Desvenlafaxine Succinate
(PWPDEXVGKDEKTE-UHFFFAOYSA-N)
Structure
- SMILES
- CN(CC(C1(O)CCCCC1)c1ccc(cc1)O)C.OC(=O)CCC(=O)O.O
- Molecular Formula:
- C20H33NO7
- Molecular Weight:
- 399.479
- Log P:
- 2.6041
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 5
- TPSA:
- 127.53
- CAS Number(s):
- 386750-22-7
Synonym(s)
1.
Desvenlafaxine Succinate
2.
2-(1-hydroxycyclohexyl)-2-((4-hydroxyphenyl)ethyl)dimethylammonium 3-carboxypropanoate monohydrate
3.
4-(2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl)phenol
4.
Desvenlafaxine
5.
O-desmethylvenlafaxine
6.
O-desmethylvenlafaxine Succinate
7.
O-desmethylvenlafaxine Succinate Monohydrate
8.
Pristiq
9.
WY 45,233
10.
WY 45233
11.
WY-45,233
12.
WY-45233
13.
45,233, WY
14.
45233, WY
15.
Monohydrate, O-desmethylvenlafaxine Succinate
16.
O desmethylvenlafaxine
17.
O desmethylvenlafaxine Succinate
18.
O desmethylvenlafaxine Succinate Monohydrate
19.
Succinate Monohydrate, O-desmethylvenlafaxine
20.
Succinate, Desvenlafaxine
21.
Succinate, O-desmethylvenlafaxine
22.
WY45,233
23.
WY45233
External Link(s)
| MeSH | D000069468 |
| PubChem Compound | 134715671 6918664 |
| KEGG | dr:D02570 |
| Therapeutic Target Database | D03CEF |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 677 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 639 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 558 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 4 | Headache | FAERS: 505 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 5 | Drug withdrawal syndrome | FAERS: 501 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Anxiety | FAERS: 417 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 7 | Feeling abnormal | FAERS: 396 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 8 | Fatigue | FAERS: 341 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 9 | Medication residue | FAERS: 327 | US FAERS | |
| 10 | Malaise | FAERS: 262 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 11 | Crying | FAERS: 175 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 12 | Somnolence | FAERS: 166 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Vomiting | FAERS: 160 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 14 | Tremor | FAERS: 158 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 15 | Agitation | FAERS: 136 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 16 | Nervousness | FAERS: 110 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 17 | Constipation | FAERS: 109 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Palpitations | FAERS: 107 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Asthenia | FAERS: 104 | US FAERS | |
| 20 | Depressed mood | FAERS: 97 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Anger | FAERS: 95 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Pain | FAERS: 90 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Alopecia | FAERS: 84 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Emotional disorder | FAERS: 81 | US FAERS | |
| 25 | Tinnitus | FAERS: 80 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Restlessness | FAERS: 76 | US FAERS | |
| 27 | Abdominal discomfort | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Unevaluable event | FAERS: 72 | US FAERS | |
| 29 | Completed Suicide | FAERS: 65 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 30 | Weight decreased | FAERS: 65 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 31 | Wrong technique in drug usage process | FAERS: 64 | US FAERS | |
| 32 | Apathy | FAERS: 63 | US FAERS | |
| 33 | Mydriasis | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Feeling jittery | FAERS: 61 | US FAERS | |
| 35 | Vertigo | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Pruritus | FAERS: 59 | US FAERS | |
| 37 | Urticaria | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Myalgia | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Drug screen false positive | FAERS: 50 | US FAERS | |
| 40 | Drug screen positive | FAERS: 49 | US FAERS | |
| 41 | Intentional drug misuse | FAERS: 49 | US FAERS | |
| 42 | Chest Pain | FAERS: 48 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 43 | Activities of daily living impaired | FAERS: 47 | US FAERS | |
| 44 | Blood cholesterol increased | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Memory impairment | FAERS: 46 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 46 | Visual Impairment | FAERS: 45 | US FAERS | |
