Restasis
(PMATZTZNYRCHOR-KMSBSJHKSA-N)
Structure
- SMILES
- C/C=C/C[C@H]([C@H](C1C(=O)NC(CC)C(=O)N(C)CC(=O)N(C)C(CC(C)C)C(=O)NC(C(C)C)C(=O)N(C)C(CC(C)C)C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)O)C
- Molecular Formula:
- C62H111N11O12
- Molecular Weight:
- 1202.610
- Log P:
- 4.1495
- Hydrogen Bond Acceptor:
- 23
- Hydrogen Bond Donor:
- 5
- TPSA:
- 278.8
- CAS Number(s):
- 79217-60-0
Synonym(s)
1.
Restasis
External Link(s)
| PubChem Compound | 6435893 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 2319 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 876 Canada Vigilance: 31 | Canada Vigilance US FAERS | |
| 3 | Eye pain | FAERS: 838 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Product container issue | FAERS: 422 | US FAERS | |
| 5 | Foreign body sensation in eyes | FAERS: 339 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Incorrect dose administered | FAERS: 327 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Product dose omission | FAERS: 275 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Drug dose omission | FAERS: 260 | US FAERS | |
| 9 | Inappropriate schedule of drug administration | FAERS: 257 | US FAERS | |
| 10 | Accidental exposure to product | FAERS: 238 | US FAERS | |
| 11 | Wrong technique in product usage process | FAERS: 227 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Headache | FAERS: 198 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Multiple use of single-use product | FAERS: 142 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Product storage error | FAERS: 133 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Visual Impairment | FAERS: 115 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Cataract | FAERS: 109 | US FAERS | |
| 17 | Ocular discomfort | FAERS: 108 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Instillation site pain | FAERS: 105 | US FAERS | |
| 19 | Incorrect product storage | FAERS: 102 | US FAERS | |
| 20 | Expired product administered | FAERS: 99 | US FAERS | |
| 21 | Dizziness | FAERS: 98 | US FAERS | |
| 22 | Product dropper issue | FAERS: 95 | US FAERS | |
| 23 | Burning sensation | FAERS: 93 | US FAERS | |
| 24 | Erythema | FAERS: 93 | US FAERS | |
| 25 | Photophobia | FAERS: 90 | US FAERS | |
| 26 | Pruritus | FAERS: 86 | US FAERS | |
| 27 | Product packaging quantity issue | FAERS: 85 | US FAERS | |
| 28 | Hypersensitivity | FAERS: 80 | US FAERS | |
| 29 | Pain | FAERS: 74 | US FAERS | |
| 30 | Superficial injury of eye | FAERS: 66 | US FAERS | |
| 31 | Eye Infection | FAERS: 62 | US FAERS | |
| 32 | Asthenopia | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Nausea | FAERS: 49 | US FAERS | |
| 34 | Dysgeusia | FAERS: 48 | US FAERS | |
| 35 | Inappropriate schedule of product administration | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Product use complaint | FAERS: 43 | US FAERS | |
| 37 | Eye inflammation | FAERS: 42 | US FAERS | |
| 38 | Product quality issue | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Vitreous floaters | FAERS: 32 | US FAERS | |
| 40 | Oropharyngeal pain | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Alopecia | FAERS: 28 | US FAERS | |
| 42 | Blepharitis | FAERS: 28 | US FAERS | |
| 43 | Dry skin | FAERS: 28 | US FAERS | |
| 44 | Intentional product misuse | FAERS: 27 | US FAERS | |
| 45 | Urticaria | FAERS: 27 | US FAERS | |
| 46 | Malaise | FAERS: 25 | US FAERS | |
| 47 | Epistaxis | FAERS: 24 | US FAERS | |
| 48 | Feeling abnormal | FAERS: 24 | US FAERS | |
| 49 | Diplopia | FAERS: 23 | US FAERS | |
| 50 | Dysphonia | FAERS: 22 | US FAERS | |
| 51 | Application site pain | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Fatigue | FAERS: 21 | US FAERS | |
| 53 | Glaucoma | FAERS: 21 | US FAERS | |
| 54 | Throat irritation | FAERS: 21 | US FAERS | |
| 55 | Wrong technique in drug usage process | FAERS: 21 | US FAERS | |
| 56 | Adverse event | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Eyelids pruritus | FAERS: 20 | US FAERS | |
