Loperamide
(RDOIQAHITMMDAJ-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc(cc1)C1(O)CCN(CC1)CCC(C(=O)N(C)C)(c1ccccc1)c1ccccc1
- Type(s)
- Approved
- ATC code(s)
- A07DA03; A07DA53
- Molecular Formula:
- C29H33ClN2O2
- Molecular Weight:
- 477.038
- Log P:
- 5.0259
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 43.78
- CAS Number(s):
- 34552-83-5; 53179-11-6
Synonym(s)
1.
Loperamide
2.
Imodium
3.
Loperamide Hydrochloride
4.
Loperamide Monohydrochloride
5.
R-18553
6.
Hydrochloride, Loperamide
7.
Monohydrochloride, Loperamide
8.
R 18553
9.
R18553
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug abuse | FAERS: 275 | US FAERS | |
| 2 | Drug ineffective | FAERS: 236 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Overdose | FAERS: 148 | US FAERS | |
| 4 | Intentional product misuse | FAERS: 118 | US FAERS | |
| 5 | Cardiac Arrest | FAERS: 86 | US FAERS | |
| 6 | Toxicity to various agents | FAERS: 86 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Constipation | FAERS: 70 | 20350559 20699592 25261794 | CTD SIDER US FAERS |
| 8 | Incorrect dose administered | FAERS: 66 | US FAERS | |
| 9 | Product use issue | FAERS: 59 | US FAERS | |
| 10 | Syncope | FAERS: 59 | US FAERS | |
| 11 | Vomiting | FAERS: 49 | SIDER US FAERS | |
| 12 | Expired product administered | FAERS: 37 | US FAERS | |
| 13 | Intentional self-injury | FAERS: 37 | US FAERS | |
| 14 | Product size issue | FAERS: 33 | US FAERS | |
| 15 | Dizziness | FAERS: 32 | SIDER US FAERS | |
| 16 | Drug withdrawal syndrome | FAERS: 31 | US FAERS | |
| 17 | Ventricular arrhythmia | FAERS: 30 | US FAERS | |
| 18 | Drug Dependence | FAERS: 29 | US FAERS | |
| 19 | Nausea | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 20 | Product packaging issue | FAERS: 28 | US FAERS | |
| 21 | Intentional product use issue | FAERS: 27 | US FAERS | |
| 22 | Inappropriate schedule of drug administration | FAERS: 26 | US FAERS | |
| 23 | Product use complaint | FAERS: 26 | US FAERS | |
| 24 | Somnolence | FAERS: 26 | SIDER US FAERS | |
| 25 | Abdominal Pain | FAERS: 25 | 10985875 | CTD OFFSIDES SIDER US FAERS |
| 26 | Cardiotoxicity | FAERS: 25 | 30597669 | CTD US FAERS |
| 27 | Bradycardia | FAERS: 24 | US FAERS | |
| 28 | Product use in unapproved indication | FAERS: 23 | US FAERS | |
| 29 | Tachycardia | FAERS: 22 | US FAERS | |
| 30 | Accidental overdose | FAERS: 21 | US FAERS | |
| 31 | Malaise | FAERS: 21 | US FAERS | |
| 32 | Fatigue | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 33 | Wrong technique in product usage process | FAERS: 20 | US FAERS | |
| 34 | Electrocardiogram abnormal | FAERS: 19 | US FAERS | |
| 35 | Anxiety | FAERS: 18 | US FAERS | |
| 36 | Drug administration error | FAERS: 18 | US FAERS | |
| 37 | Therapeutic response unexpected | FAERS: 18 | US FAERS | |
| 38 | Acute kidney injury | FAERS: 17 | US FAERS | |
| 39 | Product difficult to swallow | FAERS: 17 | US FAERS | |
| 40 | Product quality issue | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Urinary Retention | FAERS: 17 | 17405350 | CTD SIDER US FAERS |
| 42 | Ventricular Fibrillation | FAERS: 17 | US FAERS | |
| 43 | Abdominal discomfort | FAERS: 16 | US FAERS | |
| 44 | Adverse event | FAERS: 16 | US FAERS | |
| 45 | Hypotension | FAERS: 16 | US FAERS | |
| 46 | Unresponsive to stimuli | FAERS: 16 | US FAERS | |
| 47 | Electrolyte imbalance | FAERS: 15 | US FAERS | |
| 48 | Suicide attempt | FAERS: 15 | US FAERS | |