| 47 | Suicide attempt | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Tachycardia | FAERS: 42 | US FAERS | |
| 49 | Sexual Dysfunction | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Psychiatric symptom | FAERS: 38 | US FAERS | |
| 51 | Amnesia | FAERS: 36 | US FAERS | |
| 52 | Tension | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Drug Dependence | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 54 | Arthralgia | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 55 | Lethargy | FAERS: 34 | US FAERS | |
| 56 | Feelings of worthlessness | FAERS: 33 | US FAERS | |
| 57 | Hypersensitivity | FAERS: 33 | US FAERS | |
| 58 | Negative thoughts | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 59 | Nonspecific reaction | FAERS: 30 | US FAERS | |
| 60 | Mood swings | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Stress | FAERS: 29 | US FAERS | |
| 62 | Chills | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Disorientation | FAERS: 28 | US FAERS | |
| 64 | Impaired work ability | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 65 | Abdominal Pain | FAERS: 27 | US FAERS | |
| 66 | Hypersomnia | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 67 | Dysgeusia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Night sweats | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 69 | Therapeutic response unexpected | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 70 | Dyspepsia | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Middle insomnia | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Drug dose omission | FAERS: 24 | US FAERS | |
| 73 | Impaired driving ability | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 74 | Myocardial Infarction | FAERS: 24 | US FAERS | |
| 75 | Back Pain | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Product quality issue | FAERS: 22 | US FAERS | |
| 77 | Restless Legs Syndrome | FAERS: 22 | US FAERS | |
| 78 | Syncope | FAERS: 22 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 79 | Influenza | FAERS: 21 | US FAERS | |
| 80 | Nasopharyngitis | FAERS: 21 | US FAERS | |
| 81 | Bipolar Disorder | FAERS: 20 | US FAERS | |
| 82 | Drug ineffective for unapproved indication | FAERS: 20 | US FAERS | |
| 83 | Paranoia | FAERS: 20 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 84 | Serotonin Syndrome | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 85 | Anorgasmia | FAERS: 18 | US FAERS | |
| 86 | Blood triglycerides increased | FAERS: 18 | US FAERS | |
| 87 | Bruxism | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Erythema | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Flatulence | FAERS: 18 | US FAERS | |
| 90 | Medication residue present | FAERS: 18 | US FAERS | |
| 91 | Urinary Retention | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Blood glucose increased | FAERS: 17 | US FAERS | |
| 93 | Dysuria | FAERS: 17 | US FAERS | |
| 94 | Erectile dysfunction | FAERS: 17 | US FAERS | |
| 95 | Hostility | FAERS: 17 | US FAERS | |
| 96 | Mental impairment | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 97 | Musculoskeletal stiffness | FAERS: 17 | US FAERS | |
| 98 | Chest discomfort | FAERS: 16 | US FAERS | |
| 99 | Discomfort | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Joint swelling | FAERS: 16 | US FAERS | |
| 101 | Muscle tightness | FAERS: 16 | US FAERS | |
| 102 | Poor quality sleep | FAERS: 16 | US FAERS | |
| 103 | Cerebrovascular accident | FAERS: 15 | US FAERS | |
| 104 | Drug effect incomplete | FAERS: 15 | US FAERS | |
| 105 | Epistaxis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Lip swelling | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Personality Change | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Hypotension | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 109 | Incorrect dose administered | FAERS: 14 | US FAERS | |
| 110 | Burning sensation | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 111 | Feeling Cold | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Glaucoma | FAERS: 13 | US FAERS | |
| 113 | Head discomfort | FAERS: 13 | US FAERS | |
| 114 | Dysarthria | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 115 | Fibromyalgia | FAERS: 11 | US FAERS | |
| 116 | Frustration | FAERS: 11 | US FAERS | |
| 117 | No adverse event | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Swelling | FAERS: 11 | US FAERS | |
| 119 | Tardive Dyskinesia | FAERS: 11 | US FAERS | |
| 120 | Drug exposure during pregnancy | FAERS: 10 | US FAERS | |