| 58 | Product packaging issue | FAERS: 20 | US FAERS | |
| 59 | Eyelid irritation | FAERS: 19 | US FAERS | |
| 60 | Therapeutic response unexpected | FAERS: 19 | US FAERS | |
| 61 | Conjunctivitis | FAERS: 18 | US FAERS | |
| 62 | Nasopharyngitis | FAERS: 18 | US FAERS | |
| 63 | Product prescribing error | FAERS: 18 | US FAERS | |
| 64 | Tinnitus | FAERS: 18 | US FAERS | |
| 65 | Drug administration error | FAERS: 17 | US FAERS | |
| 66 | Product use issue | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 67 | Sinusitis | FAERS: 17 | US FAERS | |
| 68 | Excessive eye blinking | FAERS: 16 | US FAERS | |
| 69 | Eyelid pain | FAERS: 16 | US FAERS | |
| 70 | Incorrect dose administered by product | FAERS: 16 | US FAERS | |
| 71 | Medication Error | FAERS: 16 | US FAERS | |
| 72 | Cerebrovascular accident | FAERS: 15 | US FAERS | |
| 73 | Skin irritation | FAERS: 15 | US FAERS | |
| 74 | Lacrimation decreased | FAERS: 14 | US FAERS | |
| 75 | Palpitations | FAERS: 14 | US FAERS | |
| 76 | Rash erythematous | FAERS: 14 | US FAERS | |
| 77 | Tremor | FAERS: 14 | US FAERS | |
| 78 | Hordeolum | FAERS: 13 | US FAERS | |
| 79 | Lip swelling | FAERS: 13 | US FAERS | |
| 80 | Vertigo | FAERS: 13 | US FAERS | |
| 81 | Back Pain | FAERS: 12 | US FAERS | |
| 82 | Expired drug administered | FAERS: 12 | US FAERS | |
| 83 | Macular degeneration | FAERS: 12 | US FAERS | |
| 84 | Upper-airway cough syndrome | FAERS: 12 | US FAERS | |
| 85 | Abdominal discomfort | FAERS: 11 | US FAERS | |
| 86 | Anxiety | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Arthralgia | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 88 | Discomfort | FAERS: 10 | US FAERS | |
| 89 | Drug prescribing error | FAERS: 10 | US FAERS | |
| 90 | Eye allergy | FAERS: 10 | US FAERS | |
| 91 | Liquid product physical issue | FAERS: 10 | US FAERS | |
| 92 | Paranasal sinus hypersecretion | FAERS: 10 | US FAERS | |
| 93 | Pneumonia | FAERS: 10 | US FAERS | |
| 94 | Secretion discharge | FAERS: 10 | US FAERS | |
| 95 | Chest discomfort | FAERS: 9 | US FAERS | |
| 96 | Drug administered at inappropriate site | FAERS: 9 | US FAERS | |
| 97 | Eye complication associated with device | FAERS: 9 | US FAERS | |
| 98 | Eyelid margin crusting | FAERS: 9 | US FAERS | |
| 99 | Nasal discomfort | FAERS: 9 | US FAERS | |
| 100 | Neck Pain | FAERS: 9 | US FAERS | |
| 101 | Poor quality drug administered | FAERS: 9 | US FAERS | |
| 102 | Product physical consistency issue | FAERS: 9 | US FAERS | |
| 103 | Sinus headache | FAERS: 9 | US FAERS | |
| 104 | Ageusia | FAERS: 8 | US FAERS | |
| 105 | Blepharospasm | FAERS: 8 | US FAERS | |
| 106 | Corneal erosion | FAERS: 8 | US FAERS | |
| 107 | Eye Burns | FAERS: 8 | US FAERS | |
| 108 | Eyelid exfoliation | FAERS: 8 | US FAERS | |
| 109 | Facial Pain | FAERS: 8 | US FAERS | |
| 110 | Intentional dose omission | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Keratomileusis | FAERS: 8 | US FAERS | |
| 112 | Retinal Detachment | FAERS: 8 | US FAERS | |
| 113 | Sneezing | FAERS: 8 | US FAERS | |
| 114 | Somnolence | FAERS: 8 | US FAERS | |
| 115 | Blindness | FAERS: 7 | US FAERS | |
| 116 | Blood glucose increased | FAERS: 7 | US FAERS | |
| 117 | Bronchitis | FAERS: 7 | US FAERS | |
| 118 | Cataract operation | FAERS: 7 | US FAERS | |
| 119 | Nervousness | FAERS: 7 | US FAERS | |
| 120 | Overdose | FAERS: 7 | US FAERS | |
| 121 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 122 | Sjogren's Syndrome | FAERS: 7 | US FAERS | |
| 123 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 124 | Vomiting | FAERS: 7 | US FAERS | |
| 125 | Acne | FAERS: 6 | US FAERS | |
| 126 | Anosmia | FAERS: 6 | US FAERS | |
| 127 | Asthenia | FAERS: 6 | US FAERS | |
| 128 | Back disorder | FAERS: 6 | US FAERS | |
| 129 | Chills | FAERS: 6 | US FAERS | |
| 130 | Hypotension | FAERS: 6 | US FAERS | |
| 131 | Joint injury | FAERS: 6 | US FAERS | |
| 132 | Keratitis | FAERS: 6 | US FAERS | |
| 133 | Lacrimal duct procedure | FAERS: 6 | US FAERS | |