| 49 | Therapeutic response delayed | FAERS: 15 | US FAERS | |
| 50 | Flatulence | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 51 | Intestinal Obstruction | FAERS: 14 | OFFSIDES US FAERS | |
| 52 | Lethargy | FAERS: 13 | US FAERS | |
| 53 | Pain | FAERS: 13 | US FAERS | |
| 54 | Tremor | FAERS: 13 | US FAERS | |
| 55 | Choking | FAERS: 12 | US FAERS | |
| 56 | Depressed Level of Consciousness | FAERS: 12 | SIDER US FAERS | |
| 57 | Product blister packaging issue | FAERS: 12 | US FAERS | |
| 58 | Respiratory Depression | FAERS: 12 | US FAERS | |
| 59 | Drug ineffective for unapproved indication | FAERS: 11 | US FAERS | |
| 60 | Intentional drug misuse | FAERS: 11 | US FAERS | |
| 61 | Long QT Syndrome | FAERS: 11 | US FAERS | |
| 62 | Retching | FAERS: 11 | US FAERS | |
| 63 | Agitation | FAERS: 10 | US FAERS | |
| 64 | Headache | FAERS: 10 | 11264692 | CTD SIDER US FAERS |
| 65 | Respiratory arrest | FAERS: 10 | US FAERS | |
| 66 | Wrong technique in drug usage process | FAERS: 10 | US FAERS | |
| 67 | Rhabdomyolysis | FAERS: 9 | US FAERS | |
| 68 | Sinus bradycardia | FAERS: 9 | US FAERS | |
| 69 | Asthenia | FAERS: 8 | SIDER US FAERS | |
| 70 | Completed Suicide | FAERS: 8 | US FAERS | |
| 71 | Drug prescribing error | FAERS: 8 | US FAERS | |
| 72 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 73 | Product formulation issue | FAERS: 8 | US FAERS | |
| 74 | Pruritus | FAERS: 8 | SIDER US FAERS | |
| 75 | Yawning | FAERS: 8 | US FAERS | |
| 76 | Acidosis | FAERS: 7 | OFFSIDES US FAERS | |
| 77 | Cardiomegaly | FAERS: 7 | US FAERS | |
| 78 | Cyanosis | FAERS: 7 | OFFSIDES US FAERS | |
| 79 | Incorrect drug administration duration | FAERS: 7 | US FAERS | |
| 80 | Infrequent bowel movements | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Medication Error | FAERS: 7 | US FAERS | |
| 82 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 83 | Product coating issue | FAERS: 7 | US FAERS | |
| 84 | Product label issue | FAERS: 7 | US FAERS | |
| 85 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 86 | Seizure like phenomena | FAERS: 7 | US FAERS | |
| 87 | Anuria | FAERS: 6 | US FAERS | |
| 88 | Drug screen positive | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Hypoxia | FAERS: 6 | US FAERS | |
| 90 | Ileus | FAERS: 6 | SIDER US FAERS | |
| 91 | Product availability issue | FAERS: 6 | US FAERS | |
| 92 | Product physical issue | FAERS: 6 | US FAERS | |
| 93 | Throat irritation | FAERS: 6 | US FAERS | |
| 94 | Unmasking of previously unidentified disease | FAERS: 6 | US FAERS | |
| 95 | Urinary Incontinence | FAERS: 6 | US FAERS | |
| 96 | Accidental exposure to product | FAERS: 5 | US FAERS | |
| 97 | Anaphylactic shock | FAERS: 5 | SIDER US FAERS | |
| 98 | Chest Pain | FAERS: 5 | US FAERS | |
| 99 | Chest discomfort | FAERS: 5 | US FAERS | |
| 100 | Cytopenia | FAERS: 5 | US FAERS | |
| 101 | Dependence | FAERS: 5 | US FAERS | |
| 102 | Drug level increased | FAERS: 5 | US FAERS | |
| 103 | Drug toxicity | FAERS: 5 | OFFSIDES US FAERS | |
| 104 | Dysgeusia | FAERS: 5 | US FAERS | |
| 105 | Ejection Fraction Decreased | FAERS: 5 | US FAERS | |
| 106 | Palpitations | FAERS: 5 | US FAERS | |
| 107 | Pancreatitis | FAERS: 5 | OFFSIDES US FAERS | |
| 108 | Product package associated injury | FAERS: 5 | US FAERS | |
| 109 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 110 | Serotonin Syndrome | FAERS: 5 | US FAERS | |
| 111 | Tonic clonic movements | FAERS: 5 | US FAERS | |