| 121 | Euphoric mood | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Gastric Bypass | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 123 | Menorrhagia | FAERS: 10 | US FAERS | |
| 124 | Neck Pain | FAERS: 10 | US FAERS | |
| 125 | Obesity | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 126 | Overdose | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Sinusitis | FAERS: 10 | US FAERS | |
| 128 | Yawning | FAERS: 10 | US FAERS | |
| 129 | Acne | FAERS: 9 | US FAERS | |
| 130 | Asphyxia | FAERS: 9 | US FAERS | |
| 131 | Cold sweat | FAERS: 9 | US FAERS | |
| 132 | Diplopia | FAERS: 9 | US FAERS | |
| 133 | Dissociation | FAERS: 9 | US FAERS | |
| 134 | Drug administration error | FAERS: 9 | US FAERS | |
| 135 | Eye pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Intentional product misuse | FAERS: 9 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 137 | Oropharyngeal pain | FAERS: 9 | US FAERS | |
| 138 | Photophobia | FAERS: 9 | US FAERS | |
| 139 | Pneumonia | FAERS: 9 | US FAERS | |
| 140 | Rash erythematous | FAERS: 9 | US FAERS | |
| 141 | Tachyphrenia | FAERS: 9 | US FAERS | |
| 142 | Alanine Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 143 | Angioedema | FAERS: 8 | US FAERS | |
| 144 | Aphasia | FAERS: 8 | US FAERS | |
| 145 | Arthropathy | FAERS: 8 | US FAERS | |
| 146 | Blindness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Blood glucose decreased | FAERS: 8 | US FAERS | |
| 148 | Dehydration | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Emotional distress | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Formication | FAERS: 8 | US FAERS | |
| 151 | Hunger | FAERS: 8 | US FAERS | |
| 152 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 153 | Malabsorption | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Mental status changes | FAERS: 8 | US FAERS | |
| 155 | Musculoskeletal Pain | FAERS: 8 | US FAERS | |
| 156 | Presyncope | FAERS: 8 | US FAERS | |
| 157 | Sluggishness | FAERS: 8 | US FAERS | |
| 158 | Stomatitis | FAERS: 8 | US FAERS | |
| 159 | jaundice | FAERS: 8 | US FAERS | |
| 160 | Abasia | FAERS: 7 | US FAERS | |
| 161 | Accidental overdose | FAERS: 7 | US FAERS | |
| 162 | Bedridden | FAERS: 7 | US FAERS | |
| 163 | Expired drug administered | FAERS: 7 | US FAERS | |
| 164 | Flat affect | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 165 | Flushing | FAERS: 7 | US FAERS | |
| 166 | Hyperacusis | FAERS: 7 | US FAERS | |
| 167 | Inflammation | FAERS: 7 | US FAERS | |
| 168 | Initial insomnia | FAERS: 7 | US FAERS | |
| 169 | Joint injury | FAERS: 7 | US FAERS | |
| 170 | Multiple Sclerosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Panic Disorder | FAERS: 7 | US FAERS | |
| 172 | Product formulation issue | FAERS: 7 | US FAERS | |
| 173 | Thrombosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Urinary hesitation | FAERS: 7 | US FAERS | |
| 175 | Violence-related symptom | FAERS: 7 | US FAERS | |
| 176 | Accidental drug intake by child | FAERS: 6 | US FAERS | |
| 177 | Akathisia | FAERS: 6 | US FAERS | |
| 178 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 179 | Neutropenia | FAERS: 6 | US FAERS | |
| 180 | Obsessive thoughts | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Obsessive-Compulsive Disorder | FAERS: 6 | US FAERS | |
| 182 | Pancreatitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Sjogren's Syndrome | FAERS: 6 | US FAERS | |
| 184 | Somnambulism | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 185 | Throat irritation | FAERS: 6 | US FAERS | |
| 186 | nervous system disorder | FAERS: 6 | US FAERS | |
| 187 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 188 | Asthenopia | FAERS: 5 | US FAERS | |
| 189 | Atrial Fibrillation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Blood testosterone decreased | FAERS: 5 | US FAERS | |
| 191 | Bronchitis | FAERS: 5 | US FAERS | |
| 192 | Cataract | FAERS: 5 | US FAERS | |
| 193 | Cheilitis | FAERS: 5 | US FAERS | |
| 194 | Dysphonia | FAERS: 5 | US FAERS | |
| 195 | Dystonia | FAERS: 5 | US FAERS | |
| 196 | Feeling of body temperature change | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 197 | Hypothyroidism | FAERS: 5 | US FAERS | |
| 198 | Impatience | FAERS: 5 | US FAERS | |
| 199 | Maternal exposure during pregnancy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Myoclonus | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Product use in unapproved indication | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 202 | Sinus headache | FAERS: 5 | US FAERS | |