| 134 | Packaging design issue | FAERS: 6 | US FAERS | |
| 135 | Pregnancy | FAERS: 6 | US FAERS | |
| 136 | Product label issue | FAERS: 6 | US FAERS | |
| 137 | Punctate keratitis | FAERS: 6 | US FAERS | |
| 138 | Rheumatoid Arthritis | FAERS: 6 | US FAERS | |
| 139 | Stomatitis | FAERS: 6 | US FAERS | |
| 140 | Swelling | FAERS: 6 | US FAERS | |
| 141 | White blood cell count decreased | FAERS: 6 | US FAERS | |
| 142 | Amnesia | FAERS: 5 | US FAERS | |
| 143 | Arthritis | FAERS: 5 | US FAERS | |
| 144 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 145 | Corneal Scar | FAERS: 5 | US FAERS | |
| 146 | Ear discomfort | FAERS: 5 | US FAERS | |
| 147 | Eyelid skin dryness | FAERS: 5 | US FAERS | |
| 148 | Increased upper airway secretion | FAERS: 5 | US FAERS | |
| 149 | Instillation site erythema | FAERS: 5 | US FAERS | |
| 150 | Instillation site irritation | FAERS: 5 | US FAERS | |
| 151 | Instillation site pruritus | FAERS: 5 | US FAERS | |
| 152 | Memory impairment | FAERS: 5 | US FAERS | |
| 153 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 154 | No adverse event | FAERS: 5 | US FAERS | |
| 155 | Prescription drug used without a prescription | FAERS: 5 | US FAERS | |
| 156 | Product complaint | FAERS: 5 | US FAERS | |
| 157 | Product dispensing error | FAERS: 5 | US FAERS | |
| 158 | Product physical issue | FAERS: 5 | US FAERS | |
| 159 | Stress | FAERS: 5 | US FAERS | |
| 160 | Accidental overdose | FAERS: 4 | US FAERS | |
| 161 | Chest Pain | FAERS: 4 | US FAERS | |
| 162 | Constipation | FAERS: 4 | US FAERS | |
| 163 | Crying | FAERS: 4 | US FAERS | |
| 164 | Dacryostenosis acquired | FAERS: 4 | US FAERS | |
| 165 | Deafness | FAERS: 4 | US FAERS | |
| 166 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 167 | Disability | FAERS: 4 | US FAERS | |
| 168 | Disease recurrence | FAERS: 4 | US FAERS | |
| 169 | Eye ulcer | FAERS: 4 | US FAERS | |
| 170 | Feeling jittery | FAERS: 4 | US FAERS | |
| 171 | Head discomfort | FAERS: 4 | US FAERS | |
| 172 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 173 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 174 | Incorrect storage of drug | FAERS: 4 | US FAERS | |
| 175 | Influenza | FAERS: 4 | US FAERS | |
| 176 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 177 | Lagophthalmos | FAERS: 4 | US FAERS | |
| 178 | Lethargy | FAERS: 4 | US FAERS | |
| 179 | Macular fibrosis | FAERS: 4 | US FAERS | |
| 180 | Medical device removal | FAERS: 4 | US FAERS | |
| 181 | Medication residue present | FAERS: 4 | US FAERS | |
| 182 | Meniscus injury | FAERS: 4 | US FAERS | |
| 183 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 184 | Ocular vascular disorder | FAERS: 4 | US FAERS | |
| 185 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 186 | Product contamination | FAERS: 4 | US FAERS | |
| 187 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 188 | Scab | FAERS: 4 | US FAERS | |
| 189 | Stem cell transplant | FAERS: 4 | US FAERS | |
| 190 | Swelling of eyelid | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 191 | Therapy cessation | FAERS: 4 | US FAERS | |
| 192 | Visual acuity reduced transiently | FAERS: 4 | US FAERS | |
| 193 | Wrong dose | FAERS: 4 | US FAERS | |
| 194 | Agitation | FAERS: 3 | US FAERS | |
| 195 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 196 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 197 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 198 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 199 | Corneal degeneration | FAERS: 3 | US FAERS | |
| 200 | Dark circles under eyes | FAERS: 3 | US FAERS | |
| 201 | Dermatitis | FAERS: 3 | US FAERS | |
| 202 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 203 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 204 | Dyspepsia | FAERS: 3 | US FAERS | |
| 205 | Eczema | FAERS: 3 | US FAERS | |
| 206 | Growth of eyelashes | FAERS: 3 | US FAERS | |
| 207 | Infection | FAERS: 3 | US FAERS | |
| 208 | Inflammation | FAERS: 3 | US FAERS | |