| 112 | Urticaria | FAERS: 5 | SIDER US FAERS | |
| 113 | Arthralgia | FAERS: 4 | US FAERS | |
| 114 | Back Pain | FAERS: 4 | US FAERS | |
| 115 | Brain Death | FAERS: 4 | US FAERS | |
| 116 | Chills | FAERS: 4 | US FAERS | |
| 117 | Dehydration | FAERS: 4 | OFFSIDES US FAERS | |
| 118 | Delirium | FAERS: 4 | 2007949 10402626 | CTD US FAERS |
| 119 | Dyspepsia | FAERS: 4 | SIDER US FAERS | |
| 120 | Erythema | FAERS: 4 | US FAERS | |
| 121 | Euphoric mood | FAERS: 4 | US FAERS | |
| 122 | Gastrointestinal sounds abnormal | FAERS: 4 | US FAERS | |
| 123 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 124 | Hypersensitivity | FAERS: 4 | SIDER US FAERS | |
| 125 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 126 | Intestinal Atresia | FAERS: 4 | US FAERS | |
| 127 | Mental status changes | FAERS: 4 | OFFSIDES US FAERS | |
| 128 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 129 | Muscle strain | FAERS: 4 | US FAERS | |
| 130 | Mydriasis | FAERS: 4 | US FAERS | |
| 131 | Product solubility abnormal | FAERS: 4 | US FAERS | |
| 132 | Unevaluable event | FAERS: 4 | US FAERS | |
| 133 | Abasia | FAERS: 3 | US FAERS | |
| 134 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 135 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 136 | Asthma | FAERS: 3 | US FAERS | |
| 137 | Clonus | FAERS: 3 | US FAERS | |
| 138 | Coma scale abnormal | FAERS: 3 | US FAERS | |
| 139 | Disorientation | FAERS: 3 | US FAERS | |
| 140 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 141 | Dysarthria | FAERS: 3 | US FAERS | |
| 142 | Dystonia | FAERS: 3 | US FAERS | |
| 143 | Dysuria | FAERS: 3 | US FAERS | |
| 144 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 145 | Hyperreflexia | FAERS: 3 | OFFSIDES US FAERS | |
| 146 | Lactose Intolerance | FAERS: 3 | US FAERS | |
| 147 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 148 | Pallor | FAERS: 3 | US FAERS | |
| 149 | Product complaint | FAERS: 3 | US FAERS | |
| 150 | QRS axis abnormal | FAERS: 3 | US FAERS | |
| 151 | Shock | FAERS: 3 | US FAERS | |
| 152 | Sinus rhythm | FAERS: 3 | US FAERS | |
| 153 | Sphincter of Oddi Dysfunction | FAERS: 3 | US FAERS | |
| 154 | Tongue biting | FAERS: 3 | US FAERS | |
| 155 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 156 | Weight decreased | FAERS: 3 | US FAERS | |
| 157 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 158 | Amylase increased | FAERS: 2 | US FAERS | |
| 159 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 160 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 161 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 162 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 163 | Blood magnesium decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 164 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 165 | Burning sensation | FAERS: 2 | US FAERS | |
| 166 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 167 | Cold sweat | FAERS: 2 | US FAERS | |
| 168 | Colonic Pseudo-Obstruction | FAERS: 2 | US FAERS | |
| 169 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 170 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 171 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 172 | Drug abuser | FAERS: 2 | US FAERS | |
| 173 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 174 | Drug diversion | FAERS: 2 | US FAERS | |
| 175 | Drug dose omission | FAERS: 2 | US FAERS | |
| 176 | Drug level above therapeutic | FAERS: 2 | US FAERS | |