| 203 | Trismus | FAERS: 5 | US FAERS | |
| 204 | Alcohol interaction | FAERS: 4 | US FAERS | |
| 205 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 206 | Angle Closure Glaucoma | FAERS: 4 | US FAERS | |
| 207 | Anhedonia | FAERS: 4 | US FAERS | |
| 208 | Anorexia | FAERS: 4 | US FAERS | |
| 209 | Aphagia | FAERS: 4 | US FAERS | |
| 210 | Arthritis | FAERS: 4 | US FAERS | |
| 211 | Back disorder | FAERS: 4 | US FAERS | |
| 212 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 213 | Blood prolactin increased | FAERS: 4 | US FAERS | |
| 214 | Blood urine present | FAERS: 4 | US FAERS | |
| 215 | Bone pain | FAERS: 4 | US FAERS | |
| 216 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 217 | Bradycardia | FAERS: 4 | US FAERS | |
| 218 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 219 | Delirium | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Dependence | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Depression suicidal | FAERS: 4 | US FAERS | |
| 222 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 223 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 224 | Dysphemia | FAERS: 4 | US FAERS | |
| 225 | Epilepsy | FAERS: 4 | US FAERS | |
| 226 | Gastrointestinal Pain | FAERS: 4 | US FAERS | |
| 227 | Gout | FAERS: 4 | US FAERS | |
| 228 | Hepatitis | FAERS: 4 | US FAERS | |
| 229 | Hypoaesthesia facial | FAERS: 4 | US FAERS | |
| 230 | Hypomania | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 231 | Impaired gastric emptying | FAERS: 4 | US FAERS | |
| 232 | Incontinence | FAERS: 4 | US FAERS | |
| 233 | Low density lipoprotein increased | FAERS: 4 | US FAERS | |
| 234 | Male sexual dysfunction | FAERS: 4 | US FAERS | |
| 235 | Medication Error | FAERS: 4 | US FAERS | |
| 236 | Motion Sickness | FAERS: 4 | US FAERS | |
| 237 | Nephrolithiasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 239 | Product container issue | FAERS: 4 | US FAERS | |
| 240 | Product solubility abnormal | FAERS: 4 | US FAERS | |
| 241 | Quality of life decreased | FAERS: 4 | US FAERS | |
| 242 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 243 | Screaming | FAERS: 4 | US FAERS | |
| 244 | Skin laceration | FAERS: 4 | US FAERS | |
| 245 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 246 | Amphetamines positive | FAERS: 3 | US FAERS | |
| 247 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 248 | Autoimmune thyroiditis | FAERS: 3 | US FAERS | |
| 249 | Bipolar I disorder | FAERS: 3 | US FAERS | |
| 250 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 251 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 252 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 253 | Choking sensation | FAERS: 3 | US FAERS | |
| 254 | Choking | FAERS: 3 | US FAERS | |
| 255 | Drug abuser | FAERS: 3 | US FAERS | |
| 256 | Drug abuse | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 257 | Economic problem | FAERS: 3 | US FAERS | |
| 258 | Elevated mood | FAERS: 3 | US FAERS | |
| 259 | Endodontic procedure | FAERS: 3 | US FAERS | |
| 260 | Facial Pain | FAERS: 3 | US FAERS | |
| 261 | False positive investigation result | FAERS: 3 | US FAERS | |
| 262 | Food craving | FAERS: 3 | US FAERS | |
| 263 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 264 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 265 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 266 | Inappropriate affect | FAERS: 3 | US FAERS | |
| 267 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 268 | Libido disorder | FAERS: 3 | US FAERS | |
| 269 | Limb discomfort | FAERS: 3 | US FAERS | |
| 270 | Loss of personal independence in daily activities | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 271 | Menopause | FAERS: 3 | US FAERS | |
| 272 | Musculoskeletal discomfort | FAERS: 3 | US FAERS | |
| 273 | Oral pain | FAERS: 3 | US FAERS | |
| 274 | Pain of skin | FAERS: 3 | US FAERS | |
| 275 | Pallor | FAERS: 3 | US FAERS | |
| 276 | Poisoning | FAERS: 3 | US FAERS | |
| 277 | Polyuria | FAERS: 3 | US FAERS | |
| 278 | Post-Traumatic Stress Disorder | FAERS: 3 | US FAERS | |
| 279 | Psoriasis | FAERS: 3 | US FAERS | |
| 280 | Pulmonary Embolism | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 282 | Rebound effect | FAERS: 3 | US FAERS | |
| 283 | Renal mass | FAERS: 3 | US FAERS | |
| 284 | Retching | FAERS: 3 | US FAERS | |
| 285 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 286 | Skin necrosis | FAERS: 3 | US FAERS | |