| 209 | Meibomian gland dysfunction | FAERS: 3 | US FAERS | |
| 210 | Myalgia | FAERS: 3 | US FAERS | |
| 211 | Mydriasis | FAERS: 3 | US FAERS | |
| 212 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 213 | Oral pain | FAERS: 3 | US FAERS | |
| 214 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 215 | Product design issue | FAERS: 3 | US FAERS | |
| 216 | Restlessness | FAERS: 3 | US FAERS | |
| 217 | Rhinalgia | FAERS: 3 | US FAERS | |
| 218 | Rosacea | FAERS: 3 | US FAERS | |
| 219 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 220 | Skin Wrinkling | FAERS: 3 | US FAERS | |
| 221 | Skin reaction | FAERS: 3 | US FAERS | |
| 222 | Strabismus | FAERS: 3 | US FAERS | |
| 223 | Thirst | FAERS: 3 | US FAERS | |
| 224 | Toothache | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Trichiasis | FAERS: 3 | US FAERS | |
| 226 | Trichorrhexis | FAERS: 3 | US FAERS | |
| 227 | Weight decreased | FAERS: 3 | US FAERS | |
| 228 | Wheezing | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Altered visual depth perception | FAERS: 2 | US FAERS | |
| 230 | Aphonia | FAERS: 2 | US FAERS | |
| 231 | Asthma | FAERS: 2 | US FAERS | |
| 232 | Blepharopachynsis | FAERS: 2 | US FAERS | |
| 233 | Butterfly rash | FAERS: 2 | US FAERS | |
| 234 | Choking sensation | FAERS: 2 | US FAERS | |
| 235 | Contact lens intolerance | FAERS: 2 | US FAERS | |
| 236 | Contraindicated drug administered | FAERS: 2 | US FAERS | |
| 237 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 238 | Corneal Ulcer | FAERS: 2 | US FAERS | |
| 239 | Cyst | FAERS: 2 | US FAERS | |
| 240 | Dacryocystorhinostomy | FAERS: 2 | US FAERS | |
| 241 | Depressed mood | FAERS: 2 | US FAERS | |
| 242 | Device damage | FAERS: 2 | US FAERS | |
| 243 | Device difficult to use | FAERS: 2 | US FAERS | |
| 244 | Drug Dependence | FAERS: 2 | US FAERS | |
| 245 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 246 | Economic problem | FAERS: 2 | US FAERS | |
| 247 | Emotional distress | FAERS: 2 | US FAERS | |
| 248 | Eyelid Function Disorder | FAERS: 2 | US FAERS | |
| 249 | Eyelid rash | FAERS: 2 | US FAERS | |
| 250 | Facial paralysis | FAERS: 2 | US FAERS | |
| 251 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 252 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 253 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 254 | Glossitis | FAERS: 2 | US FAERS | |
| 255 | Hunger | FAERS: 2 | US FAERS | |
| 256 | Hypersomnia | FAERS: 2 | US FAERS | |
| 257 | Instillation site burn | FAERS: 2 | US FAERS | |
| 258 | Iris hyperpigmentation | FAERS: 2 | US FAERS | |
| 259 | Iritis | FAERS: 2 | US FAERS | |
| 260 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 261 | Joint swelling | FAERS: 2 | US FAERS | |
| 262 | Laser Therapy | FAERS: 2 | US FAERS | |
| 263 | Lid margin discharge | FAERS: 2 | US FAERS | |
| 264 | Limb injury | FAERS: 2 | US FAERS | |
| 265 | Lip pruritus | FAERS: 2 | US FAERS | |
| 266 | Lymphadenopathy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Mental impairment | FAERS: 2 | US FAERS | |
| 268 | Middle insomnia | FAERS: 2 | US FAERS | |
| 269 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 270 | Mouth swelling | FAERS: 2 | US FAERS | |
| 271 | Nasal mucosal disorder | FAERS: 2 | US FAERS | |
| 272 | Nerve injury | FAERS: 2 | US FAERS | |
| 273 | Nystagmus | FAERS: 2 | US FAERS | |
| 274 | Ocular Rosacea | FAERS: 2 | US FAERS | |
| 275 | Osteoporosis | FAERS: 2 | US FAERS | |
| 276 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 277 | Product preparation error | FAERS: 2 | US FAERS | |
| 278 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 279 | Productive Cough | FAERS: 2 | US FAERS | |
| 280 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 281 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 282 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 283 | Suture rupture | FAERS: 2 | US FAERS | |
| 284 | Syncope | FAERS: 2 | US FAERS | |
| 285 | Terminal state | FAERS: 2 | US FAERS | |
| 286 | Unevaluable event | FAERS: 2 | US FAERS | |