| 177 | Dry lung syndrome | FAERS: 2 | US FAERS | |
| 178 | Dry skin | FAERS: 2 | US FAERS | |
| 179 | Electrocardiogram PQ interval prolonged | FAERS: 2 | US FAERS | |
| 180 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 181 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 182 | Hypokinesia | FAERS: 2 | US FAERS | |
| 183 | Incorrect product administration duration | FAERS: 2 | US FAERS | |
| 184 | Influenza | FAERS: 2 | US FAERS | |
| 185 | Joint stiffness | FAERS: 2 | US FAERS | |
| 186 | Leukocytosis | FAERS: 2 | US FAERS | |
| 187 | Lip swelling | FAERS: 2 | US FAERS | |
| 188 | Metabolic alkalosis | FAERS: 2 | US FAERS | |
| 189 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 190 | Myoclonus | FAERS: 2 | US FAERS | |
| 191 | Neobladder surgery | FAERS: 2 | US FAERS | |
| 192 | Nystagmus | FAERS: 2 | US FAERS | |
| 193 | Opisthotonus | FAERS: 2 | US FAERS | |
| 194 | Pharyngitis | FAERS: 2 | US FAERS | |
| 195 | Piloerection | FAERS: 2 | US FAERS | |
| 196 | Pre-Eclampsia | FAERS: 2 | US FAERS | |
| 197 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 198 | Presyncope | FAERS: 2 | US FAERS | |
| 199 | Product administration error | FAERS: 2 | US FAERS | |
| 200 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 201 | Product prescribing error | FAERS: 2 | US FAERS | |
| 202 | Product substitution issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Respiratory Failure | FAERS: 2 | OFFSIDES US FAERS | |
| 204 | Respiratory distress | FAERS: 2 | US FAERS | |
| 205 | Restlessness | FAERS: 2 | US FAERS | |
| 206 | Screaming | FAERS: 2 | US FAERS | |
| 207 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 208 | Sluggishness | FAERS: 2 | US FAERS | |
| 209 | Snoring | FAERS: 2 | US FAERS | |
| 210 | Stupor | FAERS: 2 | US FAERS | |
| 211 | Sudden death | FAERS: 2 | US FAERS | |
| 212 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 213 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 214 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 215 | Therapy change | FAERS: 2 | US FAERS | |
| 216 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 217 | Toxicologic test abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Vertigo | FAERS: 2 | US FAERS | |
| 219 | Visual Impairment | FAERS: 2 | US FAERS | |
| 220 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 221 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 222 | Accelerated Idioventricular Rhythm | FAERS: 1 | US FAERS | |
| 223 | Accidental death | FAERS: 1 | US FAERS | |
| 224 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 225 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 226 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 227 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 228 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 229 | Altered state of consciousness | FAERS: 1 | SIDER US FAERS | |
| 230 | Amblyopia | FAERS: 1 | US FAERS | |
| 231 | Amylase abnormal | FAERS: 1 | US FAERS | |
| 232 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 233 | Angioedema | FAERS: 1 | SIDER US FAERS | |
| 234 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 235 | Apparent death | FAERS: 1 | US FAERS | |
| 236 | Ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 237 | Asphyxia | FAERS: 1 | US FAERS | |
| 238 | Ataxia | FAERS: 1 | US FAERS | |
| 239 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 240 | Bedridden | FAERS: 1 | US FAERS | |