| 287 | Skin reaction | FAERS: 3 | US FAERS | |
| 288 | Staring | FAERS: 3 | US FAERS | |
| 289 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 290 | Tension Headache | FAERS: 3 | US FAERS | |
| 291 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 292 | Urine flow decreased | FAERS: 3 | US FAERS | |
| 293 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 294 | Adnexa uteri pain | FAERS: 2 | US FAERS | |
| 295 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 296 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 297 | Anosmia | FAERS: 2 | US FAERS | |
| 298 | Apparent death | FAERS: 2 | US FAERS | |
| 299 | Asthma | FAERS: 2 | US FAERS | |
| 300 | Ataxia | FAERS: 2 | US FAERS | |
| 301 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 302 | Blepharospasm | FAERS: 2 | US FAERS | |
| 303 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 304 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 305 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 306 | Breast tenderness | FAERS: 2 | US FAERS | |
| 307 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 308 | Chromaturia | FAERS: 2 | US FAERS | |
| 309 | Clumsiness | FAERS: 2 | US FAERS | |
| 310 | Deafness | FAERS: 2 | US FAERS | |
| 311 | Disease recurrence | FAERS: 2 | US FAERS | |
| 312 | Dreamy state | FAERS: 2 | US FAERS | |
| 313 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 314 | Drug screen negative | FAERS: 2 | US FAERS | |
| 315 | Dry skin | FAERS: 2 | US FAERS | |
| 316 | Ear discomfort | FAERS: 2 | US FAERS | |
| 317 | Ecchymosis | FAERS: 2 | US FAERS | |
| 318 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 319 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 320 | Eructation | FAERS: 2 | US FAERS | |
| 321 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 322 | Exophthalmos | FAERS: 2 | US FAERS | |
| 323 | Eye irritation | FAERS: 2 | US FAERS | |
| 324 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 325 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 326 | Hepatitis C | FAERS: 2 | US FAERS | |
| 327 | Hyperphagia | FAERS: 2 | US FAERS | |
| 328 | Hypertensive crisis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 329 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 330 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 331 | Joint stiffness | FAERS: 2 | US FAERS | |
| 332 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 333 | Laryngitis | FAERS: 2 | US FAERS | |
| 334 | Limb injury | FAERS: 2 | US FAERS | |
| 335 | Muscle Rigidity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 336 | Myopia | FAERS: 2 | US FAERS | |
| 337 | Nerve injury | FAERS: 2 | US FAERS | |
| 338 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 339 | Nocturia | FAERS: 2 | US FAERS | |
| 340 | Oculogyric crisis | FAERS: 2 | US FAERS | |
| 341 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 342 | Overweight | FAERS: 2 | US FAERS | |
| 343 | Partner stress | FAERS: 2 | US FAERS | |
| 344 | Platelet function test abnormal | FAERS: 2 | US FAERS | |
| 345 | Pre-existing condition improved | FAERS: 2 | US FAERS | |
| 346 | Product label issue | FAERS: 2 | US FAERS | |
| 347 | Product residue present | FAERS: 2 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 348 | Product size issue | FAERS: 2 | US FAERS | |
| 349 | Prostatic pain | FAERS: 2 | US FAERS | |
| 350 | Radiation necrosis | FAERS: 2 | US FAERS | |
| 351 | Shock | FAERS: 2 | US FAERS | |
| 352 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 353 | Skin irritation | FAERS: 2 | US FAERS | |
| 354 | Spinal column injury | FAERS: 2 | US FAERS | |
| 355 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 356 | Suppressed lactation | FAERS: 2 | US FAERS | |
| 357 | Tablet physical issue | FAERS: 2 | US FAERS | |
| 358 | Tachyphylaxis | FAERS: 2 | US FAERS | |
| 359 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 360 | Thirst | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 361 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 362 | Toothache | FAERS: 2 | US FAERS | |
| 363 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 364 | Uterine spasm | FAERS: 2 | US FAERS | |
| 365 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 366 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 367 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 368 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 369 | Abscess | FAERS: 1 | US FAERS | |