| 287 | Upper respiratory tract congestion | FAERS: 2 | US FAERS | |
| 288 | Uveitis | FAERS: 2 | US FAERS | |
| 289 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 290 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 291 | Xanthopsia | FAERS: 2 | US FAERS | |
| 292 | Abasia | FAERS: 1 | US FAERS | |
| 293 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 294 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 295 | Administration site reaction | FAERS: 1 | US FAERS | |
| 296 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 297 | Allergy to arthropod sting | FAERS: 1 | US FAERS | |
| 298 | Allergy to vaccine | FAERS: 1 | US FAERS | |
| 299 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 300 | Anger | FAERS: 1 | US FAERS | |
| 301 | Angioedema | FAERS: 1 | US FAERS | |
| 302 | Anisomastia | FAERS: 1 | US FAERS | |
| 303 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 304 | Anoxia | FAERS: 1 | US FAERS | |
| 305 | Apathy | FAERS: 1 | US FAERS | |
| 306 | Aphasia | FAERS: 1 | US FAERS | |
| 307 | Application site irritation | FAERS: 1 | US FAERS | |
| 308 | Application site swelling | FAERS: 1 | US FAERS | |
| 309 | Arthropathy | FAERS: 1 | US FAERS | |
| 310 | Astigmatism | FAERS: 1 | US FAERS | |
| 311 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 312 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 313 | Bladder pain | FAERS: 1 | US FAERS | |
| 314 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 315 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 316 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 317 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 318 | Blood mercury abnormal | FAERS: 1 | US FAERS | |
| 319 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 320 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 321 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 322 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 323 | Bone pain | FAERS: 1 | US FAERS | |
| 324 | Borderline glaucoma | FAERS: 1 | US FAERS | |
| 325 | Breast Feeding | FAERS: 1 | US FAERS | |
| 326 | Breast discomfort | FAERS: 1 | US FAERS | |
| 327 | Breast tenderness | FAERS: 1 | US FAERS | |
| 328 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 329 | Candidiasis | FAERS: 1 | US FAERS | |
| 330 | Carcinoma | FAERS: 1 | US FAERS | |
| 331 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 332 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 333 | Cartilage injury | FAERS: 1 | US FAERS | |
| 334 | Cellulitis | FAERS: 1 | US FAERS | |
| 335 | Chemical eye injury | FAERS: 1 | US FAERS | |
| 336 | Chemotherapy | FAERS: 1 | US FAERS | |
| 337 | Choking | FAERS: 1 | US FAERS | |
| 338 | Chromatopsia | FAERS: 1 | US FAERS | |
| 339 | Chromaturia | FAERS: 1 | US FAERS | |
| 340 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 341 | Cold sweat | FAERS: 1 | US FAERS | |
| 342 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 343 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 344 | Corneal lesion | FAERS: 1 | US FAERS | |
| 345 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 346 | Cystitis | FAERS: 1 | US FAERS | |
| 347 | Dacryocanaliculitis | FAERS: 1 | US FAERS | |
| 348 | Dementia | FAERS: 1 | US FAERS | |
| 349 | Device dislocation | FAERS: 1 | US FAERS | |
| 350 | Device material opacification | FAERS: 1 | US FAERS | |
| 351 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 352 | Disease Progression | FAERS: 1 | US FAERS | |
| 353 | Dissociation | FAERS: 1 | US FAERS | |
| 354 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 355 | Drooling | FAERS: 1 | US FAERS | |
| 356 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 357 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 358 | Dysuria | FAERS: 1 | US FAERS | |
| 359 | Ear congestion | FAERS: 1 | US FAERS | |
| 360 | Elbow operation | FAERS: 1 | US FAERS | |
| 361 | Embolism | FAERS: 1 | US FAERS | |
| 362 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 363 | Episcleritis | FAERS: 1 | US FAERS | |