| 241 | Biliary Colic | FAERS: 1 | US FAERS | |
| 242 | Blood creatinine increased | FAERS: 1 | OFFSIDES US FAERS | |
| 243 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 244 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 245 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 246 | Catatonia | FAERS: 1 | US FAERS | |
| 247 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 248 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 249 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 250 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 251 | Diverticulitis | FAERS: 1 | US FAERS | |
| 252 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 253 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 254 | Drug resistance | FAERS: 1 | US FAERS | |
| 255 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 256 | Duodenostomy | FAERS: 1 | US FAERS | |
| 257 | Dysentery | FAERS: 1 | US FAERS | |
| 258 | Dysgraphia | FAERS: 1 | US FAERS | |
| 259 | Dysphonia | FAERS: 1 | OFFSIDES US FAERS | |
| 260 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 261 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 262 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 263 | Epilepsy | FAERS: 1 | US FAERS | |
| 264 | Epistaxis | FAERS: 1 | US FAERS | |
| 265 | Extra dose administered | FAERS: 1 | US FAERS | |
| 266 | Extremity contracture | FAERS: 1 | US FAERS | |
| 267 | Fat intolerance | FAERS: 1 | US FAERS | |
| 268 | Feeling Cold | FAERS: 1 | US FAERS | |
| 269 | Feeling jittery | FAERS: 1 | US FAERS | |
| 270 | Flushing | FAERS: 1 | US FAERS | |
| 271 | Food Poisoning | FAERS: 1 | US FAERS | |
| 272 | Gait inability | FAERS: 1 | US FAERS | |
| 273 | Gastritis | FAERS: 1 | US FAERS | |
| 274 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 275 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 276 | Gastrointestinal motility disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 278 | Gastroschisis | FAERS: 1 | US FAERS | |
| 279 | Glaucoma | FAERS: 1 | US FAERS | |
| 280 | Glossitis | FAERS: 1 | US FAERS | |
| 281 | Head titubation | FAERS: 1 | US FAERS | |
| 282 | Hunger | FAERS: 1 | US FAERS | |
| 283 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 284 | Hyperventilation | FAERS: 1 | US FAERS | |
| 285 | Incontinence | FAERS: 1 | US FAERS | |
| 286 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 287 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 288 | Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 289 | Inflammation | FAERS: 1 | US FAERS | |
| 290 | Intestinal Perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 291 | Intestinal villi atrophy | FAERS: 1 | US FAERS | |
| 292 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 293 | Joint swelling | FAERS: 1 | US FAERS | |
| 294 | Leukopenia | FAERS: 1 | US FAERS | |
| 295 | Limb injury | FAERS: 1 | US FAERS | |
| 296 | Lipase increased | FAERS: 1 | US FAERS | |
| 297 | Megacolon | FAERS: 1 | SIDER US FAERS | |
| 298 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 299 | Mouth swelling | FAERS: 1 | US FAERS | |
| 300 | Mutism | FAERS: 1 | US FAERS | |
| 301 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 302 | Negativism | FAERS: 1 | US FAERS | |
| 303 | Neutropenia | FAERS: 1 | US FAERS | |
| 304 | Night sweats | FAERS: 1 | US FAERS | |
| 305 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 306 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 307 | Onychoclasis | FAERS: 1 | US FAERS | |
