US FAERS | |
| 138 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 139 | Apathy | FAERS: 3 | US FAERS | |
| 140 | Aphasia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Blood electrolytes decreased | FAERS: 3 | US FAERS | |
| 142 | Blood potassium decreased | FAERS: 3 | SIDER US FAERS | |
| 143 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 144 | Bronchitis | FAERS: 3 | US FAERS | |
| 145 | Chest discomfort | FAERS: 3 | US FAERS | |
| 146 | Chills | FAERS: 3 | US FAERS | |
| 147 | Choking | FAERS: 3 | US FAERS | |
| 148 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 149 | Disorientation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Drug administration error | FAERS: 3 | US FAERS | |
| 151 | Dysentery | FAERS: 3 | US FAERS | |
| 152 | Expired product administered | FAERS: 3 | US FAERS | |
| 153 | Eye pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Gastrointestinal carcinoma | FAERS: 3 | US FAERS | |
| 155 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 156 | Joint stiffness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Joint swelling | FAERS: 3 | US FAERS | |
| 158 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 159 | Lymphoma | FAERS: 3 | US FAERS | |
| 160 | Mental status changes | FAERS: 3 | US FAERS | |
| 161 | Metastatic Neoplasm | FAERS: 3 | US FAERS | |
| 162 | Nervousness | FAERS: 3 | US FAERS | |
| 163 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 164 | Product dose omission | FAERS: 3 | US FAERS | |
| 165 | Pyelonephritis | FAERS: 3 | US FAERS | |
| 166 | Radiculopathy | FAERS: 3 | US FAERS | |
| 167 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 168 | Respiratory distress | FAERS: 3 | US FAERS | |
| 169 | Retching | FAERS: 3 | US FAERS | |
| 170 | Ruptured cerebral aneurysm | FAERS: 3 | US FAERS | |
| 171 | Sciatica | FAERS: 3 | US FAERS | |
| 172 | Sluggishness | FAERS: 3 | US FAERS | |
| 173 | Tinnitus | FAERS: 3 | US FAERS | |
| 174 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 175 | Trichodysplasia spinulosa | FAERS: 3 | US FAERS | |
| 176 | Ulcer | FAERS: 3 | US FAERS | |
| 177 | Urinary Incontinence | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 179 | Back disorder | FAERS: 2 | US FAERS | |
| 180 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 181 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 182 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 183 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 184 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 185 | Blood urea increased | FAERS: 2 | SIDER US FAERS | |
| 186 | Body height below normal | FAERS: 2 | US FAERS | |
| 187 | Burning sensation | FAERS: 2 | US FAERS | |
| 188 | Bursitis | FAERS: 2 | US FAERS | |
| 189 | Cachexia | FAERS: 2 | US FAERS | |
| 190 | Cataract | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Dental Restoration Failure | FAERS: 2 | US FAERS | |
| 192 | Dental caries | FAERS: 2 | US FAERS | |
| 193 | Depressed mood | FAERS: 2 | US FAERS | |
| 194 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 195 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 196 | Diplopia | FAERS: 2 | US FAERS | |
| 197 | Emotional distress | FAERS: 2 | US FAERS | |
| 198 | Eosinophilia | FAERS: 2 | US FAERS | |
| 199 | Epidermolysis Bullosa | FAERS: 2 | US FAERS | |
| 200 | Eructation | FAERS: 2 | US FAERS | |
| 201 | Eye irritation | FAERS: 2 | US FAERS | |
| 202 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 203 | Flushing | FAERS: 2 | US FAERS | |
| 204 | Folliculitis | FAERS: 2 | US FAERS | |
| 205 | Fracture | FAERS: 2 | US FAERS | |
| 206 | Gastritis | FAERS: 2 | US FAERS | |
| 207 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 208 | Gastrointestinal perforation | FAERS: 2 | US FAERS | |
| 209 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 210 | Glaucoma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Hypotonic urinary bladder | FAERS: 2 | US FAERS | |
| 212 | Incontinence | FAERS: 2 | US FAERS | |
| 213 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 214 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 215 | Laceration | FAERS: 2 | US FAERS | |
| 216 | Macule | FAERS: 2 | US FAERS | |
| 217 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 218 | Metastasis | FAERS: 2 | US FAERS | |
| 219 | Mood swings | FAERS: 2 | US FAERS | |
| 220 | Mouth swelling | FAERS: 2 | US FAERS | |
| 221 | Myositis | FAERS: 2 | US FAERS | |
| 222 | Neutropenia | FAERS: 2 | US FAERS | |