| 370 | Abulia | FAERS: 1 | US FAERS | |
| 371 | Accidental death | FAERS: 1 | US FAERS | |
| 372 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 373 | Adverse event | FAERS: 1 | US FAERS | |
| 374 | Ageusia | FAERS: 1 | US FAERS | |
| 375 | Agoraphobia | FAERS: 1 | US FAERS | |
| 376 | Alcohol problem | FAERS: 1 | US FAERS | |
| 377 | Alcohol test false positive | FAERS: 1 | US FAERS | |
| 378 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 379 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 380 | Amblyopia | FAERS: 1 | US FAERS | |
| 381 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 382 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 383 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 384 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 385 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 386 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 387 | Autoscopy | FAERS: 1 | US FAERS | |
| 388 | Aversion | FAERS: 1 | US FAERS | |
| 389 | Belligerence | FAERS: 1 | US FAERS | |
| 390 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 391 | Biotin deficiency | FAERS: 1 | US FAERS | |
| 392 | Blepharopachynsis | FAERS: 1 | US FAERS | |
| 393 | Blood blister | FAERS: 1 | US FAERS | |
| 394 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 395 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 396 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 397 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 398 | Blood iron increased | FAERS: 1 | US FAERS | |
| 399 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 400 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 401 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 402 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 403 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 404 | Breast engorgement | FAERS: 1 | US FAERS | |
| 405 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 406 | Bursitis | FAERS: 1 | US FAERS | |
| 407 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 408 | Cellulitis | FAERS: 1 | US FAERS | |
| 409 | Claustrophobia | FAERS: 1 | US FAERS | |
| 410 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 411 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 412 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 413 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 414 | Contact lens complication | FAERS: 1 | US FAERS | |
| 415 | Conversion disorder | FAERS: 1 | US FAERS | |
| 416 | Cystitis | FAERS: 1 | US FAERS | |
| 417 | Cyst | FAERS: 1 | US FAERS | |
| 418 | Dehydroepiandrosterone decreased | FAERS: 1 | US FAERS | |
| 419 | Dementia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 420 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 421 | Disability | FAERS: 1 | US FAERS | |
| 422 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 423 | Drooling | FAERS: 1 | US FAERS | |
| 424 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 425 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 426 | Drug effect variable | FAERS: 1 | US FAERS | |
| 427 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 428 | Drug half-life reduced | FAERS: 1 | US FAERS | |
| 429 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 430 | Dysentery | FAERS: 1 | US FAERS | |
| 431 | Dysgraphia | FAERS: 1 | US FAERS | |
| 432 | Dyspareunia | FAERS: 1 | US FAERS | |
| 433 | Eczema | FAERS: 1 | US FAERS | |
| 434 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 435 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 436 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 437 | Emotional poverty | FAERS: 1 | US FAERS | |
| 438 | Epinephrine increased | FAERS: 1 | US FAERS | |
| 439 | Erection increased | FAERS: 1 | US FAERS | |
| 440 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 441 | Excessive sexual fantasies | FAERS: 1 | US FAERS | |
| 442 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 443 | Extra dose administered | FAERS: 1 | US FAERS | |
| 444 | Eye Infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 445 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 446 | Factor VIII Deficiency | FAERS: 1 | US FAERS | |
| 447 | False negative investigation result | FAERS: 1 | US FAERS | |
| 448 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 449 | Flank Pain | FAERS: 1 | US FAERS | |
| 450 | Food Allergy | FAERS: 1 | US FAERS | |
| 451 | Fracture | FAERS: 1 | US FAERS | |