| 308 | Oral pain | FAERS: 1 | US FAERS | |
| 309 | PCO2 increased | FAERS: 1 | US FAERS | |
| 310 | PO2 increased | FAERS: 1 | US FAERS | |
| 311 | Pain management | FAERS: 1 | US FAERS | |
| 312 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 313 | Panic Disorder | FAERS: 1 | US FAERS | |
| 314 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 315 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 316 | Personality Change | FAERS: 1 | US FAERS | |
| 317 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 318 | Physical product label issue | FAERS: 1 | US FAERS | |
| 319 | Pneumonia | FAERS: 1 | US FAERS | |
| 320 | Poisoning | FAERS: 1 | US FAERS | |
| 321 | Polyuria | FAERS: 1 | OFFSIDES US FAERS | |
| 322 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 323 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 324 | Product container issue | FAERS: 1 | US FAERS | |
| 325 | Product lot number issue | FAERS: 1 | US FAERS | |
| 326 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 327 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 328 | Product selection error | FAERS: 1 | US FAERS | |
| 329 | Product tampering | FAERS: 1 | US FAERS | |
| 330 | Productive Cough | FAERS: 1 | US FAERS | |
| 331 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 332 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 333 | Rash erythematous | FAERS: 1 | US FAERS | |
| 334 | Septic Shock | FAERS: 1 | US FAERS | |
| 335 | Skin laceration | FAERS: 1 | US FAERS | |
| 336 | Skin reaction | FAERS: 1 | US FAERS | |
| 337 | Skin test positive | FAERS: 1 | US FAERS | |
| 338 | Stomatitis | FAERS: 1 | US FAERS | |
| 339 | Stress | FAERS: 1 | US FAERS | |
| 340 | Swelling | FAERS: 1 | US FAERS | |
| 341 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 342 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 343 | Thirst | FAERS: 1 | US FAERS | |
| 344 | Unintentional use for unapproved indication | FAERS: 1 | US FAERS | |
| 345 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 346 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 347 | Waxy flexibility | FAERS: 1 | US FAERS | |
| 348 | Wrong dose | FAERS: 1 | US FAERS | |
| 349 | leiomyosarcoma | FAERS: 1 | US FAERS | |
| 350 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 351 | Abdominal Cramps | SIDER | ||
| 352 | Abdominal bloating | SIDER | ||
| 353 | Abdominal colic | SIDER | ||
| 354 | Acne | OFFSIDES | ||
| 355 | Acute diarrhea | SIDER | ||
| 356 | Adenocarcinoma | OFFSIDES | ||
| 357 | Alopecia | OFFSIDES | ||
| 358 | Anaphylactoid Reaction | SIDER | ||
| 359 | Anhedonia | OFFSIDES | ||
| 360 | Anorexia | OFFSIDES | ||
| 361 | Appendicitis | OFFSIDES | ||
| 362 | Arthritis | OFFSIDES | ||
| 363 | Atrial tachycardia | OFFSIDES | ||
| 364 | Bacterial sepsis | OFFSIDES | ||
| 365 | Blood alkaline phosphatase increased | OFFSIDES | ||
| 366 | Blood amylase decreased | OFFSIDES | ||
| 367 | Blood chloride decreased | OFFSIDES | ||
| 368 | Blood creatine phosphokinase MB abnormal | OFFSIDES | ||
| 369 | Blood glucose decreased | OFFSIDES | ||
| 370 | Blood iron decreased | OFFSIDES | ||
| 371 | Blood sodium | OFFSIDES | ||
| 372 | Breast tenderness | OFFSIDES | ||
| 373 | Bronchomalacia | OFFSIDES | ||
| 374 | Bullous eruption | SIDER | ||
| 375 | Bunion | OFFSIDES | ||
| 376 | Catheter site pain | OFFSIDES | ||
| 377 | Cerebral Thrombosis | OFFSIDES | ||
| 378 | Cirrhosis | OFFSIDES | ||