| 223 | Night sweats | FAERS: 2 | US FAERS | |
| 224 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 225 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 226 | Osteosclerosis | FAERS: 2 | US FAERS | |
| 227 | Overdose | FAERS: 2 | US FAERS | |
| 228 | Pain of skin | FAERS: 2 | US FAERS | |
| 229 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 230 | Paternal exposure before pregnancy | FAERS: 2 | US FAERS | |
| 231 | Photophobia | FAERS: 2 | US FAERS | |
| 232 | Pneumonitis | FAERS: 2 | US FAERS | |
| 233 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 234 | Precocious Puberty | FAERS: 2 | US FAERS | |
| 235 | Pregnancy of partner | FAERS: 2 | US FAERS | |
| 236 | Product use issue | FAERS: 2 | US FAERS | |
| 237 | Prostate cancer recurrent | FAERS: 2 | US FAERS | |
| 238 | Psoriasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 240 | Radiation injury | FAERS: 2 | US FAERS | |
| 241 | Radiation skin injury | FAERS: 2 | US FAERS | |
| 242 | Renal Colic | FAERS: 2 | US FAERS | |
| 243 | Restlessness | FAERS: 2 | US FAERS | |
| 244 | Scab | FAERS: 2 | US FAERS | |
| 245 | Scleroderma | FAERS: 2 | US FAERS | |
| 246 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 247 | Skin neoplasm bleeding | FAERS: 2 | US FAERS | |
| 248 | Stomatitis | FAERS: 2 | US FAERS | |
| 249 | Stress | FAERS: 2 | US FAERS | |
| 250 | Stridor | FAERS: 2 | US FAERS | |
| 251 | Tachycardia | FAERS: 2 | US FAERS | |
| 252 | Therapy partial responder | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 253 | Therapy responder | FAERS: 2 | US FAERS | |
| 254 | Thirst | FAERS: 2 | US FAERS | |
| 255 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 256 | Troponin increased | FAERS: 2 | US FAERS | |
| 257 | Wound Infection | FAERS: 2 | US FAERS | |
| 258 | keratoacanthoma | FAERS: 2 | US FAERS | |
| 259 | Abasia | FAERS: 1 | US FAERS | |
| 260 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 261 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 262 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 263 | Accidental overdose | FAERS: 1 | US FAERS | |
| 264 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 265 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 266 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 267 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 268 | Alopecia universalis | FAERS: 1 | US FAERS | |
| 269 | Amylase decreased | FAERS: 1 | US FAERS | |
| 270 | Amylase increased | FAERS: 1 | US FAERS | |
| 271 | Aneurysm | FAERS: 1 | US FAERS | |
| 272 | Anger | FAERS: 1 | US FAERS | |
| 273 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 274 | Angle Closure Glaucoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Animal scratch | FAERS: 1 | US FAERS | |
| 276 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 277 | Anticoagulation drug level decreased | FAERS: 1 | US FAERS | |
| 278 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 279 | Aphagia | FAERS: 1 | US FAERS | |
| 280 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 281 | Bedridden | FAERS: 1 | US FAERS | |
| 282 | Benign neoplasm of skin | FAERS: 1 | US FAERS | |
| 283 | Blindness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 284 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 285 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 286 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 287 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 288 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 289 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 290 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 291 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 292 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 293 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 294 | Breast tenderness | FAERS: 1 | US FAERS | |
| 295 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 296 | Cancer Pain | FAERS: 1 | US FAERS | |
| 297 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 298 | Cardiac imaging procedure abnormal | FAERS: 1 | US FAERS | |
| 299 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 300 | Catheter site inflammation | FAERS: 1 | US FAERS | |
| 301 | Catheter site pain | FAERS: 1 | US FAERS | |
| 302 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 303 | Cholangitis | FAERS: 1 | US FAERS | |
| 304 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 305 | Cholecystitis | FAERS: 1 | US FAERS | |