| 452 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 453 | Gastritis | FAERS: 1 | US FAERS | |
| 454 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 455 | Gastrointestinal stoma complication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Genital Herpes | FAERS: 1 | US FAERS | |
| 457 | Genital discomfort | FAERS: 1 | US FAERS | |
| 458 | Genital pain | FAERS: 1 | US FAERS | |
| 459 | Gingivitis | FAERS: 1 | US FAERS | |
| 460 | Grief reaction | FAERS: 1 | US FAERS | |
| 461 | Hand-eye coordination impaired | FAERS: 1 | US FAERS | |
| 462 | Head titubation | FAERS: 1 | US FAERS | |
| 463 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 464 | Hernia | FAERS: 1 | US FAERS | |
| 465 | Homicide | FAERS: 1 | US FAERS | |
| 466 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 467 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 468 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 469 | Hypokinesia | FAERS: 1 | US FAERS | |
| 470 | Hypoxia | FAERS: 1 | US FAERS | |
| 471 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 472 | Incoherent | FAERS: 1 | US FAERS | |
| 473 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 474 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 475 | Infarction | FAERS: 1 | US FAERS | |
| 476 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 477 | Injury associated with device | FAERS: 1 | US FAERS | |
| 478 | Intentional product use issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 479 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 480 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 481 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 482 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 483 | Joint destruction | FAERS: 1 | US FAERS | |
| 484 | Keratitis | FAERS: 1 | US FAERS | |
| 485 | Laceration | FAERS: 1 | US FAERS | |
| 486 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 487 | Laziness | FAERS: 1 | US FAERS | |
| 488 | Leukopenia | FAERS: 1 | US FAERS | |
| 489 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 490 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 491 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 492 | Lymphoma | FAERS: 1 | US FAERS | |
| 493 | Male Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 494 | Mastitis | FAERS: 1 | US FAERS | |
| 495 | Mastoiditis | FAERS: 1 | US FAERS | |
| 496 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 497 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 498 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 499 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 500 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 501 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 502 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 503 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 504 | Narcolepsy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Neuralgia | FAERS: 1 | US FAERS | |
| 506 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 507 | Norepinephrine decreased | FAERS: 1 | US FAERS | |
| 508 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 509 | Oliguria | FAERS: 1 | US FAERS | |
| 510 | Onychoclasis | FAERS: 1 | US FAERS | |
| 511 | Opiates positive | FAERS: 1 | US FAERS | |
| 512 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 513 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 514 | Paranoid Personality Disorder | FAERS: 1 | US FAERS | |
| 515 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 516 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 517 | Penile size reduced | FAERS: 1 | US FAERS | |
| 518 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 519 | Phobia of driving | FAERS: 1 | US FAERS | |
| 520 | Piloerection | FAERS: 1 | US FAERS | |
| 521 | Plastic surgery to the face | FAERS: 1 | US FAERS | |
| 522 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 523 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 524 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 525 | Poverty of speech | FAERS: 1 | US FAERS | |
| 526 | Pregnancy | FAERS: 1 | US FAERS | |
| 527 | Pressure of speech | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 528 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 529 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 530 | Product physical issue | FAERS: 1 | US FAERS | |
| 531 | Product shape issue | FAERS: 1 | US FAERS | |
| 532 | Product substitution issue | FAERS: 1 | US FAERS | |
| 533 | Product use issue | FAERS: 1 | US FAERS | |