| 379 | Colitis | OFFSIDES | ||
| 380 | Confabulation | OFFSIDES | ||
| 381 | Congenital heart disease | OFFSIDES | ||
| 382 | Congenital tracheomalacia | OFFSIDES | ||
| 383 | Conjunctival deposit | OFFSIDES | ||
| 384 | Culture positive | OFFSIDES | ||
| 385 | Cytolytic hepatitis | OFFSIDES | ||
| 386 | Dental alveolar anomaly | OFFSIDES | ||
| 387 | Depressed mood | OFFSIDES | ||
| 388 | Depression suicidal | OFFSIDES | ||
| 389 | Dermatitis | SIDER | ||
| 390 | Diarrhea | CTD OFFSIDES | ||
| 391 | Distention | SIDER | ||
| 392 | Drowsiness | SIDER | ||
| 393 | Duodenal Ulcer | OFFSIDES | ||
| 394 | Edema, Cardiac | 30597669 | CTD | |
| 395 | Edema | 7508328 | CTD | |
| 396 | Emotional distress | OFFSIDES | ||
| 397 | Enteritis | OFFSIDES | ||
| 398 | Epigastric pain | SIDER | ||
| 399 | Erythema Multiforme | OFFSIDES SIDER | ||
| 400 | Escherichia infection | OFFSIDES | ||
| 401 | Febrile Neutropenia | OFFSIDES | ||
| 402 | Flank Pain | OFFSIDES | ||
| 403 | Gamma-Glutamyltransferase Increased | OFFSIDES | ||
| 404 | Gas Gangrene | OFFSIDES | ||
| 405 | Gastroenteritis | 17405350 | CTD OFFSIDES | |
| 406 | Genital erosion | OFFSIDES | ||
| 407 | Heat Stroke | OFFSIDES | ||
| 408 | Hepatitis C | OFFSIDES | ||
| 409 | Hidradenitis | OFFSIDES | ||
| 410 | Hypomania | OFFSIDES | ||
| 411 | Infusion site pruritus | OFFSIDES | ||
| 412 | Intestinal anastomosis complication | OFFSIDES | ||
| 413 | Kidney Failure | OFFSIDES | ||
| 414 | Laryngomalacia | OFFSIDES | ||
| 415 | Leukopenia neonatal | OFFSIDES | ||
| 416 | Lip erosion | OFFSIDES | ||
| 417 | Livedo Reticularis | OFFSIDES | ||
| 418 | Lymphoma | OFFSIDES | ||
| 419 | Malignant neoplasm progression | OFFSIDES | ||
| 420 | Mechanical ventilation | OFFSIDES | ||
| 421 | Mediastinal mass | OFFSIDES | ||
| 422 | Mesothelioma malignant advanced | OFFSIDES | ||
| 423 | Mucosal erosion | OFFSIDES | ||
| 424 | Multiple drug overdose | OFFSIDES | ||
| 425 | Multiple drug overdose intentional | OFFSIDES | ||
| 426 | Nasopharyngitis | OFFSIDES | ||
| 427 | Necrosis | 30597669 | CTD | |
| 428 | Negative thoughts | OFFSIDES | ||
| 429 | Nephrolithiasis | OFFSIDES | ||
| 430 | Nervous tension | OFFSIDES | ||
| 431 | Neutropenic sepsis | OFFSIDES | ||
| 432 | Oculomucocutaneous syndrome | OFFSIDES | ||
| 433 | Oliguria | OFFSIDES | ||
| 434 | Oxygen consumption decreased | OFFSIDES | ||
| 435 | Pancreatic Insufficiency | OFFSIDES | ||
| 436 | Pelvic mass | OFFSIDES | ||
| 437 | Pharyngolaryngeal discomfort | OFFSIDES | ||
| 438 | Portal venous gas | OFFSIDES | ||
| 439 | Post inflammatory pigmentation change | OFFSIDES | ||
| 440 | Protein total decreased | OFFSIDES | ||
| 441 | Right Ventricular Hypertrophy | OFFSIDES | ||
| 442 | Sarcoidosis | OFFSIDES | ||
| 443 | Scotoma | OFFSIDES | ||
| 444 | Seizures | 6870341 | CTD | |
| 445 | Sinus headache | OFFSIDES | ||
| 446 | Sinusitis | OFFSIDES | ||
| 447 | Skin Induration | OFFSIDES | ||
| 448 | Skin hypertrophy | OFFSIDES | ||
| 449 | Skin tightness | OFFSIDES | ||
| 450 | Stasis dermatitis | OFFSIDES | ||
| 451 | Stevens-Johnson Syndrome | 25811541 | CTD SIDER | |
| 452 | Supraventricular tachyarrhythmia | OFFSIDES | ||
| 453 | Thymic cancer metastatic | OFFSIDES | ||
| 454 | Toxic Epidermal Necrolysis | SIDER | ||
| 455 | Tracheostomy malfunction | OFFSIDES | ||
| 456 | Venous Insufficiency | OFFSIDES | ||
| 457 | Xerosis | OFFSIDES | ||
| 458 | prostatitis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.