| 364 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 365 | Exfoliation Syndrome | FAERS: 1 | US FAERS | |
| 366 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 367 | Exophthalmos | FAERS: 1 | US FAERS | |
| 368 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 369 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 370 | Extra dose administered | FAERS: 1 | US FAERS | |
| 371 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 372 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 373 | Eye Redness | FAERS: 1 | US FAERS | |
| 374 | Eyelid infection | FAERS: 1 | US FAERS | |
| 375 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 376 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 377 | Flushing | FAERS: 1 | US FAERS | |
| 378 | Formication | FAERS: 1 | US FAERS | |
| 379 | Fracture | FAERS: 1 | US FAERS | |
| 380 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 381 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 382 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 383 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 384 | Graft versus host disease in lung | FAERS: 1 | US FAERS | |
| 385 | Hemicephalalgia | FAERS: 1 | US FAERS | |
| 386 | Hepatitis C | FAERS: 1 | US FAERS | |
| 387 | Hip surgery | FAERS: 1 | US FAERS | |
| 388 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 389 | Hypokinesia | FAERS: 1 | US FAERS | |
| 390 | Hypopyon | FAERS: 1 | US FAERS | |
| 391 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 392 | Immunosuppression | FAERS: 1 | US FAERS | |
| 393 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 394 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 395 | Initial insomnia | FAERS: 1 | US FAERS | |
| 396 | Injection site pain | FAERS: 1 | US FAERS | |
| 397 | Injury associated with device | FAERS: 1 | US FAERS | |
| 398 | Instillation site abnormal sensation | FAERS: 1 | US FAERS | |
| 399 | Instillation site dryness | FAERS: 1 | US FAERS | |
| 400 | Instillation site reaction | FAERS: 1 | US FAERS | |
| 401 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 402 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 403 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 404 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 405 | Joint stiffness | FAERS: 1 | US FAERS | |
| 406 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 407 | Lacrimal structure injury | FAERS: 1 | US FAERS | |
| 408 | Laryngitis | FAERS: 1 | US FAERS | |
| 409 | Limb operation | FAERS: 1 | US FAERS | |
| 410 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 411 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 412 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 413 | Lymphoma | FAERS: 1 | US FAERS | |
| 414 | Meibomianitis | FAERS: 1 | US FAERS | |
| 415 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 416 | Motion Sickness | FAERS: 1 | US FAERS | |
| 417 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 418 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 419 | Muscle strain | FAERS: 1 | US FAERS | |
| 420 | Muscle tightness | FAERS: 1 | US FAERS | |
| 421 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 422 | Myopia | FAERS: 1 | US FAERS | |
| 423 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 424 | Nasal herpes | FAERS: 1 | US FAERS | |
| 425 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 426 | Nasal mucosal ulcer | FAERS: 1 | US FAERS | |
| 427 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 428 | Nodule | FAERS: 1 | US FAERS | |
| 429 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 430 | Ocular icterus | FAERS: 1 | US FAERS | |
| 431 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 432 | Oral infection | FAERS: 1 | US FAERS | |
| 433 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 434 | Oral pruritus | FAERS: 1 | US FAERS | |
| 435 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 436 | Pain of skin | FAERS: 1 | US FAERS | |