| 306 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 307 | Chromaturia | FAERS: 1 | US FAERS | |
| 308 | Cold sweat | FAERS: 1 | US FAERS | |
| 309 | Congenital cerebral cyst | FAERS: 1 | US FAERS | |
| 310 | Deformity | FAERS: 1 | US FAERS | |
| 311 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 312 | Disease complication | FAERS: 1 | US FAERS | |
| 313 | Disease susceptibility | FAERS: 1 | US FAERS | |
| 314 | Diverticulitis | FAERS: 1 | US FAERS | |
| 315 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 316 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 317 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 318 | Drug-device interaction | FAERS: 1 | US FAERS | |
| 319 | Dysacusis | FAERS: 1 | US FAERS | |
| 320 | Dysuria | FAERS: 1 | US FAERS | |
| 321 | Ear congestion | FAERS: 1 | US FAERS | |
| 322 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 323 | Endocrine test abnormal | FAERS: 1 | US FAERS | |
| 324 | Entropion | FAERS: 1 | US FAERS | |
| 325 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 326 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 327 | Erysipelas | FAERS: 1 | US FAERS | |
| 328 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 329 | Euphoric mood | FAERS: 1 | US FAERS | |
| 330 | Excessive cerumen production | FAERS: 1 | US FAERS | |
| 331 | Exposure to violent event | FAERS: 1 | US FAERS | |
| 332 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 333 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 334 | Extra dose administered | FAERS: 1 | US FAERS | |
| 335 | Eye excision | FAERS: 1 | US FAERS | |
| 336 | Facial Paresis | FAERS: 1 | US FAERS | |
| 337 | Fasciitis | FAERS: 1 | US FAERS | |
| 338 | Fibrosis | FAERS: 1 | US FAERS | |
| 339 | Fluid overload | FAERS: 1 | US FAERS | |
| 340 | Food aversion | FAERS: 1 | US FAERS | |
| 341 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 342 | Gait inability | FAERS: 1 | US FAERS | |
| 343 | Gangrene | FAERS: 1 | US FAERS | |
| 344 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 345 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 346 | Gastrointestinal stenosis | FAERS: 1 | US FAERS | |
| 347 | Gastrostomy | FAERS: 1 | US FAERS | |
| 348 | Genital rash | FAERS: 1 | US FAERS | |
| 349 | Glossopharyngeal Nerve Disorder | FAERS: 1 | US FAERS | |
| 350 | Gout | FAERS: 1 | US FAERS | |
| 351 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 352 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 353 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 354 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 355 | Hypoglossal Nerve Disorder | FAERS: 1 | US FAERS | |
| 356 | Hypotrichosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 357 | Hypoxia | FAERS: 1 | US FAERS | |
| 358 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 359 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 360 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 361 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 362 | Influenza | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 363 | Inguinal mass | FAERS: 1 | US FAERS | |
| 364 | Initial insomnia | FAERS: 1 | US FAERS | |
| 365 | Intentional product misuse | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 366 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 367 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 368 | Keratitis | FAERS: 1 | US FAERS | |
| 369 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 370 | Laryngeal Squamous Cell Carcinoma | FAERS: 1 | US FAERS | |
| 371 | Leukocytosis | FAERS: 1 | US FAERS | |
| 372 | Limb discomfort | FAERS: 1 | US FAERS | |
| 373 | Lip swelling | FAERS: 1 | US FAERS | |
| 374 | Lithiasis | FAERS: 1 | US FAERS | |
| 375 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 376 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 377 | Macular degeneration | FAERS: 1 | US FAERS | |
| 378 | Mastication disorder | FAERS: 1 | US FAERS | |
| 379 | Meningioma | FAERS: 1 | US FAERS | |
| 380 | Menorrhagia | FAERS: 1 | US FAERS | |
| 381 | Mental impairment | FAERS: 1 | US FAERS | |
| 382 | Mole excision | FAERS: 1 | US FAERS | |
| 383 | Motion Sickness | FAERS: 1 | US FAERS | |
| 384 | Mucoepidermoid Carcinoma | FAERS: 1 | US FAERS | |
| 385 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 386 | Muscle tightness | FAERS: 1 | US FAERS | |
| 387 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 388 | Myoclonus | FAERS: 1 | US FAERS | |