| 534 | Productive Cough | FAERS: 1 | US FAERS | |
| 535 | Protein urine present | FAERS: 1 | US FAERS | |
| 536 | Proteinuria | FAERS: 1 | US FAERS | |
| 537 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 538 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 539 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 540 | Regurgitation | FAERS: 1 | US FAERS | |
| 541 | Renal cyst | FAERS: 1 | US FAERS | |
| 542 | Renal pain | FAERS: 1 | US FAERS | |
| 543 | Renal vessel congenital anomaly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 544 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 545 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 546 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 547 | Rosacea | FAERS: 1 | US FAERS | |
| 548 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 549 | Saliva altered | FAERS: 1 | US FAERS | |
| 550 | Schizophrenia | FAERS: 1 | US FAERS | |
| 551 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 552 | Sinus operation | FAERS: 1 | US FAERS | |
| 553 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 554 | Skin lesion | FAERS: 1 | US FAERS | |
| 555 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 556 | Sleep Talking | FAERS: 1 | US FAERS | |
| 557 | Slow speech | FAERS: 1 | US FAERS | |
| 558 | Sperm concentration abnormal | FAERS: 1 | US FAERS | |
| 559 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 560 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 561 | Spinal rod insertion | FAERS: 1 | US FAERS | |
| 562 | Stupor | FAERS: 1 | US FAERS | |
| 563 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 564 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 565 | Suspected counterfeit product | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 566 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 567 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 568 | Therapeutic reaction time decreased | FAERS: 1 | US FAERS | |
| 569 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 570 | Therapy non-responder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 571 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 572 | Thermal burn | FAERS: 1 | US FAERS | |
| 573 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 574 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 575 | Tobacco user | FAERS: 1 | US FAERS | |
| 576 | Tobacco withdrawal symptoms | FAERS: 1 | US FAERS | |
| 577 | Toxicity to various agents | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 578 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 579 | Ulcer | FAERS: 1 | US FAERS | |
| 580 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 581 | Urethral discharge | FAERS: 1 | US FAERS | |
| 582 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 583 | Urine osmolarity decreased | FAERS: 1 | US FAERS | |
| 584 | Uveitis | FAERS: 1 | US FAERS | |
| 585 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 586 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 587 | Vascular pain | FAERS: 1 | US FAERS | |
| 588 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 589 | Visual brightness | FAERS: 1 | US FAERS | |
| 590 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 591 | heart rate | FAERS: 1 | US FAERS | |
| 592 | Antidepressant drug clearance decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 593 | Borderline Personality Disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 594 | Decreased eye contact | Canada Vigilance: 2 | Canada Vigilance | |
| 595 | Dermatomyositis | Canada Vigilance: 1 | Canada Vigilance | |
| 596 | Executive dysfunction | Canada Vigilance: 2 | Canada Vigilance | |
| 597 | Foreign body in respiratory tract | Canada Vigilance: 1 | Canada Vigilance | |
| 598 | Hallucinations, mixed | Canada Vigilance: 2 | Canada Vigilance | |
| 599 | Increased viscosity of bronchial secretion | Canada Vigilance: 1 | Canada Vigilance | |
| 600 | Prescribed overdose | Canada Vigilance: 3 | Canada Vigilance | |
| 601 | Product dose omission | Canada Vigilance: 2 | Canada Vigilance | |
| 602 | Product prescribing error | Canada Vigilance: 1 | Canada Vigilance | |
| 603 | Respiratory tract irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 604 | Therapy change | Canada Vigilance: 2 | Canada Vigilance | |
| 605 | Wrong technique in product usage process | Canada Vigilance: 1 | Canada Vigilance | |
| 606 | treatment failure | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.