| 437 | Pancreatitis | FAERS: 1 | US FAERS | |
| 438 | Panic Disorder | FAERS: 1 | US FAERS | |
| 439 | Papule | FAERS: 1 | US FAERS | |
| 440 | Paranoia | FAERS: 1 | US FAERS | |
| 441 | Penile burning sensation | FAERS: 1 | US FAERS | |
| 442 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 443 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 444 | Personality Change | FAERS: 1 | US FAERS | |
| 445 | Plasminogen decreased | FAERS: 1 | US FAERS | |
| 446 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 447 | Post procedural complication | FAERS: 1 | US FAERS | |
| 448 | Post procedural infection | FAERS: 1 | US FAERS | |
| 449 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 450 | Postoperative Care | FAERS: 1 | US FAERS | |
| 451 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 452 | Presbyopia | FAERS: 1 | US FAERS | |
| 453 | Presyncope | FAERS: 1 | US FAERS | |
| 454 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 455 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 456 | Product closure issue | FAERS: 1 | US FAERS | |
| 457 | Product deposit | FAERS: 1 | US FAERS | |
| 458 | Product label confusion | FAERS: 1 | US FAERS | |
| 459 | Product lot number issue | FAERS: 1 | US FAERS | |
| 460 | Product package associated injury | FAERS: 1 | US FAERS | |
| 461 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 462 | Product residue present | FAERS: 1 | US FAERS | |
| 463 | Product supply issue | FAERS: 1 | US FAERS | |
| 464 | Progressive supranuclear palsy | FAERS: 1 | US FAERS | |
| 465 | Psoriasis | FAERS: 1 | US FAERS | |
| 466 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 467 | Renal pain | FAERS: 1 | US FAERS | |
| 468 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 469 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 470 | Retinal scar | FAERS: 1 | US FAERS | |
| 471 | Retinitis | FAERS: 1 | US FAERS | |
| 472 | Rhinitis | FAERS: 1 | US FAERS | |
| 473 | Schirmer's test abnormal | FAERS: 1 | US FAERS | |
| 474 | Sciatica | FAERS: 1 | US FAERS | |
| 475 | Scleritis | FAERS: 1 | US FAERS | |
| 476 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 477 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 478 | Sepsis | FAERS: 1 | US FAERS | |
| 479 | Sinus operation | FAERS: 1 | US FAERS | |
| 480 | Sinus pain | FAERS: 1 | US FAERS | |
| 481 | Sinusitis noninfective | FAERS: 1 | US FAERS | |
| 482 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 483 | Skin tightness | FAERS: 1 | US FAERS | |
| 484 | Somnambulism | FAERS: 1 | US FAERS | |
| 485 | Spinal rod insertion | FAERS: 1 | US FAERS | |
| 486 | Superior limbic keratoconjunctivitis | FAERS: 1 | US FAERS | |
| 487 | Systemic leakage | FAERS: 1 | US FAERS | |
| 488 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 489 | Thermal burn | FAERS: 1 | US FAERS | |
| 490 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 491 | Thrombosis | FAERS: 1 | US FAERS | |
| 492 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 493 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 494 | Ulcer | FAERS: 1 | US FAERS | |
| 495 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 496 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 497 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 498 | Vaginal Prolapse | FAERS: 1 | US FAERS | |
| 499 | Vasculitis | FAERS: 1 | US FAERS | |
| 500 | Victim of sexual abuse | FAERS: 1 | US FAERS | |
| 501 | Visual acuity tests abnormal | FAERS: 1 | US FAERS | |
| 502 | Vitiligo | FAERS: 1 | US FAERS | |
| 503 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 504 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 505 | Wound Infection | FAERS: 1 | US FAERS | |
| 506 | furuncle | FAERS: 1 | US FAERS | |
| 507 | skin abrasion | FAERS: 1 | US FAERS | |
| 508 | Application site erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 509 | Noninfective gingivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 510 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.