| 389 | Necrosis | FAERS: 1 | US FAERS | |
| 390 | Nephrolithiasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 391 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 392 | Neuralgia | FAERS: 1 | US FAERS | |
| 393 | Nipple pain | FAERS: 1 | US FAERS | |
| 394 | Nystagmus | FAERS: 1 | US FAERS | |
| 395 | Obesity | FAERS: 1 | US FAERS | |
| 396 | Oncologic complication | FAERS: 1 | US FAERS | |
| 397 | Oral contusion | FAERS: 1 | US FAERS | |
| 398 | Oral pain | FAERS: 1 | US FAERS | |
| 399 | Osteoradionecrosis | FAERS: 1 | US FAERS | |
| 400 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 401 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 402 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 403 | Personality Change | FAERS: 1 | US FAERS | |
| 404 | Petechiae | FAERS: 1 | US FAERS | |
| 405 | Physical product label issue | FAERS: 1 | US FAERS | |
| 406 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 407 | Pneumothorax | FAERS: 1 | US FAERS | |
| 408 | Polydipsia | FAERS: 1 | US FAERS | |
| 409 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 410 | Prerenal failure | FAERS: 1 | US FAERS | |
| 411 | Presyncope | FAERS: 1 | US FAERS | |
| 412 | Primary Hypothyroidism | FAERS: 1 | US FAERS | |
| 413 | Product quality issue | FAERS: 1 | US FAERS | |
| 414 | Product storage error | FAERS: 1 | US FAERS | |
| 415 | Renal pain | FAERS: 1 | US FAERS | |
| 416 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 417 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 418 | Rosacea | FAERS: 1 | US FAERS | |
| 419 | Septic Shock | FAERS: 1 | US FAERS | |
| 420 | Sexual Dysfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 421 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 422 | Sinus operation | FAERS: 1 | US FAERS | |
| 423 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 424 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 425 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 426 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 427 | Solar lentigo | FAERS: 1 | US FAERS | |
| 428 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 429 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 430 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 431 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 432 | Suicide attempt | FAERS: 1 | US FAERS | |
| 433 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 434 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 435 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 436 | Throat irritation | FAERS: 1 | US FAERS | |
| 437 | Thymoma | FAERS: 1 | US FAERS | |
| 438 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 439 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 440 | Toothache | FAERS: 1 | US FAERS | |
| 441 | Trismus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 442 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 443 | Upper respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 444 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 445 | Vascular rupture | FAERS: 1 | US FAERS | |
| 446 | Vasculitis | FAERS: 1 | US FAERS | |
| 447 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 448 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 449 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 450 | Walking aid user | FAERS: 1 | US FAERS | |
| 451 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 452 | colonoscopy | FAERS: 1 | US FAERS | |
| 453 | muscle injury | FAERS: 1 | US FAERS | |
| 454 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 455 | skin abrasion | FAERS: 1 | US FAERS | |
| 456 | Basal Cell Nevus Syndrome | 25876211 | CTD | |
| 457 | Carcinoma, Basal Cell | 25559776 | CTD | |
| 458 | Exophthalmos | Canada Vigilance: 1 | Canada Vigilance | |
| 459 | Facial Dysmorphism with Multiple Malformations | 27585885 | CTD | |
| 460 | Flank Pain | SIDER | ||
| 461 | Holoprosencephaly | 27585885 | CTD | |
| 462 | Musculoskeletal discomfort | SIDER | ||
| 463 | Nerve injury | Canada Vigilance: 1 | Canada Vigilance | |
| 464 | Open globe injury | Canada Vigilance: 1 | Canada Vigilance | |
| 465 | Potassium low | SIDER | ||
| 466 | Renal cyst | Canada Vigilance: 1 | Canada Vigilance | |
| 467 | Secretion discharge | Canada Vigilance: 1 | Canada Vigilance | |
| 468 | Skin necrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 469 | Sodium decreased | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.